DE1283231B - Verfahren zur Herstellung von 7-Chlor-4-thiaoenanthsaeure - Google Patents
Verfahren zur Herstellung von 7-Chlor-4-thiaoenanthsaeureInfo
- Publication number
- DE1283231B DE1283231B DEST26857A DEST026857A DE1283231B DE 1283231 B DE1283231 B DE 1283231B DE ST26857 A DEST26857 A DE ST26857A DE ST026857 A DEST026857 A DE ST026857A DE 1283231 B DE1283231 B DE 1283231B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- chloro
- thiaenanthic
- reaction
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000002253 acid Substances 0.000 title description 5
- UCCXYDPCEOPAQF-UHFFFAOYSA-N 3-(3-chloropropylsulfanyl)propanoic acid Chemical compound OC(=O)CCSCCCCl UCCXYDPCEOPAQF-UHFFFAOYSA-N 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 13
- 239000011541 reaction mixture Substances 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 10
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 claims description 9
- -1 azo compound Chemical class 0.000 claims description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims description 7
- 150000002825 nitriles Chemical class 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 230000001590 oxidative effect Effects 0.000 claims description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 2
- 238000010626 work up procedure Methods 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000126 substance Substances 0.000 description 7
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 238000007259 addition reaction Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- KRMMZNOTUOIFQX-UHFFFAOYSA-N 1,1,2,2-tetraphenylhydrazine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)N(C=1C=CC=CC=1)C1=CC=CC=C1 KRMMZNOTUOIFQX-UHFFFAOYSA-N 0.000 description 1
- CYVCWLWYKRJZII-UHFFFAOYSA-N 3-(3-aminopropylsulfanyl)propanoic acid Chemical compound NCCCSCCC(O)=O CYVCWLWYKRJZII-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- YFMFSCRSAWIWOP-UHFFFAOYSA-N phenyl(trityl)diazene Chemical compound C1=CC=CC=C1N=NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 YFMFSCRSAWIWOP-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
- C07C319/18—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides by addition of thiols to unsaturated compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6606402A NL6606402A (https=) | 1966-05-11 | 1966-05-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1283231B true DE1283231B (de) | 1968-11-21 |
Family
ID=19796564
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEST26857A Pending DE1283231B (de) | 1966-05-11 | 1967-05-10 | Verfahren zur Herstellung von 7-Chlor-4-thiaoenanthsaeure |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3536746A (https=) |
| AT (1) | AT271417B (https=) |
| BE (1) | BE698286A (https=) |
| CH (1) | CH488676A (https=) |
| DE (1) | DE1283231B (https=) |
| ES (1) | ES340349A1 (https=) |
| GB (1) | GB1150254A (https=) |
| IL (1) | IL27949A (https=) |
| NL (1) | NL6606402A (https=) |
| SE (1) | SE325023B (https=) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6523549B1 (en) | 2001-11-06 | 2003-02-25 | Bridget R. Frame | Hair ornament retaining implements and method |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3315000A (en) * | 1963-11-06 | 1967-04-18 | Chevron Res | Sulfur compounds from allene |
| US3361808A (en) * | 1963-11-15 | 1968-01-02 | Chevron Res | Preparation of alpha, omega-substituted-bis-n-alkylthiopropane-1, 3 compounds |
| US3376348A (en) * | 1964-02-12 | 1968-04-02 | Hooker Chemical Corp | Preparation of alkyl sulfides |
| US3369979A (en) * | 1964-05-18 | 1968-02-20 | Exxon Research Engineering Co | Process for the production of thiolcarboxylic acid-allene adducts |
-
1966
- 1966-05-11 NL NL6606402A patent/NL6606402A/xx unknown
-
1967
- 1967-05-09 GB GB21438/67A patent/GB1150254A/en not_active Expired
- 1967-05-09 AT AT433667A patent/AT271417B/de active
- 1967-05-09 US US637081A patent/US3536746A/en not_active Expired - Lifetime
- 1967-05-10 ES ES340349A patent/ES340349A1/es not_active Expired
- 1967-05-10 CH CH659467A patent/CH488676A/de not_active IP Right Cessation
- 1967-05-10 BE BE698286D patent/BE698286A/xx unknown
- 1967-05-10 DE DEST26857A patent/DE1283231B/de active Pending
- 1967-05-10 SE SE6574/67A patent/SE325023B/xx unknown
- 1967-05-10 IL IL27949A patent/IL27949A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE325023B (https=) | 1970-06-22 |
| ES340349A1 (es) | 1968-06-01 |
| BE698286A (https=) | 1967-11-10 |
| NL6606402A (https=) | 1967-11-13 |
| GB1150254A (en) | 1969-04-30 |
| US3536746A (en) | 1970-10-27 |
| IL27949A (en) | 1970-10-30 |
| CH488676A (de) | 1970-04-15 |
| AT271417B (de) | 1969-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2207184A1 (de) | Verfahren zur reinigung von acrylsaeure | |
| DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE1283231B (de) | Verfahren zur Herstellung von 7-Chlor-4-thiaoenanthsaeure | |
| DE1178854B (de) | Verfahren zur Herstellung von Carbonsaeure-estern, AEthern oder Acetalen des 2, 5-Dimethyl-hexan-2, 5-dihydroperoxyds | |
| DE2540972A1 (de) | Verfahren zur herstellung von 5-oxohexansaeure und deren derivaten | |
| DE2558517A1 (de) | 4-methylimidazol-5-carbonsaeureisopropylester und ein neues verfahren zu seiner herstellung | |
| DE1174786B (de) | Verfahren zur Herstellung von Azacycloalken-(2, 3)-2-chlor-1-carbonsaeurechloriden | |
| DE837998C (de) | Verfahren zur Herstellung von aliphatischen Diketonen | |
| EP0009200B1 (de) | Verfahren zur Herstellung von N,N-Dimethylaminoacetonitril | |
| DE1238462B (de) | Verfahren zur Herstellung von beta-Mercaptopropionitril | |
| DE960813C (de) | Verfahren zur Herstellung von ungesaettigten ª†- und ª€-Laktonen | |
| DE2409195B2 (de) | Verfahren zur herstellung von imidazol-4,5-dicarboxamid | |
| DE2051320C3 (de) | Verfahren zur Reinigung von aliphatischen Dicarbonsäuregemischen | |
| DE1227450B (de) | Verfahren zur Herstellung von sekundaeren N-Alkyl-allylaminen | |
| DE1237561B (de) | Verfahren zur Herstellung von 7-Chlor-4-thiaoenanthsaeure | |
| DE1191379B (de) | Verfahren zur Herstellung von N-substituierten 3, 6-Dihydro-1, 2-oxazinen | |
| DE870121C (de) | Verfahren zur Herstellung von Aminen | |
| DE1468344B2 (de) | Methylthio-chlor-zimtsaeuren und verfahren zu ihrer herstellung | |
| DE971392C (de) | Verfahren zur Herstellung von aliphatischen ªÏ-Aminocarbonsaeureestern | |
| DE1237562B (de) | Verfahren zur Herstellung von 7-Chlor-4-thiaoenanthsaeure | |
| DE1445655C3 (de) | Verfahren zur Herstellung von in 3-Stellung gamma-Aminopropylgruppen enthaltenden 3,4,5,6-Tetrahydropyridinderivaten | |
| DE1202282B (de) | Verfahren zur Herstellung von aliphatischen Diaminen | |
| DE1245355B (de) | Verfahren zur Herstellung von Alkalisalzen von Perhalogenaceton-cyanhydrinen | |
| DE825412B (de) | Verfahren zur Herstellung von 2, 3, 4, 5-Tetrahydropyrimidinabkömmlingen | |
| DE2233489A1 (de) | Verfahren zur herstellung von octachlordipropylaether |