DE2336494A1 - Verfahren zur spaltung von enolaethern und ketalen - Google Patents
Verfahren zur spaltung von enolaethern und ketalenInfo
- Publication number
- DE2336494A1 DE2336494A1 DE19732336494 DE2336494A DE2336494A1 DE 2336494 A1 DE2336494 A1 DE 2336494A1 DE 19732336494 DE19732336494 DE 19732336494 DE 2336494 A DE2336494 A DE 2336494A DE 2336494 A1 DE2336494 A1 DE 2336494A1
- Authority
- DE
- Germany
- Prior art keywords
- ketal
- alcohol
- reaction mixture
- reaction
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 56
- 238000006243 chemical reaction Methods 0.000 claims description 39
- -1 nitrous acid ester Chemical class 0.000 claims description 33
- 239000011541 reaction mixture Substances 0.000 claims description 31
- 239000002904 solvent Substances 0.000 claims description 27
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 22
- 150000002084 enol ethers Chemical class 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- 239000007858 starting material Substances 0.000 claims description 16
- 238000003776 cleavage reaction Methods 0.000 claims description 14
- 230000007017 scission Effects 0.000 claims description 13
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 150000003138 primary alcohols Chemical class 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 8
- 125000003158 alcohol group Chemical group 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 8
- 150000001721 carbon Chemical group 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 238000011065 in-situ storage Methods 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 150000002828 nitro derivatives Chemical class 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 108090000623 proteins and genes Proteins 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 150000003457 sulfones Chemical class 0.000 claims description 2
- 238000004448 titration Methods 0.000 claims description 2
- 210000003608 fece Anatomy 0.000 claims 1
- 230000001737 promoting effect Effects 0.000 claims 1
- 239000000047 product Substances 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- 239000003054 catalyst Substances 0.000 description 7
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 6
- 239000003377 acid catalyst Substances 0.000 description 5
- 230000001476 alcoholic effect Effects 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 125000001033 ether group Chemical group 0.000 description 4
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 4
- 235000019392 nitrosyl chloride Nutrition 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 238000007086 side reaction Methods 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000004157 Nitrosyl chloride Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000001605 fetal effect Effects 0.000 description 3
- 125000000468 ketone group Chemical group 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical class ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 1
- QHDHNVFIKWGRJR-UHFFFAOYSA-N 1-cyclohexenol Chemical compound OC1=CCCCC1 QHDHNVFIKWGRJR-UHFFFAOYSA-N 0.000 description 1
- ILZVJFHNPUWKQQ-UHFFFAOYSA-N 1-ethoxycyclohexene Chemical compound CCOC1=CCCCC1 ILZVJFHNPUWKQQ-UHFFFAOYSA-N 0.000 description 1
- NOKREJZAIYLIFW-UHFFFAOYSA-N 1-ethoxycyclopentene Chemical compound CCOC1=CCCC1 NOKREJZAIYLIFW-UHFFFAOYSA-N 0.000 description 1
- SZNILIWUUKKNPE-UHFFFAOYSA-N 2-nitrocyclohexan-1-one Chemical compound [O-][N+](=O)C1CCCCC1=O SZNILIWUUKKNPE-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- SKUPALMUTWEAPI-UHFFFAOYSA-N 5-cyanopentanoic acid Chemical compound OC(=O)CCCCC#N SKUPALMUTWEAPI-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000723346 Cinnamomum camphora Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- QQZWEECEMNQSTG-UHFFFAOYSA-N Ethyl nitrite Chemical compound CCON=O QQZWEECEMNQSTG-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical group O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229960000846 camphor Drugs 0.000 description 1
- 229930008380 camphor Natural products 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- HBNCYROJXZDCOM-UHFFFAOYSA-N cyano pentanoate Chemical compound CCCCC(=O)OC#N HBNCYROJXZDCOM-UHFFFAOYSA-N 0.000 description 1
- 150000003997 cyclic ketones Chemical class 0.000 description 1
- 125000002243 cyclohexanonyl group Chemical group *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000003500 enol ether group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- SKRDXYBATCVEMS-UHFFFAOYSA-N isopropyl nitrite Chemical compound CC(C)ON=O SKRDXYBATCVEMS-UHFFFAOYSA-N 0.000 description 1
- 150000002560 ketene acetals Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- BLLFVUPNHCTMSV-UHFFFAOYSA-N methyl nitrite Chemical compound CON=O BLLFVUPNHCTMSV-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- RHMRKSLUXZLPMB-UHFFFAOYSA-N nitroso acetate Chemical compound CC(=O)ON=O RHMRKSLUXZLPMB-UHFFFAOYSA-N 0.000 description 1
- UXYOCJORLLDICG-UHFFFAOYSA-N nitroso formate Chemical compound O=CON=O UXYOCJORLLDICG-UHFFFAOYSA-N 0.000 description 1
- HLNRBHDRGMNBEG-UHFFFAOYSA-N nitrous acid Chemical compound ON=O.ON=O HLNRBHDRGMNBEG-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 125000005646 oximino group Chemical group 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KAOQVXHBVNKNHA-UHFFFAOYSA-N propyl nitrite Chemical compound CCCON=O KAOQVXHBVNKNHA-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 1
- 239000012414 tert-butyl nitrite Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/06—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members
- C07C2603/10—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings
- C07C2603/12—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings only one five-membered ring
- C07C2603/16—Benz[e]indenes; Hydrogenated benz[e]indenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27401672A | 1972-07-21 | 1972-07-21 | |
| US00336570A US3839407A (en) | 1972-07-21 | 1973-02-28 | Cleavage of enol ethers and ketals |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2336494A1 true DE2336494A1 (de) | 1974-01-31 |
Family
ID=26956560
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732336494 Pending DE2336494A1 (de) | 1972-07-21 | 1973-07-18 | Verfahren zur spaltung von enolaethern und ketalen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3839407A (OSRAM) |
| JP (1) | JPS4943902A (OSRAM) |
| CA (1) | CA999304A (OSRAM) |
| DE (1) | DE2336494A1 (OSRAM) |
| FR (1) | FR2193802B1 (OSRAM) |
| GB (1) | GB1397525A (OSRAM) |
| IT (1) | IT991715B (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4097517A (en) * | 1976-09-10 | 1978-06-27 | Allied Chem | Cleavage of alpha-oximinoketones, aldehydes and acetals and their nitroso isomers |
-
1973
- 1973-02-28 US US00336570A patent/US3839407A/en not_active Expired - Lifetime
- 1973-06-11 CA CA173,685A patent/CA999304A/en not_active Expired
- 1973-07-11 IT IT69065/73A patent/IT991715B/it active
- 1973-07-18 DE DE19732336494 patent/DE2336494A1/de active Pending
- 1973-07-20 GB GB3463373A patent/GB1397525A/en not_active Expired
- 1973-07-20 JP JP48080784A patent/JPS4943902A/ja active Pending
- 1973-07-20 FR FR7326814A patent/FR2193802B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1397525A (en) | 1975-06-11 |
| FR2193802B1 (OSRAM) | 1976-04-30 |
| IT991715B (it) | 1975-08-30 |
| US3839407A (en) | 1974-10-01 |
| CA999304A (en) | 1976-11-02 |
| JPS4943902A (OSRAM) | 1974-04-25 |
| FR2193802A1 (OSRAM) | 1974-02-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69116826T2 (de) | Herstellung von Alkoxyalkansäuren | |
| DE2715080C2 (de) | Verfahren zur Herstellung von Cyclopent-2-enon-Derivaten | |
| EP0581115B1 (de) | Verfahren zur Abtrennung von Methanol aus Dimethylcarbonat/Methanol-Gemischen | |
| DE2336494A1 (de) | Verfahren zur spaltung von enolaethern und ketalen | |
| DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
| EP3601211B1 (de) | Katalytisches verfahren zur herstellung von n,n-dimethylglucamin ausgehend aus n-methylglucamin | |
| EP0613882B1 (de) | Verfahren zur Herstellung von 5-Cyanvaleriansäureestern | |
| DE1287571B (de) | Verfahren zur Herstellung von Enaminen | |
| DE2756560C2 (de) | Verfahren zur Herstellung von Piperonal | |
| DE2249993A1 (de) | Verfahren zur spaltung von ketonen | |
| DE2548384A1 (de) | Verfahren zur herstellung von hydroxyphenylaethern | |
| DE2030031A1 (en) | Hydrogenation of cinnamaldehyde to give - increased yields of dihydrocinnamaldehyde | |
| DE2740482A1 (de) | Verfahren zur aufspaltung eines alpha-oximinoketons, -aldehyds oder acetals oder alpha-nitrosoisomers derselben | |
| DE1275045B (de) | Verfahren zur Herstellung von disubstituierten ª-Oxycarbonsaeuren, deren Estern oder Amiden | |
| CH628868A5 (en) | Process for the preparation of acyclic monoterpene alcohols | |
| DE2349537A1 (de) | Verfahren zur herstellung von paradolen | |
| DE2345911C3 (de) | Verfahren zur Isomerisierung von Phenetol zu o-Äthylphenol | |
| DE2329145B2 (de) | Verfahren zur herstellung von alkinolen | |
| EP0363726B1 (de) | 1-Trifluormethyl-l-nitro-2-alkoxy-2-aryl-ethane, ihre Herstellung und sie enthaltende antimykotische Mittel | |
| AT256809B (de) | Verfahren zur Herstellung von disubstituierten α-Oxycarbonsäureverbindungen | |
| DE942444C (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Mononitrokohlenwasserstoffen | |
| DE1618177C3 (de) | Verfahren zur Herstellung von 2,2-Dialkyl- und 2,2-Alkylenglutarsäuren | |
| DE2940256A1 (de) | N,n-dimethyl-n'-(beta)-hydroxyethyl-propylendiamin und verfahren zu seiner herstellung | |
| DE2609566C3 (de) | Verfahren zur Herstellung von Methylheptenon | |
| EP1389608A1 (de) | Katalytische Reduktion von Benzonitrilderivaten zu Benzaldehydderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |