DE2228474A1 - Neue bicycloalkan-derivate - Google Patents
Neue bicycloalkan-derivateInfo
- Publication number
- DE2228474A1 DE2228474A1 DE2228474A DE2228474A DE2228474A1 DE 2228474 A1 DE2228474 A1 DE 2228474A1 DE 2228474 A DE2228474 A DE 2228474A DE 2228474 A DE2228474 A DE 2228474A DE 2228474 A1 DE2228474 A1 DE 2228474A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- 7ass
- tert
- tetrahydroindan
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 hydroxy methylene group Chemical group 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 150000001298 alcohols Chemical class 0.000 claims description 7
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical compound C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 41
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000012043 crude product Substances 0.000 description 12
- 239000012230 colorless oil Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Natural products CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 238000005907 ketalization reaction Methods 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical class [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 150000003431 steroids Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- LDRDSZBEUAPYIR-UHFFFAOYSA-N 1,2,3,6,7,7a-hexahydroinden-5-one Chemical compound O=C1CCC2CCCC2=C1 LDRDSZBEUAPYIR-UHFFFAOYSA-N 0.000 description 2
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 2
- UWNADWZGEHDQAB-UHFFFAOYSA-N 2,5-dimethylhexane Chemical group CC(C)CCC(C)C UWNADWZGEHDQAB-UHFFFAOYSA-N 0.000 description 2
- RHLVCLIPMVJYKS-UHFFFAOYSA-N 3-octanone Chemical compound CCCCCC(=O)CC RHLVCLIPMVJYKS-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L magnesium sulphate Substances [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 150000003509 tertiary alcohols Chemical class 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- FSUBUYXKSKDDHL-UHFFFAOYSA-N 1,2,3,3a,4,6,7,7a-octahydroinden-5-one Chemical compound C1C(=O)CCC2CCCC21 FSUBUYXKSKDDHL-UHFFFAOYSA-N 0.000 description 1
- DSKYQBGMBNTKKM-UHFFFAOYSA-N 1,2,3,4-tetrahydroinden-5-one Chemical compound C1=CC(=O)CC2=C1CCC2 DSKYQBGMBNTKKM-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 description 1
- XAEBTCPOZVEMHR-UHFFFAOYSA-N 2-methylpropan-2-ol;potassium Chemical compound [K].CC(C)(C)O XAEBTCPOZVEMHR-UHFFFAOYSA-N 0.000 description 1
- GSVQWRYRPRJOIM-UHFFFAOYSA-N 2-methylpropan-2-ol;sodium Chemical compound [Na].CC(C)(C)O GSVQWRYRPRJOIM-UHFFFAOYSA-N 0.000 description 1
- KRTGJZMJJVEKRX-UHFFFAOYSA-N 2-phenylethan-1-yl Chemical compound [CH2]CC1=CC=CC=C1 KRTGJZMJJVEKRX-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- DDGKTVGLVOCFDX-UHFFFAOYSA-N 7-chloroocta-1,6-dien-3-one Chemical compound CC(Cl)=CCCC(=O)C=C DDGKTVGLVOCFDX-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000003810 Jones reagent Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- PQMNUTBDGTXYCK-UHFFFAOYSA-N O1CCCC1.C(=C)Cl Chemical compound O1CCCC1.C(=C)Cl PQMNUTBDGTXYCK-UHFFFAOYSA-N 0.000 description 1
- VNQABZCSYCTZMS-UHFFFAOYSA-N Orthoform Chemical compound COC(=O)C1=CC=C(O)C(N)=C1 VNQABZCSYCTZMS-UHFFFAOYSA-N 0.000 description 1
- AGZVMFHCESVRRI-UHFFFAOYSA-N [Na].CC(C)O Chemical compound [Na].CC(C)O AGZVMFHCESVRRI-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical compound [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- WSZBQAJODIQDLM-UHFFFAOYSA-N ethyl 7-chloro-5-oxoheptanoate Chemical compound CCOC(=O)CCCC(=O)CCCl WSZBQAJODIQDLM-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2228474A DE2228474A1 (de) | 1972-06-08 | 1972-06-08 | Neue bicycloalkan-derivate |
| DK557572A DK141993C (da) | 1972-06-08 | 1972-11-09 | Fremgangsmaade til fremstilling af 4-substitueret alkyl-5,6,7,7a-tetrahydroindan-5-oner eller 5-substitueret alkyl-1,2,3,4,8,8a-hexahydro-6(7h)-naftalenoner |
| ES415399A ES415399A1 (es) | 1972-06-08 | 1973-05-30 | Procedimiento para la preparacion de derivados de biciclo- alcano. |
| AU56424/73A AU476686B2 (en) | 1972-06-08 | 1973-06-01 | New bicycloalkane derivatives |
| DD171355A DD108067A5 (de) | 1972-06-08 | 1973-06-06 | Verfahren zur herstellung neuer bicycloalkan-derivate |
| CS4145A CS166169B2 (OSRAM) | 1972-06-08 | 1973-06-07 | |
| HUSC432A HU167673B (OSRAM) | 1972-06-08 | 1973-06-07 | |
| AT500373A AT324298B (de) | 1972-06-08 | 1973-06-07 | Verfahren zur herstellung von neuen substituierten bicycloalkenonen |
| IL42452A IL42452A (en) | 1972-06-08 | 1973-06-07 | 5,6,7,7a-tetrahydroindanone derivatives |
| GB2723573A GB1431819A (en) | 1972-06-08 | 1973-06-07 | Bicycloalkane derivatives |
| AR248481A AR202894A1 (es) | 1972-06-08 | 1973-06-08 | Nuevos derivados de 5,6,7,7a-tetrahidroindan-5-onas constitutivos de valiosos productos intermedios desprovistos de actividad terapeutica para la sintesis total de esteroides y procedimiento para su produccion |
| CH836373A CH579521A5 (OSRAM) | 1972-06-08 | 1973-06-08 | |
| NL7308078A NL7308078A (OSRAM) | 1972-06-08 | 1973-06-08 | |
| IE942/73A IE37778B1 (en) | 1972-06-08 | 1973-06-08 | New bicycloalkane derivatives |
| CA173,639A CA1003843A (en) | 1972-06-08 | 1973-06-08 | Bicycloalkane derivatives |
| BE132101A BE800716A (fr) | 1972-06-08 | 1973-06-08 | Nouveaux derives de dicycloalkane et leur procede de preparation |
| FR7320952A FR2187749B1 (OSRAM) | 1972-06-08 | 1973-06-08 | |
| ZA733898A ZA733898B (en) | 1972-06-08 | 1973-06-08 | New bicycloalkane derivatives |
| SE7601079A SE7601079L (sv) | 1972-06-08 | 1976-02-02 | Sett att framstella nya bicykloalkan-derivat |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2228474A DE2228474A1 (de) | 1972-06-08 | 1972-06-08 | Neue bicycloalkan-derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2228474A1 true DE2228474A1 (de) | 1973-12-20 |
Family
ID=5847484
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2228474A Withdrawn DE2228474A1 (de) | 1972-06-08 | 1972-06-08 | Neue bicycloalkan-derivate |
Country Status (19)
| Country | Link |
|---|---|
| AR (1) | AR202894A1 (OSRAM) |
| AT (1) | AT324298B (OSRAM) |
| AU (1) | AU476686B2 (OSRAM) |
| BE (1) | BE800716A (OSRAM) |
| CA (1) | CA1003843A (OSRAM) |
| CH (1) | CH579521A5 (OSRAM) |
| CS (1) | CS166169B2 (OSRAM) |
| DD (1) | DD108067A5 (OSRAM) |
| DE (1) | DE2228474A1 (OSRAM) |
| DK (1) | DK141993C (OSRAM) |
| ES (1) | ES415399A1 (OSRAM) |
| FR (1) | FR2187749B1 (OSRAM) |
| GB (1) | GB1431819A (OSRAM) |
| HU (1) | HU167673B (OSRAM) |
| IE (1) | IE37778B1 (OSRAM) |
| IL (1) | IL42452A (OSRAM) |
| NL (1) | NL7308078A (OSRAM) |
| SE (1) | SE7601079L (OSRAM) |
| ZA (1) | ZA733898B (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4158012A (en) * | 1978-06-19 | 1979-06-12 | Syntex (U.S.A.) Inc. | Steroid synthesis process using mixed anhydride |
-
1972
- 1972-06-08 DE DE2228474A patent/DE2228474A1/de not_active Withdrawn
- 1972-11-09 DK DK557572A patent/DK141993C/da active
-
1973
- 1973-05-30 ES ES415399A patent/ES415399A1/es not_active Expired
- 1973-06-01 AU AU56424/73A patent/AU476686B2/en not_active Expired
- 1973-06-06 DD DD171355A patent/DD108067A5/xx unknown
- 1973-06-07 GB GB2723573A patent/GB1431819A/en not_active Expired
- 1973-06-07 CS CS4145A patent/CS166169B2/cs unknown
- 1973-06-07 IL IL42452A patent/IL42452A/en unknown
- 1973-06-07 AT AT500373A patent/AT324298B/de not_active IP Right Cessation
- 1973-06-07 HU HUSC432A patent/HU167673B/hu unknown
- 1973-06-08 CA CA173,639A patent/CA1003843A/en not_active Expired
- 1973-06-08 CH CH836373A patent/CH579521A5/xx not_active IP Right Cessation
- 1973-06-08 AR AR248481A patent/AR202894A1/es active
- 1973-06-08 FR FR7320952A patent/FR2187749B1/fr not_active Expired
- 1973-06-08 ZA ZA733898A patent/ZA733898B/xx unknown
- 1973-06-08 IE IE942/73A patent/IE37778B1/xx unknown
- 1973-06-08 BE BE132101A patent/BE800716A/xx unknown
- 1973-06-08 NL NL7308078A patent/NL7308078A/xx not_active Application Discontinuation
-
1976
- 1976-02-02 SE SE7601079A patent/SE7601079L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE800716A (fr) | 1973-12-10 |
| IE37778B1 (en) | 1977-10-12 |
| GB1431819A (en) | 1976-04-14 |
| ZA733898B (en) | 1974-05-29 |
| AT324298B (de) | 1975-08-25 |
| IE37778L (en) | 1973-12-08 |
| CA1003843A (en) | 1977-01-18 |
| NL7308078A (OSRAM) | 1973-12-11 |
| CS166169B2 (OSRAM) | 1976-01-29 |
| FR2187749A1 (OSRAM) | 1974-01-18 |
| FR2187749B1 (OSRAM) | 1976-11-12 |
| AU5642473A (en) | 1974-12-05 |
| SE7601079L (sv) | 1976-02-02 |
| DD108067A5 (de) | 1974-09-05 |
| DK141993B (da) | 1980-08-04 |
| DK141993C (da) | 1980-12-15 |
| IL42452A0 (en) | 1973-08-29 |
| AU476686B2 (en) | 1976-09-30 |
| ES415399A1 (es) | 1976-02-16 |
| HU167673B (OSRAM) | 1975-11-28 |
| CH579521A5 (OSRAM) | 1976-09-15 |
| AR202894A1 (es) | 1975-07-31 |
| IL42452A (en) | 1977-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2652256C2 (de) | Polyprenylalkohole und diese enthaltende pharmazeutische Zusammensetzungen | |
| DE2943776A1 (de) | 17 (alpha) -alkylsteroide, diese enthaltende praeparate sowie verfahren zu ihrer herstellung | |
| EP0572489B1 (de) | Ausgangsverbindungen zur herstellung von calcitriol sowie dessen abkömmlingen, verfahren zur herstellung dieser ausgangsverbindungen sowie zwischenprodukte für dieses verfahren | |
| DE1958608A1 (de) | Verfahren zur Herstellung von Benzindenen | |
| DE2932925C2 (OSRAM) | ||
| DE2160066A1 (de) | Neue benzopyran-derivate | |
| DE2423485A1 (de) | Bicyclooctan-derivate | |
| DE2315355A1 (de) | Verfahren zur herstellung von oximen | |
| DE2228474A1 (de) | Neue bicycloalkan-derivate | |
| EP0201452B1 (de) | Verfahren zur Herstellung von 17alpha-Ethinyl-17beta-hydroxy-18-methyl-4,15-estradien-3-on und die neuen Ausgangsverbindungen für dieses Verfahren | |
| DE2253089C2 (de) | 9-Oxo-9,10,seco-östran-Derivate und Verfahren zur Herstellung dieser Verbindungen und von 9-Oxo-D-homo-9,10-seco-östran-Derivaten | |
| DE2729846C2 (de) | Verfahren zur Herstellung von in 3-Stellung alkylsubstituierten cis-1-Hydroxy-6,6-dimethyl-6,6a,7,8,10,10a-hexahydro-9H-dibenzo [b,d] pyran-9-onen | |
| DE1618507C3 (de) | desA-Steroiden und Verfahren zu deren Herstellung | |
| DE2331997A1 (de) | Verfahren zur herstellung von bicycloalkan-derivaten | |
| DE2212589C3 (de) | Verfahren zur Herstellung von 13 beta-R-4,9,11-gonatrienen und 13 beta-R-4,5-seco-9,l 1-gonadiene als Z wise henproduk te | |
| EP0037973B1 (de) | Verfahren zur Synthese von Östron bzw. Östronderivaten | |
| DE2729634A1 (de) | Verfahren zur herstellung von 1alpha-hydroxy-cholesterinderivaten | |
| DE2749104C2 (de) | Verfahren zur Herstellung von δ↑15↑ -Steroiden | |
| DE1593348C3 (de) | Verfahren zur Herstellung von 19-Fluorsteroidepoxyden und 19-Fluor-11,19epoxysteroide | |
| DE1618871B2 (de) | Verfahren zur herstellung eines steroidketonderivates | |
| AT271753B (de) | Verfahren zur Herstellung von neuen desA-Steroiden | |
| DE1966921C3 (de) | 17 alpha-propadienylsubstituierte 3-Ketosteroide und Verfahren zu deren Herstellung | |
| DE2130052A1 (de) | Neue bicycloalkanderivate | |
| DE2253088C2 (de) | 9-Hydroxy-9,10-seco-östran-Derivate und Verfahren zur Herstellung dieser Verbindungen und von 9-Hydroxy-9,10-seco-D-homo-östran-Derivaten | |
| DE2023401A1 (de) | Polycyclische Verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |