DE2220540A1 - Reinigungskomposition fuer glas und reflektierende oberflaechen - Google Patents
Reinigungskomposition fuer glas und reflektierende oberflaechenInfo
- Publication number
- DE2220540A1 DE2220540A1 DE2220540A DE2220540A DE2220540A1 DE 2220540 A1 DE2220540 A1 DE 2220540A1 DE 2220540 A DE2220540 A DE 2220540A DE 2220540 A DE2220540 A DE 2220540A DE 2220540 A1 DE2220540 A1 DE 2220540A1
- Authority
- DE
- Germany
- Prior art keywords
- cleaning composition
- composition according
- salt
- copolymer
- anhydride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000203 mixture Substances 0.000 title claims description 41
- 238000004140 cleaning Methods 0.000 title claims description 19
- 150000003839 salts Chemical class 0.000 claims description 25
- 229920001577 copolymer Polymers 0.000 claims description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 21
- 239000004094 surface-active agent Substances 0.000 claims description 19
- 150000008064 anhydrides Chemical class 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 14
- 230000015572 biosynthetic process Effects 0.000 claims description 13
- 239000002585 base Substances 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 8
- 239000000178 monomer Substances 0.000 claims description 8
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 6
- 229920001296 polysiloxane Polymers 0.000 claims description 6
- 125000000129 anionic group Chemical group 0.000 claims description 5
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 5
- 230000003381 solubilizing effect Effects 0.000 claims description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 4
- 239000011976 maleic acid Substances 0.000 claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 3
- 239000011521 glass Substances 0.000 claims description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims 1
- 238000009472 formulation Methods 0.000 description 27
- -1 Polyoxyethylene Polymers 0.000 description 12
- 229910021529 ammonia Inorganic materials 0.000 description 10
- 229920000642 polymer Polymers 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- 239000000463 material Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- 239000011734 sodium Substances 0.000 description 6
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 150000002334 glycols Chemical class 0.000 description 4
- 238000006386 neutralization reaction Methods 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- 239000003595 mist Substances 0.000 description 3
- 230000003472 neutralizing effect Effects 0.000 description 3
- DTCCVIYSGXONHU-CJHDCQNGSA-N (z)-2-(2-phenylethenyl)but-2-enedioic acid Chemical compound OC(=O)\C=C(C(O)=O)\C=CC1=CC=CC=C1 DTCCVIYSGXONHU-CJHDCQNGSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 2
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 235000020778 linoleic acid Nutrition 0.000 description 2
- OYHQOLUKZRVURQ-IXWMQOLASA-N linoleic acid Natural products CCCCC\C=C/C\C=C\CCCCCCCC(O)=O OYHQOLUKZRVURQ-IXWMQOLASA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- ZQHJVIHCDHJVII-OWOJBTEDSA-N (e)-2-chlorobut-2-enedioic acid Chemical compound OC(=O)\C=C(\Cl)C(O)=O ZQHJVIHCDHJVII-OWOJBTEDSA-N 0.000 description 1
- LDMOEFOXLIZJOW-UHFFFAOYSA-N 1-dodecanesulfonic acid Chemical compound CCCCCCCCCCCCS(O)(=O)=O LDMOEFOXLIZJOW-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 238000010669 acid-base reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- KQNZLOUWXSAZGD-UHFFFAOYSA-N benzylperoxymethylbenzene Chemical compound C=1C=CC=CC=1COOCC1=CC=CC=C1 KQNZLOUWXSAZGD-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 description 1
- 229940043276 diisopropanolamine Drugs 0.000 description 1
- VVSMKOFFCAJOSC-UHFFFAOYSA-L disodium;dodecylbenzene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1 VVSMKOFFCAJOSC-UHFFFAOYSA-L 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- WOLATMHLPFJRGC-UHFFFAOYSA-N furan-2,5-dione;styrene Chemical compound O=C1OC(=O)C=C1.C=CC1=CC=CC=C1 WOLATMHLPFJRGC-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 235000019830 sodium polyphosphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940104261 taurate Drugs 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
- C11D3/3746—Macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- C11D3/3757—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions
- C11D3/3765—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions in liquid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82815A US3696043A (en) | 1970-10-21 | 1970-10-21 | Cleaning composition for glass and reflective surfaces |
| FR7137621A FR2111579A5 (cg-RX-API-DMAC10.html) | 1970-10-21 | 1971-10-20 | |
| NL7205261A NL7205261A (cg-RX-API-DMAC10.html) | 1970-10-21 | 1972-04-19 | |
| DE2220540A DE2220540A1 (de) | 1970-10-21 | 1972-04-26 | Reinigungskomposition fuer glas und reflektierende oberflaechen |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US8281570A | 1970-10-21 | 1970-10-21 | |
| NL7205261A NL7205261A (cg-RX-API-DMAC10.html) | 1970-10-21 | 1972-04-19 | |
| DE2220540A DE2220540A1 (de) | 1970-10-21 | 1972-04-26 | Reinigungskomposition fuer glas und reflektierende oberflaechen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2220540A1 true DE2220540A1 (de) | 1973-11-15 |
Family
ID=27184368
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2220540A Pending DE2220540A1 (de) | 1970-10-21 | 1972-04-26 | Reinigungskomposition fuer glas und reflektierende oberflaechen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3696043A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2220540A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2111579A5 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7205261A (cg-RX-API-DMAC10.html) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0009194A1 (de) * | 1978-09-16 | 1980-04-02 | Henkel Kommanditgesellschaft auf Aktien | Reinigungsmittel für Fenster, Spiegel und reflektierende Oberflächen |
| DE2843160A1 (de) * | 1978-10-04 | 1980-04-17 | Collo Gmbh | Reinigungsmittel zum reinigen von gegenstaenden aus thermisch belastbarem glas und glaskeramischen werkstoffen, insbesondere glaskochflaechen u.dgl. |
| US5507971A (en) * | 1992-03-27 | 1996-04-16 | Henkel Kommanditgesellschaft Auf Aktien | Liquid cleaners for hard surfaces |
| US6187731B1 (en) | 1998-12-23 | 2001-02-13 | Henkel Kommandigesellschaft Auf Aktien (Kgaa) | Cleaning compositions for hard surfaces containing naphthalene sulfonic acid/formaldehyde condensates |
| US6288015B1 (en) | 1998-12-23 | 2001-09-11 | Henkel Kommanditgesellschaft Auf Aktien | Multiphase cleaning composition containing lignin sulfonate |
| US6362154B1 (en) | 1998-12-23 | 2002-03-26 | Henkel Kommanditgesellschaft Auf Aktien | Multiphase cleaning composition containing naphthalene sulfonic acid/formaldehyde condensate |
| US6521584B1 (en) | 1998-03-16 | 2003-02-18 | Henkel Kommanditgesellschaft Auf Aktien | Liquid multiphase detergents |
| US6884766B2 (en) | 2000-06-20 | 2005-04-26 | The Procter & Gamble Company | Multi-phase fabric care composition for delivering multiple fabric care benefits |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3939090A (en) * | 1973-10-23 | 1976-02-17 | Colgate-Palmolive Company | Antifogging cleaner |
| US3978010A (en) * | 1973-12-20 | 1976-08-31 | Shell Oil Company | Aqueous windshield cleaner formulation comprising amine salts, methanol and boric acid |
| IT1038373B (it) * | 1974-08-06 | 1979-11-20 | Rolls Royce Motors Ltd | Formulazione per puliture dei vetri |
| US4288327A (en) * | 1975-09-08 | 1981-09-08 | Betz Laboratories, Inc. | Copolymers for the control of the formation and deposition of materials in aqueous mediums |
| JPS5358492A (en) * | 1976-11-08 | 1978-05-26 | Kao Corp | Anti-foggig agent composition with lng lasting effect |
| GB1571438A (en) * | 1977-03-15 | 1980-07-16 | Colgate Palmolive Co | Cleaning compositions |
| US4448704A (en) * | 1981-05-29 | 1984-05-15 | Lever Brothers Company | Article suitable for wiping hard surfaces |
| US4606842A (en) * | 1982-03-05 | 1986-08-19 | Drackett Company | Cleaning composition for glass and similar hard surfaces |
| US4689168A (en) * | 1984-06-08 | 1987-08-25 | The Drackett Company | Hard surface cleaning composition |
| DE3609734A1 (de) * | 1986-03-22 | 1987-09-24 | Henkel Kgaa | Glasreinigungsmittel |
| US4784786A (en) * | 1986-04-16 | 1988-11-15 | Creative Product Resource Associates, Ltd. | Glass cleaning composition containing an EMA resin and a poly(acrylamidomethylpropane) sulfonic acid to reduce friction and streaking |
| US4673523A (en) * | 1986-04-16 | 1987-06-16 | Creative Products Resource Associates, Ltd. | Glass cleaning composition containing a cyclic anhydride and a poly(acrylamidomethylpropane) sulfonic acid to reduce friction |
| DE3614336A1 (de) * | 1986-04-28 | 1987-10-29 | Henkel Kgaa | Fluessige waessrige reinigungsmittel fuer harte oberflaechen |
| DE3713998A1 (de) * | 1987-04-27 | 1988-11-10 | Henkel Kgaa | Reinigungsmittel fuer harte oberflaechen |
| GB2219001B (en) * | 1988-05-27 | 1992-03-04 | Trico Folberth Ltd | Glass cleaning composition |
| CA2004310C (en) * | 1989-05-05 | 1995-02-21 | John Jerome Burke | Hard surface cleaning composition containing polyacrylate copolymers as performance boosters |
| US5540865A (en) * | 1990-01-29 | 1996-07-30 | The Procter & Gamble Company | Hard surface liquid detergent compositions containing hydrocarbylamidoalkylenebetaine |
| US5342549A (en) * | 1990-01-29 | 1994-08-30 | The Procter & Gamble Company | Hard surface liquid detergent compositions containing hydrocarbyl-amidoalkylenebetaine |
| EP0467472A3 (en) * | 1990-07-16 | 1993-06-02 | Colgate-Palmolive Company | Hard surface liquid cleaning composition with anti-soiling polymer |
| US5540864A (en) * | 1990-12-21 | 1996-07-30 | The Procter & Gamble Company | Liquid hard surfce detergent compositions containing zwitterionic detergent surfactant and monoethanolamine and/or beta-aminoalkanol |
| DE69303005T2 (de) * | 1992-01-23 | 1997-01-23 | Procter & Gamble | Zusammensetzung flüssiger reinigungsmittel für harte oberflächen, zwitterionische und kationische tenside und monoethanolamin und/oder beta-aminoalkanol enthaltend |
| US5254284A (en) * | 1992-04-13 | 1993-10-19 | Miles Inc. | Glass cleaner having antifog properties |
| US5536451A (en) * | 1992-10-26 | 1996-07-16 | The Procter & Gamble Company | Liquid hard surface detergent compositions containing short chain amphocarboxylate detergent surfactant |
| CN1065906C (zh) * | 1993-03-30 | 2001-05-16 | 美国3M公司 | 多表面的清洁组合物及其使用方法 |
| BR9405912A (pt) * | 1993-03-30 | 1996-01-30 | Minnesota Mining & Mfg | Composiçao adequada para extrair revestimentos de uma superficie |
| CA2157672C (en) * | 1993-03-30 | 2005-07-26 | Augustine Liu | Cleaning compositions and methods of use |
| ES2143030T3 (es) * | 1993-11-12 | 2000-05-01 | Procter & Gamble | Composiciones detergentes liquidas para superficies duras, que contienen tensioactivo detergente anfotero y perfume. |
| US5531933A (en) * | 1993-12-30 | 1996-07-02 | The Procter & Gamble Company | Liquid hard surface detergent compositions containing specific polycarboxylate detergent builders |
| AU2698895A (en) * | 1994-06-09 | 1996-01-04 | S.C. Johnson & Son, Inc. | Glass cleaner with enhanced antifog properties |
| KR970704863A (ko) * | 1994-07-21 | 1997-09-06 | 테릴 켄트 퀼리 | 희석시 점도 증가를 나타낼 수 있는 농축 세정제 조성물 |
| US5534198A (en) * | 1994-08-02 | 1996-07-09 | The Procter & Gamble Company | Glass cleaner compositions having good filming/streaking characteristics and substantive modifier to provide long lasting hydrophilicity |
| US5922665A (en) * | 1997-05-28 | 1999-07-13 | Minnesota Mining And Manufacturing Company | Aqueous cleaning composition including a nonionic surfactant and a very slightly water-soluble organic solvent suitable for hydrophobic soil removal |
| US6849589B2 (en) | 2001-10-10 | 2005-02-01 | 3M Innovative Properties Company | Cleaning composition |
| US20030126691A1 (en) * | 2001-12-20 | 2003-07-10 | Gerlach Christian Gerhard Friedrich | Fabric article treating method and apparatus |
| US8006336B1 (en) | 2001-12-20 | 2011-08-30 | The Procter & Gamble Company | Fabric article treating method and apparatus |
| ATE350446T1 (de) * | 2002-09-27 | 2007-01-15 | Unilever Nv | Reinigungsmittel und feuchtwischtuch |
| US20080227679A1 (en) * | 2007-03-13 | 2008-09-18 | Elementis Specialties, Inc. | Biodegradable Cleaning Compositions |
| AP3585A (en) | 2010-10-25 | 2016-02-09 | Stepan Co | Fatty amides and derivatives from natural oil metathesis |
| FR3026743B1 (fr) * | 2014-10-03 | 2018-03-02 | Valeo Systemes D'essuyage | Liquide lave glace pour pare-brise de vehicule |
| US12252673B2 (en) | 2020-01-23 | 2025-03-18 | Korex Canada Company | Concentrated glass cleaning compositions in unit dose packets or pouches |
| FR3106594B1 (fr) * | 2020-01-29 | 2024-11-08 | Valeo Systemes Dessuyage | Liquide lave-glace pour véhicule |
| US12415974B2 (en) | 2020-03-09 | 2025-09-16 | Korex Canada Company | Unit-dose concentrated high performance multipurpose cleaning compositions comprising an antimicrobial/disinfectant mixture |
-
1970
- 1970-10-21 US US82815A patent/US3696043A/en not_active Expired - Lifetime
-
1971
- 1971-10-20 FR FR7137621A patent/FR2111579A5/fr not_active Expired
-
1972
- 1972-04-19 NL NL7205261A patent/NL7205261A/xx unknown
- 1972-04-26 DE DE2220540A patent/DE2220540A1/de active Pending
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0009194A1 (de) * | 1978-09-16 | 1980-04-02 | Henkel Kommanditgesellschaft auf Aktien | Reinigungsmittel für Fenster, Spiegel und reflektierende Oberflächen |
| DE2843160A1 (de) * | 1978-10-04 | 1980-04-17 | Collo Gmbh | Reinigungsmittel zum reinigen von gegenstaenden aus thermisch belastbarem glas und glaskeramischen werkstoffen, insbesondere glaskochflaechen u.dgl. |
| US5507971A (en) * | 1992-03-27 | 1996-04-16 | Henkel Kommanditgesellschaft Auf Aktien | Liquid cleaners for hard surfaces |
| US6521584B1 (en) | 1998-03-16 | 2003-02-18 | Henkel Kommanditgesellschaft Auf Aktien | Liquid multiphase detergents |
| US6187731B1 (en) | 1998-12-23 | 2001-02-13 | Henkel Kommandigesellschaft Auf Aktien (Kgaa) | Cleaning compositions for hard surfaces containing naphthalene sulfonic acid/formaldehyde condensates |
| US6288015B1 (en) | 1998-12-23 | 2001-09-11 | Henkel Kommanditgesellschaft Auf Aktien | Multiphase cleaning composition containing lignin sulfonate |
| US6362154B1 (en) | 1998-12-23 | 2002-03-26 | Henkel Kommanditgesellschaft Auf Aktien | Multiphase cleaning composition containing naphthalene sulfonic acid/formaldehyde condensate |
| US6884766B2 (en) | 2000-06-20 | 2005-04-26 | The Procter & Gamble Company | Multi-phase fabric care composition for delivering multiple fabric care benefits |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2111579A5 (cg-RX-API-DMAC10.html) | 1972-06-02 |
| NL7205261A (cg-RX-API-DMAC10.html) | 1973-10-23 |
| US3696043A (en) | 1972-10-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2220540A1 (de) | Reinigungskomposition fuer glas und reflektierende oberflaechen | |
| DE69424539T2 (de) | Reinigungszusammensetzungen für verschiedene oberflächen und verwandlungsverfahren | |
| EP0256354B1 (de) | Reinigungsmittel | |
| DE69631549T2 (de) | Keimtötende saure reinigungsmittel für harte oberflächen | |
| DE69323033T2 (de) | Nichtchlorierte Reinigungsmittel mit niedriger Alkalinität und hohem Zurückhalten | |
| DE69416426T2 (de) | Alkalische flüssige reinigungsmittel für harte oberflächen, die quaternäre ammoniumverbindungen als desinfektionsmittel und dicarboxylate als sequestriermittel enthalten | |
| JP2857168B2 (ja) | 多目的洗浄組成物 | |
| EP0009194B1 (de) | Reinigungsmittel für Fenster, Spiegel und reflektierende Oberflächen | |
| CA2312219C (en) | Hard surface cleaner containing anionic surfactants | |
| DD296697A5 (de) | Saures, waessriges reinigungsmittel fuer harte oberflaechen | |
| DE60303193T2 (de) | Antiverschmutzungsreinigungsmittel für harte oberflächen | |
| EP0876460A1 (de) | Reinigungsmittel für harte oberflächen | |
| AT394204B (de) | Klares, einphasiges, fluessiges, besonders zur reinigung harter oberflaechen geeignetes reinigungsmittel | |
| EP0303188A2 (de) | Flüssige Mittel zum Reinigen harter Oberflächen | |
| DE2331353B2 (cg-RX-API-DMAC10.html) | ||
| AT397254B (de) | Flüssige reinigungsmittel | |
| DE69819698T2 (de) | Transparentes flüssigwaschmittel enthaltend alkylbenzolsulfonat und natriumsilikat | |
| EP0632823B1 (de) | Flüssige reinigungsmittel für harte oberflächen | |
| DE69424528T2 (de) | Reinigungsmittel für harte oberflächen | |
| DE1692019A1 (de) | Schaumarme Spuel- und Reinigungsmittel fuer die Geschirreinigung | |
| WO1991009926A1 (de) | Flüssiges reinigungsmittel für harte oberflächen | |
| DE2717928A1 (de) | Reinigungsmittelmischung | |
| DE1767384A1 (de) | Schaumarme Spuel- und Reinigungsmittel fuer die Geschirreinigung | |
| US6350727B1 (en) | Non-streaking no-wipe cleaning compositions with improved cleaning capability | |
| DE2918255A1 (de) | Fluessige reinigungsmittelmasse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |