DE1135653B - Schwer entflammbare Formmassen aus Polyolefinen - Google Patents
Schwer entflammbare Formmassen aus PolyolefinenInfo
- Publication number
- DE1135653B DE1135653B DEC21993A DEC0021993A DE1135653B DE 1135653 B DE1135653 B DE 1135653B DE C21993 A DEC21993 A DE C21993A DE C0021993 A DEC0021993 A DE C0021993A DE 1135653 B DE1135653 B DE 1135653B
- Authority
- DE
- Germany
- Prior art keywords
- weight
- percent
- flame
- bromine
- chlorine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 15
- 229920000098 polyolefin Polymers 0.000 title claims description 12
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title claims description 11
- 239000003063 flame retardant Substances 0.000 title claims description 11
- 238000000465 moulding Methods 0.000 title claims description 6
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 claims description 24
- -1 alkenyl radicals Chemical class 0.000 claims description 16
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 15
- 229910052794 bromium Inorganic materials 0.000 claims description 15
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000001246 bromo group Chemical group Br* 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 12
- 239000004698 Polyethylene Substances 0.000 description 8
- 229920000573 polyethylene Polymers 0.000 description 8
- 238000012360 testing method Methods 0.000 description 6
- HRICYCBIRUKDED-UHFFFAOYSA-N 1-benzyl-2-(2-phenylethyl)benzene Chemical compound C=1C=CC=CC=1CCC1=CC=CC=C1CC1=CC=CC=C1 HRICYCBIRUKDED-UHFFFAOYSA-N 0.000 description 4
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 3
- GDPISEKNRFFKMM-UHFFFAOYSA-N 1,3-diphenylpropan-2-ylbenzene Chemical class C=1C=CC=CC=1CC(C=1C=CC=CC=1)CC1=CC=CC=C1 GDPISEKNRFFKMM-UHFFFAOYSA-N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- PKQYSCBUFZOAPE-UHFFFAOYSA-N 1,2-dibenzyl-3-methylbenzene Chemical compound C=1C=CC=CC=1CC=1C(C)=CC=CC=1CC1=CC=CC=C1 PKQYSCBUFZOAPE-UHFFFAOYSA-N 0.000 description 1
- VEAFKIYNHVBNIP-UHFFFAOYSA-N 1,3-Diphenylpropane Chemical class C=1C=CC=CC=1CCCC1=CC=CC=C1 VEAFKIYNHVBNIP-UHFFFAOYSA-N 0.000 description 1
- BUZMJVBOGDBMGI-UHFFFAOYSA-N 1-phenylpropylbenzene Chemical compound C=1C=CC=CC=1C(CC)C1=CC=CC=C1 BUZMJVBOGDBMGI-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000002820 allylidene group Chemical group [H]C(=[*])C([H])=C([H])[H] 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/20—Oxides; Hydroxides
- C08K3/22—Oxides; Hydroxides of metals
- C08K3/2279—Oxides; Hydroxides of metals of antimony
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/02—Halogenated hydrocarbons
- C08K5/03—Halogenated hydrocarbons aromatic, e.g. C6H5-CH2-Cl
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC21993A DE1135653B (de) | 1960-07-25 | 1960-07-25 | Schwer entflammbare Formmassen aus Polyolefinen |
| US77017A US3141860A (en) | 1960-07-25 | 1960-12-20 | Flame-resistant polyolefine composition |
| SE193/61A SE304847B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1960-07-25 | 1961-01-10 | |
| FR868179A FR1295232A (fr) | 1960-07-25 | 1961-07-18 | Mélanges difficilement inflammables de polyoléfines |
| GB26672/61A GB913161A (en) | 1960-07-25 | 1961-07-24 | Flame-resistant polyolefine mixtures |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC21993A DE1135653B (de) | 1960-07-25 | 1960-07-25 | Schwer entflammbare Formmassen aus Polyolefinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1135653B true DE1135653B (de) | 1962-08-30 |
Family
ID=7017118
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC21993A Pending DE1135653B (de) | 1960-07-25 | 1960-07-25 | Schwer entflammbare Formmassen aus Polyolefinen |
Country Status (4)
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1230209B (de) * | 1963-07-03 | 1966-12-08 | Huels Chemische Werke Ag | Thermoplastische Massen zur Herstellung schwerentflammbarer Formteile aus Polyolefinen |
| DE19581920B4 (de) * | 1995-02-16 | 2006-12-28 | Chisso Corp. | Kristalline Polyolefin-Harzzusammensetzung und elektrisches Isolierteil, das diese Zusammensetzung enthält |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1123823B (de) * | 1959-12-18 | 1962-02-15 | Huels Chemische Werke Ag | Schwer entflammbare Formmassen auf Basis von Polyolefinen |
| US3899466A (en) * | 1970-09-09 | 1975-08-12 | Ethyl Corp | Brominated xylene diols |
| JPS5120061B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1972-11-20 | 1976-06-22 | Nippon Synthetic Chem Ind | |
| DE3334068A1 (de) * | 1983-09-21 | 1985-04-11 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur brommethylierung von polyphenylenethern |
| US5039729A (en) * | 1990-03-05 | 1991-08-13 | Ethyl Corporation | Novel mixtures of brominated diphenyl ethanes |
| US5136107A (en) * | 1990-06-04 | 1992-08-04 | Ethyl Corporation | Process for halogenating aromatic compounds |
| US5401890A (en) * | 1990-07-30 | 1995-03-28 | Albemarle Corporation | Process and apparatus for heat treating halogenated compounds |
| US5124496A (en) * | 1990-11-01 | 1992-06-23 | Ethyl Corporation | Process for decabromodiphenylalkane predominant product |
| US5055235A (en) * | 1990-12-12 | 1991-10-08 | Ethyl Corporation | Bromination process |
| US5324874A (en) * | 1992-05-26 | 1994-06-28 | Ethyl Corporation | Process for a decarbromodiphenylethane predominate product having enhanced whiteness |
| JPH08510208A (ja) * | 1993-04-07 | 1996-10-29 | グレート・レークス・ケミカル・コーポレーション | 臭素化ジフェニルアルカン生成物および製法 |
| US6518468B1 (en) | 1994-09-16 | 2003-02-11 | Albemarle Corporation | Bromination process |
| US6743825B1 (en) * | 2001-08-03 | 2004-06-01 | Albemarle Corporation | Poly(bromoaryl)alkane additives and methods for their preparation and use |
| WO2003055832A1 (en) * | 2001-12-21 | 2003-07-10 | Pabu Services, Inc. | Method and apparatus for producing decabromodiphenyl alkanes |
| US20080221239A1 (en) * | 2007-03-07 | 2008-09-11 | Falloon Stephen B | Flame retardant composition for use in styrenics |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE580957A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-07-24 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2033612A (en) * | 1933-04-04 | 1936-03-10 | Gen Electric | Chlorine derivatives of dibenzyl and process of preparing them |
| US2244284A (en) * | 1937-02-03 | 1941-06-03 | Dow Chemical Co | Dielectric agents and method of making same |
| US2556880A (en) * | 1945-08-17 | 1951-06-12 | Solar Mfg Corp | Synthetic oils and resins and methods of producing same |
| US2623910A (en) * | 1947-04-26 | 1952-12-30 | Sprague Electric Co | Chlorinated aromatic compounds |
| US2517930A (en) * | 1947-06-02 | 1950-08-08 | Sprague Electric Co | Halogenated aromatic compounds |
| US2669521A (en) * | 1948-04-17 | 1954-02-16 | Diamond Alkali Co | Flame resistant compositions |
| US2548982A (en) * | 1949-03-18 | 1951-04-17 | Dominion Tar & Chemical Co | Polyaryl polyparaffins |
| US2588362A (en) * | 1949-08-17 | 1952-03-11 | Diamond Alkali Co | Flame retardant polyethylene and lignin containing composition |
| US2676946A (en) * | 1950-09-11 | 1954-04-27 | Dow Chemical Co | Nonflammable molding compositions and method of making same |
| US2723963A (en) * | 1953-01-21 | 1955-11-15 | Dow Chemical Co | Non-flammable plastic compositions and method of making same |
| US2846478A (en) * | 1954-09-17 | 1958-08-05 | American Cyanamid Co | Halogen nuclear substituted diaryl paraffins |
| US3017440A (en) * | 1957-10-30 | 1962-01-16 | Diamond Alkali Co | Dihalo, bis-(2, 4, 5-trihalophenyl)-methanes |
| DE1123823B (de) * | 1959-12-18 | 1962-02-15 | Huels Chemische Werke Ag | Schwer entflammbare Formmassen auf Basis von Polyolefinen |
| US3043886A (en) * | 1959-08-21 | 1962-07-10 | Standard Oil Co | Diarylmethanes |
-
1960
- 1960-07-25 DE DEC21993A patent/DE1135653B/de active Pending
- 1960-12-20 US US77017A patent/US3141860A/en not_active Expired - Lifetime
-
1961
- 1961-01-10 SE SE193/61A patent/SE304847B/xx unknown
- 1961-07-24 GB GB26672/61A patent/GB913161A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE580957A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-07-24 |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1230209B (de) * | 1963-07-03 | 1966-12-08 | Huels Chemische Werke Ag | Thermoplastische Massen zur Herstellung schwerentflammbarer Formteile aus Polyolefinen |
| DE19581920B4 (de) * | 1995-02-16 | 2006-12-28 | Chisso Corp. | Kristalline Polyolefin-Harzzusammensetzung und elektrisches Isolierteil, das diese Zusammensetzung enthält |
Also Published As
| Publication number | Publication date |
|---|---|
| GB913161A (en) | 1962-12-19 |
| SE304847B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1968-10-07 |
| US3141860A (en) | 1964-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1135654B (de) | Schwer entflammbare Formmassen aus Polyolefinen | |
| DE1135653B (de) | Schwer entflammbare Formmassen aus Polyolefinen | |
| DE2530293C2 (de) | Feuerhemmende Styrolpolymerzusammensetzungen | |
| DE2951906C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE2733695A1 (de) | Stabilisierte feuerhemmende styrolpolymermischungen | |
| CH628664A5 (de) | Feuerhemmende polyamid-grundmischung und -masse. | |
| DE2460194A1 (de) | Verfahren zur unterdrueckung der rauchentwicklung brennender halogenhaltiger polymerisatmassen | |
| DE1794182C3 (de) | Schwerentflammbare Formmassen aus Styrolpolymerisaten | |
| DE2404537B2 (de) | Flammbestaendige formmassen auf der grundlage von polyaethylen | |
| DE3877744T2 (de) | Flammverzoegernde polyurethanschaum-komposition enthaltend polybromierte alkylbenzole und polyarylphoshate. | |
| DE69126137T2 (de) | Flammhemmende zusammensetzungen | |
| DE602004008520T2 (de) | Halogenfreies flammhemmendes Material | |
| DE2548088C3 (de) | Selbstverlöschende Olefinpolymerisat- oder Styrolpolymerisatzusammensetzungen | |
| DE1127582B (de) | Schwer entflammbare Formmassen aus Polyolefinen | |
| DE2731677A1 (de) | Fuellstoff enthaltende poly-(phosphazen)-massen | |
| DE1669811B2 (de) | Thermoplastische massen zur herstellung schwerentflammbarer formteile aus polyolefinen | |
| DE1469899B2 (de) | Flammfeste Kunststoffe | |
| DE1230209B (de) | Thermoplastische Massen zur Herstellung schwerentflammbarer Formteile aus Polyolefinen | |
| DE1669938A1 (de) | Verfahren zur Herabsetzung der Entflammbarkeit von organischen Hochpolymeren | |
| DE1236775C2 (de) | Thermoplastische massen zur herstellung flammfester formkoerper und ueberzuege | |
| DE1103020B (de) | Schwer entflammbare Formmasse auf Basis von Polyolefinen | |
| DE2248833A1 (de) | Lichtabbaubare kunststoff-formmassen | |
| DE2312804A1 (de) | Selbstverloeschendes schlagfestes polystyrol | |
| DE1911434A1 (de) | Thermoplastische Masse zur Herstellung von schwerentflammbaren Formteilen | |
| DE1669938C3 (de) | Verfahren zur Herabsetzung der Entflammbarkeit von organischen Hochpolymeren |