DE2129012A1 - Azol-derivate - Google Patents
Azol-derivateInfo
- Publication number
- DE2129012A1 DE2129012A1 DE2129012A DE2129012A DE2129012A1 DE 2129012 A1 DE2129012 A1 DE 2129012A1 DE 2129012 A DE2129012 A DE 2129012A DE 2129012 A DE2129012 A DE 2129012A DE 2129012 A1 DE2129012 A1 DE 2129012A1
- Authority
- DE
- Germany
- Prior art keywords
- mercapto
- oxazolyl
- bis
- acid
- chlorophenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000007980 azole derivatives Chemical class 0.000 title description 4
- -1 (4,5-Diphenyl-2-thiazolyl-mercapto) -heptanoic acid Chemical compound 0.000 claims description 358
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 226
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 181
- 239000002253 acid Substances 0.000 claims description 108
- 125000004494 ethyl ester group Chemical group 0.000 claims description 74
- 235000019260 propionic acid Nutrition 0.000 claims description 71
- 150000001875 compounds Chemical class 0.000 claims description 68
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 67
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 17
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 14
- 150000001408 amides Chemical class 0.000 claims description 14
- 150000004702 methyl esters Chemical class 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 8
- 150000002825 nitriles Chemical class 0.000 claims description 8
- STVVIBPFTMJJIZ-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetic acid Chemical compound O1C(SCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 STVVIBPFTMJJIZ-UHFFFAOYSA-N 0.000 claims description 4
- MDLNHSYXCATEOV-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]propanoic acid Chemical compound O1C(SC(C)C(O)=O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 MDLNHSYXCATEOV-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- WOQCDEPGRSMFMH-UHFFFAOYSA-N 2-[4-(4-methylphenyl)-5-phenyl-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC=CC=2)SC(C(S)C(O)=O)=N1 WOQCDEPGRSMFMH-UHFFFAOYSA-N 0.000 claims description 2
- ODRIBJRBZMHVNM-UHFFFAOYSA-N 3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]propanoic acid Chemical compound O1C(SCCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 ODRIBJRBZMHVNM-UHFFFAOYSA-N 0.000 claims description 2
- RDJFRGLOWSBXLL-UHFFFAOYSA-N 4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]butanoic acid Chemical compound O1C(SCCCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 RDJFRGLOWSBXLL-UHFFFAOYSA-N 0.000 claims description 2
- AKFMJYHQDPJSRA-UHFFFAOYSA-N 4-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]butanoic acid Chemical compound S1C(SCCCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 AKFMJYHQDPJSRA-UHFFFAOYSA-N 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims 3
- 239000000654 additive Substances 0.000 claims 2
- 230000000996 additive effect Effects 0.000 claims 2
- UIKNJBQMVYHLTL-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-(5-phenyl-1,3-thiazol-2-yl)-2-sulfanylacetic acid Chemical compound C=1C=C(F)C=CC=1C(S)(C(=O)O)C(S1)=NC=C1C1=CC=CC=C1 UIKNJBQMVYHLTL-UHFFFAOYSA-N 0.000 claims 1
- AKGSRDLLLIXAMO-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]-2-methylpropanoic acid Chemical compound S1C(SC(C)(C)C(O)=O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 AKGSRDLLLIXAMO-UHFFFAOYSA-N 0.000 claims 1
- AYULKBVIJJZQAB-UHFFFAOYSA-N 2-[4,5-bis(1,3-benzodioxol-5-yl)-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=C2OCOC2=CC(C=2N=C(OC=2C=2C=C3OCOC3=CC=2)C(S)C(=O)O)=C1 AYULKBVIJJZQAB-UHFFFAOYSA-N 0.000 claims 1
- CBFXGRKVYUYYFK-UHFFFAOYSA-N 2-[4-(4-methoxyphenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC=CC=2)OC(C(S)C(O)=O)=N1 CBFXGRKVYUYYFK-UHFFFAOYSA-N 0.000 claims 1
- YDNJMJFPPCTSDF-UHFFFAOYSA-N 2-[[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]sulfanyl]butanoic acid Chemical compound O1C(SC(CC)C(O)=O)=NC(C=2C=CC(C)=CC=2)=C1C1=CC=C(C)C=C1 YDNJMJFPPCTSDF-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 239000002552 dosage form Substances 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 145
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 111
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 69
- 235000011054 acetic acid Nutrition 0.000 description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 60
- 239000000243 solution Substances 0.000 description 58
- 238000006243 chemical reaction Methods 0.000 description 57
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 56
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 55
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 53
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 51
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 48
- 150000002148 esters Chemical class 0.000 description 48
- 239000000203 mixture Substances 0.000 description 48
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 47
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 33
- 239000002904 solvent Substances 0.000 description 32
- 150000003254 radicals Chemical class 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 26
- 150000007513 acids Chemical class 0.000 description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 238000003756 stirring Methods 0.000 description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 22
- 239000012442 inert solvent Substances 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 21
- 239000000460 chlorine Substances 0.000 description 21
- 125000003396 thiol group Chemical class [H]S* 0.000 description 21
- 239000003054 catalyst Substances 0.000 description 20
- 229910052794 bromium Inorganic materials 0.000 description 19
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 18
- 150000001735 carboxylic acids Chemical class 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 17
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 16
- 239000002585 base Substances 0.000 description 16
- 238000009835 boiling Methods 0.000 description 16
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 16
- 239000011734 sodium Substances 0.000 description 16
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 15
- 229910052801 chlorine Inorganic materials 0.000 description 15
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 14
- 150000001298 alcohols Chemical class 0.000 description 13
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 13
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 159000000000 sodium salts Chemical class 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 12
- 239000012954 diazonium Substances 0.000 description 12
- 239000000194 fatty acid Substances 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- 229940053200 antiepileptics fatty acid derivative Drugs 0.000 description 11
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 11
- 235000014113 dietary fatty acids Nutrition 0.000 description 11
- 229930195729 fatty acid Natural products 0.000 description 11
- 125000002971 oxazolyl group Chemical group 0.000 description 11
- 239000000052 vinegar Substances 0.000 description 11
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 10
- 239000002184 metal Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- 238000010626 work up procedure Methods 0.000 description 10
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 230000002378 acidificating effect Effects 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- 238000007127 saponification reaction Methods 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- 150000001805 chlorine compounds Chemical class 0.000 description 8
- 150000001989 diazonium salts Chemical class 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 238000007363 ring formation reaction Methods 0.000 description 8
- 239000008096 xylene Substances 0.000 description 8
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 7
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 7
- 125000004414 alkyl thio group Chemical group 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- NYQSTRUSYDZNHC-UHFFFAOYSA-N 4,5-diphenyl-3h-1,3-oxazole-2-thione Chemical compound O1C(S)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 NYQSTRUSYDZNHC-UHFFFAOYSA-N 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- WQEACQPHPZCLKG-UHFFFAOYSA-N ethyl 2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-sulfanylacetate Chemical compound O1C(C(S)C(=O)OCC)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 WQEACQPHPZCLKG-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 5
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 5
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 5
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 229910017604 nitric acid Inorganic materials 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- CLEJZSNZYFJMKD-UHFFFAOYSA-N 3h-1,3-oxazole-2-thione Chemical class SC1=NC=CO1 CLEJZSNZYFJMKD-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 150000003863 ammonium salts Chemical class 0.000 description 4
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 4
- 125000004663 dialkyl amino group Chemical group 0.000 description 4
- 238000006193 diazotization reaction Methods 0.000 description 4
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical class CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 4
- 239000011133 lead Substances 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 229910001923 silver oxide Inorganic materials 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 3
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical class CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical class CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical class NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 125000004442 acylamino group Chemical group 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 3
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical class NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 3
- 125000000068 chlorophenyl group Chemical group 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000011097 chromatography purification Methods 0.000 description 3
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical class CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 3
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 3
- 229940008406 diethyl sulfate Drugs 0.000 description 3
- ZWWCURLKEXEFQT-UHFFFAOYSA-N dinitrogen pentoxide Inorganic materials [O-][N+](=O)O[N+]([O-])=O ZWWCURLKEXEFQT-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229960003750 ethyl chloride Drugs 0.000 description 3
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical class CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 150000002497 iodine compounds Chemical class 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 229940080818 propionamide Drugs 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- 150000007979 thiazole derivatives Chemical class 0.000 description 3
- 150000003556 thioamides Chemical class 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- YZBBUYKPTHDZHF-KNVGNIICSA-N (3R)-7,2'-dihydroxy-4'-methoxyisoflavanol Chemical compound OC1=CC(OC)=CC=C1[C@H]1C(O)C2=CC=C(O)C=C2OC1 YZBBUYKPTHDZHF-KNVGNIICSA-N 0.000 description 2
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- CARFETJZUQORNQ-UHFFFAOYSA-N 1h-pyrrole-2-thiol Chemical compound SC1=CC=CN1 CARFETJZUQORNQ-UHFFFAOYSA-N 0.000 description 2
- LOSWOLRBWAZTNI-UHFFFAOYSA-N 2-(2-iminoethoxy)ethanimine;hydrochloride Chemical compound Cl.N=CCOCC=N LOSWOLRBWAZTNI-UHFFFAOYSA-N 0.000 description 2
- BCCVJOZFPLPVKX-UHFFFAOYSA-N 2-[4-(4-aminophenyl)-5-(4-chlorophenyl)-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(N)=CC=C1C1=C(C=2C=CC(Cl)=CC=2)OC(C(S)C(O)=O)=N1 BCCVJOZFPLPVKX-UHFFFAOYSA-N 0.000 description 2
- HVORZAHIAYWROQ-UHFFFAOYSA-N 2-[5-(4-iodophenyl)-4-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=C(I)C=C1 HVORZAHIAYWROQ-UHFFFAOYSA-N 0.000 description 2
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 2
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 2
- RXDYOLRABMJTEF-UHFFFAOYSA-N 2-chloro-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Cl)C(=O)C1=CC=CC=C1 RXDYOLRABMJTEF-UHFFFAOYSA-N 0.000 description 2
- PAVIHTWMLRILFC-UHFFFAOYSA-N 2-chloro-4,5-diphenyl-1,3-oxazole Chemical compound O1C(Cl)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PAVIHTWMLRILFC-UHFFFAOYSA-N 0.000 description 2
- MSUAFFBEKJQZIC-UHFFFAOYSA-N 2-chloroethanone Chemical compound ClC[C]=O MSUAFFBEKJQZIC-UHFFFAOYSA-N 0.000 description 2
- GAWAYYRQGQZKCR-UHFFFAOYSA-N 2-chloropropionic acid Chemical group CC(Cl)C(O)=O GAWAYYRQGQZKCR-UHFFFAOYSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- 239000004808 2-ethylhexylester Substances 0.000 description 2
- VJIKFWJCVWFZIN-UHFFFAOYSA-N 2-ethylsulfanylacetic acid Chemical compound CCSCC(O)=O VJIKFWJCVWFZIN-UHFFFAOYSA-N 0.000 description 2
- NJBCRXCAPCODGX-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-amine Chemical class CC(C)CNCC(C)C NJBCRXCAPCODGX-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- OCVLSHAVSIYKLI-UHFFFAOYSA-N 3h-1,3-thiazole-2-thione Chemical class SC1=NC=CS1 OCVLSHAVSIYKLI-UHFFFAOYSA-N 0.000 description 2
- LDPBTGBWTUWCBU-UHFFFAOYSA-N 4,5-diphenyl-3h-1,3-oxazol-2-one Chemical compound O1C(=O)NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 LDPBTGBWTUWCBU-UHFFFAOYSA-N 0.000 description 2
- OYNVQAUSTQRNHE-UHFFFAOYSA-N 4-chloro-2-phenyl-1,3-oxazole Chemical compound ClC1=COC(C=2C=CC=CC=2)=N1 OYNVQAUSTQRNHE-UHFFFAOYSA-N 0.000 description 2
- ZLLOWHFKKIOINR-UHFFFAOYSA-N 5-phenyl-1,3-thiazole Chemical compound S1C=NC=C1C1=CC=CC=C1 ZLLOWHFKKIOINR-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-REOHCLBHSA-N L-Lactic acid Natural products C[C@H](O)C(O)=O JVTAAEKCZFNVCJ-REOHCLBHSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 244000028419 Styrax benzoin Species 0.000 description 2
- 235000000126 Styrax benzoin Nutrition 0.000 description 2
- 235000008411 Sumatra benzointree Nutrition 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 230000002862 amidating effect Effects 0.000 description 2
- 150000001409 amidines Chemical class 0.000 description 2
- YNNGZCVDIREDDK-UHFFFAOYSA-N aminocarbamodithioic acid Chemical compound NNC(S)=S YNNGZCVDIREDDK-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 150000007514 bases Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical class CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- KBPLFHHGFOOTCA-UHFFFAOYSA-N caprylic alcohol Natural products CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 229940106681 chloroacetic acid Drugs 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 2
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 150000003946 cyclohexylamines Chemical class 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical class CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 2
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical class CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 2
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical class [H]C#C* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 235000019382 gum benzoic Nutrition 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000002463 imidates Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
- 229910000474 mercury oxide Inorganic materials 0.000 description 2
- 229910001960 metal nitrate Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 125000006501 nitrophenyl group Chemical group 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- ZWRUINPWMLAQRD-UHFFFAOYSA-N nonan-1-ol Chemical compound CCCCCCCCCO ZWRUINPWMLAQRD-UHFFFAOYSA-N 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- SJWFXCIHNDVPSH-UHFFFAOYSA-N octan-2-ol Chemical compound CCCCCCC(C)O SJWFXCIHNDVPSH-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 150000007978 oxazole derivatives Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 230000004962 physiological condition Effects 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 description 2
- 229940005657 pyrophosphoric acid Drugs 0.000 description 2
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000001149 thermolysis Methods 0.000 description 2
- 150000003557 thiazoles Chemical class 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical compound C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- REPVLJRCJUVQFA-UHFFFAOYSA-N (-)-isopinocampheol Natural products C1C(O)C(C)C2C(C)(C)C1C2 REPVLJRCJUVQFA-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-SSDOTTSWSA-N (R)-mandelic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-SSDOTTSWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N 1,2-diethoxyethane Chemical compound CCOCCOCC LZDKZFUFMNSQCJ-UHFFFAOYSA-N 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- QNAZMNIHTSBAMG-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)-2-chloro-2-(2-chlorophenyl)ethanone Chemical compound C=1C=C2OCOC2=CC=1C(=O)C(Cl)C1=CC=CC=C1Cl QNAZMNIHTSBAMG-UHFFFAOYSA-N 0.000 description 1
- UQFZWXKNJTYISX-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)-2-chloro-2-(4-chlorophenyl)ethanone Chemical compound C=1C=C2OCOC2=CC=1C(=O)C(Cl)C1=CC=C(Cl)C=C1 UQFZWXKNJTYISX-UHFFFAOYSA-N 0.000 description 1
- WNRWEBKEQARBKV-UHFFFAOYSA-N 1-(2-chloroethyl)piperidine Chemical compound ClCCN1CCCCC1 WNRWEBKEQARBKV-UHFFFAOYSA-N 0.000 description 1
- RMGFLMXDCGQKPS-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidine Chemical compound ClCCN1CCCC1 RMGFLMXDCGQKPS-UHFFFAOYSA-N 0.000 description 1
- HDDNBUNZJIQDBQ-UHFFFAOYSA-N 1-(3-chloropropyl)piperidine Chemical compound ClCCCN1CCCCC1 HDDNBUNZJIQDBQ-UHFFFAOYSA-N 0.000 description 1
- SPRTXTPFQKHSBG-UHFFFAOYSA-N 1-(3-chloropropyl)pyrrolidine Chemical compound ClCCCN1CCCC1 SPRTXTPFQKHSBG-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical group CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical compound CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- LIUSHSVUMMYGRB-UHFFFAOYSA-N 1-naphthalen-1-yl-n-phenoxymethanamine Chemical compound C=1C=CC2=CC=CC=C2C=1CNOC1=CC=CC=C1 LIUSHSVUMMYGRB-UHFFFAOYSA-N 0.000 description 1
- IDCPFAYURAQKDZ-UHFFFAOYSA-N 1-nitroguanidine Chemical compound NC(=N)N[N+]([O-])=O IDCPFAYURAQKDZ-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- FEXSVCTUDASSOQ-UHFFFAOYSA-N 10-chlorodecanoic acid Chemical compound OC(=O)CCCCCCCCCCl FEXSVCTUDASSOQ-UHFFFAOYSA-N 0.000 description 1
- GVZXFVFTBUYBJD-UHFFFAOYSA-N 11-chloroundecanoic acid Chemical compound OC(=O)CCCCCCCCCCCl GVZXFVFTBUYBJD-UHFFFAOYSA-N 0.000 description 1
- CERJZAHSUZVMCH-UHFFFAOYSA-N 2,2-dichloro-1-phenylethanone Chemical compound ClC(Cl)C(=O)C1=CC=CC=C1 CERJZAHSUZVMCH-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 1
- BCZCPWCRQPEUDQ-UHFFFAOYSA-N 2-(1,3-oxazol-2-ylsulfanyl)acetic acid Chemical compound OC(=O)CSC1=NC=CO1 BCZCPWCRQPEUDQ-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- ATQYPKUZRYPUEG-UHFFFAOYSA-N 2-(4,5-dinaphthalen-2-yl-1,3-oxazol-2-yl)-2-sulfanylacetic acid Chemical compound C1=CC=CC2=CC(C=3N=C(OC=3C=3C=C4C=CC=CC4=CC=3)C(S)C(=O)O)=CC=C21 ATQYPKUZRYPUEG-UHFFFAOYSA-N 0.000 description 1
- PMYKLKNSHUHUFE-UHFFFAOYSA-N 2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-sulfanylacetaldehyde Chemical compound O1C(C(C=O)S)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PMYKLKNSHUHUFE-UHFFFAOYSA-N 0.000 description 1
- RFSRWZDPZOAIAA-UHFFFAOYSA-N 2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-sulfanylacetyl chloride Chemical compound O1C(C(C(Cl)=O)S)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 RFSRWZDPZOAIAA-UHFFFAOYSA-N 0.000 description 1
- GYYLODKRHJHTGR-UHFFFAOYSA-N 2-(4,5-diphenyl-1,3-thiazol-2-yl)-2-sulfanylacetamide Chemical compound S1C(C(S)C(=O)N)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 GYYLODKRHJHTGR-UHFFFAOYSA-N 0.000 description 1
- HBUKZKJHJVUSFP-UHFFFAOYSA-N 2-(4,5-diphenyl-1,3-thiazol-2-yl)-2-sulfanylacetic acid Chemical compound S1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 HBUKZKJHJVUSFP-UHFFFAOYSA-N 0.000 description 1
- DDCHRAAHMVBTKW-UHFFFAOYSA-N 2-(4,5-diphenyl-1,3-thiazol-2-yl)-2-sulfanylacetonitrile Chemical compound S1C(C(C#N)S)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 DDCHRAAHMVBTKW-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- CYCNLHANIZXCRM-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]butanoic acid Chemical compound O1C(SC(CC)C(O)=O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 CYCNLHANIZXCRM-UHFFFAOYSA-N 0.000 description 1
- QRTAMDJXMRCVRZ-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]propanamide Chemical compound O1C(SC(C)C(N)=O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 QRTAMDJXMRCVRZ-UHFFFAOYSA-N 0.000 description 1
- VUSKQZDXZDZBPB-UHFFFAOYSA-N 2-[3,4-bis(propanoylamino)phenyl]-2-(1,3-oxazol-2-yl)-2-sulfanylacetic acid Chemical compound C1=C(NC(=O)CC)C(NC(=O)CC)=CC=C1C(S)(C(O)=O)C1=NC=CO1 VUSKQZDXZDZBPB-UHFFFAOYSA-N 0.000 description 1
- LHXGNBXEUFOZTO-UHFFFAOYSA-N 2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=C(OC)C(OC)=CC=C1C1=C(C=2C=C(OC)C(OC)=CC=2)OC(C(S)C(O)=O)=N1 LHXGNBXEUFOZTO-UHFFFAOYSA-N 0.000 description 1
- PXXKGIDERSCKAN-UHFFFAOYSA-N 2-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetaldehyde Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(C)=CC=2)OC(C(S)C=O)=N1 PXXKGIDERSCKAN-UHFFFAOYSA-N 0.000 description 1
- GEDJJEKTXYFFCT-UHFFFAOYSA-N 2-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetonitrile Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(C)=CC=2)OC(C(S)C#N)=N1 GEDJJEKTXYFFCT-UHFFFAOYSA-N 0.000 description 1
- KGCWPUGKYJNMCE-UHFFFAOYSA-N 2-[4-(1,3-benzodioxol-5-yl)-5-(4-chlorophenyl)-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=C3OCOC3=CC=2)=C1C1=CC=C(Cl)C=C1 KGCWPUGKYJNMCE-UHFFFAOYSA-N 0.000 description 1
- XZRCRHGMTHPVAR-UHFFFAOYSA-N 2-[4-(2-bromophenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C(=CC=CC=2)Br)=C1C1=CC=CC=C1 XZRCRHGMTHPVAR-UHFFFAOYSA-N 0.000 description 1
- ZFAJXJXPJFTTHS-UHFFFAOYSA-N 2-[4-(2-fluorophenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C(=CC=CC=2)F)=C1C1=CC=CC=C1 ZFAJXJXPJFTTHS-UHFFFAOYSA-N 0.000 description 1
- JSUJFHGOIPEVTK-UHFFFAOYSA-N 2-[4-(2-methoxyphenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound COC1=CC=CC=C1C1=C(C=2C=CC=CC=2)OC(C(S)C(O)=O)=N1 JSUJFHGOIPEVTK-UHFFFAOYSA-N 0.000 description 1
- IQBLUEOGDHMNCF-UHFFFAOYSA-N 2-[4-(4-bromophenyl)-5-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound S1C(C(S)C(=O)O)=NC(C=2C=CC(Br)=CC=2)=C1C1=CC=C(Cl)C=C1 IQBLUEOGDHMNCF-UHFFFAOYSA-N 0.000 description 1
- YSVLVHOUYQVGPC-UHFFFAOYSA-N 2-[4-(4-bromophenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC(Br)=CC=2)=C1C1=CC=CC=C1 YSVLVHOUYQVGPC-UHFFFAOYSA-N 0.000 description 1
- AVPBTUZEGCMJQP-UHFFFAOYSA-N 2-[4-(4-bromophenyl)-5-phenyl-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound S1C(C(S)C(=O)O)=NC(C=2C=CC(Br)=CC=2)=C1C1=CC=CC=C1 AVPBTUZEGCMJQP-UHFFFAOYSA-N 0.000 description 1
- DRJJHQLKWMPMLA-UHFFFAOYSA-N 2-[4-(4-fluorophenyl)-5-(4-methylphenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound FC1=CC=C(C=C1)C=1N=C(SC1C1=CC=C(C=C1)C)C(C(=O)O)S DRJJHQLKWMPMLA-UHFFFAOYSA-N 0.000 description 1
- GGXGHLPCGXBAMY-UHFFFAOYSA-N 2-[4-(4-fluorophenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC(F)=CC=2)=C1C1=CC=CC=C1 GGXGHLPCGXBAMY-UHFFFAOYSA-N 0.000 description 1
- YYLMMZIUMTUKED-UHFFFAOYSA-N 2-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound S1C(C(S)C(=O)O)=NC(C=2C=CC(F)=CC=2)=C1C1=CC=CC=C1 YYLMMZIUMTUKED-UHFFFAOYSA-N 0.000 description 1
- KRNNAPXRJXGSAE-UHFFFAOYSA-N 2-[4-(4-hydroxyphenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC(O)=CC=2)=C1C1=CC=CC=C1 KRNNAPXRJXGSAE-UHFFFAOYSA-N 0.000 description 1
- TUTUXMKTTGQUQO-UHFFFAOYSA-N 2-[4-(4-iodophenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC(I)=CC=2)=C1C1=CC=CC=C1 TUTUXMKTTGQUQO-UHFFFAOYSA-N 0.000 description 1
- WCSXMFZQEMAJFD-UHFFFAOYSA-N 2-[4-(4-methoxyphenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetaldehyde Chemical compound COC1=CC=C(C=C1)C=1N=C(OC1C1=CC=CC=C1)C(C=O)S WCSXMFZQEMAJFD-UHFFFAOYSA-N 0.000 description 1
- UTMUDAKWEBAGIG-UHFFFAOYSA-N 2-[4-(4-methoxyphenyl)-5-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetonitrile Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC=CC=2)OC(C(S)C#N)=N1 UTMUDAKWEBAGIG-UHFFFAOYSA-N 0.000 description 1
- ZTWWHGPPGMNCAA-UHFFFAOYSA-N 2-[5-(2-bromophenyl)-4-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1Br ZTWWHGPPGMNCAA-UHFFFAOYSA-N 0.000 description 1
- BZVOBFDNMRRWRP-UHFFFAOYSA-N 2-[5-(2-chlorophenyl)-4-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1Cl BZVOBFDNMRRWRP-UHFFFAOYSA-N 0.000 description 1
- MCMUYMSLSZEJGA-UHFFFAOYSA-N 2-[5-(4-aminophenyl)-4-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(N)=CC=C1C1=C(C=2C=CC=CC=2)N=C(C(S)C(O)=O)O1 MCMUYMSLSZEJGA-UHFFFAOYSA-N 0.000 description 1
- GMTSMWNUTWZVBX-UHFFFAOYSA-N 2-[5-(4-bromophenyl)-4-(4-methylphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(Br)=CC=2)OC(C(S)C(O)=O)=N1 GMTSMWNUTWZVBX-UHFFFAOYSA-N 0.000 description 1
- MUBDQTXHLIEINX-UHFFFAOYSA-N 2-[5-(4-bromophenyl)-4-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound O1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=C(Br)C=C1 MUBDQTXHLIEINX-UHFFFAOYSA-N 0.000 description 1
- JZSXFRDBLKUMKA-UHFFFAOYSA-N 2-[5-(4-bromophenyl)-4-phenyl-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound S1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=C(Br)C=C1 JZSXFRDBLKUMKA-UHFFFAOYSA-N 0.000 description 1
- RNVALGLJSATNGI-UHFFFAOYSA-N 2-[5-(4-chlorophenyl)-4-(4-methylphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(Cl)=CC=2)OC(C(S)C(O)=O)=N1 RNVALGLJSATNGI-UHFFFAOYSA-N 0.000 description 1
- WJNRBXOXCUXASU-UHFFFAOYSA-N 2-[5-(4-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(Cl)=CC=2)SC(C(S)C(O)=O)=N1 WJNRBXOXCUXASU-UHFFFAOYSA-N 0.000 description 1
- SJMFWVDUCDUQBJ-UHFFFAOYSA-N 2-[5-(4-chlorophenyl)-4-phenyl-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound S1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=C(Cl)C=C1 SJMFWVDUCDUQBJ-UHFFFAOYSA-N 0.000 description 1
- AKLGHAOOWXCFAL-UHFFFAOYSA-N 2-[5-(4-methylphenyl)-4-phenyl-1,3-oxazol-2-yl]-2-sulfanylacetic acid Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC=CC=2)N=C(C(S)C(O)=O)O1 AKLGHAOOWXCFAL-UHFFFAOYSA-N 0.000 description 1
- SCAPICDKABHTCC-UHFFFAOYSA-N 2-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]-2-sulfanylacetic acid Chemical compound S1C(C(S)C(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=C([N+]([O-])=O)C=C1 SCAPICDKABHTCC-UHFFFAOYSA-N 0.000 description 1
- GIRVUUSVENKOIN-UHFFFAOYSA-N 2-[[5-(4-methylphenyl)-4-phenyl-1,3-oxazol-2-yl]sulfanyl]propanoic acid Chemical compound O1C(SC(C)C(O)=O)=NC(C=2C=CC=CC=2)=C1C1=CC=C(C)C=C1 GIRVUUSVENKOIN-UHFFFAOYSA-N 0.000 description 1
- NPIXZJYEPKGSOW-UHFFFAOYSA-N 2-amino-2-chloro-1-phenylethanone Chemical compound NC(Cl)C(=O)C1=CC=CC=C1 NPIXZJYEPKGSOW-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 1
- WTRIMJTZOOLIFZ-UHFFFAOYSA-N 2-bromo-2-methylpropanamide Chemical compound CC(C)(Br)C(N)=O WTRIMJTZOOLIFZ-UHFFFAOYSA-N 0.000 description 1
- XDSDCTDECRVDTB-UHFFFAOYSA-N 2-bromo-2-methylpropanenitrile Chemical compound CC(C)(Br)C#N XDSDCTDECRVDTB-UHFFFAOYSA-N 0.000 description 1
- ANZBOYVAJOJGFC-UHFFFAOYSA-N 2-bromo-4,5-diphenyl-1,3-oxazole Chemical compound O1C(Br)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 ANZBOYVAJOJGFC-UHFFFAOYSA-N 0.000 description 1
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 1
- AKSLRYGHJVUELA-UHFFFAOYSA-N 2-bromobutanamide Chemical compound CCC(Br)C(N)=O AKSLRYGHJVUELA-UHFFFAOYSA-N 0.000 description 1
- CIBGXJVJPZCMFX-UHFFFAOYSA-N 2-bromobutanenitrile Chemical compound CCC(Br)C#N CIBGXJVJPZCMFX-UHFFFAOYSA-N 0.000 description 1
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- AUHYZQCEIVEMFH-UHFFFAOYSA-N 2-bromopropanamide Chemical compound CC(Br)C(N)=O AUHYZQCEIVEMFH-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- PYNYHMRMZOGVML-UHFFFAOYSA-N 2-bromopropanenitrile Chemical compound CC(Br)C#N PYNYHMRMZOGVML-UHFFFAOYSA-N 0.000 description 1
- KXMZHKOZDQLZMO-UHFFFAOYSA-N 2-carbamothioylsulfanylacetic acid Chemical class NC(=S)SCC(O)=O KXMZHKOZDQLZMO-UHFFFAOYSA-N 0.000 description 1
- YSKMUSXKBMZDMH-UHFFFAOYSA-N 2-carbamoylsulfanylacetic acid Chemical compound NC(=O)SCC(O)=O YSKMUSXKBMZDMH-UHFFFAOYSA-N 0.000 description 1
- ZCOFOBIIOQWUDE-UHFFFAOYSA-N 2-chloro-1,2-diphenylethanol Chemical compound C=1C=CC=CC=1C(O)C(Cl)C1=CC=CC=C1 ZCOFOBIIOQWUDE-UHFFFAOYSA-N 0.000 description 1
- BIFYMRJYBXEHHK-UHFFFAOYSA-N 2-chloro-2-(4-fluorophenyl)-1-phenylethanone Chemical compound C1=CC(F)=CC=C1C(Cl)C(=O)C1=CC=CC=C1 BIFYMRJYBXEHHK-UHFFFAOYSA-N 0.000 description 1
- MYCXCBCDXVFXNE-UHFFFAOYSA-N 2-chloro-2-methylpropanoic acid Chemical compound CC(C)(Cl)C(O)=O MYCXCBCDXVFXNE-UHFFFAOYSA-N 0.000 description 1
- RIGHPXPUHJFRHG-UHFFFAOYSA-N 2-chloro-2-phenylacetaldehyde Chemical compound O=CC(Cl)C1=CC=CC=C1 RIGHPXPUHJFRHG-UHFFFAOYSA-N 0.000 description 1
- DDTJFSPKEIAZAM-UHFFFAOYSA-N 2-chloro-3-methylbutanoic acid Chemical compound CC(C)C(Cl)C(O)=O DDTJFSPKEIAZAM-UHFFFAOYSA-N 0.000 description 1
- MGCMOMZLPPXHTK-UHFFFAOYSA-N 2-chloro-4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazole Chemical compound C1=C(OC)C(OC)=CC=C1C1=C(C=2C=C(OC)C(OC)=CC=2)OC(Cl)=N1 MGCMOMZLPPXHTK-UHFFFAOYSA-N 0.000 description 1
- VDEIMNDINOSPDX-UHFFFAOYSA-N 2-chloro-4,5-bis(4-iodophenyl)-1,3-oxazole Chemical compound O1C(Cl)=NC(C=2C=CC(I)=CC=2)=C1C1=CC=C(I)C=C1 VDEIMNDINOSPDX-UHFFFAOYSA-N 0.000 description 1
- KGNHQNUVTIOBFK-UHFFFAOYSA-N 2-chloro-4,5-bis(4-methoxyphenyl)-1,3-oxazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)OC(Cl)=N1 KGNHQNUVTIOBFK-UHFFFAOYSA-N 0.000 description 1
- WJZCYPZHNDZOMM-UHFFFAOYSA-N 2-chloro-4-(3,4-dimethoxyphenyl)-5-phenyl-1,3-oxazole Chemical compound C1=C(OC)C(OC)=CC=C1C1=C(C=2C=CC=CC=2)OC(Cl)=N1 WJZCYPZHNDZOMM-UHFFFAOYSA-N 0.000 description 1
- HNNXQYNYRHTFGS-UHFFFAOYSA-N 2-chloro-4-(4-chlorophenyl)-5-(4-nitrophenyl)-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=C(C=2C=CC(Cl)=CC=2)N=C(Cl)S1 HNNXQYNYRHTFGS-UHFFFAOYSA-N 0.000 description 1
- YSLMDTRURJOEGA-UHFFFAOYSA-N 2-chloro-4-(4-iodophenyl)-5-phenyl-1,3-thiazole Chemical compound S1C(Cl)=NC(C=2C=CC(I)=CC=2)=C1C1=CC=CC=C1 YSLMDTRURJOEGA-UHFFFAOYSA-N 0.000 description 1
- IRCRHHGXKVONAO-UHFFFAOYSA-N 2-chloro-4-(4-methoxyphenyl)-5-phenyl-1,3-oxazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC=CC=2)OC(Cl)=N1 IRCRHHGXKVONAO-UHFFFAOYSA-N 0.000 description 1
- XCAFETNHRKFQFK-UHFFFAOYSA-N 2-chloro-5-(3-fluorophenyl)-4-phenyl-1,3-oxazole Chemical compound FC1=CC=CC(C2=C(N=C(Cl)O2)C=2C=CC=CC=2)=C1 XCAFETNHRKFQFK-UHFFFAOYSA-N 0.000 description 1
- OUIXNZWJUCHYHY-UHFFFAOYSA-N 2-chloro-5-(3-fluorophenyl)-4-phenyl-1,3-thiazole Chemical compound FC1=CC=CC(C2=C(N=C(Cl)S2)C=2C=CC=CC=2)=C1 OUIXNZWJUCHYHY-UHFFFAOYSA-N 0.000 description 1
- FARWJSTVXYIRTQ-UHFFFAOYSA-N 2-chloro-5-(4-chlorophenyl)-4-(4-fluorophenyl)-1,3-thiazole Chemical compound C1=CC(F)=CC=C1C1=C(C=2C=CC(Cl)=CC=2)SC(Cl)=N1 FARWJSTVXYIRTQ-UHFFFAOYSA-N 0.000 description 1
- ZYOPOXZCYCYDPP-UHFFFAOYSA-N 2-chloro-5-(4-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazole Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(Cl)=CC=2)SC(Cl)=N1 ZYOPOXZCYCYDPP-UHFFFAOYSA-N 0.000 description 1
- BALPQJNMGHABBK-UHFFFAOYSA-N 2-chloro-5-(4-fluorophenyl)-4-(4-methylphenyl)-1,3-thiazole Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(F)=CC=2)SC(Cl)=N1 BALPQJNMGHABBK-UHFFFAOYSA-N 0.000 description 1
- PDXNYGYWOYICBU-UHFFFAOYSA-N 2-chloro-5-(4-iodophenyl)-4-phenyl-1,3-oxazole Chemical compound O1C(Cl)=NC(C=2C=CC=CC=2)=C1C1=CC=C(I)C=C1 PDXNYGYWOYICBU-UHFFFAOYSA-N 0.000 description 1
- JXTBMFZJDIDIAW-UHFFFAOYSA-N 2-chloro-5-(4-nitrophenyl)-4-phenyl-1,3-oxazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=C(C=2C=CC=CC=2)N=C(Cl)O1 JXTBMFZJDIDIAW-UHFFFAOYSA-N 0.000 description 1
- RVBUZBPJAGZHSQ-UHFFFAOYSA-N 2-chlorobutanoic acid Chemical compound CCC(Cl)C(O)=O RVBUZBPJAGZHSQ-UHFFFAOYSA-N 0.000 description 1
- SHNUMBLTYZKYIP-UHFFFAOYSA-N 2-chlorodecanoic acid Chemical compound CCCCCCCCC(Cl)C(O)=O SHNUMBLTYZKYIP-UHFFFAOYSA-N 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- QKDQHBXHIDQBQR-UHFFFAOYSA-N 2-chloroheptanoic acid Chemical compound CCCCCC(Cl)C(O)=O QKDQHBXHIDQBQR-UHFFFAOYSA-N 0.000 description 1
- OMPRMWFZHLNRQJ-UHFFFAOYSA-N 2-chlorohexanoic acid Chemical compound CCCCC(Cl)C(O)=O OMPRMWFZHLNRQJ-UHFFFAOYSA-N 0.000 description 1
- BPPQZFLRCMEVEC-UHFFFAOYSA-N 2-chlorononanoic acid Chemical compound CCCCCCCC(Cl)C(O)=O BPPQZFLRCMEVEC-UHFFFAOYSA-N 0.000 description 1
- LIUDEKQOAOAXJZ-UHFFFAOYSA-N 2-chlorooctanoic acid Chemical compound CCCCCCC(Cl)C(O)=O LIUDEKQOAOAXJZ-UHFFFAOYSA-N 0.000 description 1
- WZZRDRYYUVHLRD-UHFFFAOYSA-N 2-chloropentanoic acid Chemical compound CCCC(Cl)C(O)=O WZZRDRYYUVHLRD-UHFFFAOYSA-N 0.000 description 1
- WIEONBWNZIAFGI-UHFFFAOYSA-N 2-chloroundecanoic acid Chemical compound CCCCCCCCCC(Cl)C(O)=O WIEONBWNZIAFGI-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- NHGQBOQYUPIPCD-UHFFFAOYSA-N 2-methyl-2-sulfanylbutanoic acid Chemical compound CCC(C)(S)C(O)=O NHGQBOQYUPIPCD-UHFFFAOYSA-N 0.000 description 1
- DHZYQENDVYAOSE-UHFFFAOYSA-N 2-methylpropane-1-sulfinyl bromide Chemical compound CC(C)CS(Br)=O DHZYQENDVYAOSE-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- WYKHSBAVLOPISI-UHFFFAOYSA-N 2-phenyl-1,3-thiazole Chemical compound C1=CSC(C=2C=CC=CC=2)=N1 WYKHSBAVLOPISI-UHFFFAOYSA-N 0.000 description 1
- NOIMVFVYEQWIRE-UHFFFAOYSA-N 2-phenyl-1,3-thiazole-4-thiol Chemical compound SC1=CSC(C=2C=CC=CC=2)=N1 NOIMVFVYEQWIRE-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical class ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- DZGLTWCHCQNHRX-UHFFFAOYSA-N 3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]propanamide Chemical compound O1C(SCCC(=O)N)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 DZGLTWCHCQNHRX-UHFFFAOYSA-N 0.000 description 1
- OWGXEDGDZFDVML-UHFFFAOYSA-N 3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]propanenitrile Chemical compound O1C(SCCC#N)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 OWGXEDGDZFDVML-UHFFFAOYSA-N 0.000 description 1
- KCRLLTAUMWFTOP-UHFFFAOYSA-N 3-amino-3-oxo-2-sulfanylpropanoic acid Chemical class NC(=O)C(S)C(O)=O KCRLLTAUMWFTOP-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- DBIVLAVBOICUQX-UHFFFAOYSA-N 3-bromopropanamide Chemical compound NC(=O)CCBr DBIVLAVBOICUQX-UHFFFAOYSA-N 0.000 description 1
- CQZIEDXCLQOOEH-UHFFFAOYSA-N 3-bromopropanenitrile Chemical compound BrCCC#N CQZIEDXCLQOOEH-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- XEEMVPPCXNTVNP-UHFFFAOYSA-N 3-chlorobutanoic acid Chemical compound CC(Cl)CC(O)=O XEEMVPPCXNTVNP-UHFFFAOYSA-N 0.000 description 1
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- XPVXACUXQGEZDD-UHFFFAOYSA-N 4,5-diphenyl-3h-1,3-thiazole-2-thione Chemical compound S1C(=S)NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 XPVXACUXQGEZDD-UHFFFAOYSA-N 0.000 description 1
- JKNKFDZDLNUUKE-UHFFFAOYSA-N 4-(1,3-benzodioxol-5-yl)-5-(4-chlorophenyl)-3h-1,3-oxazole-2-thione Chemical compound O1C(S)=NC(C=2C=C3OCOC3=CC=2)=C1C1=CC=C(Cl)C=C1 JKNKFDZDLNUUKE-UHFFFAOYSA-N 0.000 description 1
- ALPVVRJUDPAYQD-UHFFFAOYSA-N 4-(2-methoxyphenyl)-5-phenyl-3h-1,3-oxazole-2-thione Chemical compound COC1=CC=CC=C1C1=C(C=2C=CC=CC=2)OC(=S)N1 ALPVVRJUDPAYQD-UHFFFAOYSA-N 0.000 description 1
- LAUUYBJVBBWZAN-UHFFFAOYSA-N 4-(4-aminophenyl)-5-phenyl-3h-1,3-thiazole-2-thione Chemical compound C1=CC(N)=CC=C1C1=C(C=2C=CC=CC=2)SC(S)=N1 LAUUYBJVBBWZAN-UHFFFAOYSA-N 0.000 description 1
- PQGQYZYOONLMGR-UHFFFAOYSA-N 4-(4-bromophenyl)-2-chloro-5-phenyl-1,3-thiazole Chemical compound S1C(Cl)=NC(C=2C=CC(Br)=CC=2)=C1C1=CC=CC=C1 PQGQYZYOONLMGR-UHFFFAOYSA-N 0.000 description 1
- OUAAFXISTLHEGF-UHFFFAOYSA-N 4-(4-bromophenyl)-5-(4-chlorophenyl)-3h-1,3-oxazole-2-thione Chemical compound O1C(S)=NC(C=2C=CC(Br)=CC=2)=C1C1=CC=C(Cl)C=C1 OUAAFXISTLHEGF-UHFFFAOYSA-N 0.000 description 1
- YUUPIQGTIOBMTJ-UHFFFAOYSA-N 4-(4-bromophenyl)-5-(4-methylphenyl)-3h-1,3-oxazole-2-thione Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(Br)=CC=2)N=C(S)O1 YUUPIQGTIOBMTJ-UHFFFAOYSA-N 0.000 description 1
- SXWJFFXVZGOWKK-UHFFFAOYSA-N 4-(4-bromophenyl)-5-(4-methylphenyl)-3h-1,3-thiazole-2-thione Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC(Br)=CC=2)N=C(S)S1 SXWJFFXVZGOWKK-UHFFFAOYSA-N 0.000 description 1
- XWHLPYGZQGVTAT-UHFFFAOYSA-N 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3h-1,3-oxazole-2-thione Chemical compound C1=C(OC)C(OC)=CC=C1C1=C(C=2C=CC(Cl)=CC=2)N=C(S)O1 XWHLPYGZQGVTAT-UHFFFAOYSA-N 0.000 description 1
- WUEDILIONMHCSW-UHFFFAOYSA-N 4-(4-chlorophenyl)-5-(4-nitrophenyl)-3h-1,3-thiazole-2-thione Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=C(C=2C=CC(Cl)=CC=2)N=C(S)S1 WUEDILIONMHCSW-UHFFFAOYSA-N 0.000 description 1
- PNIHWHUOZMYVQB-UHFFFAOYSA-N 4-(4-hydroxyphenyl)-5-phenyl-3h-1,3-oxazole-2-thione Chemical compound C1=CC(O)=CC=C1C1=C(C=2C=CC=CC=2)OC(S)=N1 PNIHWHUOZMYVQB-UHFFFAOYSA-N 0.000 description 1
- QYCWDRGSXUQJKQ-UHFFFAOYSA-N 4-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]butanal Chemical compound S1C(SCCCC=O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 QYCWDRGSXUQJKQ-UHFFFAOYSA-N 0.000 description 1
- RVLVPRUGOKZJJN-UHFFFAOYSA-N 4-[2-chloro-5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C1=C(C=2C=CC(=CC=2)N(C)C)OC(Cl)=N1 RVLVPRUGOKZJJN-UHFFFAOYSA-N 0.000 description 1
- NIHUUTIZYTZSSW-UHFFFAOYSA-N 4-bromo-2-phenyl-1,3-oxazole Chemical compound BrC1=COC(C=2C=CC=CC=2)=N1 NIHUUTIZYTZSSW-UHFFFAOYSA-N 0.000 description 1
- XGBWZNGTYRKKFE-UHFFFAOYSA-N 4-bromo-2-phenyl-1,3-thiazole Chemical compound BrC1=CSC(C=2C=CC=CC=2)=N1 XGBWZNGTYRKKFE-UHFFFAOYSA-N 0.000 description 1
- XYHHQIWETDSNOP-UHFFFAOYSA-N 4-bromobutanamide Chemical compound NC(=O)CCCBr XYHHQIWETDSNOP-UHFFFAOYSA-N 0.000 description 1
- CQPGDDAKTTWVDD-UHFFFAOYSA-N 4-bromobutanenitrile Chemical compound BrCCCC#N CQPGDDAKTTWVDD-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- IPLKGJHGWCVSOG-UHFFFAOYSA-N 4-chlorobutanoic acid Chemical compound OC(=O)CCCCl IPLKGJHGWCVSOG-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- BIAFFQOREAYRTF-UHFFFAOYSA-N 4-tert-butyl-2-phenyl-1,3-oxazole Chemical compound CC(C)(C)C1=COC(C=2C=CC=CC=2)=N1 BIAFFQOREAYRTF-UHFFFAOYSA-N 0.000 description 1
- MKXVMJBCICINET-UHFFFAOYSA-N 5-(1,3-benzodioxol-5-yl)-2-chloro-4-(4-chlorophenyl)-1,3-oxazole Chemical compound C=1C=C2OCOC2=CC=1C=1OC(Cl)=NC=1C1=CC=C(Cl)C=C1 MKXVMJBCICINET-UHFFFAOYSA-N 0.000 description 1
- QQGORMGWTFAGLB-UHFFFAOYSA-N 5-(1,3-benzodioxol-5-yl)-2-chloro-4-phenyl-1,3-oxazole Chemical compound C=1C=C2OCOC2=CC=1C=1OC(Cl)=NC=1C1=CC=CC=C1 QQGORMGWTFAGLB-UHFFFAOYSA-N 0.000 description 1
- DXPTVRBUUJOMBU-UHFFFAOYSA-N 5-(2-chlorophenyl)-4-(4-methoxyphenyl)-3h-1,3-oxazole-2-thione Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C(=CC=CC=2)Cl)OC(S)=N1 DXPTVRBUUJOMBU-UHFFFAOYSA-N 0.000 description 1
- NJVHPUNGYNOCQN-UHFFFAOYSA-N 5-(3-chlorophenyl)-1,3-oxazole Chemical compound ClC1=CC=CC(C=2OC=NC=2)=C1 NJVHPUNGYNOCQN-UHFFFAOYSA-N 0.000 description 1
- YVAWSOZUJADUSA-UHFFFAOYSA-N 5-(4-bromophenyl)-2-chloro-4-phenyl-1,3-oxazole Chemical compound O1C(Cl)=NC(C=2C=CC=CC=2)=C1C1=CC=C(Br)C=C1 YVAWSOZUJADUSA-UHFFFAOYSA-N 0.000 description 1
- YSXDKDWNIPOSMF-UHFFFAOYSA-N 5-chloropentanoic acid Chemical compound OC(=O)CCCCCl YSXDKDWNIPOSMF-UHFFFAOYSA-N 0.000 description 1
- YPYPBEGIASEWKA-UHFFFAOYSA-N 5-phenyl-1,3-oxazole Chemical compound O1C=NC=C1C1=CC=CC=C1 YPYPBEGIASEWKA-UHFFFAOYSA-N 0.000 description 1
- MOESUCUIWOMFQA-UHFFFAOYSA-N 6-(2-carboxyphenyl)-2,3-dinitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=C([N+]([O-])=O)C([N+]([O-])=O)=C1C(O)=O MOESUCUIWOMFQA-UHFFFAOYSA-N 0.000 description 1
- XWWKSLXUVZVGSP-UHFFFAOYSA-N 6-chlorohexanoic acid Chemical compound OC(=O)CCCCCCl XWWKSLXUVZVGSP-UHFFFAOYSA-N 0.000 description 1
- PLKOZPXBWWDZDW-UHFFFAOYSA-N 7-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]heptanoic acid Chemical compound O1C(SCCCCCCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PLKOZPXBWWDZDW-UHFFFAOYSA-N 0.000 description 1
- UKPCPDOVQZSQQT-UHFFFAOYSA-N 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptan-1-ol Chemical compound S1C(SCCCCCCCO)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 UKPCPDOVQZSQQT-UHFFFAOYSA-N 0.000 description 1
- LXCVOBFYFADBPX-UHFFFAOYSA-N 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanoic acid Chemical compound S1C(SCCCCCCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 LXCVOBFYFADBPX-UHFFFAOYSA-N 0.000 description 1
- GOHMASZFJWDEJB-UHFFFAOYSA-N 7-bromoheptanamide Chemical compound NC(=O)CCCCCCBr GOHMASZFJWDEJB-UHFFFAOYSA-N 0.000 description 1
- IGNBKLCFKTYIRI-UHFFFAOYSA-N 7-chloroheptanoic acid Chemical compound OC(=O)CCCCCCCl IGNBKLCFKTYIRI-UHFFFAOYSA-N 0.000 description 1
- SCTRLHIAVHHIEJ-UHFFFAOYSA-N 8-chlorooctanoic acid Chemical compound OC(=O)CCCCCCCCl SCTRLHIAVHHIEJ-UHFFFAOYSA-N 0.000 description 1
- DFJLDESPZKERQH-UHFFFAOYSA-N 9-chlorononanoic acid Chemical compound OC(=O)CCCCCCCCCl DFJLDESPZKERQH-UHFFFAOYSA-N 0.000 description 1
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- NPVFIHQMUPLLJC-UHFFFAOYSA-N C1(=CC=CC=C1)C=1OC=C(N1)S Chemical compound C1(=CC=CC=C1)C=1OC=C(N1)S NPVFIHQMUPLLJC-UHFFFAOYSA-N 0.000 description 1
- MXGWUJOAJOHHRF-UHFFFAOYSA-N CCC(C)OS(Cl)(=O)=O Chemical compound CCC(C)OS(Cl)(=O)=O MXGWUJOAJOHHRF-UHFFFAOYSA-N 0.000 description 1
- OXWWYZQCAVPMHS-UHFFFAOYSA-N CCOC(C(C1=NC(C2=CC=C(C)C=C2)=C(C2=CC=CC=C2)S1)S)=O Chemical compound CCOC(C(C1=NC(C2=CC=C(C)C=C2)=C(C2=CC=CC=C2)S1)S)=O OXWWYZQCAVPMHS-UHFFFAOYSA-N 0.000 description 1
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- BKUSIZVONSGUMF-UHFFFAOYSA-N COC(CCSC1=NC(C2=CC=CC=C2)=C(C2=CC=CC=C2)O1)=O Chemical compound COC(CCSC1=NC(C2=CC=CC=C2)=C(C2=CC=CC=C2)O1)=O BKUSIZVONSGUMF-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- LSPHULWDVZXLIL-UHFFFAOYSA-N Camphoric acid Natural products CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- OPIHSJTXFDYDIE-UHFFFAOYSA-N ClC1=CC=C(C=C1)C1=C(N=C(S1)C1=CC=CC=C1)N Chemical compound ClC1=CC=C(C=C1)C1=C(N=C(S1)C1=CC=CC=C1)N OPIHSJTXFDYDIE-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- YYLLIJHXUHJATK-UHFFFAOYSA-N Cyclohexyl acetate Chemical compound CC(=O)OC1CCCCC1 YYLLIJHXUHJATK-UHFFFAOYSA-N 0.000 description 1
- 229930182843 D-Lactic acid Natural products 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UWTATZPHSA-N D-lactic acid Chemical compound C[C@@H](O)C(O)=O JVTAAEKCZFNVCJ-UWTATZPHSA-N 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- HWBLTYHIEYOAOL-UHFFFAOYSA-N Diisopropyl sulfate Chemical compound CC(C)OS(=O)(=O)OC(C)C HWBLTYHIEYOAOL-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- QMGVPVSNSZLJIA-UHFFFAOYSA-N Nux Vomica Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OCC=C2CN2C1C46CC2 QMGVPVSNSZLJIA-UHFFFAOYSA-N 0.000 description 1
- UXTVGRGRCJBQTQ-UHFFFAOYSA-N OC(C(C1=NC=CO1)(C(C=C1)=CC=C1Cl)S)=O Chemical compound OC(C(C1=NC=CO1)(C(C=C1)=CC=C1Cl)S)=O UXTVGRGRCJBQTQ-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical class [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BLALBRWEAJQIIL-UHFFFAOYSA-N [Cl].CC(O)=O Chemical compound [Cl].CC(O)=O BLALBRWEAJQIIL-UHFFFAOYSA-N 0.000 description 1
- SYKNUAWMBRIEKB-UHFFFAOYSA-N [Cl].[Br] Chemical compound [Cl].[Br] SYKNUAWMBRIEKB-UHFFFAOYSA-N 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- WRYNUJYAXVDTCB-UHFFFAOYSA-M acetyloxymercury Chemical compound CC(=O)O[Hg] WRYNUJYAXVDTCB-UHFFFAOYSA-M 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000842 anti-protozoal effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000003904 antiprotozoal agent Substances 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical group C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- 238000007193 benzoin condensation reaction Methods 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- MEMRJYWXQDJQMI-UHFFFAOYSA-L bis(ethylsulfanyl)mercury Chemical compound [Hg+2].CC[S-].CC[S-] MEMRJYWXQDJQMI-UHFFFAOYSA-L 0.000 description 1
- 229940116229 borneol Drugs 0.000 description 1
- CKDOCTFBFTVPSN-UHFFFAOYSA-N borneol Natural products C1CC2(C)C(C)CC1C2(C)C CKDOCTFBFTVPSN-UHFFFAOYSA-N 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-M bromoacetate Chemical compound [O-]C(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-M 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 description 1
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- LSPHULWDVZXLIL-QUBYGPBYSA-N camphoric acid Chemical compound CC1(C)[C@H](C(O)=O)CC[C@]1(C)C(O)=O LSPHULWDVZXLIL-QUBYGPBYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- 239000000731 choleretic agent Substances 0.000 description 1
- 230000001989 choleretic effect Effects 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000007278 cyanoethylation reaction Methods 0.000 description 1
- DHQYDHVETSVMKQ-UHFFFAOYSA-N cyclohexyl 2-sulfanylacetate Chemical compound SCC(=O)OC1CCCCC1 DHQYDHVETSVMKQ-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PAFZNILMFXTMIY-UHFFFAOYSA-O cyclohexylammonium Chemical compound [NH3+]C1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-O 0.000 description 1
- OCDXZFSOHJRGIL-UHFFFAOYSA-N cyclohexyloxycyclohexane Chemical compound C1CCCCC1OC1CCCCC1 OCDXZFSOHJRGIL-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000000911 decarboxylating effect Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- CRGRWBQSZSQVIE-UHFFFAOYSA-N diazomethylbenzene Chemical compound [N-]=[N+]=CC1=CC=CC=C1 CRGRWBQSZSQVIE-UHFFFAOYSA-N 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical group C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-O dicyclohexylazanium Chemical compound C1CCCCC1[NH2+]C1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-O 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- GSFDYMMFCGYFJF-UHFFFAOYSA-N diethyl 2-(bromomethyl)propanedioate Chemical compound CCOC(=O)C(CBr)C(=O)OCC GSFDYMMFCGYFJF-UHFFFAOYSA-N 0.000 description 1
- FNJVDWXUKLTFFL-UHFFFAOYSA-N diethyl 2-bromopropanedioate Chemical compound CCOC(=O)C(Br)C(=O)OCC FNJVDWXUKLTFFL-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- 229940019778 diethylene glycol diethyl ether Drugs 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- JYCKNDWZDXGNBW-UHFFFAOYSA-N dipropyl sulfate Chemical compound CCCOS(=O)(=O)OCCC JYCKNDWZDXGNBW-UHFFFAOYSA-N 0.000 description 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- DTGKSKDOIYIVQL-UHFFFAOYSA-N dl-isoborneol Natural products C1CC2(C)C(O)CC1C2(C)C DTGKSKDOIYIVQL-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-N ethanethioic S-acid Chemical compound CC(S)=O DUYAAUVXQSMXQP-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- IOLQWGVDEFWYNP-UHFFFAOYSA-N ethyl 2-bromo-2-methylpropanoate Chemical compound CCOC(=O)C(C)(C)Br IOLQWGVDEFWYNP-UHFFFAOYSA-N 0.000 description 1
- XIMFCGSNSKXPBO-UHFFFAOYSA-N ethyl 2-bromobutanoate Chemical compound CCOC(=O)C(Br)CC XIMFCGSNSKXPBO-UHFFFAOYSA-N 0.000 description 1
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 1
- TUJGBFCJSHWEBG-UHFFFAOYSA-N ethyl 2-carbamoylsulfanylacetate Chemical compound C(N)(=O)SCC(=O)OCC TUJGBFCJSHWEBG-UHFFFAOYSA-N 0.000 description 1
- GNALEXUCJNFKLC-UHFFFAOYSA-N ethyl 2-carbonochloridoyloxyacetate Chemical compound CCOC(=O)COC(Cl)=O GNALEXUCJNFKLC-UHFFFAOYSA-N 0.000 description 1
- PVWKSDFVGFGMKY-UHFFFAOYSA-N ethyl 2-sulfanylbutanoate Chemical compound CCOC(=O)C(S)CC PVWKSDFVGFGMKY-UHFFFAOYSA-N 0.000 description 1
- FQTIYMRSUOADDK-UHFFFAOYSA-N ethyl 3-bromopropanoate Chemical compound CCOC(=O)CCBr FQTIYMRSUOADDK-UHFFFAOYSA-N 0.000 description 1
- MGDWUTQKXCZNAJ-UHFFFAOYSA-N ethyl 4-bromo-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)CBr MGDWUTQKXCZNAJ-UHFFFAOYSA-N 0.000 description 1
- XBPOBCXHALHJFP-UHFFFAOYSA-N ethyl 4-bromobutanoate Chemical compound CCOC(=O)CCCBr XBPOBCXHALHJFP-UHFFFAOYSA-N 0.000 description 1
- OOBFNDGMAGSNKA-UHFFFAOYSA-N ethyl 7-bromoheptanoate Chemical compound CCOC(=O)CCCCCCBr OOBFNDGMAGSNKA-UHFFFAOYSA-N 0.000 description 1
- XKZIVCIHQVDKEZ-UHFFFAOYSA-N ethyl 7-sulfanylheptanoate Chemical compound CCOC(=O)CCCCCCS XKZIVCIHQVDKEZ-UHFFFAOYSA-N 0.000 description 1
- BUBWTSJXUHKBBX-UHFFFAOYSA-N ethyl acetate;sodium Chemical compound [Na].CCOC(C)=O BUBWTSJXUHKBBX-UHFFFAOYSA-N 0.000 description 1
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical group CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 1
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 description 1
- IDNUEBSJWINEMI-UHFFFAOYSA-N ethyl nitrate Chemical compound CCO[N+]([O-])=O IDNUEBSJWINEMI-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229950006191 gluconic acid Drugs 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000007857 hydrazones Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910021506 iron(II) hydroxide Inorganic materials 0.000 description 1
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical compound [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical class CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- FFAPJBSBWKRCLK-UHFFFAOYSA-N n,n-dimethyl-4-(1,3-thiazol-2-yl)aniline Chemical compound C1=CC(N(C)C)=CC=C1C1=NC=CS1 FFAPJBSBWKRCLK-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- TYDFLVGVWMSQAC-UHFFFAOYSA-N n-chloro-n-ethylethanamine Chemical compound CCN(Cl)CC TYDFLVGVWMSQAC-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CSDTZUBPSYWZDX-UHFFFAOYSA-N n-pentyl nitrite Chemical compound CCCCCON=O CSDTZUBPSYWZDX-UHFFFAOYSA-N 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- JBCXQJHXIYZCNI-UHFFFAOYSA-N nitro benzoate Chemical compound [O-][N+](=O)OC(=O)C1=CC=CC=C1 JBCXQJHXIYZCNI-UHFFFAOYSA-N 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical group O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- OSDZHDOKXGSWOD-UHFFFAOYSA-N nitroxyl;hydrochloride Chemical class Cl.O=N OSDZHDOKXGSWOD-UHFFFAOYSA-N 0.000 description 1
- JVJQPDTXIALXOG-UHFFFAOYSA-N nitryl fluoride Chemical compound [O-][N+](F)=O JVJQPDTXIALXOG-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 150000004727 oxaloacetic acid derivatives Chemical class 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- IMACFCSSMIZSPP-UHFFFAOYSA-N phenacyl chloride Chemical compound ClCC(=O)C1=CC=CC=C1 IMACFCSSMIZSPP-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 208000037821 progressive disease Diseases 0.000 description 1
- MAUIZVRLYLDWDK-UHFFFAOYSA-N propan-2-yl thiohypochlorite Chemical compound CC(C)SCl MAUIZVRLYLDWDK-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 235000008160 pyridoxine Nutrition 0.000 description 1
- 239000011677 pyridoxine Substances 0.000 description 1
- 229960001404 quinidine Drugs 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- VIZKNPCUYVYNQR-UHFFFAOYSA-M sodium 2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-sulfanylacetate Chemical compound [Na+].C1(=CC=CC=C1)C=1N=C(OC=1C1=CC=CC=C1)C(C(=O)[O-])S VIZKNPCUYVYNQR-UHFFFAOYSA-M 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Inorganic materials [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- LEDMRZGFZIAGGB-UHFFFAOYSA-L strontium carbonate Chemical class [Sr+2].[O-]C([O-])=O LEDMRZGFZIAGGB-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid group Chemical class S(N)(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000007970 thio esters Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229940011671 vitamin b6 Drugs 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- XLOMVQKBTHCTTD-UHFFFAOYSA-N zinc oxide Inorganic materials [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/46—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (38)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2129012A DE2129012A1 (de) | 1971-06-11 | 1971-06-11 | Azol-derivate |
| ZA723502A ZA723502B (en) | 1971-06-11 | 1972-05-22 | Azole derivatives |
| GB2419572A GB1331408A (en) | 1971-06-11 | 1972-05-23 | Azole derivatives |
| IL39528A IL39528A (en) | 1971-06-11 | 1972-05-25 | History of 4,5-diaryl-2-oxazolyl and 2-thiazolyl-alkanoic mercanoic acid |
| RO71023A RO60483A (enExample) | 1971-06-11 | 1972-05-25 | |
| CS4416*A CS167988B2 (enExample) | 1971-06-11 | 1972-05-29 | |
| CS4415*A CS167987B2 (enExample) | 1971-06-11 | 1972-05-29 | |
| CS4417*A CS167989B2 (enExample) | 1971-06-11 | 1972-05-29 | |
| CS3691A CS167984B2 (enExample) | 1971-06-11 | 1972-05-29 | |
| AU42850/72A AU462556B2 (en) | 1971-06-11 | 1972-05-29 | Azole derivatives |
| CS4414*A CS167986B2 (enExample) | 1971-06-11 | 1972-05-29 | |
| CS4413*A CS167985B2 (enExample) | 1971-06-11 | 1972-05-29 | |
| CH28876A CH584702A5 (enExample) | 1971-06-11 | 1972-05-31 | |
| CH28776A CH584701A5 (enExample) | 1971-06-11 | 1972-05-31 | |
| CH806272A CH584700A5 (enExample) | 1971-06-11 | 1972-05-31 | |
| CH28976A CH584210A5 (enExample) | 1971-06-11 | 1972-05-31 | |
| CH28576A CH585213A5 (enExample) | 1971-06-11 | 1972-05-31 | |
| CH28676A CH590856A5 (enExample) | 1971-06-11 | 1972-05-31 | |
| SE7207357A SE381467B (sv) | 1971-06-11 | 1972-06-05 | Forfarande for framstellning av azolderivat |
| US05/260,307 US3933840A (en) | 1971-06-11 | 1972-06-06 | Azole derivatives |
| AT489572A AT328440B (de) | 1971-06-11 | 1972-06-07 | Verfahren zur herstellung von neuen 4,5-diaryloxazol- bzw. -thiazol-2-mercaptoalkansauren und deren derivaten |
| AT136474*1A AT323158B (de) | 1971-06-11 | 1972-06-07 | Verfahren zur herstellung von neuen 4,5-diaryloxazol- bzw. -thiazol-2-mercaptoalkansauren und deren derivaten |
| NL7207784A NL7207784A (enExample) | 1971-06-11 | 1972-06-08 | |
| FR7220858A FR2140632B1 (enExample) | 1971-06-11 | 1972-06-09 | |
| BE784682A BE784682A (fr) | 1971-06-11 | 1972-06-09 | Derives d'azoles |
| DD163592A DD97206A5 (enExample) | 1971-06-11 | 1972-06-09 | |
| HUME1505A HU166271B (enExample) | 1971-06-11 | 1972-06-09 | |
| CA144,331A CA1008863A (en) | 1971-06-11 | 1972-06-09 | Azole derivatives |
| PL1972155917A PL79513B1 (enExample) | 1971-06-11 | 1972-06-09 | |
| BR3714/72A BR7203714D0 (pt) | 1971-06-11 | 1972-06-09 | Processo para a preparacao de uma composicao contendo derivados de azol |
| ES403741A ES403741A1 (es) | 1971-06-11 | 1972-06-10 | Procedimiento para la obtencion de derivados azolicos. |
| JP5775772A JPS5728705B1 (enExample) | 1971-06-11 | 1972-06-12 | |
| AT136774*1A AT327891B (de) | 1971-06-11 | 1974-02-20 | Verfahren zur herstellung von neuen 4,5-diaryloxazol- bzw. -thiazol-2-mercaptoalkansauren und deren derivaten |
| AT136874*1A AT327892B (de) | 1971-06-11 | 1974-02-20 | Verfahren zur herstellung von neuen 4,5-diaryloxazol- bzw. -thiazol-2-mercaptoalkansauren und deren derivaten |
| AT136674*1A AT327890B (de) | 1971-06-11 | 1974-02-20 | Verfahren zur herstellung von neuen 4,5-diaryloxazol- bzw. -thiazol-2-mercaptoalkansauren und deren derivaten |
| AT136574*1A AT327889B (de) | 1971-06-11 | 1974-02-20 | Verfahren zur herstellung von neuen 4,5-diaryloxazol- bzw. -thiazol-2-mercaptoalkansauren und deren derivaten |
| ES439448A ES439448A1 (es) | 1971-06-11 | 1975-07-15 | Procedimiento para la obtencion de acido 2-(4,5-bis-p-cloro-genil-3-oxazolilmercapto)-propionico y sus sales. |
| US05/624,447 US4051250A (en) | 1971-06-11 | 1975-10-21 | Antiinflammatory azole derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2129012A DE2129012A1 (de) | 1971-06-11 | 1971-06-11 | Azol-derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2129012A1 true DE2129012A1 (de) | 1973-01-04 |
Family
ID=5810494
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2129012A Withdrawn DE2129012A1 (de) | 1971-06-11 | 1971-06-11 | Azol-derivate |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US3933840A (enExample) |
| JP (1) | JPS5728705B1 (enExample) |
| AT (6) | AT323158B (enExample) |
| AU (1) | AU462556B2 (enExample) |
| BE (1) | BE784682A (enExample) |
| BR (1) | BR7203714D0 (enExample) |
| CA (1) | CA1008863A (enExample) |
| CH (6) | CH584210A5 (enExample) |
| CS (6) | CS167984B2 (enExample) |
| DD (1) | DD97206A5 (enExample) |
| DE (1) | DE2129012A1 (enExample) |
| ES (2) | ES403741A1 (enExample) |
| FR (1) | FR2140632B1 (enExample) |
| GB (1) | GB1331408A (enExample) |
| HU (1) | HU166271B (enExample) |
| IL (1) | IL39528A (enExample) |
| NL (1) | NL7207784A (enExample) |
| PL (1) | PL79513B1 (enExample) |
| RO (1) | RO60483A (enExample) |
| SE (1) | SE381467B (enExample) |
| ZA (1) | ZA723502B (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2942050A1 (de) * | 1978-10-17 | 1980-04-24 | Eni Ente Naz Idrocarb | 2- amino- oder 2-thio-substituierte 4,5-diphenyl-oxazol-derivate und verfahren zu deren herstellung |
| EP0029171A1 (de) * | 1979-11-17 | 1981-05-27 | Bayer Ag | Azolyloxy-carbonsäure-N-oxy-amide, Verfahren und Zwischenprodukte zu ihrer Herstellung, ihre Verwendung, sie enthaltende herbizide Mittel und deren Herstellung |
| EP0061425A3 (de) * | 1981-03-18 | 1982-12-15 | Ciba-Geigy Ag | Neue Thiazolderivate, Verfahren zu ihrer Herstellung, diese enthaltende pharmazeutische Präparate und ihre Verwendung |
| US4762848A (en) * | 1985-03-12 | 1988-08-09 | Hoechst Aktiengesellschaft | 1,3-thiazoles and their use as immunomodulators |
| EP0434034A1 (en) * | 1989-12-20 | 1991-06-26 | Bristol-Myers Squibb Company | Oxazole derivatives |
| EP0331966B1 (de) * | 1988-03-05 | 1992-09-23 | Bayer Ag | Substituierte Acrylsäureester |
| WO2023144326A1 (de) * | 2022-01-28 | 2023-08-03 | Symrise Ag | Neue kühlstoffe und zubereitungen, die diese enthalten |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2129012A1 (de) * | 1971-06-11 | 1973-01-04 | Merck Patent Gmbh | Azol-derivate |
| US4089865A (en) * | 1971-10-27 | 1978-05-16 | Syntex (U.S.A.) Inc. | Certain thiazole compounds |
| GB1507032A (en) * | 1974-08-06 | 1978-04-12 | Serono Lab | 2-thiol-4,5-diphenyloxazole s-derivatives |
| DE2549998A1 (de) * | 1975-11-07 | 1977-05-12 | Merck Patent Gmbh | Mittel zur hemmung der thrombozytenaggregation |
| DE3060330D1 (en) * | 1979-04-06 | 1982-06-09 | Bayer Ag | Azolyloxy-acetamides, process for their preparation and their use as herbicides |
| DE3336846A1 (de) * | 1983-10-11 | 1985-04-25 | Bayer Ag, 5090 Leverkusen | Neue 2-mercaptothiazolderivate, verfahren zu deren herstellung sowie die verwendung von 2-mercaptothiazolderivaten in arzneimitteln |
| GB8610432D0 (en) * | 1986-04-29 | 1986-06-04 | Akzo Nv | Amino-thiazole & oxazole derivatives |
| USRE34242E (en) * | 1986-04-29 | 1993-05-04 | Akzo N.V. | Amino-oxazole compounds having dopaminergic activity |
| JPH02145524A (ja) * | 1988-11-29 | 1990-06-05 | Katsumi Nagata | 木酢液より得られる医薬品原料の製造方法 |
| US5545755A (en) * | 1989-05-31 | 1996-08-13 | The Upjohn Company | Therapeutically useful 2-aminotetralin derivatives |
| AU654653B2 (en) * | 1989-05-31 | 1994-11-17 | Pharmacia & Upjohn Company | Therapeutically useful 2-aminotetralin derivatives |
| US5840915A (en) * | 1990-01-22 | 1998-11-24 | Hoechst Marion Roussel, Inc. | Process for the enatioselective synthesis of intermediates used |
| US5274117A (en) * | 1990-01-22 | 1993-12-28 | Hoechst-Roussel Pharmaceuticals, Inc. | Process for the enantioselective synthesis of intermediates used in the preparation of physostigmine |
| FR2663331B1 (fr) * | 1990-06-14 | 1994-05-06 | Bellon Laboratoires | Nouveaux derives de l'oxazole, leur preparation et les compositions pharmaceutiques qui les contiennent. |
| US5380738A (en) * | 1993-05-21 | 1995-01-10 | Monsanto Company | 2-substituted oxazoles further substituted by 4-fluorophenyl and 4-methylsulfonylphenyl as antiinflammatory agents |
| US6515014B2 (en) | 1995-06-02 | 2003-02-04 | G. D. Searle & Co. | Thiophene substituted hydroxamic acid derivatives as cyclooxygenase-2 and 5-lipoxygenase inhibitors |
| US6512121B2 (en) | 1998-09-14 | 2003-01-28 | G.D. Searle & Co. | Heterocyclo substituted hydroxamic acid derivatives as cyclooxygenase-2 and 5-lipoxygenase inhibitors |
| WO1996038418A1 (en) | 1995-06-02 | 1996-12-05 | G.D. Searle & Co. | Heterocyclo substituted hydroxamic acid derivatives as cyclooxygenase-2 and 5-lipoxygenase inhibitors |
| US6677364B2 (en) | 1998-04-20 | 2004-01-13 | G.D. Searle & Co. | Substituted sulfonylphenylheterocycles as cyclooxygenase-2 and 5-lipoxygenase inhibitors |
| US7358254B2 (en) * | 2001-07-13 | 2008-04-15 | Bristol-Myers Squibb Company | Method for treating atherosclerosis employing an aP2 inhibitor and combination |
| DE69939481D1 (de) | 1998-09-17 | 2008-10-16 | Bristol Myers Squibb Co | Methode zur behandlung von diabetes die einen ap2-inhibitor und dazugehörige kombinationen verwendet |
| US7390824B1 (en) | 1999-09-07 | 2008-06-24 | Bristol-Myers Squibb Company | Method for treating diabetes employing an aP2 inhibitor and combination |
| US20030105144A1 (en) | 2001-04-17 | 2003-06-05 | Ping Gao | Stabilized oral pharmaceutical composition |
| US7329401B2 (en) * | 2002-04-15 | 2008-02-12 | The Regents Of The University Of California | Cyclooxygenase-2 selective agents useful as imaging probes and related methods |
| TW200505446A (en) * | 2003-01-17 | 2005-02-16 | Fuj Isawa Pharmaceutical Co Ltd | Inhibitor of cox |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2513923A (en) * | 1947-11-10 | 1950-07-04 | Ilford Ltd | Dyestuffs from s-(thiazolyl-2)-thioglycollic acid and method for preparing same |
| US3578671A (en) * | 1967-11-06 | 1971-05-11 | Wyeth John & Brother Ltd | Oxazoles |
| DE2129012A1 (de) * | 1971-06-11 | 1973-01-04 | Merck Patent Gmbh | Azol-derivate |
-
1971
- 1971-06-11 DE DE2129012A patent/DE2129012A1/de not_active Withdrawn
-
1972
- 1972-05-22 ZA ZA723502A patent/ZA723502B/xx unknown
- 1972-05-23 GB GB2419572A patent/GB1331408A/en not_active Expired
- 1972-05-25 RO RO71023A patent/RO60483A/ro unknown
- 1972-05-25 IL IL39528A patent/IL39528A/en unknown
- 1972-05-29 CS CS3691A patent/CS167984B2/cs unknown
- 1972-05-29 CS CS4415*A patent/CS167987B2/cs unknown
- 1972-05-29 CS CS4413*A patent/CS167985B2/cs unknown
- 1972-05-29 CS CS4417*A patent/CS167989B2/cs unknown
- 1972-05-29 AU AU42850/72A patent/AU462556B2/en not_active Expired
- 1972-05-29 CS CS4416*A patent/CS167988B2/cs unknown
- 1972-05-29 CS CS4414*A patent/CS167986B2/cs unknown
- 1972-05-31 CH CH28976A patent/CH584210A5/xx not_active IP Right Cessation
- 1972-05-31 CH CH28676A patent/CH590856A5/xx not_active IP Right Cessation
- 1972-05-31 CH CH806272A patent/CH584700A5/xx not_active IP Right Cessation
- 1972-05-31 CH CH28776A patent/CH584701A5/xx not_active IP Right Cessation
- 1972-05-31 CH CH28576A patent/CH585213A5/xx not_active IP Right Cessation
- 1972-05-31 CH CH28876A patent/CH584702A5/xx not_active IP Right Cessation
- 1972-06-05 SE SE7207357A patent/SE381467B/xx unknown
- 1972-06-06 US US05/260,307 patent/US3933840A/en not_active Expired - Lifetime
- 1972-06-07 AT AT136474*1A patent/AT323158B/de not_active IP Right Cessation
- 1972-06-07 AT AT489572A patent/AT328440B/de not_active IP Right Cessation
- 1972-06-08 NL NL7207784A patent/NL7207784A/xx not_active Application Discontinuation
- 1972-06-09 CA CA144,331A patent/CA1008863A/en not_active Expired
- 1972-06-09 BE BE784682A patent/BE784682A/xx unknown
- 1972-06-09 PL PL1972155917A patent/PL79513B1/pl unknown
- 1972-06-09 HU HUME1505A patent/HU166271B/hu unknown
- 1972-06-09 BR BR3714/72A patent/BR7203714D0/pt unknown
- 1972-06-09 DD DD163592A patent/DD97206A5/xx unknown
- 1972-06-09 FR FR7220858A patent/FR2140632B1/fr not_active Expired
- 1972-06-10 ES ES403741A patent/ES403741A1/es not_active Expired
- 1972-06-12 JP JP5775772A patent/JPS5728705B1/ja active Pending
-
1974
- 1974-02-20 AT AT136674*1A patent/AT327890B/de active
- 1974-02-20 AT AT136574*1A patent/AT327889B/de active
- 1974-02-20 AT AT136774*1A patent/AT327891B/de not_active IP Right Cessation
- 1974-02-20 AT AT136874*1A patent/AT327892B/de active
-
1975
- 1975-07-15 ES ES439448A patent/ES439448A1/es not_active Expired
- 1975-10-21 US US05/624,447 patent/US4051250A/en not_active Expired - Lifetime
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2942050A1 (de) * | 1978-10-17 | 1980-04-24 | Eni Ente Naz Idrocarb | 2- amino- oder 2-thio-substituierte 4,5-diphenyl-oxazol-derivate und verfahren zu deren herstellung |
| EP0029171A1 (de) * | 1979-11-17 | 1981-05-27 | Bayer Ag | Azolyloxy-carbonsäure-N-oxy-amide, Verfahren und Zwischenprodukte zu ihrer Herstellung, ihre Verwendung, sie enthaltende herbizide Mittel und deren Herstellung |
| EP0061425A3 (de) * | 1981-03-18 | 1982-12-15 | Ciba-Geigy Ag | Neue Thiazolderivate, Verfahren zu ihrer Herstellung, diese enthaltende pharmazeutische Präparate und ihre Verwendung |
| US4762848A (en) * | 1985-03-12 | 1988-08-09 | Hoechst Aktiengesellschaft | 1,3-thiazoles and their use as immunomodulators |
| EP0331966B1 (de) * | 1988-03-05 | 1992-09-23 | Bayer Ag | Substituierte Acrylsäureester |
| EP0434034A1 (en) * | 1989-12-20 | 1991-06-26 | Bristol-Myers Squibb Company | Oxazole derivatives |
| WO2023144326A1 (de) * | 2022-01-28 | 2023-08-03 | Symrise Ag | Neue kühlstoffe und zubereitungen, die diese enthalten |
| WO2023143741A1 (de) * | 2022-01-28 | 2023-08-03 | Symrise Ag | Neue kühlstoffe und zubereitungen, die diese enthalten |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2129012A1 (de) | Azol-derivate | |
| DE69835434T2 (de) | Verwendung von colchinolderivate zur gefässschädigung | |
| DE69209395T2 (de) | Therapeutische Amide | |
| DE3884563T2 (de) | Aminomethyl-oxo-oxazolidinyl-ethenylbenzen-Derivate, nützlich als antibakterielles Mittel. | |
| DE60025621T2 (de) | O-anisamid-derivate | |
| WO2000018749A1 (de) | Indeno-, naphtho- und benzocyclohepta-dihydrothiazol derivate, deren herstellung und deren verwendung als anorektische arzneimittel | |
| JPS6330458A (ja) | アシルアニリド,その製法及びこの化合物を含む黄体ホルモン様作用を有する医薬又は獣医薬組成物 | |
| DE3685829T2 (de) | Heterocyclische amide. | |
| WO2001062746A1 (de) | 8,8a-DIHYDRO-INDENO[1,2-d]THIAZOL-DERIVATE, DIE IN 8a-STELLUNG SUBSTITUIERT SIND; VERFAHREN ZU IHRER HERSTELLUNG UND IHRE VERWENDUNG ALS ARZNEIMITTEL Z.B. ALS ANOREKTIKA | |
| DE2122273C3 (de) | Substituierte Phenylessigsäureverbindungen, sie enthaltende entzündungshemmende, antipyretische und analgetische Mittel und Verfahren zu ihrer Herstellung | |
| US5185370A (en) | Substituted β-diketones and their use | |
| US4018830A (en) | Phenylthioaralkylamines | |
| DE3884858T2 (de) | Phenol-thioalkylamide als Inhibitoren von 5-Lipoxygenase. | |
| EP0043788A1 (de) | Neue Imidazol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| Thirtle | 2-Mercaptopyridine | |
| CA1128517A (en) | Disulfide compounds | |
| US4055665A (en) | Treating arrythmia with phenylthioaralkylamines | |
| DE1593728C3 (de) | Substituierte Amidine und Verfahren zu ihrer Herstellung | |
| DE2950095A1 (de) | Benzothiazolderivate, diese enthaltende pharmazeutische zubereitungen und verfahren zu ihrer herstellung | |
| CH536311A (de) | Verfahren zur Herstellung neuer trisubstituierter Oxagole | |
| DD295344A5 (de) | Benzanilide | |
| US4025528A (en) | Thiazole derivatives of benzoic and phenylalkanoic acids | |
| DE3888394T2 (de) | Phenolische Thioäther, Sulfoxide und Disulfide als Hemmstoffe der 5-Lipoxigenase. | |
| US4301167A (en) | 2-Amino thiazoline derivatives | |
| FR2556721A1 (fr) | Nouveaux derives de o-mercaptopropanamide d'o amino-acides, leur procede de preparation, leur application comme medicaments et les compositions les renfermant |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |