DE2332731A1 - Chinolin-carbonsaeure-(2)-verbindungen, verfahren zu ihrer herstellung sowie solche verbindungen enthaltende arzneimittelpraeparate - Google Patents
Chinolin-carbonsaeure-(2)-verbindungen, verfahren zu ihrer herstellung sowie solche verbindungen enthaltende arzneimittelpraeparateInfo
- Publication number
- DE2332731A1 DE2332731A1 DE2332731A DE2332731A DE2332731A1 DE 2332731 A1 DE2332731 A1 DE 2332731A1 DE 2332731 A DE2332731 A DE 2332731A DE 2332731 A DE2332731 A DE 2332731A DE 2332731 A1 DE2332731 A1 DE 2332731A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- quinoline
- amide
- carboxylic acid
- tetrazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 45
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- CIRQMILQJVWYKN-UHFFFAOYSA-N carbonic acid;quinoline Chemical compound OC(O)=O.N1=CC=CC2=CC=CC=C21 CIRQMILQJVWYKN-UHFFFAOYSA-N 0.000 title 2
- -1 2 Chemical compound 0.000 claims description 91
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 47
- 239000002253 acid Substances 0.000 claims description 29
- 150000001408 amides Chemical class 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 239000000443 aerosol Substances 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 claims description 5
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical group C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 125000005122 aminoalkylamino group Chemical group 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 2
- 125000005191 hydroxyalkylamino group Chemical group 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000000843 powder Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 241001024304 Mino Species 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- 230000000144 pharmacologic effect Effects 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 84
- 238000002844 melting Methods 0.000 description 58
- 230000008018 melting Effects 0.000 description 58
- 239000000243 solution Substances 0.000 description 49
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 40
- 238000000354 decomposition reaction Methods 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 125000004494 ethyl ester group Chemical group 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000575 pesticide Substances 0.000 description 12
- 239000007787 solid Substances 0.000 description 11
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 9
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 description 8
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 229960002887 deanol Drugs 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000000825 pharmaceutical preparation Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- XDHVXNYIJMSNIQ-UHFFFAOYSA-N 4-chloroquinoline-2-carboxylic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC(Cl)=C21 XDHVXNYIJMSNIQ-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- HCZHHEIFKROPDY-UHFFFAOYSA-N acide cynurenique Natural products C1=CC=C2NC(C(=O)O)=CC(=O)C2=C1 HCZHHEIFKROPDY-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000003380 propellant Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- DFJNDYTZAWTDCY-UHFFFAOYSA-N 6-butyl-4-chloroquinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=C(Cl)C2=CC(CCCC)=CC=C21 DFJNDYTZAWTDCY-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 150000003536 tetrazoles Chemical group 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- LAUODWAMPIXMAA-UHFFFAOYSA-N 4,6-dimethoxyquinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=C(OC)C2=CC(OC)=CC=C21 LAUODWAMPIXMAA-UHFFFAOYSA-N 0.000 description 2
- FWVQXAVJFFRRBW-UHFFFAOYSA-N 4,7-dimethoxyquinoline-2-carboxylic acid Chemical compound COC1=CC(C(O)=O)=NC2=CC(OC)=CC=C21 FWVQXAVJFFRRBW-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- PTICFUIJAYCVSV-UHFFFAOYSA-N 4-chloro-6-nitroquinoline-2-carboxylic acid Chemical compound C1=C([N+]([O-])=O)C=CC2=NC(C(=O)O)=CC(Cl)=C21 PTICFUIJAYCVSV-UHFFFAOYSA-N 0.000 description 2
- NRSHXBBQICYYFJ-UHFFFAOYSA-N 4-chloro-7-methoxyquinoline-2-carboxylic acid Chemical compound ClC1=CC(C(O)=O)=NC2=CC(OC)=CC=C21 NRSHXBBQICYYFJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 235000010986 ammonium phosphatide Nutrition 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 2
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- DWKNOLCXIFYNFV-HSZRJFAPSA-N 2-[[(2r)-1-[1-[(4-chloro-3-methylphenyl)methyl]piperidin-4-yl]-5-oxopyrrolidine-2-carbonyl]amino]-n,n,6-trimethylpyridine-4-carboxamide Chemical compound CN(C)C(=O)C1=CC(C)=NC(NC(=O)[C@@H]2N(C(=O)CC2)C2CCN(CC=3C=C(C)C(Cl)=CC=3)CC2)=C1 DWKNOLCXIFYNFV-HSZRJFAPSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 1
- DXCUSGFEDABNDO-UHFFFAOYSA-N 4-(2-methoxyethoxy)quinoline-2-carboxylic acid Chemical compound C1=CC=C2C(OCCOC)=CC(C(O)=O)=NC2=C1 DXCUSGFEDABNDO-UHFFFAOYSA-N 0.000 description 1
- ABZWLACJDXTMKJ-UHFFFAOYSA-N 4-butoxyquinoline-2-carboxylic acid Chemical compound C1=CC=C2C(OCCCC)=CC(C(O)=O)=NC2=C1 ABZWLACJDXTMKJ-UHFFFAOYSA-N 0.000 description 1
- OGIQUQKNJJTLSZ-UHFFFAOYSA-N 4-butylaniline Chemical compound CCCCC1=CC=C(N)C=C1 OGIQUQKNJJTLSZ-UHFFFAOYSA-N 0.000 description 1
- CANGWKMDBFGLLW-UHFFFAOYSA-N 4-chloro-6-methoxyquinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=C(Cl)C2=CC(OC)=CC=C21 CANGWKMDBFGLLW-UHFFFAOYSA-N 0.000 description 1
- KEPWFVVUVJSPJC-UHFFFAOYSA-N 4-chloro-7,8-dimethylquinoline-2-carboxylic acid Chemical compound ClC1=CC(C(O)=O)=NC2=C(C)C(C)=CC=C21 KEPWFVVUVJSPJC-UHFFFAOYSA-N 0.000 description 1
- AOATVJLAFLBGPZ-UHFFFAOYSA-N 4-chloro-8-nitroquinoline Chemical compound C1=CN=C2C([N+](=O)[O-])=CC=CC2=C1Cl AOATVJLAFLBGPZ-UHFFFAOYSA-N 0.000 description 1
- XMUZZTLXXJYPPM-UHFFFAOYSA-N 4-chloro-8-nitroquinoline-2-carboxylic acid Chemical compound C1=CC=C([N+]([O-])=O)C2=NC(C(=O)O)=CC(Cl)=C21 XMUZZTLXXJYPPM-UHFFFAOYSA-N 0.000 description 1
- IUEBPBUIUJWLGX-UHFFFAOYSA-N 4-ethoxy-2,4-dioxobutanoic acid;sodium Chemical compound [Na].CCOC(=O)CC(=O)C(O)=O IUEBPBUIUJWLGX-UHFFFAOYSA-N 0.000 description 1
- KQFRZQHCZNAUOS-UHFFFAOYSA-N 4-hydroxy-6-nitroquinoline-2-carboxylic acid Chemical compound [O-][N+](=O)C1=CC=C2NC(C(=O)O)=CC(=O)C2=C1 KQFRZQHCZNAUOS-UHFFFAOYSA-N 0.000 description 1
- QXUIWGSCIJUQKI-UHFFFAOYSA-N 4-methoxy-6-nitroquinoline-2-carboxylic acid Chemical compound C1=C([N+]([O-])=O)C=C2C(OC)=CC(C(O)=O)=NC2=C1 QXUIWGSCIJUQKI-UHFFFAOYSA-N 0.000 description 1
- WIRVSNNUAOSCNU-UHFFFAOYSA-N 4-methoxy-8-nitroquinoline-2-carboxylic acid Chemical compound C1=CC=C2C(OC)=CC(C(O)=O)=NC2=C1[N+]([O-])=O WIRVSNNUAOSCNU-UHFFFAOYSA-N 0.000 description 1
- WQBCQEDMLHHOMQ-UHFFFAOYSA-N 4-methoxycyclohexa-1,5-diene-1,4-diol Chemical compound COC1(O)CC=C(O)C=C1 WQBCQEDMLHHOMQ-UHFFFAOYSA-N 0.000 description 1
- NFANKIOZMXAOQA-UHFFFAOYSA-N 4-phenylmethoxyquinoline-2-carboxylic acid Chemical compound C=12C=CC=CC2=NC(C(=O)O)=CC=1OCC1=CC=CC=C1 NFANKIOZMXAOQA-UHFFFAOYSA-N 0.000 description 1
- QCVGEOXPDFCNHA-UHFFFAOYSA-N 5,5-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound CC1(C)OC(=O)N(C(N)=O)C1=O QCVGEOXPDFCNHA-UHFFFAOYSA-N 0.000 description 1
- FRBJWXNSTZTLJM-UHFFFAOYSA-N 6-butyl-1h-quinolin-4-one Chemical compound N1C=CC(=O)C2=CC(CCCC)=CC=C21 FRBJWXNSTZTLJM-UHFFFAOYSA-N 0.000 description 1
- WQYUWRVKNBTRGO-UHFFFAOYSA-N 7,8-dimethyl-4-oxo-1h-quinoline-2-carboxylic acid Chemical compound OC1=CC(C(O)=O)=NC2=C(C)C(C)=CC=C21 WQYUWRVKNBTRGO-UHFFFAOYSA-N 0.000 description 1
- VEIPDRQRGAWCPC-UHFFFAOYSA-N 8-nitro-4-oxo-1h-quinoline-2-carboxylic acid Chemical compound C1=CC=C([N+]([O-])=O)C2=NC(C(=O)O)=CC(O)=C21 VEIPDRQRGAWCPC-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 206010012434 Dermatitis allergic Diseases 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 102000002322 Egg Proteins Human genes 0.000 description 1
- 108010000912 Egg Proteins Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 210000000991 chicken egg Anatomy 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 239000003179 convulsant agent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000006310 cycloalkyl amino group Chemical group 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000014103 egg white Nutrition 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 101150085091 lat-2 gene Proteins 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- VOVZXURTCKPRDQ-CQSZACIVSA-N n-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3r)-3-hydroxypyrrolidin-1-yl]-5-(1h-pyrazol-5-yl)pyridine-3-carboxamide Chemical compound C1[C@H](O)CCN1C1=NC=C(C(=O)NC=2C=CC(OC(F)(F)Cl)=CC=2)C=C1C1=CC=NN1 VOVZXURTCKPRDQ-CQSZACIVSA-N 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- KHPXUQMNIQBQEV-UHFFFAOYSA-N oxaloacetic acid Chemical compound OC(=O)CC(=O)C(O)=O KHPXUQMNIQBQEV-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- CIBMHJPPKCXONB-UHFFFAOYSA-N propane-2,2-diol Chemical compound CC(C)(O)O CIBMHJPPKCXONB-UHFFFAOYSA-N 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- BWAUQTFFVCLSOS-UHFFFAOYSA-N sodiosodium hydrate Chemical compound O.[Na].[Na] BWAUQTFFVCLSOS-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Quinoline Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3099072A GB1383088A (en) | 1972-07-03 | 1972-07-03 | Pharmacologically active quinaldamide derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2332731A1 true DE2332731A1 (de) | 1974-03-07 |
Family
ID=10316264
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2332731A Pending DE2332731A1 (de) | 1972-07-03 | 1973-06-27 | Chinolin-carbonsaeure-(2)-verbindungen, verfahren zu ihrer herstellung sowie solche verbindungen enthaltende arzneimittelpraeparate |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3932416A (enExample) |
| JP (1) | JPS4962486A (enExample) |
| AT (1) | AT328449B (enExample) |
| AU (1) | AU473752B2 (enExample) |
| BE (1) | BE801246A (enExample) |
| CH (1) | CH592081A5 (enExample) |
| CS (1) | CS193474B2 (enExample) |
| DE (1) | DE2332731A1 (enExample) |
| ES (1) | ES416495A1 (enExample) |
| FR (1) | FR2247241B1 (enExample) |
| GB (1) | GB1383088A (enExample) |
| HU (1) | HU168474B (enExample) |
| IE (1) | IE37795B1 (enExample) |
| IL (1) | IL42513A (enExample) |
| LU (1) | LU67918A1 (enExample) |
| NL (1) | NL7309226A (enExample) |
| NO (1) | NO137899C (enExample) |
| PH (1) | PH9997A (enExample) |
| SE (1) | SE405477B (enExample) |
| ZA (1) | ZA734041B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0456442A1 (en) * | 1990-05-09 | 1991-11-13 | Zeneca Limited | Quinoline derivatives, process for their preparation and their use as medicaments |
| WO1998049155A1 (en) * | 1997-04-25 | 1998-11-05 | Takeda Chemical Industries, Ltd. | Cell differentiation inducing amide derivatives, their production and use |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1433774A (en) * | 1973-02-26 | 1976-04-28 | Allen & Hanburys Ltd | Heterocyclic compounds apparatus for conveying articles |
| US4156726A (en) * | 1974-12-07 | 1979-05-29 | Fisons Limited | 4-Oxo-2-carboxyl quinoline derivatives used as antiallergic compounds |
| US4186201A (en) * | 1977-02-07 | 1980-01-29 | Riker Laboratories, Inc. | Methods of using 8(tetrazol-5-ylcarbamoyl)isoquinoline compounds |
| US4147694A (en) * | 1977-02-07 | 1979-04-03 | Riker Laboratories, Inc. | 8-(1H-Tetrazol-5-yl-carbamoyl)quinoline compounds |
| US4474792A (en) * | 1979-06-18 | 1984-10-02 | Riker Laboratories, Inc. | N-Tetrazolyl benzamides and anti-allergic use thereof |
| ES8301230A1 (es) * | 1980-03-05 | 1982-12-01 | Glaxo Group Ltd | Un procedimiento para la preparacion de 1-fenil-5-amidotetrazoles. |
| JPS61197558A (ja) * | 1985-02-25 | 1986-09-01 | Nippon Chemiphar Co Ltd | 新規なキナルジン酸アミド誘導体およびその製造法 |
| US4772703A (en) * | 1986-01-27 | 1988-09-20 | American Home Products Corporation | 2-(phenoxymethyl)-quinazolines as antiallergic and antiinflammatory agents |
| EP0412848B1 (en) * | 1989-08-11 | 1995-01-18 | Zeneca Limited | Quinoline derivatives, process for their preparation and their use as medicaments |
| US5028707A (en) * | 1989-11-20 | 1991-07-02 | Board Of Regents, University Of Texas | 4-hydroxyquinaldic acid derivatives |
| AU6593700A (en) * | 1999-08-18 | 2001-03-13 | Nippon Soda Co., Ltd. | Quinoline compounds and process for producing the same |
| FR2827599A1 (fr) * | 2001-07-20 | 2003-01-24 | Neuro3D | Composes derives de quinoleine et quinoxaline,preparation et utilisations |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3391146A (en) * | 1964-11-10 | 1968-07-02 | Bristol Myers Co | Nu-substituted carbamates and thiocarbamates of 2-quinolinemethanols |
-
1972
- 1972-07-03 GB GB3099072A patent/GB1383088A/en not_active Expired
-
1973
- 1973-06-14 IE IE978/73A patent/IE37795B1/xx unknown
- 1973-06-14 ZA ZA734041A patent/ZA734041B/xx unknown
- 1973-06-15 IL IL42513A patent/IL42513A/en unknown
- 1973-06-18 CS CS734384A patent/CS193474B2/cs unknown
- 1973-06-19 AU AU57099/73A patent/AU473752B2/en not_active Expired
- 1973-06-21 HU HUAE386A patent/HU168474B/hu unknown
- 1973-06-21 US US05/372,027 patent/US3932416A/en not_active Expired - Lifetime
- 1973-06-21 BE BE132551A patent/BE801246A/xx unknown
- 1973-06-25 CH CH920573A patent/CH592081A5/xx not_active IP Right Cessation
- 1973-06-26 SE SE7309000A patent/SE405477B/xx unknown
- 1973-06-27 DE DE2332731A patent/DE2332731A1/de active Pending
- 1973-06-28 AT AT570873A patent/AT328449B/de not_active IP Right Cessation
- 1973-07-02 ES ES416495A patent/ES416495A1/es not_active Expired
- 1973-07-02 LU LU67918A patent/LU67918A1/xx unknown
- 1973-07-02 PH PH14792A patent/PH9997A/en unknown
- 1973-07-02 NO NO2705/73A patent/NO137899C/no unknown
- 1973-07-03 JP JP48075190A patent/JPS4962486A/ja active Pending
- 1973-07-03 FR FR7324350A patent/FR2247241B1/fr not_active Expired
- 1973-07-03 NL NL7309226A patent/NL7309226A/xx not_active Application Discontinuation
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0456442A1 (en) * | 1990-05-09 | 1991-11-13 | Zeneca Limited | Quinoline derivatives, process for their preparation and their use as medicaments |
| US5369114A (en) * | 1990-05-09 | 1994-11-29 | Imperial Chemical Industries Plc | Biphenylene branched alkyleneoxy quinolines |
| WO1998049155A1 (en) * | 1997-04-25 | 1998-11-05 | Takeda Chemical Industries, Ltd. | Cell differentiation inducing amide derivatives, their production and use |
| US6340704B1 (en) | 1997-04-25 | 2002-01-22 | Takeda Chemical Industries, Ltd. | Cell differentiation inducing amide derivatives, their production and use |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2247241A1 (enExample) | 1975-05-09 |
| AU5709973A (en) | 1974-12-19 |
| US3932416A (en) | 1976-01-13 |
| IE37795L (en) | 1974-01-03 |
| FR2247241B1 (enExample) | 1976-12-31 |
| LU67918A1 (enExample) | 1973-09-05 |
| AT328449B (de) | 1976-03-25 |
| CH592081A5 (enExample) | 1977-10-14 |
| JPS4962486A (enExample) | 1974-06-17 |
| NO137899B (no) | 1978-02-06 |
| NL7309226A (enExample) | 1974-01-07 |
| HU168474B (enExample) | 1976-05-28 |
| IE37795B1 (en) | 1977-10-12 |
| PH9997A (en) | 1976-07-13 |
| SE405477B (sv) | 1978-12-11 |
| AU473752B2 (en) | 1976-07-01 |
| ES416495A1 (es) | 1976-06-01 |
| GB1383088A (en) | 1975-02-05 |
| BE801246A (fr) | 1973-12-21 |
| ZA734041B (en) | 1974-05-29 |
| CS193474B2 (en) | 1979-10-31 |
| IL42513A0 (en) | 1973-08-29 |
| IL42513A (en) | 1976-12-31 |
| ATA570873A (de) | 1975-06-15 |
| NO137899C (no) | 1978-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69815126T2 (de) | Pyrimidinderivate und verfahren zu deren herstellung | |
| DE69530989T2 (de) | Neue pyrimidinderivate und verfahren zu ihrer herstellung | |
| DE2058295C3 (de) | Xanthen-9-on-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69815008T2 (de) | Alfa-substituierte Phenylpropionsäurederivate und diese enthaltende Arzneimittel | |
| EP0013894B1 (de) | Neue Arylether, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2407744A1 (de) | Chinolin-3-carboxamidotetrazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel | |
| DE2332731A1 (de) | Chinolin-carbonsaeure-(2)-verbindungen, verfahren zu ihrer herstellung sowie solche verbindungen enthaltende arzneimittelpraeparate | |
| DD211555A5 (de) | Verfahren zur herstellung neuer 4-amino-6,7-dimethoxychinolin-derivate | |
| CH635586A5 (de) | Verfahren zur herstellung von 1,3-dihydroimidazo(4,5-b)pyridin-2-onen. | |
| EP0387821B1 (de) | 2-Alkyl-4-arylmethylaminochinoline, ihre Verwendung und daraus hergestellte Arzneimittel | |
| DE69008542T2 (de) | Chinolinderivate, ihre herstellung und verwendung. | |
| DE2802493C2 (enExample) | ||
| DE1620450C3 (de) | 1 - (2- Hydroxybenzyl) -2-piperazinomethylbenzimidazole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DD286581A5 (de) | Verfahren zur herstellung von hetera-aliphatischem carbonsaeureamiden | |
| EP0185909B1 (de) | 5-Alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0561252A1 (de) | 2-Oxochinolinderivate als Angiotensin II-Antagonisten | |
| DE2816884A1 (de) | Anilinderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| EP0250361B1 (de) | Disubstituierte Piperazine | |
| DE2424334A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE2410852A1 (de) | Neue chinoxalin-2-carboxamidotetrazolderivate, verfahren zu ihrer herstellung und diese enthaltende mittel | |
| DE3813531A1 (de) | Neue 2-aminoalkyl-4-benzyl-1-(2h)-phthalazinon-derivate | |
| DE69827233T2 (de) | Diaminderivate und diese enthaltende arzneimittel | |
| EP0072960B1 (de) | 1,5-Diphenylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0064685A1 (de) | Dibenzo(de,g)chinolin-Derivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| CH642967A5 (de) | Neue pyrimidoisochinolin-derivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |