DE2300153A1 - Verkuerzbarer schirm - Google Patents
Verkuerzbarer schirmInfo
- Publication number
- DE2300153A1 DE2300153A1 DE19732300153 DE2300153A DE2300153A1 DE 2300153 A1 DE2300153 A1 DE 2300153A1 DE 19732300153 DE19732300153 DE 19732300153 DE 2300153 A DE2300153 A DE 2300153A DE 2300153 A1 DE2300153 A1 DE 2300153A1
- Authority
- DE
- Germany
- Prior art keywords
- rod
- main
- shortened
- rods
- umbrella
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 235000015250 liver sausages Nutrition 0.000 claims 1
- XYSQXZCMOLNHOI-UHFFFAOYSA-N s-[2-[[4-(acetylsulfamoyl)phenyl]carbamoyl]phenyl] 5-pyridin-1-ium-1-ylpentanethioate;bromide Chemical compound [Br-].C1=CC(S(=O)(=O)NC(=O)C)=CC=C1NC(=O)C1=CC=CC=C1SC(=O)CCCC[N+]1=CC=CC=C1 XYSQXZCMOLNHOI-UHFFFAOYSA-N 0.000 claims 1
- 238000004904 shortening Methods 0.000 description 3
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45B—WALKING STICKS; UMBRELLAS; LADIES' OR LIKE FANS
- A45B19/00—Special folding or telescoping of umbrellas
- A45B19/10—Special folding or telescoping of umbrellas with collapsible ribs
Landscapes
- Walking Sticks, Umbrellas, And Fans (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1903572A IT946297B (it) | 1972-01-04 | 1972-01-04 | Ombrello accorciabile |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2300153A1 true DE2300153A1 (de) | 1973-07-19 |
Family
ID=11153987
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732300153 Pending DE2300153A1 (de) | 1972-01-04 | 1973-01-03 | Verkuerzbarer schirm |
Country Status (3)
| Country | Link |
|---|---|
| DE (1) | DE2300153A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2167673B1 (enrdf_load_stackoverflow) |
| IT (1) | IT946297B (enrdf_load_stackoverflow) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3203510A1 (de) * | 1982-02-02 | 1983-08-11 | Fu Tai Umbrella Works, Ltd., Taipei | Gegliederte gerueststruktur fuer das geruest eines schirms |
| US4674524A (en) * | 1985-11-22 | 1987-06-23 | Demarco Joseph | Folding umbrella |
| US4685482A (en) * | 1985-03-06 | 1987-08-11 | Yung Kwong Y | Closable, collapsible umbrella for one-hand operation |
| US5392799A (en) * | 1994-07-29 | 1995-02-28 | Lai; Chen M. | Four-section umbrella strut spreader structure |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US467115A (en) * | 1892-01-12 | hawkins | ||
| DE202184C (enrdf_load_stackoverflow) * | ||||
| DE944147C (de) * | 1939-06-15 | 1956-06-07 | Elisabeth Haupt Geb Hohler | Verkuerzbarer Schirm |
-
1972
- 1972-01-04 IT IT1903572A patent/IT946297B/it active
-
1973
- 1973-01-03 DE DE19732300153 patent/DE2300153A1/de active Pending
- 1973-01-04 FR FR7300220A patent/FR2167673B1/fr not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3203510A1 (de) * | 1982-02-02 | 1983-08-11 | Fu Tai Umbrella Works, Ltd., Taipei | Gegliederte gerueststruktur fuer das geruest eines schirms |
| US4685482A (en) * | 1985-03-06 | 1987-08-11 | Yung Kwong Y | Closable, collapsible umbrella for one-hand operation |
| US4674524A (en) * | 1985-11-22 | 1987-06-23 | Demarco Joseph | Folding umbrella |
| US5392799A (en) * | 1994-07-29 | 1995-02-28 | Lai; Chen M. | Four-section umbrella strut spreader structure |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2167673A1 (enrdf_load_stackoverflow) | 1973-08-24 |
| IT946297B (it) | 1973-05-21 |
| FR2167673B1 (enrdf_load_stackoverflow) | 1976-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE212019000099U1 (de) | Faltbares Zelt mit einer automatischen Traufstruktur | |
| DE69602014T2 (de) | Behälter, insbesondere pflanzenstütze | |
| EP0219571B1 (de) | Wäschegestell | |
| DE3239407A1 (de) | Regenschirm | |
| DE2259875A1 (de) | Verkuerzbarer schirm | |
| DE2300153A1 (de) | Verkuerzbarer schirm | |
| DE3039414A1 (de) | Als staender, bock, waeschtrockner o.dgl. zu verwendendes klappgestell | |
| DE6919448U (de) | Klappbarer teewagen bzw. klapptisch | |
| DE2932423A1 (de) | Zusammenklappbarer schirm | |
| DE1254832B (de) | Verkuerzbarer Schirm | |
| DE20217285U1 (de) | Stapelbarer Einkaufswagen | |
| DE3306966C2 (de) | Schirm | |
| DE708581C (de) | Verkuerzbares Schirmgestell | |
| DE2317082A1 (de) | Selbsttaetig sich oeffnender und schliessender schirm | |
| DE2530697A1 (de) | Kistenfoermiger behaelter | |
| DE2012025C3 (de) | Faltschirm | |
| DE2535765C3 (de) | Faltschirm | |
| DE102011002667B4 (de) | Tragekorb | |
| DE1632493B1 (de) | Verkürzbarer Schirm | |
| DE1757776C (de) | Verkürzbarer Schirm | |
| DE2022515B1 (de) | Taschenschirm | |
| DE471905C (de) | Taschendoppelspiegel | |
| DE2307679C3 (de) | Verkürzbarer Schirm | |
| DE2007080C2 (de) | Verkürzbarer Schirm | |
| DE676303C (de) | Feldstuhl |