DE19947457A1 - 2'-Substituierte 1,1'-Biphenyl-2-carbonamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie enthaltende pharmazeutische Zubereitungen - Google Patents
2'-Substituierte 1,1'-Biphenyl-2-carbonamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie enthaltende pharmazeutische ZubereitungenInfo
- Publication number
- DE19947457A1 DE19947457A1 DE19947457A DE19947457A DE19947457A1 DE 19947457 A1 DE19947457 A1 DE 19947457A1 DE 19947457 A DE19947457 A DE 19947457A DE 19947457 A DE19947457 A DE 19947457A DE 19947457 A1 DE19947457 A1 DE 19947457A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- biphenyl
- carboxylic acid
- alkyl
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 206010003658 Atrial Fibrillation Diseases 0.000 title claims description 12
- 206010003662 Atrial flutter Diseases 0.000 title claims description 6
- 206010042600 Supraventricular arrhythmias Diseases 0.000 title claims description 4
- 239000003450 potassium channel blocker Substances 0.000 title description 2
- ZUFXOLHMADEDCB-UHFFFAOYSA-N 2-[2-(aminomethyl)phenyl]benzamide Chemical class NCC1=CC=CC=C1C1=CC=CC=C1C(N)=O ZUFXOLHMADEDCB-UHFFFAOYSA-N 0.000 title 1
- -1 2'-(N-Substituted aminomethyl)-biphenyl-2-carboxamides Chemical class 0.000 claims abstract description 85
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 37
- 150000003839 salts Chemical class 0.000 claims abstract description 29
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 13
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims abstract description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 13
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 12
- 125000002541 furyl group Chemical group 0.000 claims abstract description 11
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims abstract description 11
- 125000001544 thienyl group Chemical group 0.000 claims abstract description 11
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 65
- 125000004432 carbon atom Chemical group C* 0.000 claims description 49
- 239000003814 drug Substances 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052731 fluorine Inorganic materials 0.000 claims description 9
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 238000011321 prophylaxis Methods 0.000 claims description 8
- 108091006146 Channels Proteins 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 7
- 206010003119 arrhythmia Diseases 0.000 claims description 7
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 238000002560 therapeutic procedure Methods 0.000 claims description 7
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 6
- 239000000969 carrier Substances 0.000 claims description 5
- 229940079593 drug Drugs 0.000 claims description 5
- 230000036982 action potential Effects 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 4
- 230000000903 blocking effect Effects 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 230000006793 arrhythmia Effects 0.000 claims description 3
- 201000010099 disease Diseases 0.000 claims description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 3
- 239000002876 beta blocker Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims 2
- 229940097320 beta blocking agent Drugs 0.000 claims 1
- 230000001404 mediated effect Effects 0.000 claims 1
- 239000002831 pharmacologic agent Substances 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract description 8
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 4
- 229910006074 SO2NH2 Inorganic materials 0.000 abstract 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 abstract 3
- 125000001475 halogen functional group Chemical group 0.000 abstract 3
- 125000000565 sulfonamide group Chemical group 0.000 abstract 3
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical group F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 abstract 2
- 108010081348 HRT1 protein Hairy Chemical group 0.000 abstract 2
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 abstract 2
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical group F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 abstract 2
- 125000005004 perfluoroethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 abstract 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical class C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 abstract 1
- 239000002243 precursor Substances 0.000 description 59
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- 238000000034 method Methods 0.000 description 23
- 239000000243 solution Substances 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- MCJOUORSTIRIDM-UHFFFAOYSA-N 2-[2-(phenylmethoxycarbonylaminomethyl)phenyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)OCC1=CC=CC=C1 MCJOUORSTIRIDM-UHFFFAOYSA-N 0.000 description 16
- ACMMGZHFCQTLSC-UHFFFAOYSA-N 2-[2-(aminomethyl)phenyl]-n-(2-pyridin-2-ylethyl)benzamide Chemical compound NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=N1 ACMMGZHFCQTLSC-UHFFFAOYSA-N 0.000 description 14
- IIGZCWFZJWLNNT-UHFFFAOYSA-N 2-[2-(aminomethyl)phenyl]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CN IIGZCWFZJWLNNT-UHFFFAOYSA-N 0.000 description 14
- 238000003818 flash chromatography Methods 0.000 description 13
- PRUQKUCYGRIPQS-UHFFFAOYSA-N 2-[2-(aminomethyl)phenyl]-n-(2-phenylethyl)benzamide Chemical compound NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 PRUQKUCYGRIPQS-UHFFFAOYSA-N 0.000 description 12
- 101001026214 Homo sapiens Potassium voltage-gated channel subfamily A member 5 Proteins 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 239000003416 antiarrhythmic agent Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- FGAWPQFJKMZANL-UHFFFAOYSA-N 2-[2-(aminomethyl)phenyl]-n-benzylbenzamide Chemical compound NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCC1=CC=CC=C1 FGAWPQFJKMZANL-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 238000004140 cleaning Methods 0.000 description 7
- 238000000605 extraction Methods 0.000 description 7
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 7
- ILYSAKHOYBPSPC-UHFFFAOYSA-N 2-phenylbenzoic acid Chemical class OC(=O)C1=CC=CC=C1C1=CC=CC=C1 ILYSAKHOYBPSPC-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000003213 activating effect Effects 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 5
- YHXKXVFQHWJYOD-UHFFFAOYSA-N 1-biphenyl-2-ylmethanamine Chemical group NCC1=CC=CC=C1C1=CC=CC=C1 YHXKXVFQHWJYOD-UHFFFAOYSA-N 0.000 description 5
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 5
- 230000003111 delayed effect Effects 0.000 description 5
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 5
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 4
- OKYSUJVCDXZGKE-UHFFFAOYSA-N 3-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=CC(S(Cl)(=O)=O)=C1 OKYSUJVCDXZGKE-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- 206010003130 Arrhythmia supraventricular Diseases 0.000 description 4
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 4
- FLOLVFLAXFXKBU-UHFFFAOYSA-N S9947 Chemical compound C=1C=CC=CC=1COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=N1 FLOLVFLAXFXKBU-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 230000003288 anthiarrhythmic effect Effects 0.000 description 4
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 4
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 4
- 210000000287 oocyte Anatomy 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- KGLPWQKSKUVKMJ-UHFFFAOYSA-N 2,3-dihydrophthalazine-1,4-dione Chemical compound C1=CC=C2C(=O)NNC(=O)C2=C1 KGLPWQKSKUVKMJ-UHFFFAOYSA-N 0.000 description 3
- IPUFFJSTKHPCBZ-UHFFFAOYSA-N 2-[2-(aminomethyl)phenyl]benzoic acid Chemical compound NCC1=CC=CC=C1C1=CC=CC=C1C(O)=O IPUFFJSTKHPCBZ-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- UYCIYTZGOBZBME-UHFFFAOYSA-N 7h-benzo[d][2]benzoxepin-5-one Chemical compound O=C1OCC2=CC=CC=C2C2=CC=CC=C12 UYCIYTZGOBZBME-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- FPQVGDGSRVMNMR-JCTPKUEWSA-N [[(z)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxy-(dimethylamino)methylidene]-dimethylazanium;tetrafluoroborate Chemical compound F[B-](F)(F)F.CCOC(=O)C(\C#N)=N/OC(N(C)C)=[N+](C)C FPQVGDGSRVMNMR-JCTPKUEWSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 239000008186 active pharmaceutical agent Substances 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- 150000003857 carboxamides Chemical class 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 210000002837 heart atrium Anatomy 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 150000002513 isocyanates Chemical group 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 230000001536 pro-arrhythmogenic effect Effects 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- WAENTQBPIPWCDR-UHFFFAOYSA-N (2-chlorophenyl)methyl n-[[2-[2-(3-methylbutylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)OCC1=CC=CC=C1Cl WAENTQBPIPWCDR-UHFFFAOYSA-N 0.000 description 2
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- CQHYPXOZOVLCJD-UHFFFAOYSA-N 1-[4-(trifluoromethyl)phenyl]ethyl 2-amino-2-[2-[2-(2-pyridin-2-ylethylcarbamoyl)phenyl]phenyl]acetate Chemical compound C=1C=C(C(F)(F)F)C=CC=1C(C)OC(=O)C(N)C1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=N1 CQHYPXOZOVLCJD-UHFFFAOYSA-N 0.000 description 2
- RXYVNNWGXQRJAC-UHFFFAOYSA-N 1-chloro-1-[3-(trifluoromethyl)phenyl]propan-2-one Chemical class CC(=O)C(Cl)C1=CC=CC(C(F)(F)F)=C1 RXYVNNWGXQRJAC-UHFFFAOYSA-N 0.000 description 2
- JOGIZWICIRWGFL-UHFFFAOYSA-N 2-[2-(benzamidomethyl)phenyl]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)C1=CC=CC=C1 JOGIZWICIRWGFL-UHFFFAOYSA-N 0.000 description 2
- ZEXOJVUEVIWTKZ-UHFFFAOYSA-N 2-[2-(benzenesulfonamidomethyl)phenyl]-n-(2-pyridin-2-ylethyl)benzamide Chemical compound C=1C=CC=C(C=2C(=CC=CC=2)CNS(=O)(=O)C=2C=CC=CC=2)C=1C(=O)NCCC1=CC=CC=N1 ZEXOJVUEVIWTKZ-UHFFFAOYSA-N 0.000 description 2
- BNULFSVIEDFQPK-UHFFFAOYSA-N 2-[2-(benzenesulfonamidomethyl)phenyl]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNS(=O)(=O)C1=CC=CC=C1 BNULFSVIEDFQPK-UHFFFAOYSA-N 0.000 description 2
- ZNTFYSWVLCIONU-UHFFFAOYSA-N 2-[2-[(butoxycarbonylamino)methyl]phenyl]benzoic acid Chemical compound CCCCOC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(O)=O ZNTFYSWVLCIONU-UHFFFAOYSA-N 0.000 description 2
- JNHINWBBUROPEC-UHFFFAOYSA-N 2-[2-[[(3-acetylphenyl)sulfonylamino]methyl]phenyl]-n-benzylbenzamide Chemical compound CC(=O)C1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCC=2C=CC=CC=2)=C1 JNHINWBBUROPEC-UHFFFAOYSA-N 0.000 description 2
- RAQOOHJIMPCPGP-UHFFFAOYSA-N 2-[2-[[(3-fluorophenyl)sulfonylamino]methyl]phenyl]-n-(2-phenylethyl)benzamide Chemical compound FC1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCCC=2C=CC=CC=2)=C1 RAQOOHJIMPCPGP-UHFFFAOYSA-N 0.000 description 2
- PDVASPCMZHSBQQ-UHFFFAOYSA-N 2-[2-[[(3-fluorophenyl)sulfonylamino]methyl]phenyl]-n-(2-pyridin-2-ylethyl)benzamide Chemical compound FC1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCCC=2N=CC=CC=2)=C1 PDVASPCMZHSBQQ-UHFFFAOYSA-N 0.000 description 2
- GLZJECKDJXFUKA-UHFFFAOYSA-N 2-[2-[[(3-nitrophenyl)sulfonylamino]methyl]phenyl]-n-(2-phenylethyl)benzamide Chemical compound [O-][N+](=O)C1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCCC=2C=CC=CC=2)=C1 GLZJECKDJXFUKA-UHFFFAOYSA-N 0.000 description 2
- OPPJOACYJBFUTL-UHFFFAOYSA-N 2-[2-[[(4-acetylphenyl)sulfonylamino]methyl]phenyl]-n-(2-phenylethyl)benzamide Chemical compound C1=CC(C(=O)C)=CC=C1S(=O)(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 OPPJOACYJBFUTL-UHFFFAOYSA-N 0.000 description 2
- LYNXNSOTSIELLH-UHFFFAOYSA-N 2-[2-[[(4-ethylphenyl)sulfonylamino]methyl]phenyl]-n-(2-phenylethyl)benzamide Chemical compound C1=CC(CC)=CC=C1S(=O)(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 LYNXNSOTSIELLH-UHFFFAOYSA-N 0.000 description 2
- OKZWTWLZVHKTDN-UHFFFAOYSA-N 2-[2-[[(4-fluorophenyl)sulfonylamino]methyl]phenyl]-n-(2-pyridin-2-ylethyl)benzamide Chemical compound C1=CC(F)=CC=C1S(=O)(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=N1 OKZWTWLZVHKTDN-UHFFFAOYSA-N 0.000 description 2
- QRSSVDLGQLGIAF-UHFFFAOYSA-N 2-phenyl-n-(2-phenylethyl)benzamide Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1C(=O)NCCC1=CC=CC=C1 QRSSVDLGQLGIAF-UHFFFAOYSA-N 0.000 description 2
- XPQIPUZPSLAZDV-UHFFFAOYSA-N 2-pyridylethylamine Chemical compound NCCC1=CC=CC=N1 XPQIPUZPSLAZDV-UHFFFAOYSA-N 0.000 description 2
- ONCAZCNPWWQQMW-UHFFFAOYSA-N 3-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=CC(S(Cl)(=O)=O)=C1 ONCAZCNPWWQQMW-UHFFFAOYSA-N 0.000 description 2
- MWWNNNAOGWPTQY-UHFFFAOYSA-N 3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(S(Cl)(=O)=O)=C1 MWWNNNAOGWPTQY-UHFFFAOYSA-N 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- BFXHJFKKRGVUMU-UHFFFAOYSA-N 4-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C=C1 BFXHJFKKRGVUMU-UHFFFAOYSA-N 0.000 description 2
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 2
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 208000024172 Cardiovascular disease Diseases 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- IUDFAEMDUMPLLJ-UHFFFAOYSA-N NCCC1=NC=CC=C1.OC(C1=CC=CC=C1C1=C(CNC(C2=CC=CC=C2)=O)C=CC=C1)=O Chemical compound NCCC1=NC=CC=C1.OC(C1=CC=CC=C1C1=C(CNC(C2=CC=CC=C2)=O)C=CC=C1)=O IUDFAEMDUMPLLJ-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102000004257 Potassium Channel Human genes 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000001746 atrial effect Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- AJIWJHJSVZLNMV-UHFFFAOYSA-N benzyl n-[[2-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound FC(F)(F)CNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)OCC1=CC=CC=C1 AJIWJHJSVZLNMV-UHFFFAOYSA-N 0.000 description 2
- PJQCUAYFLRLUPL-UHFFFAOYSA-N benzyl n-[[2-[2-(2-phenylethylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 PJQCUAYFLRLUPL-UHFFFAOYSA-N 0.000 description 2
- QVORWRQIAHBWOE-UHFFFAOYSA-N benzyl n-[[2-[2-[(2,4-difluorophenyl)methylcarbamoyl]phenyl]phenyl]methyl]carbamate Chemical compound FC1=CC(F)=CC=C1CNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)OCC1=CC=CC=C1 QVORWRQIAHBWOE-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 2
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 2
- 229940082627 class iii antiarrhythmics Drugs 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- IXTMWRCNAAVVAI-UHFFFAOYSA-N dofetilide Chemical compound C=1C=C(NS(C)(=O)=O)C=CC=1CCN(C)CCOC1=CC=C(NS(C)(=O)=O)C=C1 IXTMWRCNAAVVAI-UHFFFAOYSA-N 0.000 description 2
- 229960002994 dofetilide Drugs 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000002651 drug therapy Methods 0.000 description 2
- 230000002526 effect on cardiovascular system Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 235000001727 glucose Nutrition 0.000 description 2
- 238000006698 hydrazinolysis reaction Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 238000013178 mathematical model Methods 0.000 description 2
- MQKBFEZKBXCOKU-UHFFFAOYSA-N methyl 3-phenyl-2-[[2-[2-(phenylmethoxycarbonylaminomethyl)phenyl]benzoyl]amino]propanoate Chemical compound C=1C=CC=C(C=2C(=CC=CC=2)CNC(=O)OCC=2C=CC=CC=2)C=1C(=O)NC(C(=O)OC)CC1=CC=CC=C1 MQKBFEZKBXCOKU-UHFFFAOYSA-N 0.000 description 2
- VFGSXGIKICQYJO-UHFFFAOYSA-N methyl 4-[[2-[2-(3-methylbutylcarbamoyl)phenyl]phenyl]methylcarbamoyloxy]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC(C)C VFGSXGIKICQYJO-UHFFFAOYSA-N 0.000 description 2
- GCQMVWHPYNFZKA-UHFFFAOYSA-N methyl n-[[2-[2-(3-methylbutylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC(C)C GCQMVWHPYNFZKA-UHFFFAOYSA-N 0.000 description 2
- MVCJLZBAITXAIM-UHFFFAOYSA-N n-(2-phenylethyl)-2-[2-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]phenyl]benzamide Chemical compound FC(F)(F)C1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCCC=2C=CC=CC=2)=C1 MVCJLZBAITXAIM-UHFFFAOYSA-N 0.000 description 2
- UYDDIZMTLXUIDP-UHFFFAOYSA-N n-(3-methylbutyl)-2-[2-[(phenylcarbamoylamino)methyl]phenyl]benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)NC1=CC=CC=C1 UYDDIZMTLXUIDP-UHFFFAOYSA-N 0.000 description 2
- BOKFJHWYJAKUHB-UHFFFAOYSA-N n-(3-methylbutyl)-2-[2-[(propan-2-ylsulfonylamino)methyl]phenyl]benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNS(=O)(=O)C(C)C BOKFJHWYJAKUHB-UHFFFAOYSA-N 0.000 description 2
- OWUWRDBPUSOVIF-UHFFFAOYSA-N n-benzyl-2-[2-[[(3-fluorophenyl)sulfonylamino]methyl]phenyl]benzamide Chemical compound FC1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCC=2C=CC=CC=2)=C1 OWUWRDBPUSOVIF-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- ZCNFMJAZABWJHQ-UHFFFAOYSA-N phenyl n-[[2-[2-(3-methylbutylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)OC1=CC=CC=C1 ZCNFMJAZABWJHQ-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 108020001213 potassium channel Proteins 0.000 description 2
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- DRINJBFRTLBHNF-UHFFFAOYSA-N propane-2-sulfonyl chloride Chemical compound CC(C)S(Cl)(=O)=O DRINJBFRTLBHNF-UHFFFAOYSA-N 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 230000036279 refractory period Effects 0.000 description 2
- 210000001567 regular cardiac muscle cell of ventricle Anatomy 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 229960002317 succinimide Drugs 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QDZZDVQGBKTLHV-UHFFFAOYSA-N (2,4-difluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1F QDZZDVQGBKTLHV-UHFFFAOYSA-N 0.000 description 1
- GCCKNHYFOVQZRG-UHFFFAOYSA-N (2-chlorophenyl)methyl carbonochloridate Chemical class ClC(=O)OCC1=CC=CC=C1Cl GCCKNHYFOVQZRG-UHFFFAOYSA-N 0.000 description 1
- 125000004509 1,3,4-oxadiazol-2-yl group Chemical group O1C(=NN=C1)* 0.000 description 1
- 125000004510 1,3,4-oxadiazol-5-yl group Chemical group O1C=NN=C1* 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- YMXIDIAEXNLCFT-UHFFFAOYSA-N 1-[4-(trifluoromethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=C(C(F)(F)F)C=C1 YMXIDIAEXNLCFT-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- LEBVLXFERQHONN-UHFFFAOYSA-N 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide Chemical compound CCCCN1CCCCC1C(=O)NC1=C(C)C=CC=C1C LEBVLXFERQHONN-UHFFFAOYSA-N 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical class OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 1
- JUUBFHLPTCPVBO-UHFFFAOYSA-N 2,2-dimethylpropyl carbonochloridate Chemical compound CC(C)(C)COC(Cl)=O JUUBFHLPTCPVBO-UHFFFAOYSA-N 0.000 description 1
- XLKKYUXSWZCTID-UHFFFAOYSA-N 2,2-dimethylpropyl n-[[2-[2-(2-phenylethylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound CC(C)(C)COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 XLKKYUXSWZCTID-UHFFFAOYSA-N 0.000 description 1
- XJEVHMGJSYVQBQ-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-amine Chemical class C1=CC=C2C(N)CCC2=C1 XJEVHMGJSYVQBQ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IQBCGVQXCJTIFP-UHFFFAOYSA-N 2-[2-(benzenesulfonamidomethyl)phenyl]-n-(2-phenylethyl)benzamide Chemical compound C=1C=CC=C(C=2C(=CC=CC=2)CNS(=O)(=O)C=2C=CC=CC=2)C=1C(=O)NCCC1=CC=CC=C1 IQBCGVQXCJTIFP-UHFFFAOYSA-N 0.000 description 1
- FCTRSEUTCQVOQO-UHFFFAOYSA-N 2-[2-[(phenylcarbamoylamino)methyl]phenyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)NC1=CC=CC=C1 FCTRSEUTCQVOQO-UHFFFAOYSA-N 0.000 description 1
- UBOGVRCZWZXUGY-UHFFFAOYSA-N 2-[2-[(propan-2-ylsulfonylamino)methyl]phenyl]-n-(2-pyridin-2-ylethyl)benzamide Chemical compound CC(C)S(=O)(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=N1 UBOGVRCZWZXUGY-UHFFFAOYSA-N 0.000 description 1
- KMIPGXOIWLMIMN-UHFFFAOYSA-N 2-[2-[[(3-fluorophenyl)sulfonylamino]methyl]phenyl]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNS(=O)(=O)C1=CC=CC(F)=C1 KMIPGXOIWLMIMN-UHFFFAOYSA-N 0.000 description 1
- SBGXHKKWCNJNLO-UHFFFAOYSA-N 2-[2-[[(4-fluorophenyl)sulfonylamino]methyl]phenyl]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1C1=CC=CC=C1CNS(=O)(=O)C1=CC=C(F)C=C1 SBGXHKKWCNJNLO-UHFFFAOYSA-N 0.000 description 1
- MIVHRWIBCKTZJW-UHFFFAOYSA-N 2-[2-[amino-(3-nitrophenyl)sulfonylmethyl]phenyl]-N-benzylbenzamide Chemical compound C(C1=CC=CC=C1)NC(=O)C=1C(=CC=CC=1)C1=C(C=CC=C1)C(N)S(=O)(=O)C1=CC(=CC=C1)[N+](=O)[O-] MIVHRWIBCKTZJW-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- MWPNPNLDBXDQCC-UHFFFAOYSA-N 2-amino-3-(diethylamino)propanoic acid Chemical compound CCN(CC)CC(N)C(O)=O MWPNPNLDBXDQCC-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- RIJGFWLYPLQVQP-UHFFFAOYSA-N 2-methylsulfonylethyl 2-amino-2-[2-[2-(2-phenylethylcarbamoyl)phenyl]phenyl]acetate Chemical compound C1(=CC=CC=C1)CCNC(=O)C=1C(=CC=CC=1)C1=C(C=CC=C1)C(N)C(=O)OCCS(=O)(=O)C RIJGFWLYPLQVQP-UHFFFAOYSA-N 0.000 description 1
- XPVFTBRMOPAAGW-UHFFFAOYSA-N 2-methylsulfonylethyl n-[[2-[2-(2-phenylethylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound CS(=O)(=O)CCOC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 XPVFTBRMOPAAGW-UHFFFAOYSA-N 0.000 description 1
- RWBYNNXSUXXDGE-UHFFFAOYSA-N 2-pyridin-2-ylethanamine 2-[2-[(4,4,4-trifluorobutoxycarbonylamino)methyl]phenyl]benzoic acid Chemical compound NCCC1=NC=CC=C1.OC(C1=CC=CC=C1C1=C(CNC(OCCCC(F)(F)F)=O)C=CC=C1)=O RWBYNNXSUXXDGE-UHFFFAOYSA-N 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- CGMBNEIGZOCPPP-UHFFFAOYSA-N 3-acetylbenzenesulfonyl chloride Chemical compound CC(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 CGMBNEIGZOCPPP-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- VKRFUGHXKNNIJO-UHFFFAOYSA-N 4,4,4-trifluorobutan-1-ol Chemical compound OCCCC(F)(F)F VKRFUGHXKNNIJO-UHFFFAOYSA-N 0.000 description 1
- MOOUWXDQAUXZRG-UHFFFAOYSA-N 4-(trifluoromethyl)benzyl alcohol Chemical compound OCC1=CC=C(C(F)(F)F)C=C1 MOOUWXDQAUXZRG-UHFFFAOYSA-N 0.000 description 1
- FXVDNCRTKXMSEZ-UHFFFAOYSA-N 4-acetylbenzenesulfonyl chloride Chemical compound CC(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 FXVDNCRTKXMSEZ-UHFFFAOYSA-N 0.000 description 1
- LACFLXDRFOQEFZ-UHFFFAOYSA-N 4-ethylbenzenesulfonyl chloride Chemical compound CCC1=CC=C(S(Cl)(=O)=O)C=C1 LACFLXDRFOQEFZ-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical compound [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- 239000005541 ACE inhibitor Substances 0.000 description 1
- 229940123073 Angiotensin antagonist Drugs 0.000 description 1
- 208000032845 Atrial Remodeling Diseases 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- FBONOPFPOKPEQS-UHFFFAOYSA-N CC(C)S(NCC(C=CC=C1)=C1C1=CC=CC=C1C(O)=O)(=O)=O.NCCC1=NC=CC=C1 Chemical compound CC(C)S(NCC(C=CC=C1)=C1C1=CC=CC=C1C(O)=O)(=O)=O.NCCC1=NC=CC=C1 FBONOPFPOKPEQS-UHFFFAOYSA-N 0.000 description 1
- LSJOVCDMHKAERV-UHFFFAOYSA-N CCCCOC(NCC(C=CC=C1)=C1C1=CC=CC=C1C(O)=O)=O.NCCC1=NC=CC=C1 Chemical compound CCCCOC(NCC(C=CC=C1)=C1C1=CC=CC=C1C(O)=O)=O.NCCC1=NC=CC=C1 LSJOVCDMHKAERV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229940127291 Calcium channel antagonist Drugs 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 240000002635 Dendrocalamus asper Species 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 108010061435 Enalapril Proteins 0.000 description 1
- 244000166124 Eucalyptus globulus Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108010042111 Kv1.5 Potassium Channel Proteins 0.000 description 1
- 102000004425 Kv1.5 Potassium Channel Human genes 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- ICBIMQCIQBUFRW-UHFFFAOYSA-N NCCC1=NC=CC=C1.OC(C1=CC=CC=C1C1=C(CNC(NC2=CC=CC=C2)=O)C=CC=C1)=O Chemical compound NCCC1=NC=CC=C1.OC(C1=CC=CC=C1C1=C(CNC(NC2=CC=CC=C2)=O)C=CC=C1)=O ICBIMQCIQBUFRW-UHFFFAOYSA-N 0.000 description 1
- LUOPRHDELQOIRK-UHFFFAOYSA-N NCCC1=NC=CC=C1.OC(C1=CC=CC=C1C1=CC=CC=C1)=O Chemical compound NCCC1=NC=CC=C1.OC(C1=CC=CC=C1C1=CC=CC=C1)=O LUOPRHDELQOIRK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000019486 Sunflower oil Nutrition 0.000 description 1
- 239000000150 Sympathomimetic Substances 0.000 description 1
- 210000001744 T-lymphocyte Anatomy 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- 208000018452 Torsade de pointes Diseases 0.000 description 1
- 208000002363 Torsades de Pointes Diseases 0.000 description 1
- 241000269370 Xenopus <genus> Species 0.000 description 1
- 241000269368 Xenopus laevis Species 0.000 description 1
- IIXBGDFBPASDGU-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methyl n-[[2-[2-(2-phenylethylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound C1=CC(C(F)(F)F)=CC=C1COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 IIXBGDFBPASDGU-UHFFFAOYSA-N 0.000 description 1
- KDHURGILNMYLKS-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methyl n-[[2-[2-(2-pyridin-2-ylethylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound C1=CC(C(F)(F)F)=CC=C1COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC1=CC=CC=N1 KDHURGILNMYLKS-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000002160 alpha blocker Substances 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002369 angiotensin antagonist Substances 0.000 description 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 210000002072 atrial myocyte Anatomy 0.000 description 1
- 210000003050 axon Anatomy 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 1
- IBFSKDNWZJWWFO-UHFFFAOYSA-N benzyl n-[[2-[2-(cyclohexylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NC1CCCCC1 IBFSKDNWZJWWFO-UHFFFAOYSA-N 0.000 description 1
- MKCBSMMOKUDSGY-UHFFFAOYSA-N benzyl n-[[2-[2-(dibutylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound CCCCN(CCCC)C(=O)C1=CC=CC=C1C1=CC=CC=C1CNC(=O)OCC1=CC=CC=C1 MKCBSMMOKUDSGY-UHFFFAOYSA-N 0.000 description 1
- XQBZQGXWWLKBLE-UHFFFAOYSA-N benzyl n-[[2-[2-(phenylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NC1=CC=CC=C1 XQBZQGXWWLKBLE-UHFFFAOYSA-N 0.000 description 1
- JEHZQQAFJGTBOZ-UHFFFAOYSA-N benzyl n-[[2-[2-[benzyl(methyl)carbamoyl]phenyl]phenyl]methyl]carbamate Chemical compound C=1C=CC=C(C=2C(=CC=CC=2)CNC(=O)OCC=2C=CC=CC=2)C=1C(=O)N(C)CC1=CC=CC=C1 JEHZQQAFJGTBOZ-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229960003150 bupivacaine Drugs 0.000 description 1
- IUVQKHWQAREVJE-UHFFFAOYSA-N butyl n-[[2-[2-(3-methylbutylcarbamoyl)phenyl]phenyl]methyl]carbamate Chemical compound CCCCOC(=O)NCC1=CC=CC=C1C1=CC=CC=C1C(=O)NCCC(C)C IUVQKHWQAREVJE-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 1
- 229960000830 captopril Drugs 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229940082638 cardiac stimulant phosphodiesterase inhibitors Drugs 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000003026 cod liver oil Substances 0.000 description 1
- 235000012716 cod liver oil Nutrition 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000007405 data analysis Methods 0.000 description 1
- 238000013480 data collection Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- WCYBYZBPWZTMDW-UHFFFAOYSA-N dibutylazanide Chemical compound CCCC[N-]CCCC WCYBYZBPWZTMDW-UHFFFAOYSA-N 0.000 description 1
- 229940082657 digitalis glycosides Drugs 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- GBXSMTUPTTWBMN-XIRDDKMYSA-N enalapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 GBXSMTUPTTWBMN-XIRDDKMYSA-N 0.000 description 1
- 229960000873 enalapril Drugs 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 210000005003 heart tissue Anatomy 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000007928 imidazolide derivatives Chemical class 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000001506 immunosuppresive effect Effects 0.000 description 1
- 229960003444 immunosuppressant agent Drugs 0.000 description 1
- 239000003018 immunosuppressive agent Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000000297 inotrophic effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 235000012245 magnesium oxide Nutrition 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- SWVMLNPDTIFDDY-FVGYRXGTSA-N methyl (2s)-2-amino-3-phenylpropanoate;hydrochloride Chemical compound Cl.COC(=O)[C@@H](N)CC1=CC=CC=C1 SWVMLNPDTIFDDY-FVGYRXGTSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- MAMHJCDBHZKINF-UHFFFAOYSA-N n-benzyl-2-[2-[[(3-nitrophenyl)sulfonylamino]methyl]phenyl]benzamide Chemical compound [O-][N+](=O)C1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCC=2C=CC=CC=2)=C1 MAMHJCDBHZKINF-UHFFFAOYSA-N 0.000 description 1
- DDKGIONHQJNMEZ-UHFFFAOYSA-N n-benzyl-2-[2-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]phenyl]benzamide Chemical compound FC(F)(F)C1=CC=CC(S(=O)(=O)NCC=2C(=CC=CC=2)C=2C(=CC=CC=2)C(=O)NCC=2C=CC=CC=2)=C1 DDKGIONHQJNMEZ-UHFFFAOYSA-N 0.000 description 1
- XEKOCIBSODLFQN-UHFFFAOYSA-N n-benzyl-2-phenylbenzamide Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1C(=O)NCC1=CC=CC=C1 XEKOCIBSODLFQN-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- YCKGNIXPYKLUIQ-UHFFFAOYSA-N n-cyclohexyl-2-phenylbenzamide Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1C(=O)NC1CCCCC1 YCKGNIXPYKLUIQ-UHFFFAOYSA-N 0.000 description 1
- CXGFWBPQQXZELI-UHFFFAOYSA-N n-ethylpyridin-2-amine Chemical compound CCNC1=CC=CC=N1 CXGFWBPQQXZELI-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000001196 nonadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000002571 phosphodiesterase inhibitor Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000009117 preventive therapy Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- HDACQVRGBOVJII-JBDAPHQKSA-N ramipril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](C[C@@H]2CCC[C@@H]21)C(O)=O)CC1=CC=CC=C1 HDACQVRGBOVJII-JBDAPHQKSA-N 0.000 description 1
- 229960003401 ramipril Drugs 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002336 repolarization Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- GZKLJWGUPQBVJQ-UHFFFAOYSA-N sertindole Chemical compound C1=CC(F)=CC=C1N1C2=CC=C(Cl)C=C2C(C2CCN(CCN3C(NCC3)=O)CC2)=C1 GZKLJWGUPQBVJQ-UHFFFAOYSA-N 0.000 description 1
- 229960000652 sertindole Drugs 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- 229960002370 sotalol Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000002600 sunflower oil Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000001975 sympathomimetic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 229960002926 tedisamil Drugs 0.000 description 1
- CTIRHWCPXYGDGF-HDICACEKSA-N tedisamil Chemical compound [H][C@]12CN(CC3CC3)C[C@]([H])(CN(CC3CC3)C1)C21CCCC1 CTIRHWCPXYGDGF-HDICACEKSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- NONOKGVFTBWRLD-UHFFFAOYSA-N thioisocyanate group Chemical group S(N=C=O)N=C=O NONOKGVFTBWRLD-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 125000005500 uronium group Chemical group 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/165—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide
- A61K31/166—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide having the carbon of a carboxamide group directly attached to the aromatic ring, e.g. procainamide, procarbazine, metoclopramide, labetalol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/22—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/40—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings
- C07C271/42—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/54—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/42—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/03—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C311/06—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms to acyclic carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/12—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings
- C07C311/13—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/19—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/22—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms
- C07C311/29—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/45—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups at least one of the singly-bound nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfonamides
- C07C311/46—Y being a hydrogen or a carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/45—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups at least one of the singly-bound nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfonamides
- C07C311/47—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/16—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C317/18—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton with sulfone or sulfoxide groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
Priority Applications (39)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19947457A DE19947457A1 (de) | 1999-10-02 | 1999-10-02 | 2'-Substituierte 1,1'-Biphenyl-2-carbonamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie enthaltende pharmazeutische Zubereitungen |
| TW2'-SUBSTIA TWI270541B (https=) | 1999-10-02 | 2000-01-11 | |
| CZ20021144A CZ302591B6 (cs) | 1999-10-02 | 2000-09-19 | 2´-Substituované 1,1´-bifenyl-2-karboxamidy, jejich použití a farmaceutické prostredky, které je obsahují |
| PT00967703T PT1222163E (pt) | 1999-10-02 | 2000-09-19 | 1,1-bifenil-2-carboxamidas substituidas na posicao 2 processo para a sua preparacao, sua utilizacao como medicamento, bem como preparacoes farmaceuticas contendo estas |
| PL354322A PL204034B1 (pl) | 1999-10-02 | 2000-09-19 | 2'-podstawione 1,1'-bifenylo-2-karbonamidy, ich zastosowanie jako leku, zawierające je preparaty farmaceutyczne oraz ich zastosowanie do wytwarzania leków |
| JP2001528137A JP4713800B2 (ja) | 1999-10-02 | 2000-09-19 | 2′−置換1,1′−ビフェニル−2−カルボキサミド、その製造、医薬としてのその使用およびそれを含む医薬組成物 |
| SI200030883T SI1222163T1 (sl) | 1999-10-02 | 2000-09-19 | 2'-substituirani 1,1'-bifenil-2-karboksamidi, postopek za njihovo pripravo, njihova uporaba kot zdravilo, kot tudi farmacevtski pripravki, ki jih vsebujejo |
| KR1020027004267A KR100722178B1 (ko) | 1999-10-02 | 2000-09-19 | 2'-치환된 1,1'-비페닐-2-카복스아미드 및 이를 함유하는 약제학적 제제 |
| SK438-2002A SK286756B6 (sk) | 1999-10-02 | 2000-09-19 | 2'-Substituované 1,1'-bifenyl-2-karboxamidy, spôsob ich prípravy, ich použitie ako liečiva a farmaceutické prostriedky, ktoré ich obsahujú |
| BRPI0014465-7A BR0014465B1 (pt) | 1999-10-02 | 2000-09-19 | 1,1'-bifenil-2-carbonamidas 2'-substituÍdas, preparado farmacÊutico e aplicaÇÕes dos referidos compostos. |
| CNB008127344A CN1195738C (zh) | 1999-10-02 | 2000-09-19 | 2′-取代的1,1′-联苯-2-甲酰胺、它们的制备方法、作为药物的用途和含有它们的药物制剂 |
| EP00967703A EP1222163B1 (de) | 1999-10-02 | 2000-09-19 | 2'-substituierte 1,1'-biphenyl-2-carboxamide, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen |
| HR20020264A HRP20020264B1 (hr) | 1999-10-02 | 2000-09-19 | 2'-supstituirani 1,1'-bifenil-2-karbonamidi, postupci za njihovu proizvodnju, njihova upotreba kao lijeka, kao i farmaceutski pripravci koji ih sadrže |
| EEP200200160A EE05000B1 (et) | 1999-10-02 | 2000-09-19 | 2'-asendatud 1,1'-bifenüül-2-karboksamiidid, nende kasutamine ja farmatseutilised preparaadid |
| IL14887000A IL148870A0 (en) | 1999-10-02 | 2000-09-19 | 2'-substituted 1, 1'-biphenyl-2-carbonamides, method for the production thereof, use thereof as medicament and pharmaceutical preparations containing said compounds |
| MXPA02002691A MXPA02002691A (es) | 1999-10-02 | 2000-09-19 | 1,1'-bifenil-2-carboxamidas 2'-substituidas, procesos para su preparacion su uso como medicamento y preparaciones farmaceuticas que comprenden las mismas. |
| YUP-244/02A RS50387B (sr) | 1999-10-02 | 2000-09-19 | 2'-supstituisani 1,1'-bifenil-2-karbonamidi, postupak za njihovu proizvodnju,njihova primena kao leka kao i farmaceutski preparati koji sadrže ta jedinjenja |
| PCT/EP2000/009151 WO2001025189A1 (de) | 1999-10-02 | 2000-09-19 | 2'-substituierte 1,1'-biphenyl-2-carbonamide, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen |
| DK00967703T DK1222163T3 (da) | 1999-10-02 | 2000-09-19 | 2'-Substituerede 1,1'-biphenyl-2-carboxamider, fremgangsmåder til fremstilling deraf, deres anvendelse som medikament samt farmaceutiske præparater, som indeholder dem |
| NZ518065A NZ518065A (en) | 1999-10-02 | 2000-09-19 | 2'-Substituted 1,1'-biphenyl-2-carbonamides, processes for their preparation, their use as medicament, and pharmaceutical preparations comprising them |
| DE50013167T DE50013167D1 (de) | 1999-10-02 | 2000-09-19 | 2'-substituierte 1,1'-biphenyl-2-carboxamide, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen |
| CA002385859A CA2385859C (en) | 1999-10-02 | 2000-09-19 | 2'-substituted 1,1'-biphenyl-2-carboxamides, processes for their preparation, their use as medicament, and pharmaceutical preparations comprising them |
| HU0203505A HU229046B1 (hu) | 1999-10-02 | 2000-09-19 | 2'-Szubsztituált 1,1'-bifenil-karbonamidok, elõállításuk, gyógyszerkénti alkalmazásuk és az ilyen vegyületeket tartalmazó gyógyszerkészítmények |
| HK03101193.0A HK1048986B (zh) | 1999-10-02 | 2000-09-19 | 2'-取代的1,1'-聯苯-2-甲酰胺、它們的製備方法、作為藥物的用途和含有它們的藥物製劑 |
| AU77778/00A AU766365B2 (en) | 1999-10-02 | 2000-09-19 | 2'-substituted 1,1'-biphenyl-2-carbonamides, method for the production thereof, use thereof as a medicament and pharmaceutical preparations containing said compounds |
| TR2002/00883T TR200200883T2 (tr) | 1999-10-02 | 2000-09-19 | 2-ikameli 1,1-bifenil-2-karbonamidler, imalat yöntemleri, ilaç olarak kullanılmaları |
| AT00967703T ATE332890T1 (de) | 1999-10-02 | 2000-09-19 | 2'-substituierte 1,1'-biphenyl-2-carboxamide, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen |
| MEP-609/08A MEP60908A (en) | 1999-10-02 | 2000-09-19 | 2'-substituted 1,1'-biphenyl-2-carbonamides, method for the production thereof, use thereof as a medicament and pharmaceutical preparations containing said compounds |
| ES00967703T ES2265985T3 (es) | 1999-10-02 | 2000-09-19 | 1,1'-bifenil-2-carboxamidas 2'-sustituidas, procedimiento para su preparacion, su uso como medicamento,asi como preparado farmeutico que lascontiene. |
| RU2002111561/04A RU2252214C2 (ru) | 1999-10-02 | 2000-09-19 | 2'-замещенные 1,1'-бифенил-2-карбонамиды, способы их получения, их применение в качестве лекарственного средства, а также содержащие их фармацевтические композиции |
| ARP000105117A AR031226A1 (es) | 1999-10-02 | 2000-09-28 | 1,1'-bifenil-2-carboxamidas 2'-sustituidas, procesos para su preparacion, su uso para la manufactura de un medicamento, y composiciones farmaceuticas que las contienen |
| US09/698,078 US6531495B1 (en) | 1999-10-02 | 2000-10-30 | 2′-Substituted 1,1′-biphenyl-2-carboxamides, processes for their preparation, their use as medicaments, and pharmaceutical preparations comprising them |
| NO20021398A NO327709B1 (no) | 1999-10-02 | 2002-03-20 | 2'-substituerte 1,1'-bifenyl-2-karbonamider, deres anvendelse for fremstilling av et medikament sa vel som farmasoytiske preparater inneholdende disse |
| IL148870A IL148870A (en) | 1999-10-02 | 2002-03-25 | 2'-substituted 1,1'-biphenyl - 2 - carbonamides, method for the production thereof, use thereof as medicament and pharmaceutical preparations containing said compounds |
| ZA200202521A ZA200202521B (en) | 1999-10-02 | 2002-03-28 | 2'-substituted 1,1'-biphenyl-2-carbonamides, method for the production thereof, use thereof as a medicament and pharmaceutical preprations containing said compounds. |
| US10/252,385 US6686395B2 (en) | 1999-10-02 | 2002-09-24 | 2′-substituted 1,1′-biphenyl-2-carboxamides, process for their preparation, their use as medicaments, and pharmaceutical preparations comprising them |
| US10/691,624 US7514582B2 (en) | 1999-10-02 | 2003-10-24 | 2′-substituted 1,1′-biphenyl-2-carboxamides, processes for their preparation, their use as medicaments, and pharmaceutical preparations comprising them |
| CY20061101413T CY1106178T1 (el) | 1999-10-02 | 2006-09-28 | 2’- υποκατεστημενα 1,1’-διφαινυλο-2-καρβοξαμιδια, μεθοδος για την παρασκευη τους, η χρηση τους ως φαρμακου καθως και φαρμακευτικα παρασκευασματα που τα πepιεχουν |
| US12/419,069 US7982045B2 (en) | 1999-10-02 | 2009-04-06 | 2′-substituted 1,1′-biphenyl-2-carboxamides, processes for their preparation, their use as medicaments, and pharmaceutical preparations comprising them |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19947457A DE19947457A1 (de) | 1999-10-02 | 1999-10-02 | 2'-Substituierte 1,1'-Biphenyl-2-carbonamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie enthaltende pharmazeutische Zubereitungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE19947457A1 true DE19947457A1 (de) | 2001-04-05 |
Family
ID=7924254
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19947457A Withdrawn DE19947457A1 (de) | 1999-10-02 | 1999-10-02 | 2'-Substituierte 1,1'-Biphenyl-2-carbonamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie enthaltende pharmazeutische Zubereitungen |
| DE50013167T Expired - Lifetime DE50013167D1 (de) | 1999-10-02 | 2000-09-19 | 2'-substituierte 1,1'-biphenyl-2-carboxamide, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE50013167T Expired - Lifetime DE50013167D1 (de) | 1999-10-02 | 2000-09-19 | 2'-substituierte 1,1'-biphenyl-2-carboxamide, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen |
Country Status (32)
| Country | Link |
|---|---|
| EP (1) | EP1222163B1 (https=) |
| JP (1) | JP4713800B2 (https=) |
| KR (1) | KR100722178B1 (https=) |
| CN (1) | CN1195738C (https=) |
| AR (1) | AR031226A1 (https=) |
| AT (1) | ATE332890T1 (https=) |
| AU (1) | AU766365B2 (https=) |
| BR (1) | BR0014465B1 (https=) |
| CA (1) | CA2385859C (https=) |
| CY (1) | CY1106178T1 (https=) |
| CZ (1) | CZ302591B6 (https=) |
| DE (2) | DE19947457A1 (https=) |
| DK (1) | DK1222163T3 (https=) |
| EE (1) | EE05000B1 (https=) |
| ES (1) | ES2265985T3 (https=) |
| HK (1) | HK1048986B (https=) |
| HR (1) | HRP20020264B1 (https=) |
| HU (1) | HU229046B1 (https=) |
| IL (2) | IL148870A0 (https=) |
| ME (1) | MEP60908A (https=) |
| MX (1) | MXPA02002691A (https=) |
| NO (1) | NO327709B1 (https=) |
| NZ (1) | NZ518065A (https=) |
| PL (1) | PL204034B1 (https=) |
| PT (1) | PT1222163E (https=) |
| RS (1) | RS50387B (https=) |
| RU (1) | RU2252214C2 (https=) |
| SK (1) | SK286756B6 (https=) |
| TR (1) | TR200200883T2 (https=) |
| TW (1) | TWI270541B (https=) |
| WO (1) | WO2001025189A1 (https=) |
| ZA (1) | ZA200202521B (https=) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2002046162A1 (de) * | 2000-12-07 | 2002-06-13 | Aventis Pharma Deutschland Gmbh | Ortho-substituierte stickstoffhaltige bisarylverbindungen zur verwendung als kalium-kanal-inhibitoren |
| WO2002088073A1 (de) | 2001-04-28 | 2002-11-07 | Aventis Pharma Deutschland Gmbh | Anthranilsäureamide, verfahren zu ihrer herstellung, ihre verwendung als antiarrhythmika sowie pharmazeutische zubereitungen davon |
| WO2002100825A3 (de) * | 2001-06-12 | 2003-12-11 | Aventis Pharma Gmbh | Anthranilsäureamide mit heteroarylsulfonyl-seitenkette und ihre verwendung als antiarrhythmische wirkstoffe |
| DE10312061A1 (de) * | 2003-03-18 | 2004-09-30 | Aventis Pharma Deutschland Gmbh | Kombination von Phenylcarbonsäureamiden mit Blockern des IK-Kanals und deren Verwendung zur Behandlung von Vorhofarrhythmien |
| WO2004037789A3 (en) * | 2002-10-24 | 2004-10-28 | Merck Patent Gmbh | Methylene urea derivatives as raf-kinase inhibitors |
| DE10341233A1 (de) * | 2003-09-08 | 2005-03-24 | Aventis Pharma Deutschland Gmbh | Kombination von Phenylcarbonsäureamiden mit beta-Adrenozeptoren-Blockern und deren Verwendung zur Behandlung von Vorhofarrhythmien |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2001266346A1 (en) | 2000-06-28 | 2002-01-08 | Takeda Chemical Industries Ltd. | Biphenyl compound |
| DE10059418A1 (de) * | 2000-11-30 | 2002-06-20 | Aventis Pharma Gmbh | Ortho, meta-substituierte Bisarylverbindungen, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie sie enthaltende pharmazeutische Zubereitungen |
| TWI311133B (en) | 2001-04-20 | 2009-06-21 | Eisai R&D Man Co Ltd | Carboxylic acid derivativeand the salt thereof |
| WO2002098840A1 (en) | 2001-06-04 | 2002-12-12 | Eisai Co., Ltd. | Carboxylic acid derivative and medicine comprising salt or ester of the same |
| US7507753B2 (en) | 2001-12-28 | 2009-03-24 | Takeda Chemical Industries Ltd. | Biaryl compound and use thereof |
| GB0315950D0 (en) | 2003-06-11 | 2003-08-13 | Xention Discovery Ltd | Compounds |
| EP1663204B1 (en) * | 2003-08-29 | 2014-05-07 | Exelixis, Inc. | C-kit modulators and methods of use |
| DE102004009931A1 (de) * | 2004-02-26 | 2005-09-15 | Aventis Pharma Deutschland Gmbh | Kv1.5-Blocker zur selektiven Steigerung der Vorhofkontraktilität und Behandlung der Herzinsuffizienz |
| WO2005087236A1 (en) * | 2004-03-11 | 2005-09-22 | Glaxo Group Limited | Novel m3 muscarinic acetylcholine receptor antagonists |
| GB0412986D0 (en) | 2004-06-10 | 2004-07-14 | Xention Discovery Ltd | Compounds |
| US7569589B2 (en) | 2004-07-29 | 2009-08-04 | Merck & Co., Inc. | Potassium channel inhibitors |
| US7576212B2 (en) | 2004-12-09 | 2009-08-18 | Xention Limited | Thieno[2,3-B] pyridines as potassium channel inhibitors |
| GB0525164D0 (en) | 2005-12-09 | 2006-01-18 | Xention Discovery Ltd | Compounds |
| BRPI0710946A2 (pt) * | 2006-04-27 | 2012-03-06 | Sanofi-Aventis Deutschland Gmbh | inibidores dos canais de Íon task-1 e task-3 |
| GB0815781D0 (en) | 2008-08-29 | 2008-10-08 | Xention Ltd | Novel potassium channel blockers |
| GB0815784D0 (en) | 2008-08-29 | 2008-10-08 | Xention Ltd | Novel potassium channel blockers |
| GB0815782D0 (en) | 2008-08-29 | 2008-10-08 | Xention Ltd | Novel potassium channel blockers |
| CA2763962A1 (en) * | 2009-06-03 | 2010-12-09 | Sanofi-Aventis Deutschland Gmbh | Crystalline phases of 2'-{[2-(4-methoxy-phenyl)-acetylamino]-methyl}-biphenyl-2-carboxylic acid (2-pyridin-3-yl-ethyl)-amide |
| GB201105659D0 (en) | 2011-04-01 | 2011-05-18 | Xention Ltd | Compounds |
| NO3175985T3 (https=) | 2011-07-01 | 2018-04-28 | ||
| HK1201455A1 (en) | 2012-01-27 | 2015-09-04 | Gilead Sciences Inc | Combination therapies using late sodium ion channel blockers and potassium ion channel blockers |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8705150D0 (sv) * | 1987-12-23 | 1987-12-23 | Haessle Ab | Novel antiarrhythmic agents |
| DE4102024A1 (de) * | 1991-01-24 | 1992-07-30 | Thomae Gmbh Dr K | Biphenylderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| GB9307527D0 (en) * | 1993-04-13 | 1993-06-02 | Fujisawa Pharmaceutical Co | New venzamide derivatives,processes for the preparation thereof and pharmaceutical composition comprising the same |
-
1999
- 1999-10-02 DE DE19947457A patent/DE19947457A1/de not_active Withdrawn
-
2000
- 2000-01-11 TW TW2'-SUBSTIA patent/TWI270541B/zh not_active IP Right Cessation
- 2000-09-19 IL IL14887000A patent/IL148870A0/xx active IP Right Grant
- 2000-09-19 CA CA002385859A patent/CA2385859C/en not_active Expired - Fee Related
- 2000-09-19 HK HK03101193.0A patent/HK1048986B/zh not_active IP Right Cessation
- 2000-09-19 MX MXPA02002691A patent/MXPA02002691A/es active IP Right Grant
- 2000-09-19 WO PCT/EP2000/009151 patent/WO2001025189A1/de not_active Ceased
- 2000-09-19 CZ CZ20021144A patent/CZ302591B6/cs not_active IP Right Cessation
- 2000-09-19 DK DK00967703T patent/DK1222163T3/da active
- 2000-09-19 SK SK438-2002A patent/SK286756B6/sk not_active IP Right Cessation
- 2000-09-19 PT PT00967703T patent/PT1222163E/pt unknown
- 2000-09-19 EE EEP200200160A patent/EE05000B1/xx not_active IP Right Cessation
- 2000-09-19 EP EP00967703A patent/EP1222163B1/de not_active Expired - Lifetime
- 2000-09-19 ES ES00967703T patent/ES2265985T3/es not_active Expired - Lifetime
- 2000-09-19 AT AT00967703T patent/ATE332890T1/de active
- 2000-09-19 PL PL354322A patent/PL204034B1/pl unknown
- 2000-09-19 RU RU2002111561/04A patent/RU2252214C2/ru not_active IP Right Cessation
- 2000-09-19 HU HU0203505A patent/HU229046B1/hu not_active IP Right Cessation
- 2000-09-19 CN CNB008127344A patent/CN1195738C/zh not_active Expired - Fee Related
- 2000-09-19 KR KR1020027004267A patent/KR100722178B1/ko not_active Expired - Fee Related
- 2000-09-19 NZ NZ518065A patent/NZ518065A/en not_active IP Right Cessation
- 2000-09-19 JP JP2001528137A patent/JP4713800B2/ja not_active Expired - Fee Related
- 2000-09-19 ME MEP-609/08A patent/MEP60908A/xx unknown
- 2000-09-19 AU AU77778/00A patent/AU766365B2/en not_active Ceased
- 2000-09-19 RS YUP-244/02A patent/RS50387B/sr unknown
- 2000-09-19 HR HR20020264A patent/HRP20020264B1/xx not_active IP Right Cessation
- 2000-09-19 TR TR2002/00883T patent/TR200200883T2/xx unknown
- 2000-09-19 BR BRPI0014465-7A patent/BR0014465B1/pt not_active IP Right Cessation
- 2000-09-19 DE DE50013167T patent/DE50013167D1/de not_active Expired - Lifetime
- 2000-09-28 AR ARP000105117A patent/AR031226A1/es active IP Right Grant
-
2002
- 2002-03-20 NO NO20021398A patent/NO327709B1/no not_active IP Right Cessation
- 2002-03-25 IL IL148870A patent/IL148870A/en not_active IP Right Cessation
- 2002-03-28 ZA ZA200202521A patent/ZA200202521B/xx unknown
-
2006
- 2006-09-28 CY CY20061101413T patent/CY1106178T1/el unknown
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2002046162A1 (de) * | 2000-12-07 | 2002-06-13 | Aventis Pharma Deutschland Gmbh | Ortho-substituierte stickstoffhaltige bisarylverbindungen zur verwendung als kalium-kanal-inhibitoren |
| US6794377B2 (en) | 2000-12-07 | 2004-09-21 | Aventis Pharma Deutschland Gmbh | Ortho, ortho-substituted nitrogen-containing bisaryl compounds, processes for their preparation, their use as medicaments, and pharmaceutical preparation comprising them |
| US7235690B2 (en) | 2001-04-28 | 2007-06-26 | Sanofi-Aventis Deutschland Gmbh | Anthranilamides and methods of their use |
| WO2002088073A1 (de) | 2001-04-28 | 2002-11-07 | Aventis Pharma Deutschland Gmbh | Anthranilsäureamide, verfahren zu ihrer herstellung, ihre verwendung als antiarrhythmika sowie pharmazeutische zubereitungen davon |
| US7332608B2 (en) | 2001-04-28 | 2008-02-19 | Sanofi-Aventis Deutschland Gmbh | Anthranilamides and methods of their use |
| KR100863924B1 (ko) * | 2001-06-12 | 2008-10-17 | 사노피-아벤티스 도이칠란트 게엠베하 | 헤테로아릴설포닐 측쇄를 갖는 안트라닐산 아미드 및 당해 화합물을 함유하는 약제학적 제제 |
| US6903216B2 (en) | 2001-06-12 | 2005-06-07 | Aventis Pharma Deutschland Gmbh | Anthranilamides with heteroarylsulfonyl side chain, process of preparation, and use |
| US7235664B2 (en) | 2001-06-12 | 2007-06-26 | Sanofi-Aventis Deutschland Gmbh | Anthranilamides with heteroarylsulfonyl side chain, process of preparation, and use |
| WO2002100825A3 (de) * | 2001-06-12 | 2003-12-11 | Aventis Pharma Gmbh | Anthranilsäureamide mit heteroarylsulfonyl-seitenkette und ihre verwendung als antiarrhythmische wirkstoffe |
| WO2004037789A3 (en) * | 2002-10-24 | 2004-10-28 | Merck Patent Gmbh | Methylene urea derivatives as raf-kinase inhibitors |
| US7589112B2 (en) | 2002-10-24 | 2009-09-15 | Merck Patent Gmbh | Methylene urea derivatives |
| AU2003268926B2 (en) * | 2002-10-24 | 2010-06-17 | Merck Patent Gmbh | Methylene urea derivatives as raf-kinase inhibitors |
| US8410143B2 (en) | 2002-10-24 | 2013-04-02 | Merck Patent Gmbh | Methylene urea derivatives |
| DE10312061A1 (de) * | 2003-03-18 | 2004-09-30 | Aventis Pharma Deutschland Gmbh | Kombination von Phenylcarbonsäureamiden mit Blockern des IK-Kanals und deren Verwendung zur Behandlung von Vorhofarrhythmien |
| DE10341233A1 (de) * | 2003-09-08 | 2005-03-24 | Aventis Pharma Deutschland Gmbh | Kombination von Phenylcarbonsäureamiden mit beta-Adrenozeptoren-Blockern und deren Verwendung zur Behandlung von Vorhofarrhythmien |
| WO2005025674A1 (de) * | 2003-09-08 | 2005-03-24 | Sanofi-Aventis Deutschland Gmbh | Kombination von phenylcarbonsäureamiden mit beta-adrenozeptoren-blockern und deren verwendung zur behandlung von vorhofarrhythmien |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19947457A1 (de) | 2'-Substituierte 1,1'-Biphenyl-2-carbonamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie enthaltende pharmazeutische Zubereitungen | |
| EP1341764B1 (de) | Ortho-substituierte stickstoffhaltige bisarylverbindungen zur verwendung als kalium-kanal-inhibitoren | |
| EP1349846B1 (de) | Arylierte furan- und thiophencarbonsaureamide mit kalium kanal blockierender wirkung | |
| EP1339675B1 (de) | Ortho, meta-substituierte bisarylverbindungen, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen | |
| EP1194403B1 (de) | Indanylsubstituierte benzolcarbonamide, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen | |
| EP1385820B1 (de) | Anthranilsäureamide, verfahren zu ihrer herstellung, ihre verwendung als antiarrhythmika sowie pharmazeutische zubereitungen davon | |
| EP0556674B1 (de) | 3,5-Substituierte Benzoylguanidine, mit antiarrythmischer Wirkung und inhibierender Wirkung auf die Proliferationen von Zellen | |
| EP1399423B9 (de) | Anthranilsäureamide mit heteroarylsulfonyl-seitenkette und ihre verwendung als antiarrhythmische wirkstoffe | |
| US7982045B2 (en) | 2′-substituted 1,1′-biphenyl-2-carboxamides, processes for their preparation, their use as medicaments, and pharmaceutical preparations comprising them | |
| EP0589336A1 (de) | Benzoylguanidine, Verfahren zu ihrer Herstellung, sowie ihre Verwendung als Antiarrythmika | |
| EP0603650B1 (de) | 3,5-Substituierte Aminobenzoylguanidine, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament oder Diagnostikum sowie sie enthaltendes Medikament | |
| EP0556673A1 (de) | Ortho-substituierte Benzoylguanidine, zur Behandlung und zur Prophylaxe von Herz-Rhythmus-Störungen und von ischämisch induzierten Schäden sowie zur Inhibition der Proliferation von Zellen | |
| DE10121002A1 (de) | Verwendung von Anthranilsäureamiden als Medikament zur Behandlung von Arrhythmien sowie sie enthaltende pharmazeutische Zubereitungen | |
| WO2001087829A1 (de) | Bisacylguanidine | |
| DE19605610A1 (de) | Substituierte Thiophenylalkenylcarbonsäureguanidide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament oder Diagnostikum sowie sie enthaltendes Medikament |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: SANOFI-AVENTIS DEUTSCHLAND GMBH, 65929 FRANKFURT, |
|
| 8141 | Disposal/no request for examination |