DE2242786A1 - Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel - Google Patents
Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittelInfo
- Publication number
- DE2242786A1 DE2242786A1 DE2242786A DE2242786A DE2242786A1 DE 2242786 A1 DE2242786 A1 DE 2242786A1 DE 2242786 A DE2242786 A DE 2242786A DE 2242786 A DE2242786 A DE 2242786A DE 2242786 A1 DE2242786 A1 DE 2242786A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- radical
- amino
- alkoxy
- chain
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 CARBONYL FUNCTION Chemical group 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 229940126601 medicinal product Drugs 0.000 title 1
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- YSMRAFSHKXBOFO-UHFFFAOYSA-N 1,4-dihydropyridin-2-amine Chemical class NC1=CCC=CN1 YSMRAFSHKXBOFO-UHFFFAOYSA-N 0.000 claims description 7
- 239000003814 drug Substances 0.000 claims description 7
- 150000003254 radicals Chemical class 0.000 claims description 7
- 150000001409 amidines Chemical class 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 150000002576 ketones Chemical class 0.000 claims description 4
- 125000005493 quinolyl group Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 48
- 235000019441 ethanol Nutrition 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- HSDKTLKBDJXJQU-UHFFFAOYSA-N ethyl 3-amino-3-iminopropanoate Chemical compound CCOC(=O)CC(N)=N HSDKTLKBDJXJQU-UHFFFAOYSA-N 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- DQFBYFPFKXHELB-VAWYXSNFSA-N trans-chalcone Chemical compound C=1C=CC=CC=1C(=O)\C=C\C1=CC=CC=C1 DQFBYFPFKXHELB-VAWYXSNFSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- IGSYOTSSTZUGIA-ZHACJKMWSA-N (e)-3-(2-chlorophenyl)-1-phenylprop-2-en-1-one Chemical compound ClC1=CC=CC=C1\C=C\C(=O)C1=CC=CC=C1 IGSYOTSSTZUGIA-ZHACJKMWSA-N 0.000 description 2
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 2
- QHJJSLUZWHFHTK-UHFFFAOYSA-N 3-amino-3-azaniumylidenepropanoate Chemical compound NC(=N)CC(O)=O QHJJSLUZWHFHTK-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 210000003748 coronary sinus Anatomy 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- ZVWPDJQEKLAOHT-UHFFFAOYSA-N propan-2-yl 3-amino-3-iminopropanoate Chemical compound CC(C)OC(=O)CC(N)=N ZVWPDJQEKLAOHT-UHFFFAOYSA-N 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ZBJKXINTBAOXAJ-UHFFFAOYSA-N (2-methyl-3-phenylprop-1-enyl)benzene Chemical compound C=1C=CC=CC=1C=C(C)CC1=CC=CC=C1 ZBJKXINTBAOXAJ-UHFFFAOYSA-N 0.000 description 1
- 239000001211 (E)-4-phenylbut-3-en-2-one Substances 0.000 description 1
- PAWSVPVNIXFKOS-IHWYPQMZSA-N (Z)-2-aminobutenoic acid Chemical class C\C=C(/N)C(O)=O PAWSVPVNIXFKOS-IHWYPQMZSA-N 0.000 description 1
- MFDFEQQOFGIZAS-MDZDMXLPSA-N (e)-1-phenyl-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one Chemical compound COC1=C(OC)C(OC)=CC(\C=C\C(=O)C=2C=CC=CC=2)=C1 MFDFEQQOFGIZAS-MDZDMXLPSA-N 0.000 description 1
- KPPVNWGJXFMGAM-UUILKARUSA-N (e)-2-methyl-1-(6-methyl-3,4-dihydro-2h-quinolin-1-yl)but-2-en-1-one Chemical compound CC1=CC=C2N(C(=O)C(/C)=C/C)CCCC2=C1 KPPVNWGJXFMGAM-UUILKARUSA-N 0.000 description 1
- SMFBODMWKWBFOK-MDZDMXLPSA-N (e)-3-(3-nitrophenyl)-1-phenylprop-2-en-1-one Chemical compound [O-][N+](=O)C1=CC=CC(\C=C\C(=O)C=2C=CC=CC=2)=C1 SMFBODMWKWBFOK-MDZDMXLPSA-N 0.000 description 1
- WRRZKDVBPZBNJN-ONEGZZNKSA-N (e)-4-(4-methoxyphenyl)but-3-en-2-one Chemical compound COC1=CC=C(\C=C\C(C)=O)C=C1 WRRZKDVBPZBNJN-ONEGZZNKSA-N 0.000 description 1
- WCFAPJDPAPDDAQ-UHFFFAOYSA-N 1,2-dihydropyrimidine Chemical class C1NC=CC=N1 WCFAPJDPAPDDAQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical compound CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 1
- QZMAQARJRMCAPU-UHFFFAOYSA-N 1-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one Chemical compound C1=CC(C(F)(F)F)=CC=C1C=CC(=O)C1=CC=CC=C1 QZMAQARJRMCAPU-UHFFFAOYSA-N 0.000 description 1
- KZDCMKVLEYCGQX-UDPGNSCCSA-N 2-(diethylamino)ethyl 4-aminobenzoate;(2s,5r,6r)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrate Chemical compound O.CCN(CC)CCOC(=O)C1=CC=C(N)C=C1.N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 KZDCMKVLEYCGQX-UDPGNSCCSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- WKXHSRQMNCLEEH-UHFFFAOYSA-N 3-(2-methylsulfanylphenyl)-1-phenylprop-2-en-1-one Chemical compound CSC1=CC=CC=C1C=CC(=O)C1=CC=CC=C1 WKXHSRQMNCLEEH-UHFFFAOYSA-N 0.000 description 1
- COYCXICZZVMYLE-UHFFFAOYSA-N 3-(3-bromophenyl)-1-phenylprop-2-en-1-one Chemical compound BrC1=CC=CC(C=CC(=O)C=2C=CC=CC=2)=C1 COYCXICZZVMYLE-UHFFFAOYSA-N 0.000 description 1
- XBFMSIZYORSEPA-UHFFFAOYSA-N 3-(3-chlorophenyl)-1-phenylprop-2-en-1-one Chemical compound ClC1=CC=CC(C=CC(=O)C=2C=CC=CC=2)=C1 XBFMSIZYORSEPA-UHFFFAOYSA-N 0.000 description 1
- WDZGGAFMGIOIQS-UHFFFAOYSA-N 3-(4-nitrophenyl)-1-phenylprop-2-en-1-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1C=CC(=O)C1=CC=CC=C1 WDZGGAFMGIOIQS-UHFFFAOYSA-N 0.000 description 1
- RGXJMLZFKIUGNH-UHFFFAOYSA-N 3-amino-3-iminopropanamide Chemical compound NC(=N)CC(N)=O RGXJMLZFKIUGNH-UHFFFAOYSA-N 0.000 description 1
- ABGIIXRNMHUKII-DHZHZOJOSA-N 4-chlorochalcone Chemical compound C1=CC(Cl)=CC=C1\C=C\C(=O)C1=CC=CC=C1 ABGIIXRNMHUKII-DHZHZOJOSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- KHMYONNPZWOTKW-VMPITWQZSA-N [(e)-pent-1-enyl]benzene Chemical compound CCC\C=C\C1=CC=CC=C1 KHMYONNPZWOTKW-VMPITWQZSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000003440 anti-fibrillation Effects 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940127088 antihypertensive drug Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229930008407 benzylideneacetone Natural products 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 235000005513 chalcones Nutrition 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000036543 hypotension Effects 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- SNGMABFTOTYJGX-UHFFFAOYSA-N prop-2-ynyl prop-2-ynoate Chemical compound C#CC(=O)OCC#C SNGMABFTOTYJGX-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- BWHOZHOGCMHOBV-BQYQJAHWSA-N trans-benzylideneacetone Chemical compound CC(=O)\C=C\C1=CC=CC=C1 BWHOZHOGCMHOBV-BQYQJAHWSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
- Medicinal Preparation (AREA)
- Pyridine Compounds (AREA)
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2242786A DE2242786A1 (de) | 1972-08-31 | 1972-08-31 | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel |
| US390194A US3862162A (en) | 1972-08-31 | 1973-08-21 | Certain-2-amino-1,4-dihydro-4-phenyl-6-lower alkyl (or phenyl)-3-pyridinecarboxylates |
| CA179,511A CA999869A (en) | 1972-08-31 | 1973-08-23 | Process for the preparation of 2-amino-1,4-dihydropyridine derivatives |
| IL43079A IL43079A (en) | 1972-08-31 | 1973-08-27 | 2-amino-1,4-dihydropyridines,their production and pharmaceutical compositions containing them |
| NL7311831A NL7311831A (enExample) | 1972-08-31 | 1973-08-28 | |
| PL1973164909A PL89414B1 (enExample) | 1972-08-31 | 1973-08-29 | |
| DD173162A DD111904A5 (enExample) | 1972-08-31 | 1973-08-29 | |
| CH1239073A CH592062A5 (enExample) | 1972-08-31 | 1973-08-29 | |
| BE135059A BE804160A (fr) | 1972-08-31 | 1973-08-29 | Procede de production de nouvelles 2-amino-1, 4-dihydropyridines a fonction carbonyle et medicament contenant ces composes |
| LU68326A LU68326A1 (enExample) | 1972-08-31 | 1973-08-29 | |
| JP48096288A JPS4962482A (enExample) | 1972-08-31 | 1973-08-29 | |
| HUBA2975A HU166813B (enExample) | 1972-08-31 | 1973-08-30 | |
| ES418339A ES418339A1 (es) | 1972-08-31 | 1973-08-30 | Procedimiento para la obtencion de 2-amino-1,4-dihidropiri-nas. |
| GB4084773A GB1389504A (en) | 1972-08-31 | 1973-08-30 | 2-amino-1,4-dihydropyridines their production and their medicinal use |
| ZA735974A ZA735974B (en) | 1972-08-31 | 1973-08-30 | New 2-amino-1,4-dihydropyridines,their production and their medicinal use |
| IE1523/73A IE38182B1 (en) | 1972-08-31 | 1973-08-30 | New 2-anomi-1,4-dihydropyridines their production and their medicinal use |
| AU59834/73A AU470790B2 (en) | 1972-08-31 | 1973-08-30 | New 2-amino-1, 4-dihydropyridines, their production, and their medicinal use |
| DK476473A DK135040C (da) | 1972-08-31 | 1973-08-30 | Fremgangsmade til fremstilling af 2-amino-1,4-dihydropyridiner |
| SE7311812A SE385881B (sv) | 1972-08-31 | 1973-08-30 | Sett att framstella nya 2-amino - 1,4-dihydropyridiner med en karbonylfunktion |
| AT759973A AT327901B (de) | 1972-08-31 | 1973-08-31 | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen |
| FR7331530A FR2279397A1 (fr) | 1972-08-31 | 1973-08-31 | Procede de production de nouvelles 2-amino-1,4-dihydropyridines a fonction carbonyle et medicament contenant ces composes |
| US05/526,510 US3989708A (en) | 1972-08-31 | 1974-11-25 | 2-Amino-1,4-dihydropyridine derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2242786A DE2242786A1 (de) | 1972-08-31 | 1972-08-31 | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2242786A1 true DE2242786A1 (de) | 1974-03-14 |
Family
ID=5855064
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2242786A Pending DE2242786A1 (de) | 1972-08-31 | 1972-08-31 | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3862162A (enExample) |
| JP (1) | JPS4962482A (enExample) |
| AT (1) | AT327901B (enExample) |
| AU (1) | AU470790B2 (enExample) |
| BE (1) | BE804160A (enExample) |
| CA (1) | CA999869A (enExample) |
| CH (1) | CH592062A5 (enExample) |
| DD (1) | DD111904A5 (enExample) |
| DE (1) | DE2242786A1 (enExample) |
| DK (1) | DK135040C (enExample) |
| ES (1) | ES418339A1 (enExample) |
| FR (1) | FR2279397A1 (enExample) |
| GB (1) | GB1389504A (enExample) |
| HU (1) | HU166813B (enExample) |
| IE (1) | IE38182B1 (enExample) |
| IL (1) | IL43079A (enExample) |
| LU (1) | LU68326A1 (enExample) |
| NL (1) | NL7311831A (enExample) |
| PL (1) | PL89414B1 (enExample) |
| SE (1) | SE385881B (enExample) |
| ZA (1) | ZA735974B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3959296A (en) * | 1972-06-10 | 1976-05-25 | Bayer Aktiengesellschaft | 1,4-Dihydropyridines |
| NZ201395A (en) * | 1981-07-30 | 1987-02-20 | Bayer Ag | Pharmaceutical compositions containing 1,4-dihydropyridines and certain of these dihydropyridines |
| DE3130041A1 (de) * | 1981-07-30 | 1983-02-17 | Bayer Ag, 5090 Leverkusen | Dihydropyridine mit positiv inotroper wirkung, neue verbindungen, ihre verwendung in arzneimitteln und verfahren zu ihrer herstellung |
| DE3206671A1 (de) * | 1982-02-25 | 1983-09-01 | Bayer Ag, 5090 Leverkusen | Dihydropyridine mit positiv inotroper wirkung, neue verbindungen, ihre verwendung in arzneimitteln und verfahren zu ihrer herstellung |
| US4678796A (en) * | 1984-11-30 | 1987-07-07 | Warner-Lambert Company | 2-alkylidene derivatives of 1,2,3,4-tetrahydropyridine-2,5-pyridine carboxylic acid dialkyl esters useful for treatment of cardiovascular disorders |
| CA1267416A (en) | 1985-06-17 | 1990-04-03 | Ila Sircar | 1,4-dihydropyridine derivatives useful for the treatment of cardiovascular disorders |
| US4732898A (en) * | 1986-04-29 | 1988-03-22 | Warner-Lambert Company | 2-(2-aryl-2-oxoalkylidene) analogs of-3,5-pyridinedicarboxylic acid dialkyl esters useful for treatment of cardiovascular disorders |
| DE4117750A1 (de) * | 1991-05-30 | 1992-12-24 | Bayer Ag | Neue 2-amino-5-cyano-1,4-dihydropyridine, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln |
| DE4313695A1 (de) * | 1993-04-27 | 1994-11-03 | Bayer Ag | 2-Amino-5-cyano-4-chinolyldihydropyridinester, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln |
| DE4313696A1 (de) * | 1993-04-27 | 1994-11-03 | Bayer Ag | 2-Amino-4-heteroaryl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln |
| DE4313693A1 (de) * | 1993-04-27 | 1994-11-03 | Bayer Ag | 2-Amino-4-chinolin-dihydropyridine, Verfahren zu ihrer Herstellung und ihre Verwendung |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1923990C3 (de) * | 1969-05-10 | 1978-11-23 | Bayer Ag | Verfahren zur Herstellung von N-substituierten M-Dihydropyridin-S.S-dicarbonsäureestern |
| ZA7152B (en) * | 1970-01-24 | 1971-10-27 | Bayer Ag | New pharmaceutically active 1,4-dihydropyridines |
| DE2117572C3 (de) * | 1971-04-10 | 1980-03-20 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin ^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2117571C3 (de) * | 1971-04-10 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
-
1972
- 1972-08-31 DE DE2242786A patent/DE2242786A1/de active Pending
-
1973
- 1973-08-21 US US390194A patent/US3862162A/en not_active Expired - Lifetime
- 1973-08-23 CA CA179,511A patent/CA999869A/en not_active Expired
- 1973-08-27 IL IL43079A patent/IL43079A/en unknown
- 1973-08-28 NL NL7311831A patent/NL7311831A/xx not_active Application Discontinuation
- 1973-08-29 DD DD173162A patent/DD111904A5/xx unknown
- 1973-08-29 PL PL1973164909A patent/PL89414B1/pl unknown
- 1973-08-29 BE BE135059A patent/BE804160A/xx unknown
- 1973-08-29 JP JP48096288A patent/JPS4962482A/ja active Pending
- 1973-08-29 CH CH1239073A patent/CH592062A5/xx not_active IP Right Cessation
- 1973-08-29 LU LU68326A patent/LU68326A1/xx unknown
- 1973-08-30 ZA ZA735974A patent/ZA735974B/xx unknown
- 1973-08-30 GB GB4084773A patent/GB1389504A/en not_active Expired
- 1973-08-30 AU AU59834/73A patent/AU470790B2/en not_active Expired
- 1973-08-30 IE IE1523/73A patent/IE38182B1/xx unknown
- 1973-08-30 DK DK476473A patent/DK135040C/da active
- 1973-08-30 ES ES418339A patent/ES418339A1/es not_active Expired
- 1973-08-30 HU HUBA2975A patent/HU166813B/hu unknown
- 1973-08-30 SE SE7311812A patent/SE385881B/xx unknown
- 1973-08-31 FR FR7331530A patent/FR2279397A1/fr active Granted
- 1973-08-31 AT AT759973A patent/AT327901B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CA999869A (en) | 1976-11-16 |
| JPS4962482A (enExample) | 1974-06-17 |
| LU68326A1 (enExample) | 1973-10-30 |
| GB1389504A (en) | 1975-04-03 |
| IL43079A0 (en) | 1973-11-28 |
| FR2279397B1 (enExample) | 1978-07-28 |
| AU470790B2 (en) | 1976-03-25 |
| ATA759973A (de) | 1975-05-15 |
| DK135040C (da) | 1977-09-05 |
| ES418339A1 (es) | 1976-03-16 |
| DD111904A5 (enExample) | 1975-03-12 |
| IL43079A (en) | 1976-06-30 |
| PL89414B1 (enExample) | 1976-11-30 |
| BE804160A (fr) | 1974-02-28 |
| US3862162A (en) | 1975-01-21 |
| IE38182L (en) | 1974-02-28 |
| DK135040B (da) | 1977-02-28 |
| SE385881B (sv) | 1976-07-26 |
| IE38182B1 (en) | 1978-01-18 |
| AU5983473A (en) | 1975-03-06 |
| NL7311831A (enExample) | 1974-03-04 |
| HU166813B (enExample) | 1975-06-28 |
| FR2279397A1 (fr) | 1976-02-20 |
| ZA735974B (en) | 1974-08-28 |
| CH592062A5 (enExample) | 1977-10-14 |
| AT327901B (de) | 1976-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0002208B1 (de) | Nitrosubstituierte 1,4-Dihydropyridine, diese enthaltende Arzneimittel sowie deren Herstellung | |
| DE2117571C3 (de) | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2210672C3 (de) | N-substituierte unsymmetrische 1 ^-Dihydropyridin-S^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2117572A1 (de) | Unsymmetrische 1,4-Dihydropyridine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel II | |
| DE2508181A1 (de) | 1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2228363A1 (de) | 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210633A1 (de) | Neue brueckenkopfheterocyclen, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2248150A1 (de) | Dihydropyridinpolyester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210674C3 (de) | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2117573A1 (de) | Verfahren zur Herstellung von neuen unsymmetrischen 1,4-Dihydropyridindicarbonsäureestern, sowie ihre Verwendung als Arzneimittel | |
| DE2841667A1 (de) | Fluorhaltige 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210667A1 (de) | Kondensiert aromatisch substituierte 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2335466A1 (de) | Alkoxyalkyl-1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2242786A1 (de) | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel | |
| EP0010130B1 (de) | Sila-substituierte 1,4-Dihydropyridinderivate, Verfahren zu ihrer Herstellung, Arzneimittel und Verfahren zu deren Herstellung | |
| DE2639257A1 (de) | Aminoalkylidenamino-1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2658804A1 (de) | Kreislaufbeeinflussende mittel | |
| DE2239815C2 (de) | 2-Alkylamino-dihydropyridine, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| DE2406198A1 (de) | Verfahren zur herstellung von neuen 2-amino-6-dialkylaminodihydropyridinen und ihre verwendung als arzneimittel | |
| DE2210687A1 (de) | Verfahren zur herstellung von neuen 2,6-diamino-dihydropyridinen sowie ihre verwendung als arzneimittel | |
| DE2616995A1 (de) | 1.4-dihydropyridine mit schwefelhaltigen substituenten mehrere verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2242787A1 (de) | Verfahren zur herstellung von neuen 3,4-dihydropyridonen sowie ihre verwendung als arzneimittel | |
| EP0042093A2 (de) | 4-Aralkyl-1,4-dihydropyridine, Verfahren zu deren Herstellung, ihre Verwendung in Arzneimitteln sowie deren Herstellung | |
| DE2616991A1 (de) | Heterocyclisch-substituierte schwefelhaltige dihydropyridine, mehrere verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2844595A1 (de) | Acylaminodihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |