DE2114804C3 - - Google Patents
Info
- Publication number
- DE2114804C3 DE2114804C3 DE19712114804 DE2114804A DE2114804C3 DE 2114804 C3 DE2114804 C3 DE 2114804C3 DE 19712114804 DE19712114804 DE 19712114804 DE 2114804 A DE2114804 A DE 2114804A DE 2114804 C3 DE2114804 C3 DE 2114804C3
- Authority
- DE
- Germany
- Prior art keywords
- bromine
- discharge vessel
- excess
- mercury vapor
- discharge
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 20
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 20
- 229910052794 bromium Inorganic materials 0.000 claims description 20
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 13
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 7
- -1 rare earth halides Chemical class 0.000 claims description 6
- 229910052692 Dysprosium Inorganic materials 0.000 claims description 5
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 229910052753 mercury Inorganic materials 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 150000002910 rare earth metals Chemical class 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- 229910052689 Holmium Inorganic materials 0.000 claims description 3
- 150000001649 bromium compounds Chemical class 0.000 claims description 3
- 229910052792 caesium Inorganic materials 0.000 claims description 3
- KJZYNXUDTRRSPN-UHFFFAOYSA-N holmium atom Chemical compound [Ho] KJZYNXUDTRRSPN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- 229910052775 Thulium Inorganic materials 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical compound [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- NGYIMTKLQULBOO-UHFFFAOYSA-L mercury dibromide Chemical compound Br[Hg]Br NGYIMTKLQULBOO-UHFFFAOYSA-L 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/125—Selection of substances for gas fillings; Specified operating pressure or temperature having an halogenide as principal component
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712114804 DE2114804B2 (de) | 1971-03-26 | 1971-03-26 | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden |
| AT185872A AT312096B (de) | 1971-03-26 | 1972-03-06 | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz |
| IT6778772A IT969547B (it) | 1971-03-26 | 1972-03-13 | Lampada a scarica ad alta pressione a vapori di mercurio con aggiunta di alogenuro metallico |
| FR7208976A FR2130255B2 (OSRAM) | 1971-03-26 | 1972-03-15 | |
| HUTE000635 HU163359B (OSRAM) | 1971-03-26 | 1972-03-24 | |
| BR176672A BR7201766D0 (pt) | 1971-03-26 | 1972-03-24 | Uma lampada de vapor de mercurio de alta pressao |
| GB1397172A GB1376509A (en) | 1971-03-26 | 1972-03-24 | High-pressure mercury vapour discharge lamps |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712114804 DE2114804B2 (de) | 1971-03-26 | 1971-03-26 | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2114804A1 DE2114804A1 (de) | 1972-10-05 |
| DE2114804B2 DE2114804B2 (de) | 1978-09-14 |
| DE2114804C3 true DE2114804C3 (OSRAM) | 1979-05-17 |
Family
ID=5802892
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712114804 Granted DE2114804B2 (de) | 1971-03-26 | 1971-03-26 | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden |
Country Status (7)
| Country | Link |
|---|---|
| AT (1) | AT312096B (OSRAM) |
| BR (1) | BR7201766D0 (OSRAM) |
| DE (1) | DE2114804B2 (OSRAM) |
| FR (1) | FR2130255B2 (OSRAM) |
| GB (1) | GB1376509A (OSRAM) |
| HU (1) | HU163359B (OSRAM) |
| IT (1) | IT969547B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3427280C2 (de) * | 1984-07-24 | 1986-06-12 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Metallhalogenid-Hochdruckentladungslampe |
| DE3506295A1 (de) * | 1985-02-22 | 1986-08-28 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Kompakte hochdruckentladungslampe |
| NL8502509A (nl) * | 1985-09-13 | 1987-04-01 | Philips Nv | Hogedrukkwikdampontladingslamp. |
| HU196861B (en) * | 1987-01-23 | 1989-01-30 | Tungsram Reszvenytarsasag | Low colour-temperature high-pressure metal-halide lamp with good colour reproduction |
| GB8707670D0 (en) * | 1987-03-31 | 1987-05-07 | Emi Plc Thorn | Ceramic metal halide lamps |
| DE4030202A1 (de) * | 1990-09-24 | 1992-03-26 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Metallhalogenid-hochdruckentladungslampe |
| DE4040858A1 (de) * | 1990-12-20 | 1992-06-25 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Metallhalogenid-hochdruckentladungslampe |
| US5831388A (en) * | 1995-08-23 | 1998-11-03 | Patent-Truehand-Gesellschaftfuer Elektrische Gluelampen Mbh | Rare earth metal halide lamp including niobium |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1153453B (de) * | 1961-06-02 | 1963-08-29 | Patra Patent Treuhand | Hochdruckentladungslampe mit Metallhalogeniddampf und hoher Lichtausbeute |
-
1971
- 1971-03-26 DE DE19712114804 patent/DE2114804B2/de active Granted
-
1972
- 1972-03-06 AT AT185872A patent/AT312096B/de not_active IP Right Cessation
- 1972-03-13 IT IT6778772A patent/IT969547B/it active
- 1972-03-15 FR FR7208976A patent/FR2130255B2/fr not_active Expired
- 1972-03-24 GB GB1397172A patent/GB1376509A/en not_active Expired
- 1972-03-24 BR BR176672A patent/BR7201766D0/pt unknown
- 1972-03-24 HU HUTE000635 patent/HU163359B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1376509A (en) | 1974-12-04 |
| BR7201766D0 (pt) | 1973-06-28 |
| AT312096B (de) | 1973-12-10 |
| DE2114804B2 (de) | 1978-09-14 |
| HU163359B (OSRAM) | 1973-07-28 |
| IT969547B (it) | 1974-04-10 |
| DE2114804A1 (de) | 1972-10-05 |
| FR2130255A2 (OSRAM) | 1972-11-03 |
| FR2130255B2 (OSRAM) | 1977-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3716485C1 (de) | Xenon-Kurzbogen-Entladungslampe | |
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| EP2128888B1 (de) | Quecksilberfreie Metallhalogenid-Hochdruckentladungslampe | |
| DE1940539A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz | |
| EP0453893B1 (de) | Hochdruckentladungslampe | |
| DE3813421A1 (de) | Hochdruck-quecksilberdampfentladungslampe | |
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2114804C3 (OSRAM) | ||
| DE2422411A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE3110812C2 (OSRAM) | ||
| DE2511931A1 (de) | Hg-hochdrucklampe mit metallhalogenidzusatz | |
| DE3210809A1 (de) | Hochleistungs-miniatur-metallhalogenid-bogenentladungslampe | |
| DE2510145A1 (de) | Elektrische lampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE2725297A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE3733217C2 (OSRAM) | ||
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE2456757A1 (de) | Metallhalogenid-hochdruckgasentladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE2903963A1 (de) | Entladungslampe und ihre verwendung | |
| DE3242752A1 (de) | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen | |
| DE7111644U (de) | Quecksilberdampf-hochdruckentladungslampe mit metallhalogenidzusatz |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |