DE150366C - - Google Patents
Info
- Publication number
- DE150366C DE150366C DENDAT150366D DE150366DA DE150366C DE 150366 C DE150366 C DE 150366C DE NDAT150366 D DENDAT150366 D DE NDAT150366D DE 150366D A DE150366D A DE 150366DA DE 150366 C DE150366 C DE 150366C
- Authority
- DE
- Germany
- Prior art keywords
- acid
- ammonia
- water
- nitro
- salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- -1 o-chloro-m-nitro-benzylsulphonic acid Chemical compound 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000003368 amide group Chemical group 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 150000005840 aryl radicals Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- XQRIZFHZCHYKPT-UHFFFAOYSA-N chloro-nitro-phenylmethanesulfonic acid Chemical compound OS(=O)(=O)C(Cl)([N+]([O-])=O)C1=CC=CC=C1 XQRIZFHZCHYKPT-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- KDZUARBZBREZCI-UHFFFAOYSA-N (2-chlorophenyl)methanesulfonic acid Chemical compound OS(=O)(=O)CC1=CC=CC=C1Cl KDZUARBZBREZCI-UHFFFAOYSA-N 0.000 description 2
- BASMANVIUSSIIM-UHFFFAOYSA-N 1-chloro-2-(chloromethyl)benzene Chemical compound ClCC1=CC=CC=C1Cl BASMANVIUSSIIM-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- ADULCOBSFMTTIE-UHFFFAOYSA-N 2-chloro-2-nitro-2-phenylacetic acid Chemical compound ClC(C(=O)O)(C1=CC=CC=C1)[N+](=O)[O-] ADULCOBSFMTTIE-UHFFFAOYSA-N 0.000 description 1
- KIXANWDXDRBCLI-UHFFFAOYSA-N 2-chloro-4-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1Cl KIXANWDXDRBCLI-UHFFFAOYSA-N 0.000 description 1
- QWIWYBUPJLCBSE-UHFFFAOYSA-N 3-chloro-2-nitrobenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC(Cl)=C1[N+]([O-])=O QWIWYBUPJLCBSE-UHFFFAOYSA-N 0.000 description 1
- VCHSXYHBMFKRBK-UHFFFAOYSA-N 4771-47-5 Chemical compound OC(=O)C1=CC=CC(Cl)=C1[N+]([O-])=O VCHSXYHBMFKRBK-UHFFFAOYSA-N 0.000 description 1
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/28—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/45—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/46—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton having the sulfo groups bound to carbon atoms of non-condensed six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cosmetics (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE150366C true DE150366C (OSRAM) |
Family
ID=417288
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT150366D Active DE150366C (OSRAM) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE150366C (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1586560A1 (en) * | 2004-04-13 | 2005-10-19 | Cephalon, Inc. | Thio-substituted arylmethanesulfinyl derivatives |
| US7297817B2 (en) | 2004-04-13 | 2007-11-20 | Cephalon France | Thio-substituted arylmethanesulfinyl derivatives |
-
0
- DE DENDAT150366D patent/DE150366C/de active Active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1586560A1 (en) * | 2004-04-13 | 2005-10-19 | Cephalon, Inc. | Thio-substituted arylmethanesulfinyl derivatives |
| US7297817B2 (en) | 2004-04-13 | 2007-11-20 | Cephalon France | Thio-substituted arylmethanesulfinyl derivatives |
| US8071604B2 (en) | 2004-04-13 | 2011-12-06 | Cephalon France | Thio-substituted arylmethanesulfinyl derivatives |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE150366C (OSRAM) | ||
| US1790097A (en) | New process for introducing sulphocyanic groups in organic compounds | |
| US1646785A (en) | Aryl esters of nitro amino benzene sulphonic acids | |
| US1911719A (en) | Aromatic aisino sitlphochlosides | |
| US2185661A (en) | Substituted 3-aminopyrenes and process of preparing them | |
| DE1695117C3 (de) | Verfahren zur Herstellung von Chloramino-s-triazinen | |
| EP0374653B1 (de) | Verfahren zur Herstellung von N,N'-Bis(3-aminophenyl)harnstoffen | |
| DE910779C (de) | Verfahren zur Darstellung von N-Sulfonylharnstoffen | |
| DE1095806B (de) | Verfahren zur Herstellung von Derivaten der N-Fluorsulfonylcarbamidsaeure | |
| DE553278C (de) | Verfahren zur Gewinnung von Harnstoff- und Thioharnstoffabkoemmlingen der aromatischen, heterocyklischen und aromatisch-heterocyklischen Reihe | |
| US2447653A (en) | Nitro amines and process for preparing same | |
| DE604639C (de) | Verfahren zur Darstellung von unsymmetrischen Thioharnstoffen | |
| DE824056C (de) | Verfahren zur Herstellung von mandelsaurem Hexamethylentetramin | |
| US3911031A (en) | Production of 3-nitro-p-cresol-(1) | |
| US1957089A (en) | Process of preparing nitro- | |
| DE134979C (de) | Verfahren zur darstellung von benzylphtalimiden | |
| DE850297C (de) | Verfahren zur Herstellung von Amidinsalzen | |
| US2152787A (en) | Preparation of acetoacetyl aromatic acid amides | |
| DE695331C (de) | Verfahren zur Herstellung organischer Sulfonsaeureamide | |
| US569419A (en) | Heinrich laubmann | |
| Templeton | Attempted Preparation of P-aminobenzyl Bromide | |
| US3708526A (en) | Alkyl amidosulfinic acid(bis-alkylamine)salts and method for their preparation | |
| US2570087A (en) | Process of preparing same | |
| DE884047C (de) | Verfahren zur Herstellung von p-Aminobenzolsulfimiden | |
| Meldola et al. | LI.—Researches on the constitution of azo-and diazo-derivatives. IV. Diazoamido-compounds (continued) |