DE2224255A1 - Sauer modifizierte polyterephthalsaeureester - Google Patents
Sauer modifizierte polyterephthalsaeureesterInfo
- Publication number
- DE2224255A1 DE2224255A1 DE19722224255 DE2224255A DE2224255A1 DE 2224255 A1 DE2224255 A1 DE 2224255A1 DE 19722224255 DE19722224255 DE 19722224255 DE 2224255 A DE2224255 A DE 2224255A DE 2224255 A1 DE2224255 A1 DE 2224255A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- general formula
- carbon atoms
- straight
- terephthalic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002253 acid Substances 0.000 title claims description 7
- 150000002148 esters Chemical class 0.000 title description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 20
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical class OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 18
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000002009 diols Chemical class 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 claims description 8
- 229920001634 Copolyester Polymers 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 7
- 239000000155 melt Substances 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 4
- 150000002334 glycols Chemical class 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 230000007717 exclusion Effects 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims 1
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000981 basic dye Substances 0.000 description 4
- -1 carbomethoxy Chemical group 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000006068 polycondensation reaction Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- SYRQBFQAGZOPBM-UHFFFAOYSA-N 3,3-dihydroxy-2-methylpropane-1-sulfonic acid Chemical class CC(CS(=O)(=O)O)C(O)O SYRQBFQAGZOPBM-UHFFFAOYSA-N 0.000 description 2
- QNVNLUSHGRBCLO-UHFFFAOYSA-N 5-hydroxybenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=CC(O)=CC(C(O)=O)=C1 QNVNLUSHGRBCLO-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium dioxide Chemical compound O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004246 zinc acetate Substances 0.000 description 2
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N dimethylethyleneglycol Natural products CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940119177 germanium dioxide Drugs 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- AGFGXVAAIXIOFZ-UHFFFAOYSA-L zinc;butanedioate Chemical compound [Zn+2].[O-]C(=O)CCC([O-])=O AGFGXVAAIXIOFZ-UHFFFAOYSA-L 0.000 description 1
- NHXVNEDMKGDNPR-UHFFFAOYSA-N zinc;pentane-2,4-dione Chemical compound [Zn+2].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O NHXVNEDMKGDNPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/688—Polyesters containing atoms other than carbon, hydrogen and oxygen containing sulfur
- C08G63/6884—Polyesters containing atoms other than carbon, hydrogen and oxygen containing sulfur derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6886—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Polyesters Or Polycarbonates (AREA)
- Artificial Filaments (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722224255 DE2224255A1 (de) | 1972-05-18 | 1972-05-18 | Sauer modifizierte polyterephthalsaeureester |
| DD17074973A DD107298A5 (OSRAM) | 1972-05-18 | 1973-05-10 | |
| BE131154A BE799585A (fr) | 1972-05-18 | 1973-05-16 | Polyesters d'acide terephtalique modifies acides, |
| IT2420173A IT987655B (it) | 1972-05-18 | 1973-05-16 | Esteri dell acido politereftali co modificati acidi |
| NL7306903A NL7306903A (OSRAM) | 1972-05-18 | 1973-05-17 | |
| ES414825A ES414825A1 (es) | 1972-05-18 | 1973-05-17 | Procedimiento para preparar copoliesteres del acido teref- talico. |
| FR7318173A FR2185041B1 (OSRAM) | 1972-05-18 | 1973-05-18 | |
| JP5482073A JPS4948783A (OSRAM) | 1972-05-18 | 1973-05-18 | |
| GB2377773A GB1397189A (en) | 1972-05-18 | 1973-05-18 | Acid-modified polyterephthalic acid esters |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722224255 DE2224255A1 (de) | 1972-05-18 | 1972-05-18 | Sauer modifizierte polyterephthalsaeureester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2224255A1 true DE2224255A1 (de) | 1973-11-29 |
Family
ID=5845227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722224255 Pending DE2224255A1 (de) | 1972-05-18 | 1972-05-18 | Sauer modifizierte polyterephthalsaeureester |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS4948783A (OSRAM) |
| BE (1) | BE799585A (OSRAM) |
| DD (1) | DD107298A5 (OSRAM) |
| DE (1) | DE2224255A1 (OSRAM) |
| ES (1) | ES414825A1 (OSRAM) |
| FR (1) | FR2185041B1 (OSRAM) |
| GB (1) | GB1397189A (OSRAM) |
| IT (1) | IT987655B (OSRAM) |
| NL (1) | NL7306903A (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2318184A1 (fr) * | 1975-07-16 | 1977-02-11 | Rhone Poulenc Ind | Polyesters sulfones hydrosolubles et leur application a l'encollage des fibres textiles |
| JPS5958026A (ja) * | 1982-09-27 | 1984-04-03 | Nippon Synthetic Chem Ind Co Ltd:The | スルホン酸塩基を含有するポリエステルの製造法 |
| JPS59202219A (ja) * | 1983-05-02 | 1984-11-16 | Nippon Synthetic Chem Ind Co Ltd:The | スルホン酸塩基含有ポリエステル樹脂の製造法 |
| JP2507884B2 (ja) * | 1988-05-25 | 1996-06-19 | 工業技術院長 | ポリエステルの製造方法 |
-
1972
- 1972-05-18 DE DE19722224255 patent/DE2224255A1/de active Pending
-
1973
- 1973-05-10 DD DD17074973A patent/DD107298A5/xx unknown
- 1973-05-16 BE BE131154A patent/BE799585A/xx unknown
- 1973-05-16 IT IT2420173A patent/IT987655B/it active
- 1973-05-17 ES ES414825A patent/ES414825A1/es not_active Expired
- 1973-05-17 NL NL7306903A patent/NL7306903A/xx unknown
- 1973-05-18 FR FR7318173A patent/FR2185041B1/fr not_active Expired
- 1973-05-18 GB GB2377773A patent/GB1397189A/en not_active Expired
- 1973-05-18 JP JP5482073A patent/JPS4948783A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| ES414825A1 (es) | 1976-02-01 |
| JPS4948783A (OSRAM) | 1974-05-11 |
| IT987655B (it) | 1975-03-20 |
| FR2185041B1 (OSRAM) | 1977-04-29 |
| DD107298A5 (OSRAM) | 1974-07-20 |
| BE799585A (fr) | 1973-11-16 |
| GB1397189A (en) | 1975-06-11 |
| FR2185041A1 (OSRAM) | 1973-12-28 |
| NL7306903A (OSRAM) | 1973-11-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19513056B4 (de) | Titanhaltige Katalysatoren und Verfahren zur Herstellung von Polyester | |
| DE3139127C2 (de) | Copolyester mit verbesserter Anfärbbarkeit | |
| DE69109679T2 (de) | Verfahren zur Herstellung von Mischungen von Polycarbonat und Poly(1,4-cyclohexandimethylolterephthalat) mit verminderter Vergilbung. | |
| EP1065230A2 (de) | Thermostabile, farbneutrale, antimonfreie Polyester und Verfahren zu deren Herstellung | |
| DE19631068A1 (de) | Verfahren zur Beschleunigung der Polykondensation von Polyester | |
| DE2214775C3 (de) | Verfahren zur Herstellung von Polybutylenterephthalat | |
| DE2224255A1 (de) | Sauer modifizierte polyterephthalsaeureester | |
| CH358236A (de) | Verfahren zur Herstellung von makromolekularen Polymethylenterephthalaten | |
| DE2751585A1 (de) | Verfahren zur herstellung aromatischer ester | |
| DE2121186B2 (de) | 22.10.70 Japan 93095-70 Verfahren zur Herstellung linearer Polyester | |
| DE1570764A1 (de) | Verfahren zur Herstellung hochpolymerer Polymethylenterephthalate | |
| DE1251951C2 (de) | Verfahren zur herstellung linearer faserbildender polyester | |
| DE2224831A1 (de) | Sauer modifizierte terephthalsaeurepolyester | |
| US3882185A (en) | Acid-modified polyterephthalic acid esters | |
| DE2420359A1 (de) | Sauer modifizierte polyester | |
| DE2114236A1 (de) | Modifizierte Polyterephthalsaeureester | |
| DE2426400A1 (de) | Sauer modifizierte polyester | |
| JP2833094B2 (ja) | 改質ポリエステルの製造法 | |
| DE1570627A1 (de) | Verfahren zur Herstellung linearer faserbildender Polyester | |
| DE2544069B2 (de) | Verfahren zur Herstellung von Polyestern | |
| DE1943533A1 (de) | Polyesteramide | |
| DE2441538A1 (de) | Schwerbrennbare terephthalsaeurecopolyester | |
| EP0434923A1 (de) | Verfahren zur Herstellung eines thermoplastisch verarbeitbaren, aromatischen Polyamids | |
| DE1520079C (de) | Verfahren zur Herstellung hochpolymerer Polymethylenterephthalate | |
| DE2417706A1 (de) | Geformte gebilde aus sauer modifizierten polyterephthalsaeureestern |