DE1646457C - - Google Patents
Info
- Publication number
- DE1646457C DE1646457C DE1646457C DE 1646457 C DE1646457 C DE 1646457C DE 1646457 C DE1646457 C DE 1646457C
- Authority
- DE
- Germany
- Prior art keywords
- chromite
- alkaline earth
- rare
- workpiece according
- zirconate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000919 ceramic Substances 0.000 claims description 19
- 239000006104 solid solution Substances 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 13
- FFQALBCXGPYQGT-UHFFFAOYSA-N 2,4-difluoro-5-(trifluoromethyl)aniline Chemical group NC1=CC(C(F)(F)F)=C(F)C=C1F FFQALBCXGPYQGT-UHFFFAOYSA-N 0.000 claims description 12
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000002910 rare earth metals Chemical group 0.000 claims description 6
- 150000004645 aluminates Chemical class 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- CETPSERCERDGAM-UHFFFAOYSA-N ceric oxide Chemical compound O=[Ce]=O CETPSERCERDGAM-UHFFFAOYSA-N 0.000 claims description 2
- 229910000422 cerium(IV) oxide Inorganic materials 0.000 claims description 2
- 229940071182 stannate Drugs 0.000 claims description 2
- 125000005402 stannate group Chemical group 0.000 claims description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims 1
- NFYLSJDPENHSBT-UHFFFAOYSA-N chromium(3+);lanthanum(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+3].[La+3] NFYLSJDPENHSBT-UHFFFAOYSA-N 0.000 description 11
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 229910017563 LaCrO Inorganic materials 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 6
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 229910000423 chromium oxide Inorganic materials 0.000 description 4
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 230000005496 eutectics Effects 0.000 description 2
- 229910052746 lanthanum Inorganic materials 0.000 description 2
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 2
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- -1 rare earth aluminate Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- IATRAKWUXMZMIY-UHFFFAOYSA-N strontium oxide Chemical compound [O-2].[Sr+2] IATRAKWUXMZMIY-UHFFFAOYSA-N 0.000 description 2
- 229910021193 La 2 O 3 Inorganic materials 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- 235000013929 Psidium pyriferum Nutrition 0.000 description 1
- 244000236580 Psidium pyriferum Species 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 238000012864 cross contamination Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- UZLYXNNZYFBAQO-UHFFFAOYSA-N oxygen(2-);ytterbium(3+) Chemical compound [O-2].[O-2].[O-2].[Yb+3].[Yb+3] UZLYXNNZYFBAQO-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 229910003454 ytterbium oxide Inorganic materials 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Family
ID=
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2947162A1 (de) * | 1978-11-22 | 1980-06-12 | Tokai Rika Co Ltd | Verfahren zur herstellung gut leitfaehiger sinterprodukte |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2947162A1 (de) * | 1978-11-22 | 1980-06-12 | Tokai Rika Co Ltd | Verfahren zur herstellung gut leitfaehiger sinterprodukte |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69703943T2 (de) | Keramisches Lanthanoid-Material | |
| DE112012001237B4 (de) | Dielektrische Keramik und laminierter Keramikkondensator | |
| DE60101641T2 (de) | Verfahren zur Herstellung von Oxiden mit Perowskitstruktur | |
| EP2847775B1 (de) | Keramischer vielschichtkondensator | |
| EP1337496B1 (de) | Keramischer werkstoff sowie dessen herstellung | |
| DE69024340T2 (de) | Halbleiterkeramikkondensator von laminiertem und zwischenkornisolationstyp und verfahren zu seiner herstellung | |
| DE102010050554B4 (de) | Dielektrische Keramikzusammensetzung und elektronische Komponente | |
| DE69601822T2 (de) | Nichtreduzierte, dielektrische, keramische Zusammensetzungen | |
| DE69411645T2 (de) | Poröse Sinterkörper und ihre Verwendung in Feststoffoxidbrennstoffzellen als Luftelektroden | |
| WO2013152887A1 (de) | Keramisches material und kondensator umfassend das keramische material | |
| DE3138177A1 (de) | "verfahren zur herstellung eines dielektrikums" | |
| DE3924563C2 (de) | Nicht-reduzierende dielektrische keramische Zusammensetzung | |
| DE4436392C2 (de) | Metallniobate und/oder Tantalate, Verfahren zu ihrer Herstellung sowie deren Weiterverarbeitung zu Perowskiten | |
| DE69209856T2 (de) | Supraleitendes Oxidmaterial und Verfahren zu seiner Herstellung | |
| DE69024280T2 (de) | Halbleiterkeramikkondensator von dem laminierten typ mit zwischenkornisolation und verfahren zu seiner herstellung | |
| DE1646457B1 (de) | Keramisches Werkstueck fuer Elektroden | |
| DE68922514T2 (de) | Oxidischer Hochtemperatur-Supraleiter und Verfahren zu seiner Herstellung. | |
| DE112004001237T5 (de) | Dielektrische keramische Zusammensetzung und laminierter keramischer Kondensator | |
| DE2839976A1 (de) | Halbleiterkeramik fuer grenzschichtkondensatoren | |
| DE69009628T2 (de) | Pulverzusammensetzung zum Sintern in eine modifizierte Bariumtitanat halbleitende Keramik. | |
| DE69707247T2 (de) | Keramischer vielschichtkondensator | |
| DE69023316T2 (de) | Keramischer kondensator eines halbleitertyps mit laminierten und kornisolierten grenzschichten. | |
| DE2554203C3 (de) | Katalysator zum Reformieren von Kohlenwasserstoff-Brennstoffs | |
| DE1646457C (enExample) | ||
| DE69031586T2 (de) | Supraleitende 247-Metalloxidzusammensetzungen |