DE1079205B - Starkstrom-Gleichrichter - Google Patents
Starkstrom-GleichrichterInfo
- Publication number
- DE1079205B DE1079205B DEG21740A DEG0021740A DE1079205B DE 1079205 B DE1079205 B DE 1079205B DE G21740 A DEG21740 A DE G21740A DE G0021740 A DEG0021740 A DE G0021740A DE 1079205 B DE1079205 B DE 1079205B
- Authority
- DE
- Germany
- Prior art keywords
- housing
- junction
- attached
- ceramic
- bolt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000919 ceramic Substances 0.000 claims description 22
- 239000004065 semiconductor Substances 0.000 claims description 17
- 238000009413 insulation Methods 0.000 claims 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 14
- 229910052802 copper Inorganic materials 0.000 description 14
- 239000010949 copper Substances 0.000 description 14
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 8
- 229910052710 silicon Inorganic materials 0.000 description 8
- 239000010703 silicon Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 5
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 4
- 239000011733 molybdenum Substances 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- 229910010293 ceramic material Inorganic materials 0.000 description 3
- 238000011109 contamination Methods 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000004020 conductor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 230000017525 heat dissipation Effects 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- JYGLAHSAISAEAL-UHFFFAOYSA-N Diphenadione Chemical compound O=C1C2=CC=CC=C2C(=O)C1C(=O)C(C=1C=CC=CC=1)C1=CC=CC=C1 JYGLAHSAISAEAL-UHFFFAOYSA-N 0.000 description 1
- 229910000914 Mn alloy Inorganic materials 0.000 description 1
- 229910001182 Mo alloy Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- KGWWEXORQXHJJQ-UHFFFAOYSA-N [Fe].[Co].[Ni] Chemical class [Fe].[Co].[Ni] KGWWEXORQXHJJQ-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012774 insulation material Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L23/00—Details of semiconductor or other solid state devices
- H01L23/34—Arrangements for cooling, heating, ventilating or temperature compensation ; Temperature sensing arrangements
- H01L23/36—Selection of materials, or shaping, to facilitate cooling or heating, e.g. heatsinks
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L2924/00—Indexing scheme for arrangements or methods for connecting or disconnecting semiconductor or solid-state bodies as covered by H01L24/00
- H01L2924/0001—Technical content checked by a classifier
- H01L2924/0002—Not covered by any one of groups H01L24/00, H01L24/00 and H01L2224/00
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- Condensed Matter Physics & Semiconductors (AREA)
- General Physics & Mathematics (AREA)
- Computer Hardware Design (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Power Engineering (AREA)
- Die Bonding (AREA)
- Rectifiers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US573258A US2861226A (en) | 1956-03-22 | 1956-03-22 | High current rectifier |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1079205B true DE1079205B (de) | 1960-04-07 |
Family
ID=24291258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG21740A Pending DE1079205B (de) | 1956-03-22 | 1957-03-21 | Starkstrom-Gleichrichter |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2861226A (enEXAMPLES) |
| DE (1) | DE1079205B (enEXAMPLES) |
| FR (1) | FR1169965A (enEXAMPLES) |
| GB (1) | GB836370A (enEXAMPLES) |
| NL (2) | NL215646A (enEXAMPLES) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1218069B (de) * | 1960-05-23 | 1966-06-02 | Westinghouse Electric Corp | Halbleiteranordnung |
| DE1270183B (de) * | 1962-11-08 | 1968-06-12 | Siemens Ag | Halbleiteranordnung mit einem aus einer Grundplatte und einem weiteren pfannen- oder becherfoermigen Teil bestehenden Gehaeuse |
| DE1280419B (de) * | 1959-05-15 | 1968-10-17 | Nippert Electric Products Comp | Fliesspress-Verfahren zur Herstellung eines Traegerkoerpers fuer Halbleiterbauelemente |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3064341A (en) * | 1956-12-26 | 1962-11-20 | Ibm | Semiconductor devices |
| US3051878A (en) * | 1957-05-02 | 1962-08-28 | Sarkes Tarzian | Semiconductor devices and method of manufacturing them |
| US3054033A (en) * | 1957-05-21 | 1962-09-11 | Sony Corp | Junction type semiconductor device |
| US2917686A (en) * | 1957-08-19 | 1959-12-15 | Westinghouse Electric Corp | Semiconductor rectifier device |
| DE1054585B (de) * | 1958-03-18 | 1959-04-09 | Eberle & Co Appbau Ges | Halbleiterbauelement, z. B. Diode oder Transistor |
| US3150298A (en) * | 1958-04-16 | 1964-09-22 | Motorola Inc | Stud-mounted rectifier |
| US2960641A (en) * | 1958-06-23 | 1960-11-15 | Sylvania Electric Prod | Hermetically sealed semiconductor device and manufacture thereof |
| US2921245A (en) * | 1958-10-08 | 1960-01-12 | Int Rectifier Corp | Hermetically sealed junction means |
| US3030558A (en) * | 1959-02-24 | 1962-04-17 | Fansteel Metallurgical Corp | Semiconductor diode assembly and housing therefor |
| US3001110A (en) * | 1960-11-03 | 1961-09-19 | Pacific Semiconductors Inc | Coaxial semiconductors |
| DE1248811B (enEXAMPLES) * | 1961-03-28 | |||
| BE623873A (enEXAMPLES) * | 1961-10-24 | 1900-01-01 | ||
| US3170098A (en) * | 1963-03-15 | 1965-02-16 | Westinghouse Electric Corp | Compression contacted semiconductor devices |
| DE1263193B (de) * | 1965-06-25 | 1968-03-14 | Siemens Ag | Halbleitergleichrichterzelle |
| US3452254A (en) * | 1967-03-20 | 1969-06-24 | Int Rectifier Corp | Pressure assembled semiconductor device using massive flexibly mounted terminals |
| US20060268590A1 (en) * | 2005-05-31 | 2006-11-30 | Charng-Geng Sheen | Rectifier diode of electric generator |
| US7352583B2 (en) * | 2005-10-03 | 2008-04-01 | Remy Technologies, L.L.C. | Flexible lead for a pressfit diode bridge |
| US20090323339A1 (en) * | 2008-06-04 | 2009-12-31 | The L.D. Kichler Co. | Positionable lighting assemblies |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2713133A (en) * | 1952-06-05 | 1955-07-12 | Philco Corp | Germanium diode and method for the fabrication thereof |
| FR1108663A (fr) * | 1953-10-19 | 1956-01-16 | Licentia Gmbh | Système conducteur électrique asymétrique |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL94441C (enEXAMPLES) * | 1951-09-15 | |||
| US2776920A (en) * | 1952-11-05 | 1957-01-08 | Gen Electric | Germanium-zinc alloy semi-conductors |
| US2725505A (en) * | 1953-11-30 | 1955-11-29 | Rca Corp | Semiconductor power devices |
| US2751528A (en) * | 1954-12-01 | 1956-06-19 | Gen Electric | Rectifier cell mounting |
| BE543951A (enEXAMPLES) * | 1954-12-27 | |||
| US2763822A (en) * | 1955-05-10 | 1956-09-18 | Westinghouse Electric Corp | Silicon semiconductor devices |
-
0
- NL NL101591D patent/NL101591C/xx active
- NL NL215646D patent/NL215646A/xx unknown
-
1956
- 1956-03-22 US US573258A patent/US2861226A/en not_active Expired - Lifetime
-
1957
- 1957-03-21 DE DEG21740A patent/DE1079205B/de active Pending
- 1957-03-22 FR FR1169965D patent/FR1169965A/fr not_active Expired
- 1957-03-22 GB GB9442/57A patent/GB836370A/en not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2713133A (en) * | 1952-06-05 | 1955-07-12 | Philco Corp | Germanium diode and method for the fabrication thereof |
| FR1108663A (fr) * | 1953-10-19 | 1956-01-16 | Licentia Gmbh | Système conducteur électrique asymétrique |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1280419B (de) * | 1959-05-15 | 1968-10-17 | Nippert Electric Products Comp | Fliesspress-Verfahren zur Herstellung eines Traegerkoerpers fuer Halbleiterbauelemente |
| DE1218069B (de) * | 1960-05-23 | 1966-06-02 | Westinghouse Electric Corp | Halbleiteranordnung |
| DE1270183B (de) * | 1962-11-08 | 1968-06-12 | Siemens Ag | Halbleiteranordnung mit einem aus einer Grundplatte und einem weiteren pfannen- oder becherfoermigen Teil bestehenden Gehaeuse |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1169965A (fr) | 1959-01-08 |
| US2861226A (en) | 1958-11-18 |
| GB836370A (en) | 1960-06-01 |
| NL215646A (enEXAMPLES) | |
| NL101591C (enEXAMPLES) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1079205B (de) | Starkstrom-Gleichrichter | |
| DE1047950B (de) | Luftgekuehlte Leistungs-Gleichrichteranordnung mit gekapselten Halbleiter-Gleichrichterelementen | |
| DE1085261B (de) | Halbleitervorrichtung fuer grosse Leistungen | |
| DE2337694A1 (de) | Halbleitergleichrichteranordnung | |
| DE102017120747A1 (de) | SMD-Gehäuse mit Oberseitenkühlung | |
| DE2711776A1 (de) | Leistungshalbleiterbauelement | |
| DE69227239T2 (de) | Einbau-anordnung für hochspannungs-/hochleistungs-halbleiter | |
| DE1963478A1 (de) | Halbleitergleichrichteranordnung fuer hohe Spitzenstroeme | |
| DE2012440C3 (de) | Halbleiteranordnung für gasdicht abgeschlossene scheibenförmige Halbleiterelemente | |
| DE2855493A1 (de) | Leistungs-halbleiterbauelement | |
| EP1642334B1 (de) | Elektronisches leistungsmodul mit gummidichtung und entsprechendes herstellungsverfahren | |
| DE10065495C2 (de) | Leistungshalbleitermodul | |
| DE1203394B (de) | Halbleitergleichrichteranordnung | |
| DE2611749A1 (de) | Halbleiteranordnung mit einem durch druck kontaktierbaren halbleiterbauelement | |
| DE3141643C2 (enEXAMPLES) | ||
| DE2638909A1 (de) | Halbleiteranordnung | |
| EP0016768A1 (de) | Halbleiterbauelement mit isoliergehäuse. | |
| DE1439923A1 (de) | Halbleiteranordnung | |
| DE1978283U (de) | Integrierte gleichrichter-schaltungsanordnung. | |
| DE69713635T2 (de) | Unter internem Druck zusammengesetzte Halbleiteranordnung mit einem Chip-Rahmen, der eine längere Kriechstrecke erlaubt | |
| DE1009310B (de) | Halbleitervorrichtung mit einem Flaechenkontakttransistor | |
| EP0075154B1 (de) | Leistungshalbleiterbauelement für Siedekühlung oder Flüssigkeitskühlung | |
| DE7505830U (de) | Vorrichtung zum hochspannungsfesten und gut waermeleitenden einbau von halbleiter-bauelementen | |
| DE3338165C2 (de) | Halbleiterbaueinheit mit Halbleiterbauelementen und Montage- und Kühlvorrichtung | |
| DE2641032A1 (de) | Modul-baueinheit fuer in kompaktbauweise zusammengesetzte stromrichter |