DE1138240B - Messwertumformer - Google Patents
MesswertumformerInfo
- Publication number
- DE1138240B DE1138240B DES65064A DES0065064A DE1138240B DE 1138240 B DE1138240 B DE 1138240B DE S65064 A DES65064 A DE S65064A DE S0065064 A DES0065064 A DE S0065064A DE 1138240 B DE1138240 B DE 1138240B
- Authority
- DE
- Germany
- Prior art keywords
- transducer according
- permanent magnets
- measuring transducer
- speed
- magnetic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004065 semiconductor Substances 0.000 claims description 13
- 238000005259 measurement Methods 0.000 claims description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910000859 α-Fe Inorganic materials 0.000 claims description 2
- 230000001965 increasing effect Effects 0.000 description 6
- 230000004907 flux Effects 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- BGPVFRJUHWVFKM-UHFFFAOYSA-N N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] Chemical compound N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] BGPVFRJUHWVFKM-UHFFFAOYSA-N 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- WPYVAWXEWQSOGY-UHFFFAOYSA-N indium antimonide Chemical compound [Sb]#[In] WPYVAWXEWQSOGY-UHFFFAOYSA-N 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000001208 nuclear magnetic resonance pulse sequence Methods 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K17/00—Electronic switching or gating, i.e. not by contact-making and –breaking
- H03K17/51—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used
- H03K17/90—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used by the use, as active elements, of galvano-magnetic devices, e.g. Hall-effect devices
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01D—MEASURING NOT SPECIALLY ADAPTED FOR A SPECIFIC VARIABLE; ARRANGEMENTS FOR MEASURING TWO OR MORE VARIABLES NOT COVERED IN A SINGLE OTHER SUBCLASS; TARIFF METERING APPARATUS; MEASURING OR TESTING NOT OTHERWISE PROVIDED FOR
- G01D5/00—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable
- G01D5/12—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable using electric or magnetic means
- G01D5/14—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable using electric or magnetic means influencing the magnitude of a current or voltage
- G01D5/142—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable using electric or magnetic means influencing the magnitude of a current or voltage using Hall-effect devices
- G01D5/145—Mechanical means for transferring the output of a sensing member; Means for converting the output of a sensing member to another variable where the form or nature of the sensing member does not constrain the means for converting; Transducers not specially adapted for a specific variable using electric or magnetic means influencing the magnitude of a current or voltage using Hall-effect devices influenced by the relative movement between the Hall device and magnetic fields
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01P—MEASURING LINEAR OR ANGULAR SPEED, ACCELERATION, DECELERATION, OR SHOCK; INDICATING PRESENCE, ABSENCE, OR DIRECTION, OF MOVEMENT
- G01P3/00—Measuring linear or angular speed; Measuring differences of linear or angular speeds
- G01P3/42—Devices characterised by the use of electric or magnetic means
- G01P3/44—Devices characterised by the use of electric or magnetic means for measuring angular speed
- G01P3/48—Devices characterised by the use of electric or magnetic means for measuring angular speed by measuring frequency of generated current or voltage
- G01P3/481—Devices characterised by the use of electric or magnetic means for measuring angular speed by measuring frequency of generated current or voltage of pulse signals
- G01P3/487—Devices characterised by the use of electric or magnetic means for measuring angular speed by measuring frequency of generated current or voltage of pulse signals delivered by rotating magnets
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02P—CONTROL OR REGULATION OF ELECTRIC MOTORS, ELECTRIC GENERATORS OR DYNAMO-ELECTRIC CONVERTERS; CONTROLLING TRANSFORMERS, REACTORS OR CHOKE COILS
- H02P5/00—Arrangements specially adapted for regulating or controlling the speed or torque of two or more electric motors
- H02P5/46—Arrangements specially adapted for regulating or controlling the speed or torque of two or more electric motors for speed regulation of two or more dynamo-electric motors in relation to one another
- H02P5/50—Arrangements specially adapted for regulating or controlling the speed or torque of two or more electric motors for speed regulation of two or more dynamo-electric motors in relation to one another by comparing electrical values representing the speeds
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Transmission And Conversion Of Sensor Element Output (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL254347D NL254347A (OSRAM) | 1959-09-23 | ||
| DES65064A DE1138240B (de) | 1959-09-23 | 1959-09-23 | Messwertumformer |
| CH793860A CH386123A (de) | 1959-09-23 | 1960-07-12 | Messwertumformer |
| FR836445A FR1267394A (fr) | 1959-09-23 | 1960-08-22 | Transformateur de valeurs de mesure reproduisant une grandeur mécanique sous la forme de la fréquence d'une grandeur électrique |
| US57336A US3317829A (en) | 1959-09-23 | 1960-09-20 | Translating device for converting a mechanical magnitude into an electric frequency |
| GB32793/60A GB922571A (en) | 1959-09-23 | 1960-09-23 | Improvements in or relating to inductive datum converters |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DES65064A DE1138240B (de) | 1959-09-23 | 1959-09-23 | Messwertumformer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1138240B true DE1138240B (de) | 1962-10-18 |
Family
ID=7497724
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DES65064A Pending DE1138240B (de) | 1959-09-23 | 1959-09-23 | Messwertumformer |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3317829A (OSRAM) |
| CH (1) | CH386123A (OSRAM) |
| DE (1) | DE1138240B (OSRAM) |
| GB (1) | GB922571A (OSRAM) |
| NL (1) | NL254347A (OSRAM) |
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1281549B (de) * | 1962-11-15 | 1968-10-31 | Siemens Ag | Elektronischer Impulsgeber fuer einen Laeufer aufweisende Elektrizitaetszaehler, der eine dem Laeuferdrehwinkel entsprechende Impulszahl abgibt |
| DE1282987B (de) * | 1964-10-12 | 1968-11-14 | Philips Patentverwaltung | Anordnung zur beruehrungslosen Messung von Relativverschiebungen rotierender Koerper |
| DE1623844B1 (de) * | 1967-11-11 | 1970-10-01 | Siemens Ag | Elektronischer Impulsgeber,insbesondere für Fadenlängen-Messeinrichtungen |
| DE2458398A1 (de) | 1973-12-12 | 1975-06-19 | Sony Corp | Phasen-messvorrichtung fuer ein bewegtes element |
| DE2454522A1 (de) * | 1973-11-17 | 1975-07-24 | Sony Corp | Magnetoresistives element |
| DE2537714A1 (de) * | 1974-09-04 | 1976-03-18 | Solari & C Spa | Vorrichtung zur ueberpruefung der position eines umlaufenden anzeigeorgans |
| DE2823547A1 (de) * | 1978-05-27 | 1979-11-29 | Kluessendorf Heinrich H | Einrichtung zur erfassung der momentanen stellung und einstellung von positionierbaren drehenden oder translatorisch bewegten elementen |
| DE2930223A1 (de) * | 1978-07-25 | 1980-02-07 | Mitsubishi Electric Corp | Rotationsmessvorrichtung |
| DE2933557A1 (de) * | 1979-08-18 | 1981-02-26 | Bosch Gmbh Robert | Vorrichtung zur beruehrungslosen weg- oder geschwindigkeitsmessung |
| DE2945895A1 (de) * | 1979-11-14 | 1981-05-27 | Festo-Maschinenfabrik Gottlieb Stoll, 7300 Esslingen | Magnetisches laengenmesssystem vorzugsweise zum messen der position von hydraulik-und pneumatikzylindern |
| DE3008582A1 (de) * | 1980-03-06 | 1981-09-10 | Fa. Dr. Eugen Dürrwächter DODUCO, 7530 Pforzheim | Inkrementaler weggeber |
| DE3047809A1 (de) * | 1979-12-19 | 1981-09-17 | Hitachi, Ltd., Tokyo | Drehgeber-magnetkopf |
| DE3015971A1 (de) * | 1980-04-25 | 1981-11-05 | Braun Ag, 6000 Frankfurt | Einrichtung zum erkennen der links- oder rchtsbewegung eines koerpers |
| DE3122376A1 (de) * | 1981-06-05 | 1982-12-23 | Robert Bosch Gmbh, 7000 Stuttgart | Vorrichtung zur erfassung der drehzahl von rotierenden teilen |
| DE3132549A1 (de) * | 1981-08-18 | 1983-03-03 | Robert Bosch Gmbh, 7000 Stuttgart | Vorrichtung zur erfassung der drehzahl von rotierenden teilen |
| EP0196572A2 (de) | 1984-11-14 | 1986-10-08 | Knorr-Bremse Ag | Positioniereinrichtung für kolbenstangenlose Zylinder |
| DE3730218A1 (de) * | 1987-09-09 | 1989-03-30 | Magnetfab Bonn Gmbh | Vorrichtung, insbesondere tachometerrad, fuer beruehrungslose drehzahlabnahme oder kontaktgabe an maschinen |
| DE102017212905A1 (de) * | 2017-07-27 | 2019-01-31 | Robert Bosch Gmbh | Verfahren und Vorrichtung zur Erfassung der Drehrichtung eines Rades |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3365609A (en) * | 1964-09-01 | 1968-01-23 | Philips Corp | Transducer for use with variable frequency magnetrons |
| DE1523206A1 (de) * | 1966-12-15 | 1969-04-10 | Kienzle Apparate Gmbh | Anordnung zur elektronischen Drehzahlmessung und -registrierung |
| US3477022A (en) * | 1967-05-16 | 1969-11-04 | Gen Motors Corp | Electronic speedometer and odometer control circuit |
| FR2012522A1 (OSRAM) * | 1968-07-09 | 1970-03-20 | Quick Rotan Becker & Notz Kg | |
| US3544890A (en) * | 1968-07-17 | 1970-12-01 | Iit Res Inst | Method and apparatus for detecting damage in turbine blades by their magnetic characteristics |
| DE2058834C3 (de) * | 1970-11-30 | 1985-07-11 | Robert Bosch Gmbh, 7000 Stuttgart | Einrichtung zur Ermittlung der oberen Totpunktlage des Kolbens einer zu einem Kraftfahrzeug gehörenden Brennkraftmaschine |
| US3742243A (en) * | 1971-09-27 | 1973-06-26 | Veeder Industries Inc | Pulse generator |
| DE2157801A1 (de) * | 1971-11-22 | 1973-06-28 | Siemens Ag | Analoger drehwinkelabhaengiger funktionsgeber |
| US3776606A (en) * | 1972-06-13 | 1973-12-04 | Gte Sylvania Inc | Frequency to voltage converter employing hall effect cell with signal hysteresis and normalizing |
| JPS4960748U (OSRAM) * | 1972-09-04 | 1974-05-28 | ||
| US3855774A (en) * | 1973-01-26 | 1974-12-24 | Owens Corning Fiberglass Corp | Apparatus for winding a plurality of linear materials |
| US3893059A (en) * | 1974-03-13 | 1975-07-01 | Veeder Industries Inc | Pulse generator with asymmetrical multi-pole magnet |
| JPS50151283U (OSRAM) * | 1974-05-31 | 1975-12-16 | ||
| GB1513912A (en) * | 1974-08-29 | 1978-06-14 | Bosch Gmbh Robert | Detecting rotation of a shaft |
| US4054860A (en) * | 1975-12-01 | 1977-10-18 | Oak Industries Inc. | Hall effect rotary switch |
| JPS6045804B2 (ja) * | 1978-02-28 | 1985-10-12 | 日本電気株式会社 | 角度検出器 |
| US4256277A (en) * | 1978-09-12 | 1981-03-17 | Embree David G | Actuator system for aircraft control surfaces |
| US4384252A (en) * | 1979-05-11 | 1983-05-17 | The Bendix Corporation | Cup shaped magnetic pickoff for use with a variable reluctance motion sensing system |
| DE3041041C2 (de) * | 1980-10-31 | 1983-06-23 | Krauss-Maffei AG, 8000 München | Magneto-elektrischer Wegaufnehmer |
| DE3346644A1 (de) * | 1983-12-23 | 1985-07-04 | Standard Elektrik Lorenz Ag, 7000 Stuttgart | Anordnung zur bestimmung einer drehzahl |
| JPS60228918A (ja) * | 1984-04-26 | 1985-11-14 | Fanuc Ltd | 磁気センサ |
| FR2583514B1 (fr) * | 1985-06-18 | 1990-04-20 | Peugeot | Dispositif de reperage d'une piece en mouvement utilisant des plastiques magnetiques et son procede de realisation |
| US4719419A (en) * | 1985-07-15 | 1988-01-12 | Harris Graphics Corporation | Apparatus for detecting a rotary position of a shaft |
| US4872208A (en) * | 1988-09-27 | 1989-10-03 | Ontic Engineering And Manufacturing Inc. | Compact monopole digital tachometer generator for use in airborne vehicles |
| US5686835A (en) * | 1989-01-18 | 1997-11-11 | Nippondenso Co., Ltd | Physical quantity detection device for converting a physical quantity into a corresponding time interval |
| US5789915A (en) * | 1989-02-17 | 1998-08-04 | Nartron Corporation | Magnetic field energy responsive position sensing apparatus and method |
| US5258735A (en) * | 1991-10-28 | 1993-11-02 | Allwine Jr Elmer C | Multi-pole composite magnet used in a magnetic encoder |
| US5369323A (en) * | 1991-10-28 | 1994-11-29 | Slonix Engineering | Composite magnet stepper motor |
| US5602472A (en) * | 1993-01-15 | 1997-02-11 | Hughes Electronics | Apparatus and method for determining angular position and rotational speed using a rotating magnet and a directional magnetometer |
| US6091238A (en) * | 1995-06-22 | 2000-07-18 | Kevin McDermott | Variable output electrical device |
| FI108887B (fi) * | 1998-01-23 | 2002-04-15 | Metso Paper Automation Oy | Toimilaite |
| FI112400B (fi) | 1999-05-12 | 2003-11-28 | Nokia Corp | Menetelmä tiedon osoittamiseksi ja osoitusväline |
| US6489761B1 (en) * | 1999-09-09 | 2002-12-03 | Delphi Technologies, Inc. | Magnetic arrangement for an analog angle encoder |
| US20050151534A1 (en) * | 2004-01-08 | 2005-07-14 | Omekanda Avoki M. | System and method for sensing angular position using ring magnet with sensor in flux return path |
| ITMI20041112A1 (it) * | 2004-06-01 | 2004-09-01 | Ansaldo Ricerche S R L Societa | Sensore di posizione ad effetto di hall ad alta risoluzione ed elevata immunita' al rumore elettro agnetico |
| US7889187B2 (en) * | 2007-04-20 | 2011-02-15 | Kohler Co. | User interface for controlling a bathroom plumbing fixture |
| DE102013221943A1 (de) | 2013-10-29 | 2015-04-30 | Schaeffler Technologies Gmbh & Co. Kg | Sensorsystem zur Drehzahlmessung mit einem Polrad mit linearisiertem Magnetfeld |
| EP4474260B1 (de) | 2023-06-06 | 2025-07-23 | K.W.H. Ciclosport Vertriebs GmbH | Pulsrad |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE849454C (de) * | 1949-11-01 | 1952-09-15 | Licentia Gmbh | Einrichtung zur Drehzahl-Vergleichsmessung an Zaehlern |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3123725A (en) * | 1964-03-03 | Hall effect dynamoelectric machine | ||
| US2387901A (en) * | 1942-07-31 | 1945-10-30 | Westinghouse Electric Corp | Slip indicator |
| US2559849A (en) * | 1947-06-28 | 1951-07-10 | Universal Oil Prod Co | Electronic speed indicator |
| US2493028A (en) * | 1947-07-16 | 1950-01-03 | Donald R Putt | Instrument for testing tachometers and speedometers |
| US2512325A (en) * | 1949-05-25 | 1950-06-20 | Gen Electric | Hall effect commutating apparatus |
| US2946955A (en) * | 1953-08-31 | 1960-07-26 | Siemens Ag | Measuring apparatus comprising a magnetic field-responsive resistor as a condition-responsive element |
| US2924633A (en) * | 1954-03-27 | 1960-02-09 | Siemens Ag | Ignition system for internal combustion engines |
| US2956209A (en) * | 1954-09-21 | 1960-10-11 | Siemens Ag | Apparatus for measuring the ratio of two variables, particularly two speeds of revolution |
| US2866013A (en) * | 1955-05-24 | 1958-12-23 | Charles S Reis | Magnetic record method and apparatus |
| US2978545A (en) * | 1956-10-15 | 1961-04-04 | Mc Graw Edison Co | Magnetic playback heads |
| US2945993A (en) * | 1958-04-22 | 1960-07-19 | Siemens Ag | Compensated hall voltage generator |
| DE1100305B (de) * | 1958-09-09 | 1961-02-23 | Siemens Ag | Elektromechanischer Wandler nach Art eines Tonabnehmers |
| US2989690A (en) * | 1959-04-29 | 1961-06-20 | Gen Electric | Elongation, length, and velocity gage |
-
0
- NL NL254347D patent/NL254347A/xx unknown
-
1959
- 1959-09-23 DE DES65064A patent/DE1138240B/de active Pending
-
1960
- 1960-07-12 CH CH793860A patent/CH386123A/de unknown
- 1960-09-20 US US57336A patent/US3317829A/en not_active Expired - Lifetime
- 1960-09-23 GB GB32793/60A patent/GB922571A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE849454C (de) * | 1949-11-01 | 1952-09-15 | Licentia Gmbh | Einrichtung zur Drehzahl-Vergleichsmessung an Zaehlern |
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1281549B (de) * | 1962-11-15 | 1968-10-31 | Siemens Ag | Elektronischer Impulsgeber fuer einen Laeufer aufweisende Elektrizitaetszaehler, der eine dem Laeuferdrehwinkel entsprechende Impulszahl abgibt |
| DE1282987B (de) * | 1964-10-12 | 1968-11-14 | Philips Patentverwaltung | Anordnung zur beruehrungslosen Messung von Relativverschiebungen rotierender Koerper |
| DE1623844B1 (de) * | 1967-11-11 | 1970-10-01 | Siemens Ag | Elektronischer Impulsgeber,insbesondere für Fadenlängen-Messeinrichtungen |
| DE2454522A1 (de) * | 1973-11-17 | 1975-07-24 | Sony Corp | Magnetoresistives element |
| DE2458398A1 (de) | 1973-12-12 | 1975-06-19 | Sony Corp | Phasen-messvorrichtung fuer ein bewegtes element |
| DE2537714A1 (de) * | 1974-09-04 | 1976-03-18 | Solari & C Spa | Vorrichtung zur ueberpruefung der position eines umlaufenden anzeigeorgans |
| DE2823547A1 (de) * | 1978-05-27 | 1979-11-29 | Kluessendorf Heinrich H | Einrichtung zur erfassung der momentanen stellung und einstellung von positionierbaren drehenden oder translatorisch bewegten elementen |
| DE2930223A1 (de) * | 1978-07-25 | 1980-02-07 | Mitsubishi Electric Corp | Rotationsmessvorrichtung |
| DE2933557A1 (de) * | 1979-08-18 | 1981-02-26 | Bosch Gmbh Robert | Vorrichtung zur beruehrungslosen weg- oder geschwindigkeitsmessung |
| DE2945895A1 (de) * | 1979-11-14 | 1981-05-27 | Festo-Maschinenfabrik Gottlieb Stoll, 7300 Esslingen | Magnetisches laengenmesssystem vorzugsweise zum messen der position von hydraulik-und pneumatikzylindern |
| DE3047809A1 (de) * | 1979-12-19 | 1981-09-17 | Hitachi, Ltd., Tokyo | Drehgeber-magnetkopf |
| DE3008582A1 (de) * | 1980-03-06 | 1981-09-10 | Fa. Dr. Eugen Dürrwächter DODUCO, 7530 Pforzheim | Inkrementaler weggeber |
| DE3015971A1 (de) * | 1980-04-25 | 1981-11-05 | Braun Ag, 6000 Frankfurt | Einrichtung zum erkennen der links- oder rchtsbewegung eines koerpers |
| DE3122376A1 (de) * | 1981-06-05 | 1982-12-23 | Robert Bosch Gmbh, 7000 Stuttgart | Vorrichtung zur erfassung der drehzahl von rotierenden teilen |
| DE3132549A1 (de) * | 1981-08-18 | 1983-03-03 | Robert Bosch Gmbh, 7000 Stuttgart | Vorrichtung zur erfassung der drehzahl von rotierenden teilen |
| EP0196572A2 (de) | 1984-11-14 | 1986-10-08 | Knorr-Bremse Ag | Positioniereinrichtung für kolbenstangenlose Zylinder |
| DE3730218A1 (de) * | 1987-09-09 | 1989-03-30 | Magnetfab Bonn Gmbh | Vorrichtung, insbesondere tachometerrad, fuer beruehrungslose drehzahlabnahme oder kontaktgabe an maschinen |
| DE102017212905A1 (de) * | 2017-07-27 | 2019-01-31 | Robert Bosch Gmbh | Verfahren und Vorrichtung zur Erfassung der Drehrichtung eines Rades |
Also Published As
| Publication number | Publication date |
|---|---|
| GB922571A (en) | 1963-04-03 |
| CH386123A (de) | 1964-12-31 |
| NL254347A (OSRAM) | |
| US3317829A (en) | 1967-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1138240B (de) | Messwertumformer | |
| DE69908786T2 (de) | Bürstenlosen Motor mit Vorrichtung zur Ermittlung der Rotorstellung | |
| DE3301459C2 (de) | Vorrichtung zur Erkennung einer vorbestimmten Winkelstellung an rotierenden Einrichtungen | |
| DE1147674B (de) | Verfahren zur Fertigung von Magnetstaendern fuer Gleichstromkleinstmotoren | |
| DE3627976A1 (de) | Anordnung zur erzeugung von steuersignalen | |
| DE2332110B2 (de) | Berührungsfreies MeBsystem zur Leistungsmessung | |
| DE2855635A1 (de) | Winkelsegmentgeber mit hall-generator | |
| DE1147787B (de) | Anordnung zur Geschwindigkeitsmessung mittels Wirbelstroemen | |
| DE1773149A1 (de) | Einrichtung zur Drehrichtungsanzeige von Antrieben | |
| DE926885C (de) | Einrichtung zum Abbilden einer Drehzahl als Frequenz einer Spannung oder eines Stromes | |
| DE3331755C2 (OSRAM) | ||
| DE29706260U1 (de) | Vorrichtung zum Messen der Drehzahl eines um eine Drehachse rotierenden Körpers | |
| DE923578C (de) | Einrichtung zum Abbilden einer Drehzahl als Frequenz einer Spannung oder eines Stromes | |
| DE1936348A1 (de) | Digitaltacho | |
| DE3300990C2 (OSRAM) | ||
| DE949775C (de) | Einrichtung zur induktiven Messung des Radial- oder Axialspieles bei Turbinen und aehnlichen Maschinen | |
| DE3348495C2 (de) | Antriebsanordnung für Speichermedien mit einem kollektorlosen Gleichstrommotor | |
| DE2006487C3 (de) | Tachometrische Gegenkopplungsanordnung für einen kollektorlosen Gleichstrommotor | |
| DE1266033B (de) | Einrichtung zur analogen Messung von Drehgeschwindigkeiten | |
| DE1523221B2 (de) | Kontaktloses Geschwindigkeitsmeßwerk | |
| DE69209648T2 (de) | Verfahren und Vorrichtung zur Messung des Abstandes zwischen zwei gegenüberliegenden Oberflächen mittels eines Reluktanzverfahrens | |
| DE2251967A1 (de) | Drehzahlmesser | |
| DE1297657B (de) | Codegeber zur Erzeugung digitaler Codesignale entsprechend der Lage bzw. Bewegung eines Maschinenteils | |
| DE1258160B (de) | Tachometergenerator | |
| AT220717B (de) | Vorrichtung zum elektrischen Messen der Geschwindigkeit eines mechanischen Organs |