DE19742978A1 - Multimetallcyanidkomplexe als Katalysatoren - Google Patents
Multimetallcyanidkomplexe als KatalysatorenInfo
- Publication number
- DE19742978A1 DE19742978A1 DE19742978A DE19742978A DE19742978A1 DE 19742978 A1 DE19742978 A1 DE 19742978A1 DE 19742978 A DE19742978 A DE 19742978A DE 19742978 A DE19742978 A DE 19742978A DE 19742978 A1 DE19742978 A1 DE 19742978A1
- Authority
- DE
- Germany
- Prior art keywords
- iii
- group
- rel
- anion
- complexes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 34
- 150000002825 nitriles Chemical class 0.000 title claims abstract description 30
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims abstract description 20
- 229920000570 polyether Polymers 0.000 claims abstract description 20
- 239000003446 ligand Substances 0.000 claims abstract description 17
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 claims abstract description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims abstract description 15
- -1 Co(III) Chemical compound 0.000 claims abstract description 14
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims abstract description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims abstract description 10
- 150000001298 alcohols Chemical class 0.000 claims abstract description 8
- 150000002170 ethers Chemical class 0.000 claims abstract description 8
- 150000002148 esters Chemical class 0.000 claims abstract description 7
- 150000002576 ketones Chemical class 0.000 claims abstract description 7
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical group O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000001408 amides Chemical class 0.000 claims abstract description 6
- 150000003568 thioethers Chemical class 0.000 claims abstract description 6
- 150000003672 ureas Chemical class 0.000 claims abstract description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 5
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims abstract description 5
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims abstract description 4
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims abstract description 4
- 239000012948 isocyanate Substances 0.000 claims abstract description 4
- 150000002513 isocyanates Chemical class 0.000 claims abstract description 4
- 230000011514 reflex Effects 0.000 claims abstract description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 25
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 17
- 229920005862 polyol Polymers 0.000 claims description 17
- 150000003077 polyols Chemical class 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 230000002378 acidificating effect Effects 0.000 claims description 11
- 150000002500 ions Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 5
- 150000001299 aldehydes Chemical class 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 150000002009 diols Chemical class 0.000 claims description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000004675 formic acid derivatives Chemical class 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000005529 alkyleneoxy group Chemical group 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 abstract description 22
- 239000002184 metal Substances 0.000 abstract description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 16
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 abstract 2
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 abstract 2
- BFGKITSFLPAWGI-UHFFFAOYSA-N chromium(3+) Chemical compound [Cr+3] BFGKITSFLPAWGI-UHFFFAOYSA-N 0.000 abstract 2
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 abstract 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 abstract 1
- MILUBEOXRNEUHS-UHFFFAOYSA-N iridium(3+) Chemical compound [Ir+3] MILUBEOXRNEUHS-UHFFFAOYSA-N 0.000 abstract 1
- MMIPFLVOWGHZQD-UHFFFAOYSA-N manganese(3+) Chemical compound [Mn+3] MMIPFLVOWGHZQD-UHFFFAOYSA-N 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 20
- 239000012071 phase Substances 0.000 description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- 230000007935 neutral effect Effects 0.000 description 10
- 125000002947 alkylene group Chemical group 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- 239000011701 zinc Substances 0.000 description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 229910052725 zinc Inorganic materials 0.000 description 7
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 229910017052 cobalt Inorganic materials 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- UOURRHZRLGCVDA-UHFFFAOYSA-D pentazinc;dicarbonate;hexahydroxide Chemical compound [OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Zn+2].[Zn+2].[Zn+2].[Zn+2].[Zn+2].[O-]C([O-])=O.[O-]C([O-])=O UOURRHZRLGCVDA-UHFFFAOYSA-D 0.000 description 4
- 239000012266 salt solution Substances 0.000 description 4
- 239000002699 waste material Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical group CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- NLTSCOZQKALPGZ-UHFFFAOYSA-N acetic acid;dihydrate Chemical compound O.O.CC(O)=O NLTSCOZQKALPGZ-UHFFFAOYSA-N 0.000 description 2
- 239000012072 active phase Substances 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- SRWMQSFFRFWREA-UHFFFAOYSA-M zinc formate Chemical compound [Zn+2].[O-]C=O SRWMQSFFRFWREA-UHFFFAOYSA-M 0.000 description 2
- XDWXRAYGALQIFG-UHFFFAOYSA-L zinc;propanoate Chemical compound [Zn+2].CCC([O-])=O.CCC([O-])=O XDWXRAYGALQIFG-UHFFFAOYSA-L 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
- C07F15/06—Cobalt compounds
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J27/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- B01J27/24—Nitrogen compounds
- B01J27/26—Cyanides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/02—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring
- C08G65/26—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds
- C08G65/2642—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds characterised by the catalyst used
- C08G65/2645—Metals or compounds thereof, e.g. salts
- C08G65/2663—Metal cyanide catalysts, i.e. DMC's
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Toxicology (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- General Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polyethers (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742978A DE19742978A1 (de) | 1997-09-29 | 1997-09-29 | Multimetallcyanidkomplexe als Katalysatoren |
| DE59804828T DE59804828D1 (de) | 1997-09-29 | 1998-09-28 | Multimetallcyanidkomplexe als katalysatoren |
| KR1020007003299A KR100563897B1 (ko) | 1997-09-29 | 1998-09-28 | 촉매로서의 다금속 시아니드 착물 |
| JP2000513857A JP4471492B2 (ja) | 1997-09-29 | 1998-09-28 | 触媒としての複数シアン化金属錯体 |
| EP98954291A EP1021453B1 (de) | 1997-09-29 | 1998-09-28 | Multimetallcyanidkomplexe als katalysatoren |
| PCT/EP1998/006154 WO1999016775A1 (de) | 1997-09-29 | 1998-09-28 | Multimetallcyanidkomplexe als katalysatoren |
| AT98954291T ATE220684T1 (de) | 1997-09-29 | 1998-09-28 | Multimetallcyanidkomplexe als katalysatoren |
| CNB988095912A CN1221561C (zh) | 1997-09-29 | 1998-09-28 | 作为催化剂的多金属氰化物复合物 |
| US09/509,515 US6303833B1 (en) | 1997-09-29 | 1998-09-28 | Multi-metal cyanide complexes as catalysts and their use in preparing polyetherpolyols |
| ES98954291T ES2181291T3 (es) | 1997-09-29 | 1998-09-28 | Complejos de cianuro multimetalicos como catalizadores. |
| CA002305668A CA2305668A1 (en) | 1997-09-29 | 1998-09-28 | Multi-metal cyanide complexes as catalysts |
| ARP980104847A AR017166A1 (es) | 1997-09-29 | 1998-09-29 | Cianocomplejo multimetalico cristalino, mezcla de los mismos, proceso para su obtencion, uso de dichos cianocomplejos catalizadores que los comprende, uso del mismo para la alcoxilacion de compuestos y proceso para la obtencion de polieterpolioles en presencia de dicho catalizador |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742978A DE19742978A1 (de) | 1997-09-29 | 1997-09-29 | Multimetallcyanidkomplexe als Katalysatoren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE19742978A1 true DE19742978A1 (de) | 1999-04-01 |
Family
ID=7843998
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742978A Withdrawn DE19742978A1 (de) | 1997-09-29 | 1997-09-29 | Multimetallcyanidkomplexe als Katalysatoren |
| DE59804828T Expired - Lifetime DE59804828D1 (de) | 1997-09-29 | 1998-09-28 | Multimetallcyanidkomplexe als katalysatoren |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE59804828T Expired - Lifetime DE59804828D1 (de) | 1997-09-29 | 1998-09-28 | Multimetallcyanidkomplexe als katalysatoren |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US6303833B1 (enExample) |
| EP (1) | EP1021453B1 (enExample) |
| JP (1) | JP4471492B2 (enExample) |
| KR (1) | KR100563897B1 (enExample) |
| CN (1) | CN1221561C (enExample) |
| AR (1) | AR017166A1 (enExample) |
| AT (1) | ATE220684T1 (enExample) |
| CA (1) | CA2305668A1 (enExample) |
| DE (2) | DE19742978A1 (enExample) |
| ES (1) | ES2181291T3 (enExample) |
| WO (1) | WO1999016775A1 (enExample) |
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000074844A1 (de) * | 1999-06-02 | 2000-12-14 | Basf Aktiengesellschaft | Multimetallcyanid-katalysatoren |
| WO2001004181A1 (en) * | 1999-07-09 | 2001-01-18 | The Dow Chemical Company | Metal hexacyanocobaltate nitroferricyanide complexes |
| WO2001038421A1 (de) * | 1999-11-26 | 2001-05-31 | Basf Aktiengesellschaft | Verfahren zur aufarbeitung von polyetheralkoholen |
| WO2001053381A1 (de) * | 2000-01-18 | 2001-07-26 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetheralkoholen |
| WO2001062824A1 (de) * | 2000-02-24 | 2001-08-30 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetherpolyolen in gegenwart eines multimetallcyanidkomplex-katalysators |
| WO2001062826A1 (de) * | 2000-02-24 | 2001-08-30 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetherpolyolen in gegenwart eines multimetallcyanidkomplex-katalysators |
| WO2001062825A1 (de) * | 2000-02-24 | 2001-08-30 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetherpolyolen |
| US6613714B2 (en) * | 1999-06-02 | 2003-09-02 | Basf Aktiengesellschaft | Multimetal cyanide compounds, their preparation and their use |
| US6764978B2 (en) * | 2002-08-28 | 2004-07-20 | Basf Aktiengesellschaft | Multimetal cyanide compounds |
| DE102009045651A1 (de) | 2008-10-17 | 2010-04-29 | Basf Se | Textilien und Verfahren zu ihrer Herstellung |
| WO2011039200A1 (en) | 2009-09-30 | 2011-04-07 | Basf Se | Alkoxylated polymers |
| WO2011047780A1 (en) | 2009-10-19 | 2011-04-28 | Basf Se | Conditioning of double metal cyanide catalysts |
| WO2011085772A1 (en) | 2010-01-15 | 2011-07-21 | Basf Se | "process for the dmc-catalyzed preparation of polyols" |
| WO2011160797A1 (en) | 2010-06-23 | 2011-12-29 | Basf Se | Modified double metal cyanide catalysts, process for the preparation by treatment of crystalline dmc catalyst with bronsted acid and use thereof |
| DE102010039090A1 (de) | 2010-08-09 | 2012-02-09 | Basf Se | Verfahren zur Herstellung von Polyetheralkoholen |
| WO2019081210A1 (en) | 2017-10-27 | 2019-05-02 | Huntsman International Llc | CATALYSTS FOR MANUFACTURING OXAZOLIDINONE MATERIALS |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6376645B1 (en) | 1999-07-09 | 2002-04-23 | The Dow Chemical Company | Complexing agent-modified hexacyanometallate hexanitrometallate catalysts |
| WO2001083107A2 (en) * | 2000-04-28 | 2001-11-08 | Synuthane International, Inc. | Double metal cyanide catalysts containing polyglycol ether complexing agents |
| US6388048B1 (en) * | 2000-05-19 | 2002-05-14 | The Dow Chemical Company | Complexing agent-modified trimetal cyanide catalyst |
| DE10137628A1 (de) * | 2001-08-03 | 2003-02-27 | Basf Ag | Verfahren zur Herstellung von Polyurethan-Weichschaumstoffen |
| DE10143195A1 (de) * | 2001-09-04 | 2003-03-20 | Basf Ag | Integriertes Verfahren zur Herstellung von Polyurethan-Schäumen |
| JP4112501B2 (ja) | 2002-04-26 | 2008-07-02 | ビーエーエスエフ ソシエタス・ヨーロピア | Ｃ１０−アルカノールアルコキシレート−混合物及び該混合物の使用 |
| AU2003222839A1 (en) | 2002-04-26 | 2003-11-10 | Basf Aktiengesellschaft | Alkoxylate mixtures and detergents containing the same |
| US6855658B1 (en) | 2003-08-26 | 2005-02-15 | Bayer Antwerp, N.V. | Hydroxide containing double metal cyanide (DMC) catalysts |
| DE10341724A1 (de) * | 2003-09-10 | 2005-04-21 | Basf Ag | In Alkalien stabile Alkoxylate |
| DE10341725A1 (de) * | 2003-09-10 | 2005-04-21 | Basf Ag | Festes wasserfreies Kompositmaterial |
| DE10348420A1 (de) * | 2003-10-14 | 2005-05-25 | Basf Ag | C10-Alkanolalkoxylat-Gemische und ihre Verwendung - Neue schaumarme Netzer |
| AU2005321515B2 (en) | 2004-12-24 | 2010-08-19 | Basf Aktiengesellschaft | Use of non-ionic surfactants in the production of metals |
| US20060223973A1 (en) * | 2005-03-29 | 2006-10-05 | Basf Corporation | Method of forming a polyethercarbonate polyol |
| US7671228B2 (en) * | 2005-03-29 | 2010-03-02 | Basf Corporation | Method of forming a polyethercarbonate polyol using a CO2-philic compound or substituent |
| US7268204B2 (en) * | 2005-03-29 | 2007-09-11 | Basf Corporation | Complex of a multimetal cyanide compound and methods of forming polyethercarbonate polyols |
| US20080021191A1 (en) * | 2006-07-20 | 2008-01-24 | Reese Jack R | High water content tolerant process for the production of polyethers |
| US7977501B2 (en) | 2006-07-24 | 2011-07-12 | Bayer Materialscience Llc | Polyether carbonate polyols made via double metal cyanide (DMC) catalysis |
| DE102007019458A1 (de) | 2007-04-25 | 2008-10-30 | Basf Se | Phosphatfreies Maschinengeschirrspülmittel mit ausgezeichneter Klarspülleistung |
| DE102007019457A1 (de) | 2007-04-25 | 2008-10-30 | Basf Se | Maschinengeschirrspülmittel mit ausgezeichneter Klarspülleistung |
| CN101684184A (zh) | 2008-09-27 | 2010-03-31 | 巴斯夫欧洲公司 | 可通过使用可再生的原料获得的聚氨酯鞋底 |
| WO2010072769A1 (de) | 2008-12-23 | 2010-07-01 | Basf Se | Verfahren zur herstellung von polyether-blockcopolymeren |
| WO2010105966A1 (de) | 2009-03-17 | 2010-09-23 | Basf Se | POLYURETHANFORMKÖRPER MIT VERBESSERTER WEITERREIßFESTIGKEIT UND VERBESSERTEM DAUERBIEGEVERHALTEN |
| RU2560724C2 (ru) | 2009-07-29 | 2015-08-20 | Басф Се | Способ получения простых полиэфироспиртов из алкиленоксидов |
| KR20120060845A (ko) | 2009-08-13 | 2012-06-12 | 바스프 에스이 | 다금속 시아니드 화합물의 제조 방법 |
| MX2012004023A (es) | 2009-10-14 | 2012-05-08 | Basf Se | Proceso para la extraccion terciaria de petroleo utilizando mezclas de agentes tensioactivos. |
| US8584750B2 (en) | 2009-10-14 | 2013-11-19 | Basf Se | Process for tertiary mineral oil production using surfactant mixtures |
| EP2488599B1 (de) | 2009-10-14 | 2014-04-02 | Basf Se | Verfahren zur tertiären erdölförderung unter verwendung von tensidmischungen |
| US8853136B2 (en) | 2009-10-14 | 2014-10-07 | Basf Se | Process for tertiary mineral oil production using surfactant mixtures |
| EP2542206B1 (de) | 2010-03-02 | 2015-05-13 | Basf Se | Blockcopolymere und deren verwendung |
| US8673275B2 (en) | 2010-03-02 | 2014-03-18 | Basf Se | Block copolymers and their use |
| US20110218295A1 (en) * | 2010-03-02 | 2011-09-08 | Basf Se | Anionic associative rheology modifiers |
| WO2012098177A1 (de) | 2011-01-21 | 2012-07-26 | Basf Se | Verwendung von talgfettalkoholethoxylaten in der maschinellen geschirrreinigung |
| KR102220786B1 (ko) * | 2013-07-18 | 2021-03-02 | 에스케이이노베이션 주식회사 | 이중금속 시아나이드(ｄｍｃ) 촉매 및 이를 통해 제조된 에폭사이드/이산화탄소 공중합체 |
| EP3138865A1 (de) | 2015-09-07 | 2017-03-08 | Basf Se | Verfahren zur herstellung von polyetherpolyolen |
| US9562135B1 (en) | 2015-12-21 | 2017-02-07 | Covestro Llc | Polyether carbonates by DMC catalysis |
| RU2020106787A (ru) | 2017-07-14 | 2021-08-16 | Басф Се | Биоразлагаемое поверхностно-активное вещество |
| US10479862B2 (en) | 2017-12-07 | 2019-11-19 | Covestro Llc | Amine based polymer polyol stabilizers |
| US10526484B2 (en) | 2017-12-20 | 2020-01-07 | Covestro Llc | Dithiocarbonate containing polyols as polymer polyol stabilizers |
| WO2020084046A1 (de) | 2018-10-26 | 2020-04-30 | Basf Se | Verfahren zur herstellung von propylenoxy-haltigen hydrophob assoziierenden monomeren mittels dmc-katalyse |
| WO2020084033A1 (de) | 2018-10-26 | 2020-04-30 | Basf Se | Hydrophob assoziierende copolymere für die tertiäre erdölförderung umfassend monomere mit propylenoxy-einheiten |
| US11566145B2 (en) | 2019-03-14 | 2023-01-31 | Covestro Llc | Polyurethane coating compositions and their use as gel coats |
| US10544158B1 (en) | 2019-03-14 | 2020-01-28 | Covestro Llc | Process for producing polycyclic polyether polyols |
| WO2024081701A1 (en) | 2022-10-14 | 2024-04-18 | Basf Se | Leaching aids and methods of preparation and use thereof |
| WO2024137042A1 (en) | 2022-12-23 | 2024-06-27 | Basf Se | Compositions for leaching metal-sulfide-containing materials and methods of preparation and use thereof |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5158922A (en) * | 1992-02-04 | 1992-10-27 | Arco Chemical Technology, L.P. | Process for preparing metal cyanide complex catalyst |
| US5712216A (en) | 1995-05-15 | 1998-01-27 | Arco Chemical Technology, L.P. | Highly active double metal cyanide complex catalysts |
| US5470813A (en) | 1993-11-23 | 1995-11-28 | Arco Chemical Technology, L.P. | Double metal cyanide complex catalysts |
| US5426081A (en) * | 1993-12-23 | 1995-06-20 | Arco Chemical Technology, L.P. | Polyurethane foam-supported double metal cyanide catalysts for polyol synthesis |
| US5627122A (en) * | 1995-07-24 | 1997-05-06 | Arco Chemical Technology, L.P. | Highly active double metal cyanide complex catalysts |
| DE19709031A1 (de) | 1997-03-06 | 1998-09-10 | Basf Ag | Verfahren zur Herstellung von Doppelmetallcyanidkatalysatoren |
-
1997
- 1997-09-29 DE DE19742978A patent/DE19742978A1/de not_active Withdrawn
-
1998
- 1998-09-28 US US09/509,515 patent/US6303833B1/en not_active Expired - Lifetime
- 1998-09-28 JP JP2000513857A patent/JP4471492B2/ja not_active Expired - Lifetime
- 1998-09-28 CN CNB988095912A patent/CN1221561C/zh not_active Expired - Fee Related
- 1998-09-28 WO PCT/EP1998/006154 patent/WO1999016775A1/de not_active Ceased
- 1998-09-28 KR KR1020007003299A patent/KR100563897B1/ko not_active Expired - Fee Related
- 1998-09-28 AT AT98954291T patent/ATE220684T1/de not_active IP Right Cessation
- 1998-09-28 EP EP98954291A patent/EP1021453B1/de not_active Expired - Lifetime
- 1998-09-28 DE DE59804828T patent/DE59804828D1/de not_active Expired - Lifetime
- 1998-09-28 ES ES98954291T patent/ES2181291T3/es not_active Expired - Lifetime
- 1998-09-28 CA CA002305668A patent/CA2305668A1/en not_active Abandoned
- 1998-09-29 AR ARP980104847A patent/AR017166A1/es unknown
Cited By (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000074844A1 (de) * | 1999-06-02 | 2000-12-14 | Basf Aktiengesellschaft | Multimetallcyanid-katalysatoren |
| US6613714B2 (en) * | 1999-06-02 | 2003-09-02 | Basf Aktiengesellschaft | Multimetal cyanide compounds, their preparation and their use |
| WO2001004181A1 (en) * | 1999-07-09 | 2001-01-18 | The Dow Chemical Company | Metal hexacyanocobaltate nitroferricyanide complexes |
| WO2001038421A1 (de) * | 1999-11-26 | 2001-05-31 | Basf Aktiengesellschaft | Verfahren zur aufarbeitung von polyetheralkoholen |
| WO2001053381A1 (de) * | 2000-01-18 | 2001-07-26 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetheralkoholen |
| WO2001062824A1 (de) * | 2000-02-24 | 2001-08-30 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetherpolyolen in gegenwart eines multimetallcyanidkomplex-katalysators |
| WO2001062826A1 (de) * | 2000-02-24 | 2001-08-30 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetherpolyolen in gegenwart eines multimetallcyanidkomplex-katalysators |
| WO2001062825A1 (de) * | 2000-02-24 | 2001-08-30 | Basf Aktiengesellschaft | Verfahren zur herstellung von polyetherpolyolen |
| US7022884B2 (en) | 2000-02-24 | 2006-04-04 | Basf Aktiengesellschaft | Preparation of polyetherpolyols in the presence of a multimetal cyanide complex catalyst |
| US6764978B2 (en) * | 2002-08-28 | 2004-07-20 | Basf Aktiengesellschaft | Multimetal cyanide compounds |
| DE102009045651A1 (de) | 2008-10-17 | 2010-04-29 | Basf Se | Textilien und Verfahren zu ihrer Herstellung |
| WO2011039200A1 (en) | 2009-09-30 | 2011-04-07 | Basf Se | Alkoxylated polymers |
| WO2011047780A1 (en) | 2009-10-19 | 2011-04-28 | Basf Se | Conditioning of double metal cyanide catalysts |
| US9114380B2 (en) | 2009-10-19 | 2015-08-25 | Basf Se | Conditioning of double metal cyanide catalysts |
| WO2011085772A1 (en) | 2010-01-15 | 2011-07-21 | Basf Se | "process for the dmc-catalyzed preparation of polyols" |
| WO2011160797A1 (en) | 2010-06-23 | 2011-12-29 | Basf Se | Modified double metal cyanide catalysts, process for the preparation by treatment of crystalline dmc catalyst with bronsted acid and use thereof |
| DE102010039090A1 (de) | 2010-08-09 | 2012-02-09 | Basf Se | Verfahren zur Herstellung von Polyetheralkoholen |
| WO2012020005A1 (de) | 2010-08-09 | 2012-02-16 | Basf Se | Verfahren zur herstellung von polyetheralkoholen |
| WO2019081210A1 (en) | 2017-10-27 | 2019-05-02 | Huntsman International Llc | CATALYSTS FOR MANUFACTURING OXAZOLIDINONE MATERIALS |
| US11530188B2 (en) | 2017-10-27 | 2022-12-20 | Huntsman International Llc | Catalysts for making oxazolidinone materials |
Also Published As
| Publication number | Publication date |
|---|---|
| WO1999016775A1 (de) | 1999-04-08 |
| JP2002500163A (ja) | 2002-01-08 |
| CN1275986A (zh) | 2000-12-06 |
| DE59804828D1 (de) | 2002-08-22 |
| ES2181291T3 (es) | 2003-02-16 |
| CA2305668A1 (en) | 1999-04-08 |
| JP4471492B2 (ja) | 2010-06-02 |
| US6303833B1 (en) | 2001-10-16 |
| CN1221561C (zh) | 2005-10-05 |
| AR017166A1 (es) | 2001-08-22 |
| ATE220684T1 (de) | 2002-08-15 |
| KR20010015642A (ko) | 2001-02-26 |
| EP1021453A1 (de) | 2000-07-26 |
| KR100563897B1 (ko) | 2006-03-24 |
| EP1021453B1 (de) | 2002-07-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1021453B1 (de) | Multimetallcyanidkomplexe als katalysatoren | |
| EP0862947B2 (de) | Verfahren zur Herstellung von Doppelmetallcyanidkatalysatoren und Verfahren zur Herstellung von Polyetheralkoholen | |
| EP1115490B1 (de) | Doppelmetallcyanid-katalysatoren für die herstellung von polyetherpolyolen | |
| EP1165657B1 (de) | Doppelmetallcyanid-katalysatoren für die herstellung von polyetherpolyolen | |
| EP1071509B1 (de) | Verbesserte doppelmetallcyanid-katalysatoren für die herstellung von polyetherpolyolen | |
| DE69626581T2 (de) | Hochwirksame Doppelmetallcyanidkatalysatorenkomplex | |
| EP1029871B1 (de) | Doppelmetallcyanid-Katalysatoren für die Herstellung von Polyetherpolyolen | |
| EP1165658B1 (de) | Doppelmetallcyanid-katalysatoren für die herstellung von polyetherpolyolen | |
| EP1165659B1 (de) | Verfahren zur herstellung von polyetherpolyolen | |
| WO2001053381A1 (de) | Verfahren zur herstellung von polyetheralkoholen | |
| EP1115489B1 (de) | Doppelmetallcyanid-katalysatoren für die herstellung von polyetherpolyolen | |
| EP1177239B1 (de) | Doppelmetallcyanid-katalysatoren für die herstellung von polyetherpolyolen | |
| WO2003020422A1 (de) | Doppelmetallcyanid-katalysatoren für die herstellung von polyetherpolyolen | |
| EP1254714B1 (de) | Doppelmetallcyanid-Katalysatoren für die Herstellung von Polyetherpolyolen | |
| EP1230289A1 (de) | Verfahren zur herstellung von blockweichschaumpolyolen | |
| DE19924672A1 (de) | Doppelmetallcyanic-Katalysatoren für die Herstellung von Polyetherpolyolen | |
| WO1999044940A1 (de) | Verfahren zur herstellung von doppelmetallcyanidkatalysatoren | |
| EP1185367A1 (de) | Multimetallcyanid-katalysatoren | |
| DE19920552A1 (de) | Doppelmetallcyanid-Katalysatoren für die Herstellung von Polyetherpolyolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |