DE2134148C3 - Verfahren und magnetisches System zur Lenkung des Flusses von Zylinderdomänen - Google Patents
Verfahren und magnetisches System zur Lenkung des Flusses von ZylinderdomänenInfo
- Publication number
- DE2134148C3 DE2134148C3 DE2134148A DE2134148A DE2134148C3 DE 2134148 C3 DE2134148 C3 DE 2134148C3 DE 2134148 A DE2134148 A DE 2134148A DE 2134148 A DE2134148 A DE 2134148A DE 2134148 C3 DE2134148 C3 DE 2134148C3
- Authority
- DE
- Germany
- Prior art keywords
- channel
- cylinder
- domain
- domains
- magnetic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 37
- 229910052742 iron Inorganic materials 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 14
- 239000012876 carrier material Substances 0.000 claims description 11
- 229910052684 Cerium Inorganic materials 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052693 Europium Inorganic materials 0.000 claims description 4
- 229910052688 Gadolinium Inorganic materials 0.000 claims description 4
- 229910052689 Holmium Inorganic materials 0.000 claims description 4
- 229910052779 Neodymium Inorganic materials 0.000 claims description 4
- 229910052777 Praseodymium Inorganic materials 0.000 claims description 4
- 229910052771 Terbium Inorganic materials 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052769 Ytterbium Inorganic materials 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052804 chromium Inorganic materials 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 claims description 4
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052746 lanthanum Inorganic materials 0.000 claims description 4
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims description 4
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 claims description 4
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 claims description 4
- 229910052706 scandium Inorganic materials 0.000 claims description 4
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 claims description 4
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052720 vanadium Inorganic materials 0.000 claims description 4
- NAWDYIZEMPQZHO-UHFFFAOYSA-N ytterbium Chemical compound [Yb] NAWDYIZEMPQZHO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052727 yttrium Inorganic materials 0.000 claims description 4
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 claims description 4
- 229910052692 Dysprosium Inorganic materials 0.000 claims description 3
- 229910052691 Erbium Inorganic materials 0.000 claims description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052765 Lutetium Inorganic materials 0.000 claims description 3
- 229910052773 Promethium Inorganic materials 0.000 claims description 3
- 229910052772 Samarium Inorganic materials 0.000 claims description 3
- 229910052775 Thulium Inorganic materials 0.000 claims description 3
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 claims description 3
- UYAHIZSMUZPPFV-UHFFFAOYSA-N erbium Chemical compound [Er] UYAHIZSMUZPPFV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052733 gallium Inorganic materials 0.000 claims description 3
- KJZYNXUDTRRSPN-UHFFFAOYSA-N holmium atom Chemical compound [Ho] KJZYNXUDTRRSPN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052738 indium Inorganic materials 0.000 claims description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 3
- OHSVLFRHMCKCQY-UHFFFAOYSA-N lutetium atom Chemical compound [Lu] OHSVLFRHMCKCQY-UHFFFAOYSA-N 0.000 claims description 3
- VQMWBBYLQSCNPO-UHFFFAOYSA-N promethium atom Chemical compound [Pm] VQMWBBYLQSCNPO-UHFFFAOYSA-N 0.000 claims description 3
- 230000001902 propagating effect Effects 0.000 claims description 3
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- -1 erhium Inorganic materials 0.000 claims description 2
- 229910052735 hafnium Inorganic materials 0.000 claims description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 239000000696 magnetic material Substances 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- 239000011572 manganese Substances 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- 239000010955 niobium Substances 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052715 tantalum Inorganic materials 0.000 claims description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052721 tungsten Inorganic materials 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 claims 2
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 claims 1
- 241001676573 Minium Species 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000002131 composite material Substances 0.000 claims 1
- 230000005415 magnetization Effects 0.000 claims 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- 239000000203 mixture Substances 0.000 claims 1
- 230000001850 reproductive effect Effects 0.000 claims 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- 229910052845 zircon Inorganic materials 0.000 claims 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims 1
- 239000010408 film Substances 0.000 description 6
- 230000000644 propagated effect Effects 0.000 description 3
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 2
- 241001101998 Galium Species 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 238000005229 chemical vapour deposition Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/16—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using saturable magnetic devices
- H03K19/168—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using saturable magnetic devices using thin-film devices
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/02—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements
- G11C19/08—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements using thin films in plane structure
- G11C19/0808—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements using thin films in plane structure using magnetic domain propagation
- G11C19/0833—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements using thin films in plane structure using magnetic domain propagation using magnetic domain interaction
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/02—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements
- G11C19/08—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements using thin films in plane structure
- G11C19/0875—Organisation of a plurality of magnetic shift registers
- G11C19/0883—Means for switching magnetic domains from one path into another path, i.e. transfer switches, swap gates or decoders
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F10/00—Thin magnetic films, e.g. of one-domain structure
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F10/00—Thin magnetic films, e.g. of one-domain structure
- H01F10/08—Thin magnetic films, e.g. of one-domain structure characterised by magnetic layers
- H01F10/10—Thin magnetic films, e.g. of one-domain structure characterised by magnetic layers characterised by the composition
- H01F10/18—Thin magnetic films, e.g. of one-domain structure characterised by magnetic layers characterised by the composition being compounds
- H01F10/20—Ferrites
- H01F10/22—Orthoferrites, e.g. RFeO3 (R= rare earth element) with orthorhombic structure
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F10/00—Thin magnetic films, e.g. of one-domain structure
- H01F10/26—Thin magnetic films, e.g. of one-domain structure characterised by the substrate or intermediate layers
- H01F10/28—Thin magnetic films, e.g. of one-domain structure characterised by the substrate or intermediate layers characterised by the composition of the substrate
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Computing Systems (AREA)
- Physics & Mathematics (AREA)
- General Engineering & Computer Science (AREA)
- Mathematical Physics (AREA)
- Computer Hardware Design (AREA)
- Chemical & Material Sciences (AREA)
- Materials Engineering (AREA)
- Thin Magnetic Films (AREA)
- Magnetic Resonance Imaging Apparatus (AREA)
- Compounds Of Iron (AREA)
- Physical Vapour Deposition (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US8123270A | 1970-10-16 | 1970-10-16 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2134148A1 DE2134148A1 (de) | 1972-04-20 |
| DE2134148B2 DE2134148B2 (de) | 1974-05-30 |
| DE2134148C3 true DE2134148C3 (de) | 1975-01-09 |
Family
ID=22162904
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2134148A Expired DE2134148C3 (de) | 1970-10-16 | 1971-07-08 | Verfahren und magnetisches System zur Lenkung des Flusses von Zylinderdomänen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3735145A (en:Method) |
| JP (1) | JPS511573B1 (en:Method) |
| CA (1) | CA941065A (en:Method) |
| DE (1) | DE2134148C3 (en:Method) |
| FR (1) | FR2109726A5 (en:Method) |
| GB (1) | GB1347523A (en:Method) |
| NL (1) | NL7110170A (en:Method) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3827036A (en) * | 1971-03-12 | 1974-07-30 | Rockwell International Corp | Magnetic bubble domain system |
| BE789634A (fr) * | 1971-10-05 | 1973-04-03 | Philips Nv | Plaque magnetique comportant des parties amincies |
| JPS5518981B2 (en:Method) * | 1971-12-28 | 1980-05-22 | ||
| US3887905A (en) * | 1973-01-29 | 1975-06-03 | Bell Telephone Labor Inc | Magnetic domain shifting arrangement employing movable strip domain |
| US3921155A (en) * | 1973-02-23 | 1975-11-18 | Monsanto Co | Magnetic bubble transmission circuit |
| US3863234A (en) * | 1973-02-23 | 1975-01-28 | Monsanto Co | Fast bubble logic gates |
| US3952291A (en) * | 1973-09-28 | 1976-04-20 | Monsanto Company | Readout system for magnetic bubbles |
| US4018692A (en) * | 1973-10-04 | 1977-04-19 | Rca Corporation | Composition for making garnet films for improved magnetic bubble devices |
| US3913079A (en) * | 1974-01-02 | 1975-10-14 | Ibm | Magnetic bubble domain pump shift register |
| US3940631A (en) * | 1974-03-13 | 1976-02-24 | Monsanto Company | Magnetic bubble logic gates |
| US3964035A (en) * | 1974-09-23 | 1976-06-15 | Bell Telephone Laboratories, Incorporated | Magnetic devices utilizing garnet epitaxial materials |
| US4075613A (en) * | 1977-01-03 | 1978-02-21 | Sperry Rand Corporation | Logic gate for cross-tie wall memory system incorporating isotropic data tracks |
| DE3152307A1 (de) * | 1980-08-28 | 1982-11-04 | Wisconsin Alumni Res Found | Use of metallic glasses for fabrication of structures with submicron dimensions |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3438006A (en) * | 1966-01-12 | 1969-04-08 | Cambridge Memory Systems Inc | Domain tip propagation logic |
| US3460116A (en) * | 1966-09-16 | 1969-08-05 | Bell Telephone Labor Inc | Magnetic domain propagation circuit |
| US3553661A (en) * | 1967-06-27 | 1971-01-05 | Us Army | First-in, first-out memory |
| US3503054A (en) * | 1967-10-12 | 1970-03-24 | Bell Telephone Labor Inc | Domain wall propagation in magnetic shefts |
| US3540019A (en) * | 1968-03-04 | 1970-11-10 | Bell Telephone Labor Inc | Single wall domain device |
| US3523286A (en) * | 1968-08-12 | 1970-08-04 | Bell Telephone Labor Inc | Magnetic single wall domain propagation device |
| US3636531A (en) * | 1970-06-24 | 1972-01-18 | Bell Telephone Labor Inc | Domain propagation arrangement |
-
1970
- 1970-10-16 US US00081232A patent/US3735145A/en not_active Expired - Lifetime
-
1971
- 1971-05-25 CA CA114,001A patent/CA941065A/en not_active Expired
- 1971-05-28 GB GB1793071A patent/GB1347523A/en not_active Expired
- 1971-07-08 DE DE2134148A patent/DE2134148C3/de not_active Expired
- 1971-07-23 NL NL7110170A patent/NL7110170A/xx not_active Application Discontinuation
- 1971-08-31 FR FR7131543A patent/FR2109726A5/fr not_active Expired
- 1971-10-11 JP JP46080092A patent/JPS511573B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS511573B1 (en:Method) | 1976-01-19 |
| FR2109726A5 (en:Method) | 1972-05-26 |
| CA941065A (en) | 1974-01-29 |
| GB1347523A (en) | 1974-02-27 |
| US3735145A (en) | 1973-05-22 |
| DE2134148A1 (de) | 1972-04-20 |
| DE2134148B2 (de) | 1974-05-30 |
| NL7110170A (en:Method) | 1972-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2134148C3 (de) | Verfahren und magnetisches System zur Lenkung des Flusses von Zylinderdomänen | |
| DE69231412T2 (de) | Belichtungsverfahren mit Phasenverschiebung | |
| DE2945533A1 (de) | Verfahren zur herstellung eines verdrahtungssystems und mit einem derartigen verdrahtungssystem versehene halbleiteranordnung | |
| DE2808701A1 (de) | Verfahren zum herstellen von metallisierungsmustern | |
| DE2509866A1 (de) | Register mit magnetbereichsfortpflanzung in duennen magnetischen schichten | |
| DE1264508B (de) | Magnetisches Schieberegister | |
| DE2527916A1 (de) | Magnetisches einzelwanddomaenensystem | |
| DE2843647A1 (de) | Flussquantengenerator | |
| DE1275699B (de) | Verfahren zur Herstellung einer magnetischen Duennschichtanordnung | |
| DE2156515C3 (de) | Verfahren zum Herstellen eines magnetischen Mehrschichtenmaterials für BIasendomänenbauelemente | |
| DE1076415B (de) | Maschine zur UEbertragung von Angaben aus Lochkarten auf ein Magnetband | |
| DE2165299C3 (de) | Verfahren zur Herstellung einer für Blase ndomänenanwendungsgebiete brauchbaren magnetischen Schicht | |
| DE2159443C3 (en:Method) | ||
| DE2736156C3 (de) | Magnetischer Blasendomänenspeicher mit einer Gitterstapelstruktur | |
| DE2264967C2 (de) | Magnetisches Blasendomänensystem | |
| DE2259042A1 (de) | Magnetische speicheranordnung | |
| DE2333812C3 (de) | Magnetkopf in Dünnschichttechnik und Verfahren zu seiner Herstellung | |
| DE2310191A1 (de) | Verbesserung von vorrichtungen zur ausnutzung magnetischer zylindrischer einzelwanddomaenen | |
| DE2029058C2 (de) | Halbleiteranordnung mit mindestens zwei Feldeffekttransistoren mit isolierter Gateelektrode und Verfahren zu ihrer Herstellung | |
| DE2159980C3 (en:Method) | ||
| DE2159981C3 (de) | Magnetdomäne nfortbe wegungssystem | |
| DE2529150C3 (de) | Verfahren zum Speichern von Blasendomänen in einem dünnen, ferromagnetischen Film und Anordnung zur Durchführung des Verfahrens | |
| DE2854753A1 (de) | Domaenenschichtgitter-magnetblasen- funktionseinheit | |
| DE1205144B (de) | Anordnung zur Umschaltung der Induktivitaet eines Gatterleiters zwischen zwei Extremwerten | |
| DE1917746B2 (de) | Domaenenfortbewegungsanordnung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| Q161 | Has additional application no. |
Ref document number: 2264967 Country of ref document: DE |
|
| AG | Has addition no. |
Ref document number: 2264967 Country of ref document: DE |
|
| 8339 | Ceased/non-payment of the annual fee |