DE2225448A1 - Verfahren /ur Herstellung von ter tiaren Aminmonoimiden - Google Patents
Verfahren /ur Herstellung von ter tiaren AminmonoimidenInfo
- Publication number
- DE2225448A1 DE2225448A1 DE19722225448 DE2225448A DE2225448A1 DE 2225448 A1 DE2225448 A1 DE 2225448A1 DE 19722225448 DE19722225448 DE 19722225448 DE 2225448 A DE2225448 A DE 2225448A DE 2225448 A1 DE2225448 A1 DE 2225448A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- group
- oxirane
- compound
- hydrazide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 23
- 238000002360 preparation method Methods 0.000 title claims description 5
- 150000003512 tertiary amines Chemical class 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 14
- CABDEMAGSHRORS-UHFFFAOYSA-N oxirane;hydrate Chemical group O.C1CO1 CABDEMAGSHRORS-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- -1 methacrylyl group Chemical group 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000002253 acid Substances 0.000 description 6
- 150000002924 oxiranes Chemical class 0.000 description 5
- 239000002904 solvent Substances 0.000 description 4
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- ZWAJLVLEBYIOTI-UHFFFAOYSA-N cyclohexene oxide Chemical compound C1CCCC2OC21 ZWAJLVLEBYIOTI-UHFFFAOYSA-N 0.000 description 3
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohexene oxide Natural products O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000000466 oxiranyl group Chemical group 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QBJWYMFTMJFGOL-UHFFFAOYSA-N 2-hexadecyloxirane Chemical compound CCCCCCCCCCCCCCCCC1CO1 QBJWYMFTMJFGOL-UHFFFAOYSA-N 0.000 description 1
- AAMHBRRZYSORSH-UHFFFAOYSA-N 2-octyloxirane Chemical compound CCCCCCCCC1CO1 AAMHBRRZYSORSH-UHFFFAOYSA-N 0.000 description 1
- QMIBIXKZPBEGTE-UHFFFAOYSA-N 2-tridecyloxirane Chemical compound CCCCCCCCCCCCCC1CO1 QMIBIXKZPBEGTE-UHFFFAOYSA-N 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- NZNQMPZXPUKVSQ-UHFFFAOYSA-N [O].C1CO1 Chemical group [O].C1CO1 NZNQMPZXPUKVSQ-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000036962 time dependent Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/35—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/36—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of an acyclic saturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00148164A US3850969A (en) | 1971-05-28 | 1971-05-28 | Process for the preparation of hydroxy substituted aminimides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2225448A1 true DE2225448A1 (de) | 1972-11-30 |
Family
ID=22524578
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722225448 Pending DE2225448A1 (de) | 1971-05-28 | 1972-05-25 | Verfahren /ur Herstellung von ter tiaren Aminmonoimiden |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3850969A (https=) |
| JP (1) | JPS5215562B1 (https=) |
| BE (1) | BE781330A (https=) |
| CA (1) | CA973565A (https=) |
| DE (1) | DE2225448A1 (https=) |
| FR (1) | FR2139859B1 (https=) |
| GB (1) | GB1338194A (https=) |
| IT (1) | IT967057B (https=) |
| NL (1) | NL7207159A (https=) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3962305A (en) * | 1974-02-04 | 1976-06-08 | Stauffer Chemical Company | Acylformanidine thiocarbamates |
| US3985807A (en) * | 1975-03-31 | 1976-10-12 | Ashland Oil, Inc. | Alkoxy derivatives of hydroxy aminimides |
| US4379019A (en) * | 1980-09-08 | 1983-04-05 | Pool Dan L | Masking machine |
| US4824996A (en) * | 1986-08-12 | 1989-04-25 | American Home Products Corporation | Phospholipase A2 inhibitors |
| US5705585A (en) | 1993-06-30 | 1998-01-06 | Arqule, Inc. | Aminimide-containing molecules and materials as molecular recognition agents |
| AU704878B2 (en) * | 1994-01-05 | 1999-05-06 | Arqule, Inc. | Method of making polymers having specific properties |
| US7034110B2 (en) | 1994-01-05 | 2006-04-25 | Arqule, Inc. | Method of identifying chemical compounds having selected properties for a particular application |
| US5734082A (en) * | 1994-10-20 | 1998-03-31 | Arqule Inc. | Hydroxyethyl aminimides |
| US5712171A (en) * | 1995-01-20 | 1998-01-27 | Arqule, Inc. | Method of generating a plurality of chemical compounds in a spatially arranged array |
| AU5438796A (en) * | 1995-04-06 | 1996-10-23 | Arqule, Inc. | Method for rapid purification, analysis and characterization of collections of chemical compounds |
| US5962412A (en) * | 1996-06-10 | 1999-10-05 | Arqule, Inc. | Method of making polymers having specific properties |
-
1971
- 1971-05-28 US US00148164A patent/US3850969A/en not_active Expired - Lifetime
-
1972
- 1972-01-27 CA CA133,261A patent/CA973565A/en not_active Expired
- 1972-01-31 IT IT20038/72A patent/IT967057B/it active
- 1972-02-17 GB GB748372A patent/GB1338194A/en not_active Expired
- 1972-03-28 BE BE781330A patent/BE781330A/xx unknown
- 1972-05-04 FR FR727215972A patent/FR2139859B1/fr not_active Expired
- 1972-05-25 DE DE19722225448 patent/DE2225448A1/de active Pending
- 1972-05-26 NL NL7207159A patent/NL7207159A/xx not_active Application Discontinuation
- 1972-05-27 JP JP47052905A patent/JPS5215562B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BE781330A (fr) | 1972-07-17 |
| FR2139859B1 (https=) | 1973-07-13 |
| NL7207159A (https=) | 1972-11-30 |
| FR2139859A1 (https=) | 1973-01-12 |
| US3850969A (en) | 1974-11-26 |
| CA973565A (en) | 1975-08-26 |
| JPS5215562B1 (https=) | 1977-04-30 |
| GB1338194A (en) | 1973-11-21 |
| IT967057B (it) | 1974-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0093962A1 (de) | 2-(3-Iod-2-propinyloxy)-ethanol-carbamate, ihre Herstellung und ihre Verwendung als antimikrobielle Substanzen | |
| DE1906264B2 (de) | Verfahren zur Herstellung von Aminimiden | |
| DE2225448A1 (de) | Verfahren /ur Herstellung von ter tiaren Aminmonoimiden | |
| DE1645919B2 (de) | Neue Trisamino-s-triazine | |
| DE3733755C2 (https=) | ||
| EP0025961B1 (de) | Verfahren zur Herstellung von 1,2-Diolen höherer Kohlenstoffzahl | |
| DE1914032A1 (de) | Hydroxyaminimine und Verfahren zu ihrer Herstellung | |
| DE2009960C3 (de) | Jodierte Formalverbindungen, Verfahren zu ihrer Herstellung und Verwendung derselben | |
| DE2512514C2 (de) | Verfahren zur Herstellung von aliphatischen Isocyanaten | |
| DE3824457C2 (de) | Verfahren zur Herstellung von 2- (4-Chlorphenyl-ethyl) -2- tert.-butyl-oxiran | |
| DE1618985B2 (de) | 4-acetoxy-alkylbenzylidenmalonsaeuredinitrile, verfahren zu ihrer herstellung und sie enthaltende fungizide mittel | |
| EP0491127A1 (de) | 3-(Hexenyloxy)-propan-nitrile, deren Herstellung und deren Verwendung | |
| DE3002838B1 (de) | Verfahren zur Herstellung von 1,2-Epoxy-5,9-cyclododecadien | |
| DE2023791A1 (de) | Epoxidierte Geranylester und deren Verwendung in Insektenbekämpfungsmitteln | |
| DE1149363B (de) | Verfahren zur Herstellung von quarternaeren Verbindungen | |
| EP0601138B1 (de) | Verfahren zur herstellung von 5-alkoxy-2,4-dinitroalkylbenzolen | |
| DE68921497T2 (de) | Isomerisierungsverfahren. | |
| DD258802A5 (de) | Herstellung von monochloropinacolon | |
| DE1298092B (de) | Arylthiocarbamate | |
| DE2012219A1 (de) | Substituierte Benzimidazole | |
| DE2515581C2 (de) | Verfahren zum Herstellen von tert.-Butylglycidyläther | |
| DE1543761C (de) | Verfahren zur Herstellung von substituierten 1,4 Dioxan onen (5) | |
| DE1568001C3 (de) | Verfahren zur Herstellung von Epoxyden | |
| DE1920499C3 (de) | Verfahren zur Herstellung von Nitriliumchlorosulfaten und einige Nitriliumchlorosulfate | |
| DE1643784C (de) | Biologisch wirksame Isothiocyanate und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| OHW | Rejection |