DE2311177A1 - O-(dialkylaminoalkyl)-1-alkyl-5nitroimidazol-(2)-aldoxime und verfahren zu ihrer herstellung - Google Patents
O-(dialkylaminoalkyl)-1-alkyl-5nitroimidazol-(2)-aldoxime und verfahren zu ihrer herstellungInfo
- Publication number
- DE2311177A1 DE2311177A1 DE19732311177 DE2311177A DE2311177A1 DE 2311177 A1 DE2311177 A1 DE 2311177A1 DE 19732311177 DE19732311177 DE 19732311177 DE 2311177 A DE2311177 A DE 2311177A DE 2311177 A1 DE2311177 A1 DE 2311177A1
- Authority
- DE
- Germany
- Prior art keywords
- aldoxime
- methyl
- nitroimidazole
- monohydrochloride
- propyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 32
- -1 Hydroxyethyl group Chemical group 0.000 claims description 32
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 125000004193 piperazinyl group Chemical group 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 3
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 2
- NDOVLWQBFFJETK-UHFFFAOYSA-N 1,4-thiazinane 1,1-dioxide Chemical compound O=S1(=O)CCNCC1 NDOVLWQBFFJETK-UHFFFAOYSA-N 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 125000004185 ester group Chemical group 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- 208000015181 infectious disease Diseases 0.000 description 21
- 238000012360 testing method Methods 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 244000052769 pathogen Species 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 6
- 230000001717 pathogenic effect Effects 0.000 description 6
- 238000011156 evaluation Methods 0.000 description 5
- VAOCPAMSLUNLGC-UHFFFAOYSA-N metronidazole Chemical compound CC1=NC=C([N+]([O-])=O)N1CCO VAOCPAMSLUNLGC-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- JIUFIUFXILBXAC-UHFFFAOYSA-N 1-ethyl-5-nitroimidazole Chemical compound CCN1C=NC=C1[N+]([O-])=O JIUFIUFXILBXAC-UHFFFAOYSA-N 0.000 description 4
- 241000699800 Cricetinae Species 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 4
- 206010019692 hepatic necrosis Diseases 0.000 description 4
- 210000004185 liver Anatomy 0.000 description 4
- 231100000149 liver necrosis Toxicity 0.000 description 4
- 229960000282 metronidazole Drugs 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 241000224432 Entamoeba histolytica Species 0.000 description 3
- 241000699673 Mesocricetus auratus Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 229940007078 entamoeba histolytica Drugs 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- OFQCQIGMURIECL-UHFFFAOYSA-N 2-[2-(diethylamino)ethyl]-2',6'-dimethylspiro[isoquinoline-4,4'-oxane]-1,3-dione;phosphoric acid Chemical compound OP(O)(O)=O.O=C1N(CCN(CC)CC)C(=O)C2=CC=CC=C2C21CC(C)OC(C)C2 OFQCQIGMURIECL-UHFFFAOYSA-N 0.000 description 2
- 241000224489 Amoeba Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical class [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241001502500 Trichomonadida Species 0.000 description 2
- 241000224526 Trichomonas Species 0.000 description 2
- 241000224527 Trichomonas vaginalis Species 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000009395 breeding Methods 0.000 description 2
- 230000001488 breeding effect Effects 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000000416 exudates and transudate Anatomy 0.000 description 2
- 210000003754 fetus Anatomy 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- YLGXILFCIXHCMC-JHGZEJCSSA-N methyl cellulose Chemical compound COC1C(OC)C(OC)C(COC)O[C@H]1O[C@H]1C(OC)C(OC)C(OC)OC1COC YLGXILFCIXHCMC-JHGZEJCSSA-N 0.000 description 2
- JVKAWJASTRPFQY-UHFFFAOYSA-N n-(2-aminoethyl)hydroxylamine Chemical class NCCNO JVKAWJASTRPFQY-UHFFFAOYSA-N 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- JSAQDPJIVQMBAY-UHFFFAOYSA-N (1-methyl-5-nitroimidazol-2-yl)methanol Chemical compound CN1C(CO)=NC=C1[N+]([O-])=O JSAQDPJIVQMBAY-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical class CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- YZEUHQHUFTYLPH-UHFFFAOYSA-N 2-nitroimidazole Chemical compound [O-][N+](=O)C1=NC=CN1 YZEUHQHUFTYLPH-UHFFFAOYSA-N 0.000 description 1
- VYDWQPKRHOGLPA-UHFFFAOYSA-N 5-nitroimidazole Chemical compound [O-][N+](=O)C1=CN=CN1 VYDWQPKRHOGLPA-UHFFFAOYSA-N 0.000 description 1
- 150000004958 5-nitroimidazoles Chemical class 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100387923 Caenorhabditis elegans dos-1 gene Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000004705 aldimines Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 101150117004 atg18 gene Proteins 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940042396 direct acting antivirals thiosemicarbazones Drugs 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003584 thiosemicarbazones Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/95—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by nitrogen atoms, attached to other ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732311177 DE2311177A1 (de) | 1973-03-07 | 1973-03-07 | O-(dialkylaminoalkyl)-1-alkyl-5nitroimidazol-(2)-aldoxime und verfahren zu ihrer herstellung |
| NL7402819A NL7402819A (https=) | 1973-03-07 | 1974-03-01 | |
| US05/448,376 US3951963A (en) | 1973-03-07 | 1974-03-05 | 0-(Substituted-aminoalkyl)-5-nitroimidazole-(2)-aldoximes |
| AT185474A AT332391B (de) | 1973-03-07 | 1974-03-06 | Verfahren zur herstellung von neuen 0-(dialkylaminoalkyl)-5-nitroimidazol-(2)-aldoximen und deren salzen |
| GB1000074A GB1455158A (en) | 1973-03-07 | 1974-03-06 | O-dialkyl-aminoalkyl-1-alkyl-5-nitroimidazole-2-aldoximes and process for their manufacture |
| BE141757A BE812005A (fr) | 1973-03-07 | 1974-03-07 | O-(dialkylaminoalkyl)-1-alkyl-5-nitroimidazole-(2)-aldoximes; leur procede de preparation et leurs applications |
| JP49025806A JPS49124065A (https=) | 1973-03-07 | 1974-03-07 | |
| FR7407803A FR2220267B1 (https=) | 1973-03-07 | 1974-03-07 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732311177 DE2311177A1 (de) | 1973-03-07 | 1973-03-07 | O-(dialkylaminoalkyl)-1-alkyl-5nitroimidazol-(2)-aldoxime und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2311177A1 true DE2311177A1 (de) | 1974-09-19 |
Family
ID=5873979
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732311177 Pending DE2311177A1 (de) | 1973-03-07 | 1973-03-07 | O-(dialkylaminoalkyl)-1-alkyl-5nitroimidazol-(2)-aldoxime und verfahren zu ihrer herstellung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3951963A (https=) |
| JP (1) | JPS49124065A (https=) |
| AT (1) | AT332391B (https=) |
| BE (1) | BE812005A (https=) |
| DE (1) | DE2311177A1 (https=) |
| FR (1) | FR2220267B1 (https=) |
| GB (1) | GB1455158A (https=) |
| NL (1) | NL7402819A (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005794A1 (de) * | 1978-05-24 | 1979-12-12 | Siegfried Aktiengesellschaft | Verfahren zur stereospezifischen bzw. stereoselektiven Herstellung von Imidazolyl-oximetherderivaten und Imidazolyloximderivaten |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH617427A5 (https=) * | 1975-12-24 | 1980-05-30 | Siegfried Ag | |
| DE2613167A1 (de) * | 1976-03-27 | 1977-10-06 | Bayer Ag | Oximcarbamate, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und nematozide |
| US4105763A (en) * | 1976-10-22 | 1978-08-08 | Hoechst Aktiengesellschaft | 1-Methyl-2-(phenyl-oxymethyl)-5-nitro-imidazoles |
| DE2651084A1 (de) * | 1976-11-09 | 1978-12-14 | Hoechst Ag | Basisch substituirte o-(2-hydroxypropyl) -aldoxime, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3060177A (en) * | 1957-11-11 | 1962-10-23 | Ciba Geigy Corp | O-(aminoalkyl)oxime derivatives of heterocyclic aldehydes and ketones |
| US3472864A (en) * | 1964-03-18 | 1969-10-14 | Merck & Co Inc | 2-carbonyl-5-nitroimidazoles |
| US3299090A (en) * | 1964-03-27 | 1967-01-17 | Merck & Co Inc | Nitroimidazoles |
| US3790593A (en) * | 1966-07-18 | 1974-02-05 | J Carlson | 1-substituted-5-nitroimidazol-2-ylalkyl-(n-substituted)-carbamates |
| DE1937630A1 (de) * | 1969-07-19 | 1971-02-04 | Schering Ag | 2-(5-Nitro-2-furfuryliden)-l-tetralone |
| US3634447A (en) * | 1969-10-08 | 1972-01-11 | American Cyanamid Co | Substituted nitroimidazoles and method of preparing the same |
| DE2101111A1 (de) * | 1971-01-12 | 1972-08-03 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Imidazoly 1-ketoxim-carbamate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Insektizide |
-
1973
- 1973-03-07 DE DE19732311177 patent/DE2311177A1/de active Pending
-
1974
- 1974-03-01 NL NL7402819A patent/NL7402819A/xx unknown
- 1974-03-05 US US05/448,376 patent/US3951963A/en not_active Expired - Lifetime
- 1974-03-06 AT AT185474A patent/AT332391B/de not_active IP Right Cessation
- 1974-03-06 GB GB1000074A patent/GB1455158A/en not_active Expired
- 1974-03-07 FR FR7407803A patent/FR2220267B1/fr not_active Expired
- 1974-03-07 JP JP49025806A patent/JPS49124065A/ja active Pending
- 1974-03-07 BE BE141757A patent/BE812005A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005794A1 (de) * | 1978-05-24 | 1979-12-12 | Siegfried Aktiengesellschaft | Verfahren zur stereospezifischen bzw. stereoselektiven Herstellung von Imidazolyl-oximetherderivaten und Imidazolyloximderivaten |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2220267A1 (https=) | 1974-10-04 |
| AT332391B (de) | 1976-09-27 |
| FR2220267B1 (https=) | 1978-02-03 |
| JPS49124065A (https=) | 1974-11-27 |
| US3951963A (en) | 1976-04-20 |
| GB1455158A (en) | 1976-11-10 |
| BE812005A (fr) | 1974-09-09 |
| NL7402819A (https=) | 1974-09-10 |
| ATA185474A (de) | 1976-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1914999A1 (de) | Neue Guanylhydrazone und Verfahren zu ihrer Herstellung | |
| EP0005828B1 (de) | Neue substituierte Phenylpiperazinderivate, diese enthaltende Arzneimittel und Verfahren zu deren Herstellung | |
| EP0000220B1 (de) | Dihydrouracile, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2834322A1 (de) | 4-substituierte pyrazole | |
| DE2452691A1 (de) | 2,6-disubstituierte phenylaminoguanidinverbindungen | |
| DE1620450C3 (de) | 1 - (2- Hydroxybenzyl) -2-piperazinomethylbenzimidazole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2311177A1 (de) | O-(dialkylaminoalkyl)-1-alkyl-5nitroimidazol-(2)-aldoxime und verfahren zu ihrer herstellung | |
| DE3319956A1 (de) | 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimitteln | |
| DE2463023C2 (de) | S-Triazolo-[5,1-a]-isochinolinderivate, deren Salze und Verfahren zu deren Herstellung | |
| DD207375A1 (de) | Verfahren zur herstellung von imidazolen und imidazolinen | |
| DE2819372C2 (https=) | ||
| EP0004332A1 (de) | Isochinole,Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE3438244C2 (https=) | ||
| CH667457A5 (de) | Verfahren zur herstellung von substituierten 7-oxomitosanen. | |
| DE2439629B2 (de) | O-dialkylaminoalkyl-5-nitro-2- furanaldoxime, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE1643197A1 (de) | Diarylcyclopropanderivate und Verfahren zu ihrer Herstellung | |
| DE2651084A1 (de) | Basisch substituirte o-(2-hydroxypropyl) -aldoxime, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE69114644T2 (de) | 4(5)-Imidazole fähig zur Inhibierung von Aromatase. | |
| AT360984B (de) | Verfahren zur herstellung neuer basisch substi- tuierter 0-(2-hydroxypropyl)-aldoxime | |
| AT360983B (de) | Verfahren zur herstellung neuer basisch substituierter 0-(2-hydroxypropyl)-aldoxime | |
| DE2312219A1 (de) | 1-alkyl-2-piperazinomethyl-5-nitroimidazole und verfahren zu ihrer herstellung | |
| DE3341750A1 (de) | 1,2,4-triazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2262555A1 (de) | 1,4-bis- eckige klammer auf 1'-alkyl5'-nitroimidazolyl-2'-methylen-imino eckige klammer zu -piperazin und verfahren zu ihrer herstellung | |
| DE2262553A1 (de) | 4- eckige klammer auf 1'-alkyl-5'nitroimidazolyl-2'-methylen-imino eckige klammer zu - tetrahydro-1,4-thiazin-1,1dioxide und verfahren zu ihrer herstellung | |
| DE2325159C3 (de) | l-Methyl-2-(pyridylthiomethyl)-5nitro-imidazole sowie l-Methyl-2-(N-oxypyridylthiomethyl)-5-nitroimidazole |