DE1260038B - Verfahren und Vorrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen - Google Patents
Verfahren und Vorrichtung zum Abfuehren von Spaltgasen aus KernreaktorbrennelementenInfo
- Publication number
- DE1260038B DE1260038B DEG40743A DEG0040743A DE1260038B DE 1260038 B DE1260038 B DE 1260038B DE G40743 A DEG40743 A DE G40743A DE G0040743 A DEG0040743 A DE G0040743A DE 1260038 B DE1260038 B DE 1260038B
- Authority
- DE
- Germany
- Prior art keywords
- gas
- gases
- chamber
- fuel
- fission
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000007789 gas Substances 0.000 title claims description 43
- 230000004992 fission Effects 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 13
- 239000003758 nuclear fuel Substances 0.000 title claims description 6
- 239000000446 fuel Substances 0.000 claims description 29
- 230000000712 assembly Effects 0.000 claims description 8
- 238000000429 assembly Methods 0.000 claims description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- 238000001816 cooling Methods 0.000 claims description 6
- 239000002826 coolant Substances 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 4
- 230000001681 protective effect Effects 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052792 caesium Inorganic materials 0.000 claims description 3
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 239000011521 glass Substances 0.000 claims description 3
- 229910002804 graphite Inorganic materials 0.000 claims description 3
- 239000010439 graphite Substances 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 239000000395 magnesium oxide Substances 0.000 claims description 3
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052701 rubidium Inorganic materials 0.000 claims description 3
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 2
- 230000007017 scission Effects 0.000 claims description 2
- 239000000843 powder Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 4
- 239000000919 ceramic Substances 0.000 description 3
- 230000002285 radioactive effect Effects 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- 229910052724 xenon Inorganic materials 0.000 description 3
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 238000007599 discharging Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052756 noble gas Inorganic materials 0.000 description 2
- 150000002835 noble gases Chemical class 0.000 description 2
- OOAWCECZEHPMBX-UHFFFAOYSA-N oxygen(2-);uranium(4+) Chemical compound [O-2].[O-2].[U+4] OOAWCECZEHPMBX-UHFFFAOYSA-N 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- FCTBKIHDJGHPPO-UHFFFAOYSA-N uranium dioxide Inorganic materials O=[U]=O FCTBKIHDJGHPPO-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 1
- SHZGCJCMOBCMKK-KGJVWPDLSA-N beta-L-fucose Chemical compound C[C@@H]1O[C@H](O)[C@@H](O)[C@H](O)[C@@H]1O SHZGCJCMOBCMKK-KGJVWPDLSA-N 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 229910052743 krypton Inorganic materials 0.000 description 1
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 1
- DNNSSWSSYDEUBZ-OUBTZVSYSA-N krypton-85 Chemical compound [85Kr] DNNSSWSSYDEUBZ-OUBTZVSYSA-N 0.000 description 1
- 229910001338 liquidmetal Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000000941 radioactive substance Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G21—NUCLEAR PHYSICS; NUCLEAR ENGINEERING
- G21C—NUCLEAR REACTORS
- G21C3/00—Reactor fuel elements and their assemblies; Selection of substances for use as reactor fuel elements
- G21C3/02—Fuel elements
- G21C3/04—Constructional details
- G21C3/041—Means for removal of gases from fuel elements
-
- G—PHYSICS
- G21—NUCLEAR PHYSICS; NUCLEAR ENGINEERING
- G21C—NUCLEAR REACTORS
- G21C3/00—Reactor fuel elements and their assemblies; Selection of substances for use as reactor fuel elements
- G21C3/02—Fuel elements
- G21C3/04—Constructional details
- G21C3/16—Details of the construction within the casing
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02E—REDUCTION OF GREENHOUSE GAS [GHG] EMISSIONS, RELATED TO ENERGY GENERATION, TRANSMISSION OR DISTRIBUTION
- Y02E30/00—Energy generation of nuclear origin
- Y02E30/30—Nuclear fission reactors
Landscapes
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Plasma & Fusion (AREA)
- General Engineering & Computer Science (AREA)
- High Energy & Nuclear Physics (AREA)
- Structure Of Emergency Protection For Nuclear Reactors (AREA)
- Monitoring And Testing Of Nuclear Reactors (AREA)
- Treating Waste Gases (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEG40743A DE1260038B (de) | 1964-06-03 | 1964-06-03 | Verfahren und Vorrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen |
| DE1964G0042445 DE1464989B1 (de) | 1964-06-03 | 1964-12-31 | Einrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen |
| DE1965G0043187 DE1489907A1 (enExample) | 1964-06-03 | 1965-03-26 | |
| BE664928A BE664928A (enExample) | 1964-06-03 | 1965-06-03 | |
| GB23758/65A GB1103217A (en) | 1964-06-03 | 1965-06-03 | Process and apparatus for discharge of fission gases from nuclear reactor fuel elements |
| FR19475A FR1446362A (fr) | 1964-06-03 | 1965-06-03 | Procédé et dispositif pour l'évacuation de produits gazeux de fission hors des éléments combustibles de réacteurs nucléaires |
| US461146A US3406094A (en) | 1964-06-03 | 1965-06-03 | Process and device for the discharge of fission gases from nuclear fuel elements |
| NL6507101A NL6507101A (enExample) | 1964-06-03 | 1965-06-03 |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEG40743A DE1260038B (de) | 1964-06-03 | 1964-06-03 | Verfahren und Vorrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen |
| DE1964G0042445 DE1464989B1 (de) | 1964-06-03 | 1964-12-31 | Einrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen |
| DE1965G0043187 DE1489907A1 (enExample) | 1964-06-03 | 1965-03-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1260038B true DE1260038B (de) | 1968-02-01 |
Family
ID=27210636
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG40743A Pending DE1260038B (de) | 1964-06-03 | 1964-06-03 | Verfahren und Vorrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen |
| DE1964G0042445 Pending DE1464989B1 (de) | 1964-06-03 | 1964-12-31 | Einrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen |
| DE1965G0043187 Pending DE1489907A1 (enExample) | 1964-06-03 | 1965-03-26 |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1964G0042445 Pending DE1464989B1 (de) | 1964-06-03 | 1964-12-31 | Einrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen |
| DE1965G0043187 Pending DE1489907A1 (enExample) | 1964-06-03 | 1965-03-26 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3406094A (enExample) |
| BE (1) | BE664928A (enExample) |
| DE (3) | DE1260038B (enExample) |
| FR (1) | FR1446362A (enExample) |
| GB (1) | GB1103217A (enExample) |
| NL (1) | NL6507101A (enExample) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3460236A (en) * | 1967-04-20 | 1969-08-12 | Atomic Power Dev Ass Inc | Method of making nuclear reactor fuel elements |
| FR1584831A (enExample) * | 1967-09-29 | 1970-01-02 | ||
| US3459636A (en) * | 1968-07-24 | 1969-08-05 | Atomic Energy Commission | Vented fuel pin |
| US3627635A (en) * | 1968-09-23 | 1971-12-14 | Gen Electric | Nuclear fuel retainer |
| US3619366A (en) * | 1969-05-06 | 1971-11-09 | Walston Chubb | Fuel subassembly for a nuclear reactor |
| US3953288A (en) * | 1970-03-24 | 1976-04-27 | The United States Of America As Represented By The United States Energy Research And Development Administration | Gas venting |
| US3759243A (en) * | 1970-03-25 | 1973-09-18 | United Nuclear Corp | Nuclear fuel element |
| US3772147A (en) * | 1970-10-27 | 1973-11-13 | Westinghouse Electric Corp | Pressurized fuel elements for a nuclear reactor |
| DE2137641A1 (de) * | 1971-07-28 | 1973-02-08 | Siemens Ag | Einrichtung zum erkennen von kuehlmitteleintritt in ein huellrohr eines kernreaktor-brennstabes |
| US3919757A (en) * | 1972-10-11 | 1975-11-18 | Mc Donnell Douglas Corp | Method of fabricating a vent structure containing separating particles |
| US3876403A (en) * | 1972-10-11 | 1975-04-08 | Mc Donnell Douglas Corp | Vent assembly |
| US3993453A (en) * | 1973-05-09 | 1976-11-23 | General Electric Company | Getter for nuclear fuel elements |
| US3803816A (en) * | 1973-07-05 | 1974-04-16 | Mc Donnell Douglas Corp | Patterned flow vent structure |
| US3838557A (en) * | 1973-09-04 | 1974-10-01 | Mc Donnell Douglas Corp | Vent structure |
| US3918142A (en) * | 1973-09-04 | 1975-11-11 | Mc Donnell Douglas Corp | Method of fabricating a vent structure |
| DE2543462C3 (de) * | 1975-09-29 | 1979-02-22 | Kraftwerk Union Ag, 4330 Muelheim | Verfahren zur Herstellung einer Adsorbermaterial enthaltenden Stützhülse für Kernreaktor-Brennstäbe |
| US4309250A (en) * | 1979-07-05 | 1982-01-05 | The United States Of America As Represented By The United States Department Of Energy | Between-cycle laser system for depressurization and resealing of modified design nuclear fuel assemblies |
| EP0060649B1 (en) * | 1981-03-13 | 1985-10-16 | United Kingdom Atomic Energy Authority | a nuclear fuel cartridge and a method of preparing the cartridge for the extraction of nuclear material therefrom |
| US4642217A (en) * | 1984-07-26 | 1987-02-10 | Westinghouse Electric Corp. | Fuel rod for a nuclear reactor having an improved end plug assembly |
| US20110150167A1 (en) * | 2009-08-28 | 2011-06-23 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Nuclear fission reactor, a vented nuclear fission fuel module, methods therefor and a vented nuclear fission fuel module system |
| US9269462B2 (en) * | 2009-08-28 | 2016-02-23 | Terrapower, Llc | Nuclear fission reactor, a vented nuclear fission fuel module, methods therefor and a vented nuclear fission fuel module system |
| US8929505B2 (en) * | 2009-08-28 | 2015-01-06 | Terrapower, Llc | Nuclear fission reactor, vented nuclear fission fuel module, methods therefor and a vented nuclear fission fuel module system |
| US8712005B2 (en) * | 2009-08-28 | 2014-04-29 | Invention Science Fund I, Llc | Nuclear fission reactor, a vented nuclear fission fuel module, methods therefor and a vented nuclear fission fuel module system |
| US8488734B2 (en) * | 2009-08-28 | 2013-07-16 | The Invention Science Fund I, Llc | Nuclear fission reactor, a vented nuclear fission fuel module, methods therefor and a vented nuclear fission fuel module system |
| WO2015140495A1 (en) * | 2014-03-20 | 2015-09-24 | Ian Richard Scott | Chemical optimisation in a molten salt reactor |
| CN107195350B (zh) * | 2017-06-08 | 2023-03-28 | 兰州大学 | 一种用于放射性裂变气体捕获的装置 |
| JP7579845B2 (ja) * | 2019-10-15 | 2024-11-08 | ニュースケール パワー エルエルシー | 原子炉と燃料棒 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2905611A (en) * | 1953-04-24 | 1959-09-22 | Tonks Lewi | Fuel element for a neutronic reactor |
| US3010889A (en) * | 1958-08-08 | 1961-11-28 | Fortescue Peter | Fuel element |
| US3111476A (en) * | 1958-05-14 | 1963-11-19 | Atomic Energy Authority Uk | Core elements for nuclear reactors |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2894893A (en) * | 1953-05-25 | 1959-07-14 | Jr Kriegh G Carney | Fuel element for nuclear reactor |
| US3041134A (en) * | 1955-12-12 | 1962-06-26 | North American Aviation Inc | Method of removing gaseous fission products from gases |
| US3022238A (en) * | 1957-05-23 | 1962-02-20 | Kolflat Alf | Safety device for and method of protecting nuclear power plants |
| GB915773A (en) * | 1958-11-26 | 1963-01-16 | Rnb Corp | A graphite moderated heterogeneous nuclear reactor |
| DE1166388B (de) * | 1958-12-02 | 1964-03-26 | Linde S Eismaschinen Ag Zweign | Verfahren zum Entfernen von radioaktiven Verunreinigungen aus Kuehl- bzw. Schutzgasen von Atomkernreaktoren |
| DE1250021B (enExample) * | 1959-01-20 | |||
| GB949117A (en) * | 1961-12-20 | 1964-02-12 | Atomic Energy Authority Uk | Improvements in or relating to nuclear reactors |
| US3238105A (en) * | 1964-06-03 | 1966-03-01 | Malcolm J Mcnelly | Fuel element assembly for a nuclear reactor |
-
1964
- 1964-06-03 DE DEG40743A patent/DE1260038B/de active Pending
- 1964-12-31 DE DE1964G0042445 patent/DE1464989B1/de active Pending
-
1965
- 1965-03-26 DE DE1965G0043187 patent/DE1489907A1/de active Pending
- 1965-06-03 BE BE664928A patent/BE664928A/xx unknown
- 1965-06-03 US US461146A patent/US3406094A/en not_active Expired - Lifetime
- 1965-06-03 FR FR19475A patent/FR1446362A/fr not_active Expired
- 1965-06-03 GB GB23758/65A patent/GB1103217A/en not_active Expired
- 1965-06-03 NL NL6507101A patent/NL6507101A/xx unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2905611A (en) * | 1953-04-24 | 1959-09-22 | Tonks Lewi | Fuel element for a neutronic reactor |
| US3111476A (en) * | 1958-05-14 | 1963-11-19 | Atomic Energy Authority Uk | Core elements for nuclear reactors |
| US3010889A (en) * | 1958-08-08 | 1961-11-28 | Fortescue Peter | Fuel element |
Also Published As
| Publication number | Publication date |
|---|---|
| US3406094A (en) | 1968-10-15 |
| DE1489907B2 (enExample) | 1970-07-09 |
| GB1103217A (en) | 1968-02-14 |
| NL6507101A (enExample) | 1965-12-06 |
| DE1464989B1 (de) | 1970-10-22 |
| BE664928A (enExample) | 1965-10-01 |
| FR1446362A (fr) | 1966-07-22 |
| DE1489907A1 (enExample) | 1970-07-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1260038B (de) | Verfahren und Vorrichtung zum Abfuehren von Spaltgasen aus Kernreaktorbrennelementen | |
| DE1106435B (de) | Vorrichtung und Verfahren zur Auffindung schadhafter Brennelemente in heterogenen Kernreaktoren | |
| DE1213542B (de) | Kernreaktor-Brennstoffelement | |
| DE1514977C3 (de) | Entlüftetes Brennstoffelement für Kernreaktoren | |
| DE1614950A1 (de) | Verfahren und Vorrichtung zum Abzug von Spaltprodukten aus Brennelementen | |
| DE2325828A1 (de) | Verfahren zur beeinflussung der reaktivitaet eines gasgekuehlten kernreaktors | |
| DE2220486A1 (de) | Kernreaktor | |
| DE1589662B2 (de) | Kernbrennstoffelement | |
| DE1439785B2 (de) | Atomkernreaktor mit einem Neutronenreflektor aus moderierendem Material | |
| DE1514962C3 (de) | Mit schnellen Neutronen arbeiten der Brutreaktor | |
| DE1514975B2 (de) | Verfahren zur Reinigung des Kiihlgasstromes von Reaktoren und Vorrichtung zur Durchführung des Verfahrens | |
| DE1464932B1 (de) | Selbstreinigendes Brennstoffelement für einen Kernreaktor | |
| DE2915179C2 (enExample) | ||
| DE1589010A1 (de) | Brennstoffelement fuer Kernreaktoren | |
| DE2304324A1 (de) | Vorrichtung zur ueberpruefung von brennelementen fluessigkeitsgekuehlter kernreaktoren auf huellrohrschaeden | |
| DE2023250C3 (de) | Sicherheitseinrichtung in einem Kernreaktorbrennstab mit geschlossenem Spaltgassammelraum | |
| DE6925243U (de) | Kernbrennelement | |
| DE2147789A1 (de) | Entgaster borkarbid-absorberstab | |
| DE2348947A1 (de) | Brennelement fuer gasgekuehlte kernreaktoren | |
| DE1942433A1 (de) | Brennelement fuer Kernreaktoren | |
| DE1564138C3 (de) | Verfahren zum Abführen von Spaltgas aus in ftüssigkeitsgekuhlten Kernreaktoren verwendeten Brennelementen von Kernreaktoren und Brennelement zur Ausübung des Verfahrens | |
| DE1464932C (de) | Selbstreinigendes Brennstoffelement fur einen Kernreaktor | |
| DE2023250B2 (de) | Sicherheitseinrichtung in einem kernreaktorbrennstab mit geschlossenem spaltgassammelraum | |
| DE6928753U (de) | Kernbrennstoffelement mit spaltgasabfuehrung | |
| DE2303992A1 (de) | Brennstoffstab fuer einen mit fluessigem metall gekuehlten schnellen brutreaktor |