DE1513285C3 - - Google Patents
Info
- Publication number
- DE1513285C3 DE1513285C3 DE19651513285 DE1513285A DE1513285C3 DE 1513285 C3 DE1513285 C3 DE 1513285C3 DE 19651513285 DE19651513285 DE 19651513285 DE 1513285 A DE1513285 A DE 1513285A DE 1513285 C3 DE1513285 C3 DE 1513285C3
- Authority
- DE
- Germany
- Prior art keywords
- spark gap
- arc
- web
- halves
- slots
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000007664 blowing Methods 0.000 claims description 7
- 230000000694 effects Effects 0.000 claims description 7
- 230000005291 magnetic effect Effects 0.000 claims description 7
- 238000010791 quenching Methods 0.000 claims description 6
- 230000000171 quenching effect Effects 0.000 claims description 6
- 239000011224 oxide ceramic Substances 0.000 claims description 4
- 229910052574 oxide ceramic Inorganic materials 0.000 claims description 4
- 230000005294 ferromagnetic effect Effects 0.000 claims description 3
- 239000000919 ceramic Substances 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 1
- 230000006698 induction Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 2
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- RZWWGOCLMSGROE-UHFFFAOYSA-N n-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide Chemical compound N1=C2N=C(C)C=C(C)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC=C1Cl RZWWGOCLMSGROE-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEL0050956 | 1965-06-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1513285C3 true DE1513285C3 (enExample) | 1978-01-26 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3686911T2 (de) | Vakuumschalter. | |
| DE1963216A1 (de) | Luftschalter mit nachfolgend angeordneter Lichtbogenloeschkammer | |
| DE102012209089A1 (de) | Röntgenröhre mit einer Drehanode | |
| DE1513285C3 (enExample) | ||
| DE1513285C (de) | Vielfachfunkenstrecke fur Überspannungsableiter | |
| DE832634C (de) | Kollektor fuer elektrostatische Maschinen | |
| DE1513285B2 (de) | Vielfachfunkenstrecke fuer ueberspannungsableiter | |
| CH474169A (de) | Vielfachfunkenstrecke für Überspannungsableiter | |
| DE2040053C3 (de) | Funkenstreckenanordnung | |
| DE1025967B (de) | Lichtbogenloeschkammer mit im Wege des Lichtbogens angeordneten Platten aus Isolierstoff | |
| DE805898C (de) | Kontinuierliche Elektrode | |
| DE2647643C2 (de) | Druckgasschalter | |
| DE2005988C3 (de) | Überspannungsableiter | |
| US2769885A (en) | Resistor units | |
| DE870439C (de) | Loeschfunkenstrecke fuer UEberspannungsableiter | |
| DE754393C (de) | Schmelzsicherung | |
| DE620526C (de) | Induktionsspule mit veraenderlichem Rauminhalt, insbesondere fuer kernlose Induktionsoefen | |
| DE19808667C2 (de) | Gebogene Elektrode | |
| DE3013395C2 (de) | Verfahren zum Abgleich eines flächenhaften Schichtwiderstandes | |
| DE2643433B1 (de) | Schutzschalter, insbesondere leitungsschutzschalter | |
| DE1299346B (de) | Lichtbogenloeschkammer | |
| DE2140876A1 (de) | Funkenstreckenanordnung | |
| DE1463246B2 (de) | Vielfachfunkenstrecke fur Über spannungsableiter | |
| DE1069257B (enExample) | ||
| DE1255187C2 (de) | Funkenstreckenstapel |