DE1935685A1 - Neue antimikrobiell wirksame Verbindungen - Google Patents
Neue antimikrobiell wirksame VerbindungenInfo
- Publication number
- DE1935685A1 DE1935685A1 DE19691935685 DE1935685A DE1935685A1 DE 1935685 A1 DE1935685 A1 DE 1935685A1 DE 19691935685 DE19691935685 DE 19691935685 DE 1935685 A DE1935685 A DE 1935685A DE 1935685 A1 DE1935685 A1 DE 1935685A1
- Authority
- DE
- Germany
- Prior art keywords
- nitro
- methyl
- imidazolyl
- methylene
- indanone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 24
- 230000000845 anti-microbial effect Effects 0.000 title description 3
- -1 5-nitro-1-methyl-2-imidazolyl-methylene Chemical group 0.000 claims description 62
- 125000004432 carbon atom Chemical group C* 0.000 claims description 32
- 239000003795 chemical substances by application Substances 0.000 claims description 25
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 claims description 19
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical compound C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 239000005977 Ethylene Substances 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- DEBYVIFQIVMNGL-UHFFFAOYSA-N 1,4-benzoxathiin-2-one Chemical compound C1=CC=C2OC(=O)CSC2=C1 DEBYVIFQIVMNGL-UHFFFAOYSA-N 0.000 claims description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 3
- YUVZAPAGRYGAQK-UHFFFAOYSA-N CC=CC=1NC(=CN1)[N+](=O)[O-] Chemical group CC=CC=1NC(=CN1)[N+](=O)[O-] YUVZAPAGRYGAQK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- FMJAEMCDTDPGTL-UHFFFAOYSA-N 6,7-dimethoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-benzofuran-3-one Chemical compound O1C2=C(OC)C(OC)=CC=C2C(=O)C1=CC1=NC=C([N+]([O-])=O)N1C FMJAEMCDTDPGTL-UHFFFAOYSA-N 0.000 claims description 2
- RFGNQFPXRYCKKF-UHFFFAOYSA-N 6-hydroxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-benzofuran-3-one Chemical compound OC1=CC2=C(C(C(O2)=CC=2N(C(=CN2)[N+](=O)[O-])C)=O)C=C1 RFGNQFPXRYCKKF-UHFFFAOYSA-N 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 2
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 2
- OOIVTNPWFIHCAL-UHFFFAOYSA-N 3-(1-methyl-5-nitroimidazol-2-yl)-1-phenylprop-2-en-1-one Chemical compound [N+](=O)([O-])C1=CN=C(N1C)C=CC(=O)C1=CC=CC=C1 OOIVTNPWFIHCAL-UHFFFAOYSA-N 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- NWOLIURIORAIFV-UHFFFAOYSA-N 2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-phenyl-3H-inden-1-one Chemical compound C1(=CC=CC=C1)C1C(C(C2=CC=CC=C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C NWOLIURIORAIFV-UHFFFAOYSA-N 0.000 claims 1
- KUBMVWRTCSIXMU-UHFFFAOYSA-N 7-hydroxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound OC=1C=CC=C2CC(C(C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C KUBMVWRTCSIXMU-UHFFFAOYSA-N 0.000 claims 1
- PMBWLPGJYMCUCE-UHFFFAOYSA-N 7-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC=1C=CC=C2CC(C(C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C PMBWLPGJYMCUCE-UHFFFAOYSA-N 0.000 claims 1
- 208000035473 Communicable disease Diseases 0.000 claims 1
- WXBPPTKUSWCKBV-UHFFFAOYSA-N N-[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]acetamide Chemical compound C(C)(=O)NC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C WXBPPTKUSWCKBV-UHFFFAOYSA-N 0.000 claims 1
- YQMKRTNGMVEWBW-UHFFFAOYSA-N [6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl] methanesulfonate Chemical compound CN1C(C=C2CCC3=C(C=CC(OS(C)(=O)=O)=C3)C2=O)=NC=C1[N+]([O-])=O YQMKRTNGMVEWBW-UHFFFAOYSA-N 0.000 claims 1
- 239000000654 additive Substances 0.000 claims 1
- 229940079593 drug Drugs 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 238000002844 melting Methods 0.000 description 99
- 230000008018 melting Effects 0.000 description 99
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 66
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 229910052739 hydrogen Inorganic materials 0.000 description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 229910052757 nitrogen Inorganic materials 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 238000001816 cooling Methods 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- 239000000460 chlorine Substances 0.000 description 12
- 239000012043 crude product Substances 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 8
- QOPRWBRNMPANKN-UHFFFAOYSA-N 5-methoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=C2C(=O)CCC2=C1 QOPRWBRNMPANKN-UHFFFAOYSA-N 0.000 description 7
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- ZRKQOVXGDIZYDS-UHFFFAOYSA-N 5-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=C2C(=O)CCC2=C1 ZRKQOVXGDIZYDS-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 5
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000029087 digestion Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- UMSMQVJJULFTFY-UHFFFAOYSA-N 2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound [N+](=O)([O-])C1=CN=C(N1C)C=C1C(C2=CC=CC=C2C1)=O UMSMQVJJULFTFY-UHFFFAOYSA-N 0.000 description 3
- NVKJOXRVEKMMHS-UHFFFAOYSA-N 5-nitro-1,2,4-triazol-3-one Chemical compound [O-][N+](=O)C1=NC(=O)N=N1 NVKJOXRVEKMMHS-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 3
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 3
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 2
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- RUORWXQKVXTQJJ-UHFFFAOYSA-N 4-methyl-2,3-dihydroinden-1-one Chemical compound CC1=CC=CC2=C1CCC2=O RUORWXQKVXTQJJ-UHFFFAOYSA-N 0.000 description 2
- CKPZRIYEXNKFLL-UHFFFAOYSA-N 5-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C CKPZRIYEXNKFLL-UHFFFAOYSA-N 0.000 description 2
- KLJWFFXNAZUXFJ-UHFFFAOYSA-N 6-(dimethylamino)-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(N(C)C)=CC=C21 KLJWFFXNAZUXFJ-UHFFFAOYSA-N 0.000 description 2
- BEVVUJBVEXJGKM-UHFFFAOYSA-N 6-amino-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(N)=CC=C21 BEVVUJBVEXJGKM-UHFFFAOYSA-N 0.000 description 2
- FNSQPQKPPGALFA-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(O)=CC=C21 FNSQPQKPPGALFA-UHFFFAOYSA-N 0.000 description 2
- XJWBVGDAFGVJEG-UHFFFAOYSA-N 7-hydroxy-2,3-dihydrochromen-4-one Chemical compound O=C1CCOC2=CC(O)=CC=C21 XJWBVGDAFGVJEG-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000224527 Trichomonas vaginalis Species 0.000 description 2
- XMUWQZLPLKUXFU-UHFFFAOYSA-N [6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-5-yl] acetate Chemical compound COC=1C=C2CC(C(C2=CC1OC(C)=O)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C XMUWQZLPLKUXFU-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229960002216 methylparaben Drugs 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- SJLPSXHHPOFHGX-UHFFFAOYSA-N (1-butyl-5-nitroimidazol-2-yl)methanol Chemical compound CCCCN1C(CO)=NC=C1[N+]([O-])=O SJLPSXHHPOFHGX-UHFFFAOYSA-N 0.000 description 1
- SQOOZGUUCAYPJE-UHFFFAOYSA-N (3-oxo-1,2-dihydroinden-4-yl) acetate Chemical compound CC(=O)OC1=CC=CC2=C1C(=O)CC2 SQOOZGUUCAYPJE-UHFFFAOYSA-N 0.000 description 1
- KBLPLHVEQQWZNJ-UHFFFAOYSA-N (5-oxo-7,8-dihydro-6h-naphthalen-2-yl) methanesulfonate Chemical compound O=C1CCCC2=CC(OS(=O)(=O)C)=CC=C21 KBLPLHVEQQWZNJ-UHFFFAOYSA-N 0.000 description 1
- WOGITNXCNOTRLK-VOTSOKGWSA-N (e)-3-phenylprop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC=C1 WOGITNXCNOTRLK-VOTSOKGWSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- DTOUUUZOYKYHEP-UHFFFAOYSA-N 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine Chemical compound CCCCC(CC)CN1CN(CC(CC)CCCC)CC(C)(N)C1 DTOUUUZOYKYHEP-UHFFFAOYSA-N 0.000 description 1
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 1
- XHQBIYCRFVVHFD-UHFFFAOYSA-N 1-benzothiophen-3-ol Chemical group C1=CC=C2C(O)=CSC2=C1 XHQBIYCRFVVHFD-UHFFFAOYSA-N 0.000 description 1
- JIUFIUFXILBXAC-UHFFFAOYSA-N 1-ethyl-5-nitroimidazole Chemical compound CCN1C=NC=C1[N+]([O-])=O JIUFIUFXILBXAC-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- WCJNIDIXZYVFKO-UHFFFAOYSA-N 2-[[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxy]ethyl acetate Chemical compound C(C)(=O)OCCOC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C WCJNIDIXZYVFKO-UHFFFAOYSA-N 0.000 description 1
- FWYMEPVUSSXSCU-UHFFFAOYSA-N 2-anilino-2-(4-methoxyphenyl)-1-phenylethanone;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C(C(=O)C=1C=CC=CC=1)NC1=CC=CC=C1 FWYMEPVUSSXSCU-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- FUBFWTUFPGFHOJ-UHFFFAOYSA-N 2-nitrofuran Chemical class [O-][N+](=O)C1=CC=CO1 FUBFWTUFPGFHOJ-UHFFFAOYSA-N 0.000 description 1
- BOZBBKZCBLPUSG-UHFFFAOYSA-N 2-prop-1-enyl-1h-imidazole Chemical group CC=CC1=NC=CN1 BOZBBKZCBLPUSG-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- SIUOTMYWHGODQX-UHFFFAOYSA-N 3-phenyl-2,3-dihydroinden-1-one Chemical compound C12=CC=CC=C2C(=O)CC1C1=CC=CC=C1 SIUOTMYWHGODQX-UHFFFAOYSA-N 0.000 description 1
- MSTDXOZUKAQDRL-UHFFFAOYSA-N 4-Chromanone Chemical compound C1=CC=C2C(=O)CCOC2=C1 MSTDXOZUKAQDRL-UHFFFAOYSA-N 0.000 description 1
- ZTWBCFVYMDBPPD-UHFFFAOYSA-N 4-bromo-7-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=C(Br)C2=C1C(=O)CC2 ZTWBCFVYMDBPPD-UHFFFAOYSA-N 0.000 description 1
- YVNMNVRDMWVUNR-UHFFFAOYSA-N 4-chloro-7-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=C(Cl)C2=C1C(=O)CC2 YVNMNVRDMWVUNR-UHFFFAOYSA-N 0.000 description 1
- BTYSYELHQDGJAB-UHFFFAOYSA-N 4-methoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=CC2=C1CCC2=O BTYSYELHQDGJAB-UHFFFAOYSA-N 0.000 description 1
- JEEGSBBVYUJLNR-UHFFFAOYSA-N 4-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC1=C2CC(C(C2=CC=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C JEEGSBBVYUJLNR-UHFFFAOYSA-N 0.000 description 1
- WAWRQRQDWAMCBW-UHFFFAOYSA-N 4-methyl-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound CC1=C2CC(C(C2=CC=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C WAWRQRQDWAMCBW-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- WMDAUVLSCBKCBO-UHFFFAOYSA-N 5,6-dihydroxy-2,3-dihydroinden-1-one Chemical compound C1=C(O)C(O)=CC2=C1C(=O)CC2 WMDAUVLSCBKCBO-UHFFFAOYSA-N 0.000 description 1
- ACTHIPKFWKJAAS-UHFFFAOYSA-N 5,7-dimethyl-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound CC1=C2CCC(C(C2=CC(=C1)C)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C ACTHIPKFWKJAAS-UHFFFAOYSA-N 0.000 description 1
- UYJCNOMEGPDXMV-UHFFFAOYSA-N 5,7-dimethyl-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1CCC(=O)C2=CC(C)=CC(C)=C21 UYJCNOMEGPDXMV-UHFFFAOYSA-N 0.000 description 1
- IJCQVTSNIBWXLF-UHFFFAOYSA-N 5-(2-hydroxyethoxy)-2,3-dihydroinden-1-one Chemical compound OCCOC=1C=C2CCC(C2=CC1)=O IJCQVTSNIBWXLF-UHFFFAOYSA-N 0.000 description 1
- QNQRSQUIJFKQPW-UHFFFAOYSA-N 5-[2-(dimethylamino)ethoxy]-2,3-dihydroinden-1-one Chemical compound CN(C)CCOC1=CC=C2C(=O)CCC2=C1 QNQRSQUIJFKQPW-UHFFFAOYSA-N 0.000 description 1
- RXKZAWOROTYWDR-UHFFFAOYSA-N 5-[2-(dimethylamino)ethoxy]-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3h-inden-1-one Chemical compound C1C2=CC(OCCN(C)C)=CC=C2C(=O)C1=CC1=NC=C([N+]([O-])=O)N1C RXKZAWOROTYWDR-UHFFFAOYSA-N 0.000 description 1
- CYHREFRIOXCPGS-UHFFFAOYSA-N 5-butoxy-1,3-dihydroinden-2-one Chemical compound C(CCC)OC=1C=C2CC(CC2=CC1)=O CYHREFRIOXCPGS-UHFFFAOYSA-N 0.000 description 1
- MEDSHTHCZIOVPU-UHFFFAOYSA-N 5-chloro-2,3-dihydroinden-1-one Chemical compound ClC1=CC=C2C(=O)CCC2=C1 MEDSHTHCZIOVPU-UHFFFAOYSA-N 0.000 description 1
- FLMVKFTYGACBNH-UHFFFAOYSA-N 5-ethoxy-2,3-dihydroinden-1-one Chemical compound CCOC1=CC=C2C(=O)CCC2=C1 FLMVKFTYGACBNH-UHFFFAOYSA-N 0.000 description 1
- JANSNAALIMNXFX-UHFFFAOYSA-N 5-hydroxy-6,7-dimethoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound OC1=C2CCC(C(C2=CC(=C1OC)OC)=O)=CC=1N(C(=CN=1)[N+](=O)[O-])C JANSNAALIMNXFX-UHFFFAOYSA-N 0.000 description 1
- ZIYMSHKCDCYEBL-UHFFFAOYSA-N 5-hydroxy-6,7-dimethoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=C1C=C(OC)C(OC)=C2O ZIYMSHKCDCYEBL-UHFFFAOYSA-N 0.000 description 1
- NUOWVWNBAMQRFR-UHFFFAOYSA-N 6-(2-hydroxyethoxy)-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OCCO)=CC=C21 NUOWVWNBAMQRFR-UHFFFAOYSA-N 0.000 description 1
- YCSMNQNLWDWZPB-UHFFFAOYSA-N 6-(ethylamino)-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(NCC)=CC=C21 YCSMNQNLWDWZPB-UHFFFAOYSA-N 0.000 description 1
- ZXGAPAUXCAUXDW-UHFFFAOYSA-N 6-(methylamino)-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(NC)=CC=C21 ZXGAPAUXCAUXDW-UHFFFAOYSA-N 0.000 description 1
- RFKQURMVRQGGLW-UHFFFAOYSA-N 6-[2-(dimethylamino)ethoxy]-3,4-dihydro-2H-naphthalen-1-one hydrochloride Chemical compound Cl.CN(C)CCOC1=CC2=C(C=C1)C(=O)CCC2 RFKQURMVRQGGLW-UHFFFAOYSA-N 0.000 description 1
- CAIDTRYYHGGEMP-UHFFFAOYSA-N 6-[2-(dimethylamino)ethoxy]-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OCCN(C)C)=CC=C21 CAIDTRYYHGGEMP-UHFFFAOYSA-N 0.000 description 1
- IBGSTOWDILMEHA-UHFFFAOYSA-N 6-amino-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound NC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C IBGSTOWDILMEHA-UHFFFAOYSA-N 0.000 description 1
- FEUMSMHGLKFCLZ-UHFFFAOYSA-N 6-hydroxy-5-methoxy-2,3-dihydroinden-1-one Chemical compound C1=C(O)C(OC)=CC2=C1C(=O)CC2 FEUMSMHGLKFCLZ-UHFFFAOYSA-N 0.000 description 1
- TWANVBMFHYTTTN-UHFFFAOYSA-N 6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound COC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C TWANVBMFHYTTTN-UHFFFAOYSA-N 0.000 description 1
- MNALUTYMBUBKNX-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC=C21 MNALUTYMBUBKNX-UHFFFAOYSA-N 0.000 description 1
- LXAQGDPMKKHFKF-UHFFFAOYSA-N 7-chloro-4,6-dimethoxy-1-benzofuran-3-one Chemical compound COC1=CC(OC)=C(Cl)C2=C1C(=O)CO2 LXAQGDPMKKHFKF-UHFFFAOYSA-N 0.000 description 1
- NWIGGOXLUZMSRH-UHFFFAOYSA-N 7-chloro-4,6-dimethoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-benzofuran-3-one Chemical compound ClC1=C(C=C(C=2C(C(OC21)=CC=2N(C(=CN2)[N+](=O)[O-])C)=O)OC)OC NWIGGOXLUZMSRH-UHFFFAOYSA-N 0.000 description 1
- DRHXUYFRRQUTNN-UHFFFAOYSA-N 7-hydroxy-3,4-dimethyl-2,3-dihydroinden-1-one Chemical compound CC1=CC=C(O)C2=C1C(C)CC2=O DRHXUYFRRQUTNN-UHFFFAOYSA-N 0.000 description 1
- FXSPZXVFPQNAOE-UHFFFAOYSA-N 7-methoxy-1,4-benzoxathiin-2-one Chemical compound COC1=CC=C2SCC(OC2=C1)=O FXSPZXVFPQNAOE-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- NAVKVJHCJPCNJR-UHFFFAOYSA-N C(C)(=O)NC1=CC=C(C=C1)C(C=CC=1N(C(=CN1)[N+](=O)[O-])C)=O Chemical compound C(C)(=O)NC1=CC=C(C=C1)C(C=CC=1N(C(=CN1)[N+](=O)[O-])C)=O NAVKVJHCJPCNJR-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WEBCZGJWXXPNHB-UHFFFAOYSA-N N1-(5-oxo-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide Chemical compound O=C1CCCC2=CC(NC(=O)C)=CC=C21 WEBCZGJWXXPNHB-UHFFFAOYSA-N 0.000 description 1
- LVPWKJQIJLGVBZ-UHFFFAOYSA-N OCCOC1C(C2=CC=CC=C2C1)=O Chemical compound OCCOC1C(C2=CC=CC=C2C1)=O LVPWKJQIJLGVBZ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- 241000224526 Trichomonas Species 0.000 description 1
- 208000005448 Trichomonas Infections Diseases 0.000 description 1
- 206010044620 Trichomoniasis Diseases 0.000 description 1
- NITOVKVCLCBSJS-UHFFFAOYSA-N [2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-4-yl] acetate Chemical compound C(C)(=O)OC1=C2CC(C(C2=CC=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C NITOVKVCLCBSJS-UHFFFAOYSA-N 0.000 description 1
- OFVNVWNCZLIDDU-UHFFFAOYSA-N [2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl] 3-phenylprop-2-enoate Chemical compound C(C=CC1=CC=CC=C1)(=O)OC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C OFVNVWNCZLIDDU-UHFFFAOYSA-N 0.000 description 1
- MTSIHPNKISGDDS-UHFFFAOYSA-N [2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-4-yl] acetate Chemical compound C(C)(=O)OC=1C=CC=C2CC(C(C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C MTSIHPNKISGDDS-UHFFFAOYSA-N 0.000 description 1
- UJTDFBJJWFCRMC-UHFFFAOYSA-N [7-bromo-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-4-yl] acetate Chemical compound BrC1=C2CC(C(C2=C(C=C1)OC(C)=O)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C UJTDFBJJWFCRMC-UHFFFAOYSA-N 0.000 description 1
- VGCGZUOVJXBUSJ-UHFFFAOYSA-N [7-chloro-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-4-yl] acetate Chemical compound ClC1=C2CC(C(C2=C(C=C1)OC(C)=O)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C VGCGZUOVJXBUSJ-UHFFFAOYSA-N 0.000 description 1
- FXRLQKXOJACDDT-UHFFFAOYSA-N [acetyloxy-(1-methyl-5-nitroimidazol-2-yl)methyl] acetate Chemical compound [N+](=O)([O-])C1=CN=C(N1C)C(OC(C)=O)OC(C)=O FXRLQKXOJACDDT-UHFFFAOYSA-N 0.000 description 1
- ZIXYEABWUGPELQ-UHFFFAOYSA-N acetonitrile chloroform oxolane Chemical compound O1CCCC1.C(Cl)(Cl)Cl.C(C)#N ZIXYEABWUGPELQ-UHFFFAOYSA-N 0.000 description 1
- ZULJYVVAYGFYKU-UHFFFAOYSA-N acetonitrile;chloroform Chemical compound CC#N.ClC(Cl)Cl ZULJYVVAYGFYKU-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- QDHFHIQKOVNCNC-UHFFFAOYSA-N butane-1-sulfonic acid Chemical compound CCCCS(O)(=O)=O QDHFHIQKOVNCNC-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229960004867 hexetidine Drugs 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- VAOCPAMSLUNLGC-UHFFFAOYSA-N metronidazole Chemical compound CC1=NC=C([N+]([O-])=O)N1CCO VAOCPAMSLUNLGC-UHFFFAOYSA-N 0.000 description 1
- 229960000282 metronidazole Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- GHUPGGYDRVSZSW-UHFFFAOYSA-N n-(1-oxo-2,3-dihydroinden-5-yl)acetamide Chemical compound CC(=O)NC1=CC=C2C(=O)CCC2=C1 GHUPGGYDRVSZSW-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000004957 nitroimidazoles Chemical class 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 239000000003 vaginal tablet Substances 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/94—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by oxygen or sulfur atoms, attached to other ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/95—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by nitrogen atoms, attached to other ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691935685 DE1935685A1 (de) | 1969-07-10 | 1969-07-10 | Neue antimikrobiell wirksame Verbindungen |
| ZA704381A ZA704381B (en) | 1969-07-10 | 1970-06-25 | New antimicrobially active compounds |
| SU1454753A SU365886A3 (enExample) | 1969-07-10 | 1970-07-02 | |
| SE7009299A SE387115B (sv) | 1969-07-10 | 1970-07-03 | Sett att framstella nitro-imidazoler med antimikrobiell verkan |
| EG304/70A EG10938A (en) | 1969-07-10 | 1970-07-04 | A process for preparation of nitro-methyl imidazolyl methylen endanon derivatives |
| US00053298A US3721668A (en) | 1969-07-10 | 1970-07-08 | Novel 5-nitro-imidazole antimicrobially effective compounds |
| PL1970141917A PL81333B1 (enExample) | 1969-07-10 | 1970-07-08 | |
| GB3317870A GB1320712A (en) | 1969-07-10 | 1970-07-08 | Antimicrobially active 5-nitroimidazole derivatives |
| IL34881A IL34881A (en) | 1969-07-10 | 1970-07-09 | Imidazole propellants that are active against bacteria |
| AT626270A AT295523B (de) | 1969-07-10 | 1970-07-09 | Verfahren zur Herstellung von neuen Nitroimidazolderivaten und ihren Salzen |
| FR7025515A FR2059500B1 (enExample) | 1969-07-10 | 1970-07-09 | |
| ES381633A ES381633A1 (es) | 1969-07-10 | 1970-07-09 | Procedimiento para la preparacion de nuevos compuestos con efecto antimicrobiano. |
| NO2694/70A NO127348B (enExample) | 1969-07-10 | 1970-07-09 | |
| BE753277D BE753277A (fr) | 1969-07-10 | 1970-07-10 | Nouveaux composes a activite antimicrobienne et leur preparation |
| CH1054470A CH547290A (de) | 1969-07-10 | 1970-07-10 | Verfahren zur herstellung von nitro-imidazolderivaten. |
| NL7010291A NL7010291A (enExample) | 1969-07-10 | 1970-07-10 | |
| CA087898A CA919181A (en) | 1969-07-10 | 1970-07-10 | Antimicrobially active compounds |
| JP45060553A JPS52948B1 (enExample) | 1969-07-10 | 1970-07-10 | |
| US00324598A US3814810A (en) | 1969-07-10 | 1973-01-18 | 5-nitro-imidazoles as antimicrobial agents |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691935685 DE1935685A1 (de) | 1969-07-10 | 1969-07-10 | Neue antimikrobiell wirksame Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1935685A1 true DE1935685A1 (de) | 1971-01-14 |
Family
ID=5739764
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691935685 Pending DE1935685A1 (de) | 1969-07-10 | 1969-07-10 | Neue antimikrobiell wirksame Verbindungen |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3721668A (enExample) |
| JP (1) | JPS52948B1 (enExample) |
| AT (1) | AT295523B (enExample) |
| BE (1) | BE753277A (enExample) |
| CA (1) | CA919181A (enExample) |
| CH (1) | CH547290A (enExample) |
| DE (1) | DE1935685A1 (enExample) |
| EG (1) | EG10938A (enExample) |
| ES (1) | ES381633A1 (enExample) |
| FR (1) | FR2059500B1 (enExample) |
| GB (1) | GB1320712A (enExample) |
| IL (1) | IL34881A (enExample) |
| NL (1) | NL7010291A (enExample) |
| NO (1) | NO127348B (enExample) |
| PL (1) | PL81333B1 (enExample) |
| SE (1) | SE387115B (enExample) |
| SU (1) | SU365886A3 (enExample) |
| ZA (1) | ZA704381B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0376197A1 (en) * | 1988-12-28 | 1990-07-04 | Takeda Chemical Industries, Ltd. | Sulfur-containing heterocyclic compounds |
| US5158943A (en) * | 1988-11-21 | 1992-10-27 | Takeda Chemical Industries, Ltd. | Sulfur-containing heterocyclic compounds |
| EP0924202A1 (en) * | 1997-12-16 | 1999-06-23 | SSP Co., Ltd. | Imidazole derivative and medicine comprising the same as active ingredient |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3989832A (en) * | 1972-04-01 | 1976-11-02 | Boehringer Mannheim G.M.B.H. | Combating bacteria with nitroimidazolyl-triazolo-pyridiazine compounds |
| PL91799B1 (enExample) * | 1972-04-01 | 1977-03-31 | ||
| US4086351A (en) * | 1975-10-09 | 1978-04-25 | Imperial Chemical Industries Limited | 1,2,4-Triazole-containing compounds and their use as pesticides |
| US4087536A (en) * | 1976-05-04 | 1978-05-02 | The Dow Chemical Company | Method for the use of thienylvinylimidazoles as anthelmintics |
| US4067989A (en) * | 1976-05-07 | 1978-01-10 | Imperial Chemical Industries Limited | 1,3-Diazole heterocyclic compounds and their use as pesticides |
| GB2060611A (en) * | 1979-08-08 | 1981-05-07 | Squibb & Sons Inc | 2,3-Dihydro-4H-1- benzothiopyran-4-ones and 2,3- dihydro-1H-inden-1-ones |
| US4273776A (en) * | 1980-01-30 | 1981-06-16 | E. R. Squibb & Sons, Inc. | Antibacterial and antifungal derivatives of 3-(1H-imidazol-1-yl)-2-propen-1-ones |
| EP1005338A4 (en) * | 1997-07-25 | 2001-11-07 | Phytera Inc | SUBSTITUTED AURON DERIVATIVES |
| WO2000018231A1 (en) * | 1998-09-25 | 2000-04-06 | Viropharma Incorporated | Methods for treating or preventing viral infections and associated diseases |
| US20040154264A1 (en) * | 2000-08-04 | 2004-08-12 | Colbert Elizabeth A. | Coated gypsum board products and method of manufacture |
| CN103483476B (zh) * | 2012-06-13 | 2017-02-22 | 中国石油化工股份有限公司 | 一种抗菌高分子聚合物及其制备方法和应用 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1480662A (fr) * | 1965-10-07 | 1967-05-12 | Pfizer & Co C | Perfectionnements aux procédés pour la préparation de vinyl-amidines cycliques substituées |
| AT277985B (de) * | 1967-11-14 | 1970-01-12 | Schering Ag | Verfahren zur Herstellung von neuen Nitro-furan-, -thiophen- oder -pyrrol-derivaten |
-
1969
- 1969-07-10 DE DE19691935685 patent/DE1935685A1/de active Pending
-
1970
- 1970-06-25 ZA ZA704381A patent/ZA704381B/xx unknown
- 1970-07-02 SU SU1454753A patent/SU365886A3/ru active
- 1970-07-03 SE SE7009299A patent/SE387115B/xx unknown
- 1970-07-04 EG EG304/70A patent/EG10938A/xx active
- 1970-07-08 US US00053298A patent/US3721668A/en not_active Expired - Lifetime
- 1970-07-08 GB GB3317870A patent/GB1320712A/en not_active Expired
- 1970-07-08 PL PL1970141917A patent/PL81333B1/pl unknown
- 1970-07-09 AT AT626270A patent/AT295523B/de not_active IP Right Cessation
- 1970-07-09 IL IL34881A patent/IL34881A/en unknown
- 1970-07-09 ES ES381633A patent/ES381633A1/es not_active Expired
- 1970-07-09 NO NO2694/70A patent/NO127348B/no unknown
- 1970-07-09 FR FR7025515A patent/FR2059500B1/fr not_active Expired
- 1970-07-10 CA CA087898A patent/CA919181A/en not_active Expired
- 1970-07-10 BE BE753277D patent/BE753277A/xx unknown
- 1970-07-10 JP JP45060553A patent/JPS52948B1/ja active Pending
- 1970-07-10 NL NL7010291A patent/NL7010291A/xx unknown
- 1970-07-10 CH CH1054470A patent/CH547290A/xx not_active IP Right Cessation
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5158943A (en) * | 1988-11-21 | 1992-10-27 | Takeda Chemical Industries, Ltd. | Sulfur-containing heterocyclic compounds |
| EP0376197A1 (en) * | 1988-12-28 | 1990-07-04 | Takeda Chemical Industries, Ltd. | Sulfur-containing heterocyclic compounds |
| EP0924202A1 (en) * | 1997-12-16 | 1999-06-23 | SSP Co., Ltd. | Imidazole derivative and medicine comprising the same as active ingredient |
| US6071943A (en) * | 1997-12-16 | 2000-06-06 | Ssp Co. Ltd. | Imidazole derivative and medicine comprising the same as active ingredient |
Also Published As
| Publication number | Publication date |
|---|---|
| SU365886A3 (enExample) | 1973-01-08 |
| EG10938A (en) | 1976-10-31 |
| AT295523B (de) | 1972-01-10 |
| JPS52948B1 (enExample) | 1977-01-11 |
| ES381633A1 (es) | 1972-12-01 |
| CA919181A (en) | 1973-01-16 |
| GB1320712A (en) | 1973-06-20 |
| SE387115B (sv) | 1976-08-30 |
| IL34881A (en) | 1974-07-31 |
| PL81333B1 (enExample) | 1975-08-30 |
| FR2059500A1 (enExample) | 1971-06-04 |
| BE753277A (fr) | 1971-01-11 |
| FR2059500B1 (enExample) | 1974-02-01 |
| IL34881A0 (en) | 1971-02-25 |
| NO127348B (enExample) | 1973-06-12 |
| NL7010291A (enExample) | 1971-01-12 |
| CH547290A (de) | 1974-03-29 |
| US3721668A (en) | 1973-03-20 |
| ZA704381B (en) | 1971-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1935685A1 (de) | Neue antimikrobiell wirksame Verbindungen | |
| DE2039427A1 (de) | Aliphatische Indenyl-3-amine | |
| DE2628189A1 (de) | 3-phenylindoline, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3309596A1 (de) | 2-substituierte 1-(3'-aminoalkyl)-1,2,3,4-tetrahydro-ss-carboline, ihre herstellung und verwendung als arzneimittel | |
| EP0008645B1 (de) | Alkoxyphenylpyrrolidone, Verfahren zu ihrer Herstellung und Arzneimittel auf Basis dieser Verbindungen | |
| EP0185909B1 (de) | 5-Alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2718405A1 (de) | Neue n- eckige klammer auf 1-(3-benzoylpropyl)-4-piperidyl eckige klammer zu -sulfonsaeureamide und verfahren zu deren herstellung | |
| DE1445904A1 (de) | Verfahren zur Herstellung von 4-Imidazolidon-Verbindungen | |
| DE3850308T2 (de) | Tetrahydroisochinolin-2-yl-Derivate als Thromboxan A2-Antagonisten. | |
| EP0072960B1 (de) | 1,5-Diphenylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1670305A1 (de) | 5-Phenyl-1H-1,5-benzodiazepin-2,4-dione und Verfahren zu ihrer Herstellung | |
| EP0298921B1 (de) | 1,2-Benzisoxazole und 1,2-Benzisothiazole | |
| EP0072961B1 (de) | 1-Phenylindazol-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3117389A1 (de) | Benzopyranylether, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel | |
| DE3785987T2 (de) | Imidazol-derivate und deren salze, verfahren zu deren herstellung, deren anwendung als arzneimittel und deren zusammensetzungen. | |
| CH636355A5 (de) | Substituierte 2-cyclopropyl-chromone. | |
| EP0041652A1 (de) | Neue Imidazolderivate, ihre Herstellung und diese Derivate enthaltende Arzneimittel | |
| DE1966203C3 (de) | 2,3-Dioxo-4-(R',R")-aminomethylpyrrolidine und Verfahren zu ihrer Herstellung | |
| CH619938A5 (en) | Process for the preparation of 2-carbalkoxyamino-5(6)-phenyl-sulphonyloxybenzimidazoles | |
| US3183239A (en) | 5-ether and 5-thioether-2-heterocyclic benzimidazoles | |
| AT286288B (de) | Verfahren zur Herstellung neuer Indolderivate | |
| US3441647A (en) | 1,2alpha;16,17alpha-bismethylene-delta**4,6-pregnadienes | |
| DE2642598A1 (de) | Neue isoindolinderivate, deren herstellung und diese enthaltende zusammensetzungen | |
| DE2626890A1 (de) | Neue derivate des indols, verfahren zu deren herstellung sowie diese enthaltende arzneimittel | |
| DE1133724B (de) | Verfahren zur Herstellung neuer Derivate des 1(2)-Dehydroadrenosterons |