DE1943615C - - Google Patents
Info
- Publication number
- DE1943615C DE1943615C DE1943615C DE 1943615 C DE1943615 C DE 1943615C DE 1943615 C DE1943615 C DE 1943615C
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- reaction
- liquid
- percent
- ethylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000460 chlorine Substances 0.000 claims description 60
- 229910052801 chlorine Inorganic materials 0.000 claims description 60
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 54
- 238000006243 chemical reaction Methods 0.000 claims description 35
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 31
- 239000007788 liquid Substances 0.000 claims description 31
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 30
- 239000005977 Ethylene Substances 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 27
- 125000001340 2-chloroethyl group Chemical class [H]C([H])(Cl)C([H])([H])* 0.000 claims description 15
- 239000007791 liquid phase Substances 0.000 claims description 8
- 238000005660 chlorination reaction Methods 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 5
- 229910001510 metal chloride Inorganic materials 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 15
- 229960003750 ethyl chloride Drugs 0.000 description 12
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 9
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 238000006467 substitution reaction Methods 0.000 description 9
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 8
- 229950011008 tetrachloroethylene Drugs 0.000 description 8
- VHHHONWQHHHLTI-UHFFFAOYSA-N hexachloroethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)Cl VHHHONWQHHHLTI-UHFFFAOYSA-N 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 6
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 4
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-dichloroethene Chemical class ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 4
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 238000007259 addition reaction Methods 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- UKDOTCFNLHHKOF-FGRDZWBJSA-N (z)-1-chloroprop-1-ene;(z)-1,2-dichloroethene Chemical group C\C=C/Cl.Cl\C=C/Cl UKDOTCFNLHHKOF-FGRDZWBJSA-N 0.000 description 2
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 2
- 239000012263 liquid product Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- QVLAWKAXOMEXPM-UHFFFAOYSA-N 1,1,1,2-tetrachloroethane Chemical compound ClCC(Cl)(Cl)Cl QVLAWKAXOMEXPM-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- KFUSEUYYWQURPO-UHFFFAOYSA-N 1,2-dichloroethene Chemical group ClC=CCl KFUSEUYYWQURPO-UHFFFAOYSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- 241001331845 Equus asinus x caballus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- FQZWICDYZYFYQX-UHFFFAOYSA-N chloroethane ethene Chemical compound C=C.CCCl FQZWICDYZYFYQX-UHFFFAOYSA-N 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- -1 vinylidene- Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69932609T2 (de) | Verfahren zur herstellung von 1-chloro-1,1,3,3,3-pentafluorpropan | |
| DE1417725B2 (de) | Verwendung eines Katalysators auf der Basis von Halogeniden des Kupfers, des Lanthans oder der Lanthaniden und der Alkalimetalle für die Oxychlorierung bzw. Oxybromierung von Kohlenwasserstoffen | |
| DE1542132B1 (de) | Verfahren zur Herstellung eines Kupfersilikat enthaltenden Katalysators fuer Oxychlorierungs-,Deacon- und Dehydro- chlorierungsreaktionen | |
| DE3608043A1 (de) | Verbessertes verfahren zur herstellung von 1,2-dichlorethan durch gasphasenchlorierung von ethylenhaltigen gasen | |
| DE1468680A1 (de) | Verfahren zur Herstellung von halogenierten Derivaten von aliphatischen Kohlenwasserstoffen | |
| DE3435299C2 (esLanguage) | ||
| DE68904137T2 (de) | Verfahren zur herstellung von 1,1,-dichlor-1-fluoroethan. | |
| DE1943615C (esLanguage) | ||
| DE2005259B2 (de) | Verfahren zur Herstellung von p-BromphenoL | |
| DE1817193C3 (de) | Verfahren zur gleichzeitigen Herstellung von symmetrischem und unsymmetrischem Tetrachloräthan | |
| EP0136566B1 (de) | Verfahren zur Herstellung von 3,4-Dichlorbenzotrihalogeniden | |
| DE3923248A1 (de) | Verfahren zur herstellung von 1,1,1-trifluor-2,2-dichlorethan unter erhoehtem druck | |
| DE69414375T3 (de) | Verfahren zur herstellung von 1,1,1,2,2-pentafluoroethan, verfahren zur herstellung von 2,2-dichloro-1,1,1-trifluoroethan und verfahren zur reinigung von 1,1,1,2,2-pentafluoroethan | |
| DE1943615B1 (de) | Verfahren zur Herstellung von Chloraethanen | |
| EP0022185B1 (de) | Verfahren zur Herstellung von Chloracetylchlorid | |
| DE2505055C2 (de) | Verfahren zur Herstellung von 1,1,2-Trichloräthan aus 1,2-Dichloräthan und Chlor | |
| DE1964551C3 (de) | Verfahren zur kontinuierlichen Chlorierung von 1,1,1-Trichloräthan | |
| DE1793316C3 (de) | Verfahren zur gleichseitigen Herstellung von Trichlorethylen, Tetrachloräthylen und 1,1,1-Trichloräthan | |
| DE2739621C2 (de) | Verfahren zur Herstellung von 1,1,1-Trifluor-2-chlorethan | |
| DE1793447C3 (de) | Verfahren zur Herstellung von Vinylacetat | |
| DE2645030A1 (de) | Verfahren zur herstellung von butandiol oder butendiol | |
| DE3606746A1 (de) | Verfahren zur herstellung von hexachlorethan aus hexachlorbutadien | |
| DE2845403A1 (de) | Katalysator fuer die herstellung von vinylchlorid und dessen verwendung | |
| DE2000424C3 (de) | Verfahren zur Herstellung von 1,1,1 Tnchlorathan enthaltenden polychlorierten Athanen | |
| DE1964552C3 (de) | Verfahren zur kontinuierlichen Chlorierung von Chloräthylenen im Gemisch mit Chloräthanen |