DE2228744B2 - Elektroempf indlicher Auf zeichnu ngsträger - Google Patents
Elektroempf indlicher Auf zeichnu ngsträgerInfo
- Publication number
- DE2228744B2 DE2228744B2 DE2228744A DE2228744A DE2228744B2 DE 2228744 B2 DE2228744 B2 DE 2228744B2 DE 2228744 A DE2228744 A DE 2228744A DE 2228744 A DE2228744 A DE 2228744A DE 2228744 B2 DE2228744 B2 DE 2228744B2
- Authority
- DE
- Germany
- Prior art keywords
- layer
- recording
- recording medium
- layers
- electrode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003086 colorant Substances 0.000 claims description 9
- 230000006378 damage Effects 0.000 claims description 6
- 229920003002 synthetic resin Polymers 0.000 claims description 4
- 239000000057 synthetic resin Substances 0.000 claims description 4
- 101100400378 Mus musculus Marveld2 gene Proteins 0.000 claims description 3
- 239000012876 carrier material Substances 0.000 claims description 2
- 239000000843 powder Substances 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000004065 semiconductor Substances 0.000 claims 1
- 239000004071 soot Substances 0.000 claims 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 239000011248 coating agent Substances 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 5
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 229910052787 antimony Inorganic materials 0.000 description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 3
- 230000003628 erosive effect Effects 0.000 description 3
- 239000010408 film Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000011669 selenium Substances 0.000 description 3
- 229910052711 selenium Inorganic materials 0.000 description 3
- 239000010409 thin film Substances 0.000 description 3
- 229910052718 tin Inorganic materials 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000976 ink Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000007747 plating Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- 238000007738 vacuum evaporation Methods 0.000 description 2
- 238000007740 vapor deposition Methods 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 208000034656 Contusions Diseases 0.000 description 1
- 238000002679 ablation Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 208000034526 bruise Diseases 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/24—Ablative recording, e.g. by burning marks; Spark recording
- B41M5/245—Electroerosion or spark recording
Landscapes
- Heat Sensitive Colour Forming Recording (AREA)
- Thermal Transfer Or Thermal Recording In General (AREA)
- Color Printing (AREA)
- Printers Or Recording Devices Using Electromagnetic And Radiation Means (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4183771 | 1971-06-13 | ||
| JP5882071A JPS4825541A (OSRAM) | 1971-08-04 | 1971-08-04 | |
| JP9830371A JPS4863735A (OSRAM) | 1971-12-07 | 1971-12-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2228744A1 DE2228744A1 (de) | 1972-12-21 |
| DE2228744B2 true DE2228744B2 (de) | 1975-07-10 |
Family
ID=27290968
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2228744A Pending DE2228744B2 (de) | 1971-06-13 | 1972-06-13 | Elektroempf indlicher Auf zeichnu ngsträger |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3789425A (OSRAM) |
| CA (1) | CA950424A (OSRAM) |
| DE (1) | DE2228744B2 (OSRAM) |
| FR (1) | FR2142406A5 (OSRAM) |
| GB (1) | GB1371683A (OSRAM) |
| NL (1) | NL7207943A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3322027A1 (de) * | 1983-06-18 | 1984-12-20 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Elektrosensitives papier |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4937650A (OSRAM) * | 1972-08-08 | 1974-04-08 | ||
| CA990953A (en) * | 1972-11-30 | 1976-06-15 | Kimiaki Yoshino | Electrorecording sheet |
| GB1468067A (en) * | 1973-03-26 | 1977-03-23 | Canon Kk | Image recording member |
| DE2429729C3 (de) * | 1973-06-22 | 1978-08-24 | Canon K.K., Tokio | Biidaufzeichnungsmaterial |
| JPS5413993B2 (OSRAM) * | 1973-08-17 | 1979-06-04 | ||
| DE2344654B2 (de) * | 1973-09-05 | 1976-05-20 | Robert Bosch Gmbh, 7000 Stuttgart | Registriermetallpapier und verfahren zu dessen herstellung |
| US3920873A (en) * | 1973-11-09 | 1975-11-18 | Arthur D Diamond | Electrosensitive recording media |
| JPS569565Y2 (OSRAM) * | 1974-08-02 | 1981-03-03 | ||
| US4042936A (en) * | 1975-07-29 | 1977-08-16 | Fuji Xerox Co., Ltd. | Electrosensitive recording method |
| US4097637A (en) * | 1976-03-29 | 1978-06-27 | A. B. Dick Company | Latent imaging master |
| DE2747485A1 (de) * | 1977-10-22 | 1979-04-26 | Bosch Gmbh Robert | Aufzeichnungstraeger fuer registriergeraete |
| US4308314A (en) * | 1978-08-04 | 1981-12-29 | Sekisui Kagaku Kogyo Kabushiki Kaisha | Electric recording material |
| US4319255A (en) * | 1979-12-14 | 1982-03-09 | International Business Machines Corporation | Tinted metallized recording medium |
| DE3001884A1 (de) * | 1980-01-19 | 1981-07-23 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Aufzeichnungstraeger und verfahren zum beschriften des aufzeichnungstraegers |
| DE3069983D1 (en) * | 1980-10-24 | 1985-02-28 | Bosch Gmbh Robert | Method and recording member coated with an electro-sensitive layer recording colored information and reproducing originals |
| US4462038A (en) * | 1981-01-06 | 1984-07-24 | Robert Bosch Gmbh | Multicolor recording carrier and method of recording |
| US4459604A (en) * | 1981-01-06 | 1984-07-10 | Robert Bosch Gmbh | Multicolor recording carrier and method of recording |
| US4643454A (en) * | 1986-01-14 | 1987-02-17 | Astro-Med, Inc. | Lottery ticket |
| US4850618A (en) * | 1986-05-13 | 1989-07-25 | Halladay Incorporated | Lottery ticket |
| US9234081B2 (en) | 2010-06-08 | 2016-01-12 | King Abdulaziz City For Science And Technology | Method of manufacturing a nitro blue tetrazolium and polyvinyl butyral based dosimeter film |
| US9932959B2 (en) | 2011-03-10 | 2018-04-03 | King Abdulaziz City For Science And Technology | Shrounded wind turbine configuration with nozzle augmented diffuser |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3263604A (en) * | 1962-01-12 | 1966-08-02 | Timefax Corp | Electro-responsive blanks |
| US3434878A (en) * | 1964-10-26 | 1969-03-25 | Hewlett Packard Co | Method of forming a multicolor electrosensitive recording medium and article |
-
1972
- 1972-06-06 GB GB2638772A patent/GB1371683A/en not_active Expired
- 1972-06-08 CA CA144,241,A patent/CA950424A/en not_active Expired
- 1972-06-09 US US00261392A patent/US3789425A/en not_active Expired - Lifetime
- 1972-06-12 NL NL7207943A patent/NL7207943A/xx unknown
- 1972-06-13 DE DE2228744A patent/DE2228744B2/de active Pending
- 1972-06-13 FR FR7221202A patent/FR2142406A5/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3322027A1 (de) * | 1983-06-18 | 1984-12-20 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Elektrosensitives papier |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2228744A1 (de) | 1972-12-21 |
| GB1371683A (en) | 1974-10-23 |
| FR2142406A5 (OSRAM) | 1973-01-26 |
| US3789425A (en) | 1974-01-29 |
| CA950424A (en) | 1974-07-02 |
| NL7207943A (OSRAM) | 1972-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2228744B2 (de) | Elektroempf indlicher Auf zeichnu ngsträger | |
| DE3586742T2 (de) | Fluessigkristall-mehrfarbenanzeigevorrichtung. | |
| DE2553643C3 (de) | Dickschicht-Hybridschaltung | |
| DE3130324A1 (de) | Traegerelement fuer einen ic-baustein | |
| DE1964836A1 (de) | Raster aus Lichtventilen sowie Verfahren zu seiner Herstellung | |
| DE2758142C2 (de) | Verfahren zur Herstellung von Ladeplatten | |
| DE19738531A1 (de) | Auf Druck ansprechender Widerstand | |
| DE2602194A1 (de) | Thermischer drucktraeger | |
| DE3222847C2 (de) | Aufzeichnungsvorrichtung | |
| DE1446655C3 (OSRAM) | ||
| DE3751396T2 (de) | Thermischer Kopf. | |
| DE2648403A1 (de) | Vielfach-blitzlampenanordnung | |
| DE2357127C3 (de) | Anordnung zur Funkenunterdrückung für einen Gleichstrommotor geringer Größe | |
| DE1472945B2 (de) | Elektrographisches Aufzeichnungsmaterial | |
| DE2638775A1 (de) | Elektrochrome anzeigeeinheit und verfahren zu ihrer herstellung | |
| DE1965460C3 (de) | Verfahren und Vorrichtung zur photoelektrophoretischen Bilderzeugung | |
| DE1011722B (de) | Elektroempfindlicher, vervielfaeltigungsfaehiger Aufzeichnungstraeger | |
| DE3812030A1 (de) | Fluessigkristallanzeigevorrichtung | |
| DE2163092C3 (de) | Kathodenstrahl-Aufzeichnungsröhre | |
| DE2832178A1 (de) | Verfahren zur elektrographischen aufzeichnung und elektrographisches aufzeichnungselement | |
| DE1949120C3 (de) | Photoelektrophoretisches Abbildungsverfahren | |
| DE2061752A1 (de) | Elektrophotographischer Aufzeichnungs trager mit Halbton Raster | |
| DE2303814C3 (de) | Elektrisch empfindliches Trockenregistriermaterial | |
| DE3012161A1 (de) | Verfahren zur herstellung eines temperaturbestaendigen maskenmittels, entsprechend diesem verfahren erhaltenes maskenmittel sowie verwendung desselben | |
| DE1472945C3 (de) | Elektrographisches Aufzeichnungsmaterial |