DE1695652A1 - 1,3-Disubstituierte Pyrrolidine und Verfahren zu ihrer Herstellung - Google Patents
1,3-Disubstituierte Pyrrolidine und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1695652A1 DE1695652A1 DE19671695652 DE1695652A DE1695652A1 DE 1695652 A1 DE1695652 A1 DE 1695652A1 DE 19671695652 DE19671695652 DE 19671695652 DE 1695652 A DE1695652 A DE 1695652A DE 1695652 A1 DE1695652 A1 DE 1695652A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- lower alkyl
- hydrogen
- phenyl
- pyrrolidine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 1,3-Disubstituted pyrrolidines Chemical class 0.000 title claims description 130
- 238000002360 preparation method Methods 0.000 title claims description 58
- 238000000034 method Methods 0.000 title claims description 52
- 230000008569 process Effects 0.000 title claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 166
- 229910052757 nitrogen Inorganic materials 0.000 claims description 111
- 239000000203 mixture Substances 0.000 claims description 109
- 150000001875 compounds Chemical class 0.000 claims description 102
- 239000001257 hydrogen Substances 0.000 claims description 65
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 62
- 125000000217 alkyl group Chemical group 0.000 claims description 48
- 239000002904 solvent Substances 0.000 claims description 46
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 36
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 34
- 150000002431 hydrogen Chemical class 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 27
- 125000005843 halogen group Chemical group 0.000 claims description 20
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 12
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 11
- 150000003235 pyrrolidines Chemical class 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 9
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 6
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 230000001225 therapeutic effect Effects 0.000 claims description 5
- ILSPSRZZCYJKIL-UHFFFAOYSA-N 2-pyrrolidin-3-yl-1,3-dihydroisoindole Chemical compound C1NCCC1N1CC2=CC=CC=C2C1 ILSPSRZZCYJKIL-UHFFFAOYSA-N 0.000 claims description 4
- 229910014033 C-OH Inorganic materials 0.000 claims description 4
- 229910014570 C—OH Inorganic materials 0.000 claims description 4
- 241001465754 Metazoa Species 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- OFQGVINTJUCLFL-UHFFFAOYSA-N 2-pyrrolidin-3-yl-1h-benzimidazole Chemical compound C1NCCC1C1=NC2=CC=CC=C2N1 OFQGVINTJUCLFL-UHFFFAOYSA-N 0.000 claims description 3
- RLANOFAQNVDAQD-UHFFFAOYSA-N 3-(2-methoxyphenoxy)pyrrolidine Chemical compound COC1=CC=CC=C1OC1CNCC1 RLANOFAQNVDAQD-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 3
- 239000011737 fluorine Substances 0.000 claims 3
- 208000020016 psychiatric disease Diseases 0.000 claims 2
- 208000024891 symptom Diseases 0.000 claims 2
- UBEIHHPZWBMGOE-UHFFFAOYSA-N 1-(2-methoxyphenoxy)pyrrolidine Chemical compound COC1=C(ON2CCCC2)C=CC=C1 UBEIHHPZWBMGOE-UHFFFAOYSA-N 0.000 claims 1
- 239000003849 aromatic solvent Substances 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 230000008929 regeneration Effects 0.000 claims 1
- 238000011069 regeneration method Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 106
- 239000003921 oil Substances 0.000 description 98
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 93
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 90
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 85
- 229910052799 carbon Inorganic materials 0.000 description 79
- 238000004458 analytical method Methods 0.000 description 62
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 54
- 239000000047 product Substances 0.000 description 52
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 50
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical group CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 49
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 44
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 44
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 43
- 238000010992 reflux Methods 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 239000012458 free base Substances 0.000 description 26
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 25
- 239000000725 suspension Substances 0.000 description 24
- 239000003054 catalyst Substances 0.000 description 23
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 22
- 229910000027 potassium carbonate Inorganic materials 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 238000007327 hydrogenolysis reaction Methods 0.000 description 21
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 21
- 235000019341 magnesium sulphate Nutrition 0.000 description 21
- 239000000706 filtrate Substances 0.000 description 19
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- 239000000284 extract Substances 0.000 description 18
- 239000010410 layer Substances 0.000 description 18
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 16
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 15
- 238000001816 cooling Methods 0.000 description 15
- 238000004809 thin layer chromatography Methods 0.000 description 15
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 14
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 13
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 13
- 239000012299 nitrogen atmosphere Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 11
- 239000012298 atmosphere Substances 0.000 description 11
- 238000001035 drying Methods 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 11
- 230000009467 reduction Effects 0.000 description 10
- 238000006722 reduction reaction Methods 0.000 description 10
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 229910052987 metal hydride Inorganic materials 0.000 description 9
- 150000004681 metal hydrides Chemical class 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000000538 analytical sample Substances 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 8
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 239000012280 lithium aluminium hydride Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 239000002243 precursor Substances 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000012258 stirred mixture Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 239000001530 fumaric acid Substances 0.000 description 5
- 235000011087 fumaric acid Nutrition 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 5
- 239000000391 magnesium silicate Substances 0.000 description 5
- 229910052919 magnesium silicate Inorganic materials 0.000 description 5
- 235000019792 magnesium silicate Nutrition 0.000 description 5
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 5
- 239000000523 sample Substances 0.000 description 5
- HBVNLKQGRZPGRP-UHFFFAOYSA-N 1-benzylpyrrolidin-3-amine Chemical compound C1C(N)CCN1CC1=CC=CC=C1 HBVNLKQGRZPGRP-UHFFFAOYSA-N 0.000 description 4
- SIMYCJOGGRXQIY-UHFFFAOYSA-N 3-chloropyrrolidine Chemical compound ClC1CCNC1 SIMYCJOGGRXQIY-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- 239000002262 Schiff base Substances 0.000 description 4
- 150000004753 Schiff bases Chemical class 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 230000000202 analgesic effect Effects 0.000 description 4
- UWQIEDGNGUIPKS-UHFFFAOYSA-N benzene 2,2,4-trimethylpentane Chemical compound C1=CC=CC=C1.CC(C)CC(C)(C)C UWQIEDGNGUIPKS-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000002026 chloroform extract Substances 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- LBPDTAFHCUGAQN-UHFFFAOYSA-N 2-(1-benzylpyrrolidin-3-yl)isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C(C1)CCN1CC1=CC=CC=C1 LBPDTAFHCUGAQN-UHFFFAOYSA-N 0.000 description 3
- FXFDJSQOCVDXBX-UHFFFAOYSA-N 2-(3-chloropropyl)-2-(4-fluorophenyl)-1,3-dioxolane Chemical compound C1=CC(F)=CC=C1C1(CCCCl)OCCO1 FXFDJSQOCVDXBX-UHFFFAOYSA-N 0.000 description 3
- 125000006197 2-benzoyl ethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(=O)C([H])([H])C([H])([H])* 0.000 description 3
- DKNDBIIKSJWQFL-UHFFFAOYSA-N 3-(dimethylamino)-1-phenylpropan-1-one;hydron;chloride Chemical compound Cl.CN(C)CCC(=O)C1=CC=CC=C1 DKNDBIIKSJWQFL-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- DEYIRCMGXXEBMU-UHFFFAOYSA-N 4-benzyl-5h-1,4-benzoxazepin-3-one Chemical compound O=C1COC2=CC=CC=C2CN1CC1=CC=CC=C1 DEYIRCMGXXEBMU-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 208000019901 Anxiety disease Diseases 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 229910052770 Uranium Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 230000036506 anxiety Effects 0.000 description 3
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 230000001914 calming effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 3
- 238000000199 molecular distillation Methods 0.000 description 3
- GBQSYPAVGIYPLU-UHFFFAOYSA-N n-(2-methoxyphenyl)pyrrolidin-3-amine Chemical compound COC1=CC=CC=C1NC1CNCC1 GBQSYPAVGIYPLU-UHFFFAOYSA-N 0.000 description 3
- AAFUQJGCJNFFRT-UHFFFAOYSA-N n-phenylpyrrolidin-3-amine Chemical compound C1NCCC1NC1=CC=CC=C1 AAFUQJGCJNFFRT-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- CXIXZQKWESLZBD-UHFFFAOYSA-N (1-benzylpyrrolidin-3-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C(C1)CCN1CC1=CC=CC=C1 CXIXZQKWESLZBD-UHFFFAOYSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- KAGUYPQFCBPBBF-UHFFFAOYSA-N 1-benzyl-3-(2-methoxyphenoxy)pyrrolidine Chemical compound COC1=CC=CC=C1OC1CN(CC=2C=CC=CC=2)CC1 KAGUYPQFCBPBBF-UHFFFAOYSA-N 0.000 description 2
- PVGKRIVTZOPYDN-UHFFFAOYSA-N 1-benzyl-3-(2-methylphenyl)pyrrolidin-3-ol Chemical compound CC1=CC=CC=C1C1(O)CN(CC=2C=CC=CC=2)CC1 PVGKRIVTZOPYDN-UHFFFAOYSA-N 0.000 description 2
- ODHZGSJONPTACX-UHFFFAOYSA-N 1-benzyl-3-[3-(trifluoromethyl)phenoxy]pyrrolidine Chemical compound FC(F)(F)C1=CC=CC(OC2CN(CC=3C=CC=CC=3)CC2)=C1 ODHZGSJONPTACX-UHFFFAOYSA-N 0.000 description 2
- YMTSOJGEQVRFFT-UHFFFAOYSA-N 1-benzyl-3-[4-(diethylamino)phenyl]pyrrolidin-3-ol Chemical compound C(C1=CC=CC=C1)N1CC(CC1)(O)C1=CC=C(C=C1)N(CC)CC YMTSOJGEQVRFFT-UHFFFAOYSA-N 0.000 description 2
- DHGMDHQNUNRMIN-UHFFFAOYSA-N 1-benzylpyrrolidin-3-one Chemical compound C1C(=O)CCN1CC1=CC=CC=C1 DHGMDHQNUNRMIN-UHFFFAOYSA-N 0.000 description 2
- RYCQUUNQHVAFSM-UHFFFAOYSA-N 1-benzylpyrrolidine-3-carbonitrile Chemical compound C1C(C#N)CCN1CC1=CC=CC=C1 RYCQUUNQHVAFSM-UHFFFAOYSA-N 0.000 description 2
- CWLUFVAFWWNXJZ-UHFFFAOYSA-N 1-hydroxypyrrolidine Chemical compound ON1CCCC1 CWLUFVAFWWNXJZ-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- HDVHFHONOKCUHQ-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1,4-benzoxazepine Chemical compound C1NCCOC2=CC=CC=C21 HDVHFHONOKCUHQ-UHFFFAOYSA-N 0.000 description 2
- IKNBDASDQLMNMC-UHFFFAOYSA-N 2-(1-benzylpyrrolidin-3-yl)-1,3-dihydroisoindole Chemical compound C1CC(N2CC3=CC=CC=C3C2)CN1CC1=CC=CC=C1 IKNBDASDQLMNMC-UHFFFAOYSA-N 0.000 description 2
- ZILCRMAYDFNREU-UHFFFAOYSA-N 2-(1-benzylpyrrolidin-3-yl)-1h-benzimidazole Chemical compound C1CC(C=2NC3=CC=CC=C3N=2)CN1CC1=CC=CC=C1 ZILCRMAYDFNREU-UHFFFAOYSA-N 0.000 description 2
- NHHNBWPTEMBVLN-UHFFFAOYSA-N 2-propan-2-yloxypropane;2,2,4-trimethylpentane Chemical compound CC(C)OC(C)C.CC(C)CC(C)(C)C NHHNBWPTEMBVLN-UHFFFAOYSA-N 0.000 description 2
- NUPVGPCMRJIIPJ-UHFFFAOYSA-N 3-(2-bromophenoxy)pyrrolidine Chemical compound BrC1=CC=CC=C1OC1CNCC1 NUPVGPCMRJIIPJ-UHFFFAOYSA-N 0.000 description 2
- XYLQIZRZZDDGGI-UHFFFAOYSA-N 3-(2-methylphenyl)pyrrolidin-3-ol Chemical compound CC1=CC=CC=C1C1(O)CNCC1 XYLQIZRZZDDGGI-UHFFFAOYSA-N 0.000 description 2
- XPZIJQMOVSHKOL-UHFFFAOYSA-N 3-(2-methylphenyl)pyrrolidine Chemical compound CC1=CC=CC=C1C1CNCC1 XPZIJQMOVSHKOL-UHFFFAOYSA-N 0.000 description 2
- DUYDZGBSZJZIOZ-UHFFFAOYSA-N 3-[3-(trifluoromethyl)phenyl]pyrrolidine Chemical compound FC(F)(F)C1=CC=CC(C2CNCC2)=C1 DUYDZGBSZJZIOZ-UHFFFAOYSA-N 0.000 description 2
- SKHPQIQATRHESG-UHFFFAOYSA-N 3-phenoxypyrrolidine Chemical compound C1NCCC1OC1=CC=CC=C1 SKHPQIQATRHESG-UHFFFAOYSA-N 0.000 description 2
- LBZDEGAIDVFUHM-UHFFFAOYSA-N 4,5-dihydro-1,4-benzoxazepin-3-one Chemical compound C1NC(=O)COC2=CC=CC=C21 LBZDEGAIDVFUHM-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 206010001488 Aggression Diseases 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000016571 aggressive behavior Effects 0.000 description 2
- 208000012761 aggressive behavior Diseases 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000005265 dialkylamine group Chemical group 0.000 description 2
- AINBZKYUNWUTRE-UHFFFAOYSA-N ethanol;propan-2-ol Chemical compound CCO.CC(C)O AINBZKYUNWUTRE-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000006332 fluoro benzoyl group Chemical group 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 229910017053 inorganic salt Inorganic materials 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical class C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- JGBRWOFWXRFLEG-UHFFFAOYSA-N n,n-diethyl-4-pyrrolidin-3-ylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1CNCC1 JGBRWOFWXRFLEG-UHFFFAOYSA-N 0.000 description 2
- WSUKOTKTAJYBHJ-UHFFFAOYSA-N n-phenylpyrrolidin-1-amine Chemical compound C1CCCN1NC1=CC=CC=C1 WSUKOTKTAJYBHJ-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 230000001766 physiological effect Effects 0.000 description 2
- 238000003918 potentiometric titration Methods 0.000 description 2
- GUFUWKKDHIABBW-UHFFFAOYSA-N pyrrolidin-1-ylmethanol Chemical compound OCN1CCCC1 GUFUWKKDHIABBW-UHFFFAOYSA-N 0.000 description 2
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000008174 sterile solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- DFFINYKUAYHRBO-UHFFFAOYSA-N (1-benzylpyrrolidin-3-yl) 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1CN(CC=2C=CC=CC=2)CC1 DFFINYKUAYHRBO-UHFFFAOYSA-N 0.000 description 1
- CMLOBSOBLKJDDG-UHFFFAOYSA-N (1-benzylpyrrolidin-3-yl)-[4-(trifluoromethyl)phenyl]methanone Chemical compound C(C1=CC=CC=C1)N1CC(CC1)C(C1=CC=C(C=C1)C(F)(F)F)=O CMLOBSOBLKJDDG-UHFFFAOYSA-N 0.000 description 1
- GJFYMULJMJYQAD-UHFFFAOYSA-N (1-phenylpyrrolidin-3-yl)methanol Chemical compound C1C(CO)CCN1C1=CC=CC=C1 GJFYMULJMJYQAD-UHFFFAOYSA-N 0.000 description 1
- KVAOBHMRJUWQEC-SECBINFHSA-N (2R)-2-chloro-1-(4-fluorophenyl)butan-1-one Chemical compound Cl[C@@H](C(=O)C1=CC=C(C=C1)F)CC KVAOBHMRJUWQEC-SECBINFHSA-N 0.000 description 1
- MGAXYKDBRBNWKT-UHFFFAOYSA-N (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC(=O)CC1 MGAXYKDBRBNWKT-UHFFFAOYSA-N 0.000 description 1
- HZRJIAKKDMLYFS-UHFFFAOYSA-N 1,2-benzoxazepin-3-one Chemical compound C1=CC(=O)NOC2=CC=CC=C21 HZRJIAKKDMLYFS-UHFFFAOYSA-N 0.000 description 1
- ZCXLTWVZYXBHJS-UHFFFAOYSA-N 1,2-benzoxazepine Chemical compound O1N=CC=CC2=CC=CC=C12 ZCXLTWVZYXBHJS-UHFFFAOYSA-N 0.000 description 1
- VMOUKIAUHRUOCA-UHFFFAOYSA-N 1-(1-benzylpyrrolidin-3-yl)-2,3-dihydro-1H-isoindole Chemical class C(C1=CC=CC=C1)N1CC(CC1)C1NCC2=CC=CC=C12 VMOUKIAUHRUOCA-UHFFFAOYSA-N 0.000 description 1
- AFTQVONOXWGZPJ-UHFFFAOYSA-N 1-benzyl-3-chloropyrrolidine Chemical compound C1C(Cl)CCN1CC1=CC=CC=C1 AFTQVONOXWGZPJ-UHFFFAOYSA-N 0.000 description 1
- HMGDLYUTYLPXDR-UHFFFAOYSA-N 1-benzyl-3-phenoxypyrrolidine Chemical compound C=1C=CC=CC=1CN(C1)CCC1OC1=CC=CC=C1 HMGDLYUTYLPXDR-UHFFFAOYSA-N 0.000 description 1
- NSXHIJHCRCPVAS-UHFFFAOYSA-N 1-benzyl-4-methylpyrrolidin-3-one Chemical compound C1C(=O)C(C)CN1CC1=CC=CC=C1 NSXHIJHCRCPVAS-UHFFFAOYSA-N 0.000 description 1
- LVUQCTGSDJLWCE-UHFFFAOYSA-N 1-benzylpyrrolidin-2-one Chemical compound O=C1CCCN1CC1=CC=CC=C1 LVUQCTGSDJLWCE-UHFFFAOYSA-N 0.000 description 1
- YQMXOIAIYXXXEE-UHFFFAOYSA-N 1-benzylpyrrolidin-3-ol Chemical compound C1C(O)CCN1CC1=CC=CC=C1 YQMXOIAIYXXXEE-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- NNMBNYHMJRJUBC-UHFFFAOYSA-N 1-bromo-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(Br)=C1 NNMBNYHMJRJUBC-UHFFFAOYSA-N 0.000 description 1
- AUSRRRUBMHIEJD-UHFFFAOYSA-N 1-phenoxypyrrolidine Chemical class C1CCCN1OC1=CC=CC=C1 AUSRRRUBMHIEJD-UHFFFAOYSA-N 0.000 description 1
- OWVPCUZYAAYLLV-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride Chemical compound Cl.C1NCCOC2=CC=CC=C21 OWVPCUZYAAYLLV-UHFFFAOYSA-N 0.000 description 1
- VZUGAFLCEUCRRS-UHFFFAOYSA-N 2-(1-benzylpyrrolidin-3-yl)-4,5-dimethoxy-1,3-dihydroisoindole Chemical compound COC1=C2CN(CC2=CC=C1OC)C1CN(CC1)CC1=CC=CC=C1 VZUGAFLCEUCRRS-UHFFFAOYSA-N 0.000 description 1
- NBLDRRTUBLYRMY-UHFFFAOYSA-N 2-(1-benzylpyrrolidin-3-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole Chemical compound FC(C1=C2CN(CC2=CC=C1)C1CN(CC1)CC1=CC=CC=C1)(F)F NBLDRRTUBLYRMY-UHFFFAOYSA-N 0.000 description 1
- AYLGSTZFRLAEGQ-UHFFFAOYSA-N 2-(1-benzylpyrrolidin-3-yl)-5,6-dimethoxyisoindole-1,3-dione Chemical compound COC=1C=C2C(C(=O)N(C2=O)C2CN(CC2)CC2=CC=CC=C2)=CC1OC AYLGSTZFRLAEGQ-UHFFFAOYSA-N 0.000 description 1
- DLEHBGFKTMKLGO-UHFFFAOYSA-N 2-(1-benzylpyrrolidin-3-yl)-5-(trifluoromethyl)isoindole-1,3-dione Chemical compound FC(C=1C=C2C(C(=O)N(C2=O)C2CN(CC2)CC2=CC=CC=C2)=CC1)(F)F DLEHBGFKTMKLGO-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- MNGUYQVJFSKJOJ-UHFFFAOYSA-N 2-(3-chloropropyl)-2-phenyl-1,3-dioxolane Chemical compound C=1C=CC=CC=1C1(CCCCl)OCCO1 MNGUYQVJFSKJOJ-UHFFFAOYSA-N 0.000 description 1
- BNQMPUFBEBLZGA-UHFFFAOYSA-N 2-(4-fluorophenyl)-1,3-dioxolane Chemical compound C1=CC(F)=CC=C1C1OCCO1 BNQMPUFBEBLZGA-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- FEIYUDNHQFTSBE-UHFFFAOYSA-N 2-[(benzylamino)methyl]phenol Chemical class OC1=CC=CC=C1CNCC1=CC=CC=C1 FEIYUDNHQFTSBE-UHFFFAOYSA-N 0.000 description 1
- OFQCQIGMURIECL-UHFFFAOYSA-N 2-[2-(diethylamino)ethyl]-2',6'-dimethylspiro[isoquinoline-4,4'-oxane]-1,3-dione;phosphoric acid Chemical compound OP(O)(O)=O.O=C1N(CCN(CC)CC)C(=O)C2=CC=CC=C2C21CC(C)OC(C)C2 OFQCQIGMURIECL-UHFFFAOYSA-N 0.000 description 1
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 1
- GMSWYGVWFRVORO-UHFFFAOYSA-N 2-[[(1-benzylpyrrolidin-3-yl)amino]methyl]phenol Chemical compound OC1=CC=CC=C1CNC1CN(CC=2C=CC=CC=2)CC1 GMSWYGVWFRVORO-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- VADKRMSMGWJZCF-UHFFFAOYSA-N 2-bromophenol Chemical compound OC1=CC=CC=C1Br VADKRMSMGWJZCF-UHFFFAOYSA-N 0.000 description 1
- JMTRCXPSDMMAGM-UHFFFAOYSA-N 2-chloro-3-methylbutane Chemical compound CC(C)C(C)Cl JMTRCXPSDMMAGM-UHFFFAOYSA-N 0.000 description 1
- LYINTWKRUWVLBA-UHFFFAOYSA-N 2-phenyl-1,3-dioxolane Chemical compound O1CCOC1C1=CC=CC=C1 LYINTWKRUWVLBA-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- SXRYRTQBFDKDBD-UHFFFAOYSA-N 2-pyrrolidin-3-yl-1H-benzimidazole dihydrochloride Chemical compound Cl.Cl.N1CC(CC1)C=1NC2=C(N1)C=CC=C2 SXRYRTQBFDKDBD-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- YJESALUAHUVISI-UHFFFAOYSA-N 3,5-dimethylhexan-2-one Chemical compound CC(C)CC(C)C(C)=O YJESALUAHUVISI-UHFFFAOYSA-N 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- YVMMOOGWEOMGPN-UHFFFAOYSA-N 3-[3-(trifluoromethyl)phenoxy]pyrrolidine;hydrochloride Chemical compound Cl.FC(F)(F)C1=CC=CC(OC2CNCC2)=C1 YVMMOOGWEOMGPN-UHFFFAOYSA-N 0.000 description 1
- FEZHIKGQODPJMI-UHFFFAOYSA-N 3-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol Chemical compound C=1C=CC(C(F)(F)F)=CC=1C1(O)CCNC1 FEZHIKGQODPJMI-UHFFFAOYSA-N 0.000 description 1
- BNQPUGPPVNNKBK-UHFFFAOYSA-N 3-phenoxy-1h-pyrrole Chemical compound C=1C=CC=CC=1OC=1C=CNC=1 BNQPUGPPVNNKBK-UHFFFAOYSA-N 0.000 description 1
- NHLZTNBPPGIUMZ-UHFFFAOYSA-N 3-phenoxypyrrolidine;hydrochloride Chemical compound Cl.C1NCCC1OC1=CC=CC=C1 NHLZTNBPPGIUMZ-UHFFFAOYSA-N 0.000 description 1
- 150000004042 3-pyrrolidinones Chemical class 0.000 description 1
- VEIDFRATXWBVNN-UHFFFAOYSA-N 4-(1-benzylpyrrolidin-3-yl)-9-methoxy-3,5-dihydro-2H-1,4-benzoxazepine Chemical compound C(C1=CC=CC=C1)N1CC(CC1)N1CCOC2=C(C1)C=CC=C2OC VEIDFRATXWBVNN-UHFFFAOYSA-N 0.000 description 1
- XWVAPDYBLXUOPI-UHFFFAOYSA-N 4-(1-benzylpyrrolidin-3-yl)-N,N-diethyl-3,5-dihydro-2H-1,4-benzoxazepin-8-amine Chemical compound C(C1=CC=CC=C1)N1CC(CC1)N1CCOC2=C(C1)C=CC(=C2)N(CC)CC XWVAPDYBLXUOPI-UHFFFAOYSA-N 0.000 description 1
- ZZDMBYKFNRDSKR-UHFFFAOYSA-N 4-benzyl-3,5-dihydro-2h-1,4-benzoxazepine Chemical compound C1COC2=CC=CC=C2CN1CC1=CC=CC=C1 ZZDMBYKFNRDSKR-UHFFFAOYSA-N 0.000 description 1
- NGYMZFJVHHKJQR-UHFFFAOYSA-N 4-bromo-n,n-diethylaniline Chemical compound CCN(CC)C1=CC=C(Br)C=C1 NGYMZFJVHHKJQR-UHFFFAOYSA-N 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- HXAOUYGZEOZTJO-UHFFFAOYSA-N 4-chloro-1-(4-fluorophenyl)butan-1-one Chemical compound FC1=CC=C(C(=O)CCCCl)C=C1 HXAOUYGZEOZTJO-UHFFFAOYSA-N 0.000 description 1
- GHEFQKHLHFXSBR-UHFFFAOYSA-N 4-chloro-1-phenylbutan-1-one Chemical compound ClCCCC(=O)C1=CC=CC=C1 GHEFQKHLHFXSBR-UHFFFAOYSA-N 0.000 description 1
- QFNGTIBLZCKGAF-UHFFFAOYSA-N 4-methyl-2-pyrrolidin-3-yl-1,3-dihydroisoindole Chemical compound N1CC(CC1)N1CC2=CC=CC(=C2C1)C QFNGTIBLZCKGAF-UHFFFAOYSA-N 0.000 description 1
- YBALXICRKBMFCZ-UHFFFAOYSA-N 4-methylpyrrolidin-3-one Chemical class CC1CNCC1=O YBALXICRKBMFCZ-UHFFFAOYSA-N 0.000 description 1
- HPKMHHKDGJUENI-UHFFFAOYSA-N 4-pyrrolidin-3-yl-5H-1,4-benzoxazepine Chemical compound N1CC(CC1)N1C=COC2=C(C1)C=CC=C2 HPKMHHKDGJUENI-UHFFFAOYSA-N 0.000 description 1
- YMXWGDBUOZTMRA-UHFFFAOYSA-N 5,6-dimethoxyisoindole-1,3-dione Chemical compound C1=C(OC)C(OC)=CC2=C1C(=O)NC2=O YMXWGDBUOZTMRA-UHFFFAOYSA-N 0.000 description 1
- HOZNTWKAAKPCPG-UHFFFAOYSA-N 5-(trifluoromethyl)isoindole-1,3-dione Chemical compound FC(F)(F)C1=CC=C2C(=O)NC(=O)C2=C1 HOZNTWKAAKPCPG-UHFFFAOYSA-N 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- MMGSSGIIFHIFJD-UHFFFAOYSA-N 9-methoxy-2,3,4,5-tetrahydro-1,4-benzoxazepine Chemical compound C1NCCOC2=C1C=CC=C2OC MMGSSGIIFHIFJD-UHFFFAOYSA-N 0.000 description 1
- SLUFBCIROQAWCZ-UHFFFAOYSA-N 9-methoxy-4-pyrrolidin-3-yl-3,5-dihydro-2H-1,4-benzoxazepine Chemical compound N1CC(CC1)N1CCOC2=C(C1)C=CC=C2OC SLUFBCIROQAWCZ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RJOHOXURLIPYHQ-UHFFFAOYSA-N C(C=CC(=O)O)(=O)O.C(C=CC(=O)O)(=O)O.N1CC(CC1)N1CCOC2=C(C1)C=CC=C2 Chemical compound C(C=CC(=O)O)(=O)O.C(C=CC(=O)O)(=O)O.N1CC(CC1)N1CCOC2=C(C1)C=CC=C2 RJOHOXURLIPYHQ-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- FCLZCOCSZQNREK-UHFFFAOYSA-N Pyrrolidine, hydrochloride Chemical compound Cl.C1CCNC1 FCLZCOCSZQNREK-UHFFFAOYSA-N 0.000 description 1
- 101100371158 Rattus norvegicus Tsku gene Proteins 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 241000287433 Turdus Species 0.000 description 1
- DLNVXRWZWOKOBZ-UHFFFAOYSA-N [1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol Chemical compound C1C(CO)CCN1C1=CC=C(C(F)(F)F)C=C1 DLNVXRWZWOKOBZ-UHFFFAOYSA-N 0.000 description 1
- DZJXKISLUDYJSV-UHFFFAOYSA-N [N].C1CCNC1 Chemical compound [N].C1CCNC1 DZJXKISLUDYJSV-UHFFFAOYSA-N 0.000 description 1
- YGPZMMIGZREXJQ-UHFFFAOYSA-N [Na+].[Na+].CC[O-].CC[O-] Chemical compound [Na+].[Na+].CC[O-].CC[O-] YGPZMMIGZREXJQ-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- AMZONRRFUQKTSZ-UHFFFAOYSA-N benzene;2-propan-2-yloxypropane Chemical compound C1=CC=CC=C1.CC(C)OC(C)C AMZONRRFUQKTSZ-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 150000003950 cyclic amides Chemical class 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002518 isoindoles Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- IGFVSRAMYPHRFF-UHFFFAOYSA-N n,n-diethyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-8-amine Chemical compound C1NCCOC2=CC(N(CC)CC)=CC=C21 IGFVSRAMYPHRFF-UHFFFAOYSA-N 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000004987 o-phenylenediamines Chemical class 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- VIQDUCBDZPYNNX-UHFFFAOYSA-N phenyl(pyrrolidin-1-yl)methanone Chemical class C=1C=CC=CC=1C(=O)N1CCCC1 VIQDUCBDZPYNNX-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- SAALQYKUFCIMHR-UHFFFAOYSA-N propan-2-ol;2-propan-2-yloxypropane Chemical compound CC(C)O.CC(C)OC(C)C SAALQYKUFCIMHR-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- CGQZAKVEKYETTR-UHFFFAOYSA-N pyrrolidin-1-yl n-phenylcarbamate Chemical compound C1CCCN1OC(=O)NC1=CC=CC=C1 CGQZAKVEKYETTR-UHFFFAOYSA-N 0.000 description 1
- QOTUIIJRVXKSJU-UHFFFAOYSA-N pyrrolidin-3-ylmethanol Chemical class OCC1CCNC1 QOTUIIJRVXKSJU-UHFFFAOYSA-N 0.000 description 1
- DATJETPTDKFEEF-UHFFFAOYSA-N pyrrolidine-3-carbonitrile Chemical class N#CC1CCNC1 DATJETPTDKFEEF-UHFFFAOYSA-N 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- JQWYTSHFVIDUHA-UHFFFAOYSA-M sodium;2-hydroxy-3-methoxybenzoate Chemical compound [Na+].COC1=CC=CC(C([O-])=O)=C1O JQWYTSHFVIDUHA-UHFFFAOYSA-M 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 229940125725 tranquilizer Drugs 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D267/02—Seven-membered rings
- C07D267/08—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D267/12—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D267/14—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59226366A | 1966-11-07 | 1966-11-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1695652A1 true DE1695652A1 (de) | 1971-04-29 |
Family
ID=24369972
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671695652 Pending DE1695652A1 (de) | 1966-11-07 | 1967-11-07 | 1,3-Disubstituierte Pyrrolidine und Verfahren zu ihrer Herstellung |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT272331B (en:Method) |
| BE (1) | BE704683A (en:Method) |
| CA (1) | CA955936A (en:Method) |
| CH (1) | CH511834A (en:Method) |
| DE (1) | DE1695652A1 (en:Method) |
| DK (1) | DK133942B (en:Method) |
| ES (1) | ES346816A1 (en:Method) |
| FR (2) | FR1575543A (en:Method) |
| GB (1) | GB1202747A (en:Method) |
| IL (1) | IL28811A (en:Method) |
| NL (1) | NL6714553A (en:Method) |
| SE (1) | SE315594B (en:Method) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS54151990A (en) * | 1978-04-17 | 1979-11-29 | Beiersdorf Ag | Novel condensated nitrogenncontained heterocyclic compound and its manufacture |
| GB9000305D0 (en) * | 1990-01-06 | 1990-03-07 | Pfizer Ltd | Anticholinergic agents |
| AU2008258599B2 (en) | 2007-06-05 | 2013-06-13 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | Disubstituted phenylpyrrolidines as modulators of cortical catecholaminergic neurotransmission |
-
1967
- 1967-10-04 BE BE704683D patent/BE704683A/xx unknown
- 1967-10-24 IL IL2881167A patent/IL28811A/xx unknown
- 1967-10-26 NL NL6714553A patent/NL6714553A/xx unknown
- 1967-11-02 CH CH1536867A patent/CH511834A/de not_active IP Right Cessation
- 1967-11-06 GB GB50259/67A patent/GB1202747A/en not_active Expired
- 1967-11-06 ES ES346816A patent/ES346816A1/es not_active Expired
- 1967-11-06 DK DK551967A patent/DK133942B/da unknown
- 1967-11-06 CA CA004,409A patent/CA955936A/en not_active Expired
- 1967-11-06 SE SE1517767A patent/SE315594B/xx unknown
- 1967-11-07 AT AT1003667A patent/AT272331B/de active
- 1967-11-07 DE DE19671695652 patent/DE1695652A1/de active Pending
- 1967-11-07 FR FR1575543D patent/FR1575543A/fr not_active Expired
-
1968
- 1968-02-06 FR FR138852A patent/FR7535M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1575543A (en:Method) | 1969-07-25 |
| BE704683A (en:Method) | 1968-02-15 |
| FR7535M (en:Method) | 1969-12-22 |
| CH511834A (de) | 1971-08-31 |
| DK133942C (en:Method) | 1977-01-24 |
| DK133942B (da) | 1976-08-16 |
| AT272331B (de) | 1969-07-10 |
| SE315594B (en:Method) | 1969-10-06 |
| ES346816A1 (es) | 1969-04-16 |
| GB1202747A (en) | 1970-08-19 |
| IL28811A (en) | 1971-07-28 |
| NL6714553A (en:Method) | 1968-05-08 |
| CA955936A (en) | 1974-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0136658B1 (de) | 1-Benzyl-aminoalkyl-pyrrolidinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2017255A1 (de) | 1-substituierte-3-Pheny!pyrrolidine und Verfahren zu deren Herstellung | |
| DE3784401T2 (de) | Karbostyril-derivate und ihre salze, verfahren zu ihrer herstellung und diese enthaltende kardiotonische zusammensetzung. | |
| DE4215213A1 (de) | Arylacetamide | |
| DE3705621A1 (de) | Heterocyclisch substituierte chinoloncarbonsaeure derivate | |
| EP0171728B1 (de) | Neue Tryptamin-Derivate, ein Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1964511A1 (de) | 1-substituierte-3-Phenoxypyrrolidine und Verfahren zu ihrer Herstellung | |
| DE2952279A1 (de) | Neue 2-acylaminomethyl-1,4-benzodiazepine und deren salze sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE1620224A1 (de) | Verfahren zur Herstellung von Indolverbindungen | |
| DE69713124T2 (de) | 1H-PYRIDO[3,4-b]INDOLCARBOXAMIDDERIVATE, IHRE HERSTELLUNG UND THERAPEUTISCHE VERWENDUNG | |
| DE3420193A1 (de) | Neue substituierte pyrrolidinone, verfahren zu ihrer herstellung und arzneimittel | |
| DE69128838T2 (de) | Optische isomere von 7-[3-(1-dialkylmethyl-1-amino)-1-pyrolidinyl]-chinolone und napthyridone als antibakterielle wirkstoffe | |
| DD153206A5 (de) | Verfahren zur herstellung neuer substituierter heterozyklischer phenoxyamine | |
| DE2556457C3 (de) | N-(Pyrrolidin-2-yl-methyl)-2-methoxybenzamide, deren Salze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69131057T2 (de) | 3-[1,Thiazolidinylbutyl-4-piperazinyl]-1H-Indazole, Verfahren zu ihrer Herstellung und ihre Verwendung als Medikamente | |
| DE69311123T2 (de) | Cyclische benzylamino-, benzylamido- und benzylimido derivate als antipsychotische wirkstoffe | |
| DE1695652A1 (de) | 1,3-Disubstituierte Pyrrolidine und Verfahren zu ihrer Herstellung | |
| DE2017256A1 (de) | l-Carbamoyl-3-pheny!pyrrolidine und Verfahren zu deren Herstellung | |
| DE2822465A1 (de) | Trans-2-substituierte-5-aryl- 2,3,4,4a,5,9b-hexahydro-1h-pyrido eckige klammer auf 4,3-b eckige klammer zu -indolderivate und diese enthaltende arzneimittel | |
| DE2548053A1 (de) | Azazyklische verbindungen | |
| DE2852088A1 (de) | Substituierte pyrrolidine, verfahren zu ihrer herstellung, ihre verwendung und sie enthaltende arzneimittel | |
| EP0170861A1 (de) | 3-Aminocarbonylmethoxy-5-phenylpyrazol-Verbindungen sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3000625A1 (de) | Cis- und trans-isomere von 3-aryloxy- 4-hydroxypyrrolidinen und deren derivaten, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1643198A1 (de) | Diarylcyclopropanderivate und Verfahren zu ihrer Herstellung | |
| DE2342880A1 (de) | Piperazin-pyrimidine, verfahren zu ihrer herstellung und ihre verwendung |