DE1044465B - Schieberegister mit einer Kette von Triggerkreisen - Google Patents
Schieberegister mit einer Kette von TriggerkreisenInfo
- Publication number
- DE1044465B DE1044465B DEI10914A DEI0010914A DE1044465B DE 1044465 B DE1044465 B DE 1044465B DE I10914 A DEI10914 A DE I10914A DE I0010914 A DEI0010914 A DE I0010914A DE 1044465 B DE1044465 B DE 1044465B
- Authority
- DE
- Germany
- Prior art keywords
- trigger
- potential
- resistor
- circuit
- line
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003990 capacitor Substances 0.000 claims description 25
- 230000008878 coupling Effects 0.000 claims description 13
- 238000010168 coupling process Methods 0.000 claims description 13
- 238000005859 coupling reaction Methods 0.000 claims description 13
- 239000011159 matrix material Substances 0.000 claims description 10
- 230000000295 complement effect Effects 0.000 claims description 6
- 230000002441 reversible effect Effects 0.000 description 20
- 230000008859 change Effects 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000000903 blocking effect Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 238000010586 diagram Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000010355 oscillation Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 230000001360 synchronised effect Effects 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- UQONAEXHTGDOIH-AWEZNQCLSA-N O=C(N1CC[C@@H](C1)N1CCCC1=O)C1=CC2=C(NC3(CC3)CCO2)N=C1 Chemical compound O=C(N1CC[C@@H](C1)N1CCCC1=O)C1=CC2=C(NC3(CC3)CCO2)N=C1 UQONAEXHTGDOIH-AWEZNQCLSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/28—Digital stores in which the information is moved stepwise, e.g. shift registers using semiconductor elements
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/20—Digital stores in which the information is moved stepwise, e.g. shift registers using discharge tubes
- G11C19/202—Digital stores in which the information is moved stepwise, e.g. shift registers using discharge tubes with vacuum tubes
Landscapes
- Logic Circuits (AREA)
- Details Of Television Scanning (AREA)
- Control Of Indicators Other Than Cathode Ray Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US469895A US2988701A (en) | 1954-11-19 | 1954-11-19 | Shifting registers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1044465B true DE1044465B (de) | 1958-11-20 |
Family
ID=23865453
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI10914A Pending DE1044465B (de) | 1954-11-19 | 1955-11-19 | Schieberegister mit einer Kette von Triggerkreisen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2988701A (enExample) |
| BE (1) | BE542893A (enExample) |
| CA (1) | CA583272A (enExample) |
| CH (1) | CH338316A (enExample) |
| DE (1) | DE1044465B (enExample) |
| FR (1) | FR1152098A (enExample) |
| GB (1) | GB806457A (enExample) |
| NL (2) | NL202100A (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3103597A (en) * | 1963-09-10 | Bistable diode switching circuits | ||
| US3281788A (en) * | 1961-11-03 | 1966-10-25 | Ultronic Systems Corp | Data retrieval and coupling system |
| US3119031A (en) * | 1962-01-29 | 1964-01-21 | Thompson Ramo Wooldridge Inc | Shift register with input memory converting logic level signals to positive or negative clock pulses |
| US3267433A (en) * | 1962-08-24 | 1966-08-16 | Ibm | Computing system with special purpose index registers |
| US3289165A (en) * | 1962-10-12 | 1966-11-29 | Berkeley Instr | Programming and telemetering system and apparatus |
| US3307045A (en) * | 1964-03-04 | 1967-02-28 | Burroughs Corp | Transformer control circuits for flip-flops |
| US3348069A (en) * | 1965-05-07 | 1967-10-17 | Fabri Tek Inc | Reversible shift register with simultaneous reception and transfer of information byeach stage |
| US3516665A (en) * | 1967-10-04 | 1970-06-23 | Doban Labs Inc | Automatic bowling scorekeeping system |
| US3824478A (en) * | 1972-08-07 | 1974-07-16 | Electron Emission Syst Inc | Shift register |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2688078A (en) * | 1946-02-21 | 1954-08-31 | Us Navy | Multivibrator |
| US2557729A (en) * | 1948-07-30 | 1951-06-19 | Eckert Mauchly Comp Corp | Impulse responsive network |
| US2560751A (en) * | 1949-01-11 | 1951-07-17 | Stromberg Carlson Co | Phase inversion circuits for cathode-ray tubes |
| US2700502A (en) * | 1949-01-19 | 1955-01-25 | Ibm | Multidigit shifting device |
| US2594731A (en) * | 1949-07-14 | 1952-04-29 | Teleregister Corp | Apparatus for displaying magnetically stored data |
| BE495917A (enExample) * | 1949-10-21 | |||
| US2666575A (en) * | 1949-10-26 | 1954-01-19 | Gen Electric | Calculating device |
| US2633528A (en) * | 1950-04-03 | 1953-03-31 | Leroy S Hutson | Electronic pulse modulator switch |
| IT482175A (enExample) * | 1950-11-28 | |||
| BE512434A (enExample) * | 1951-06-27 | |||
| US2719228A (en) * | 1951-08-02 | 1955-09-27 | Burroughs Corp | Binary computation circuit |
| GB738739A (en) * | 1951-09-15 | 1955-10-19 | Emi Ltd | Improvements relating to electronic binary registers |
| GB738738A (en) * | 1951-09-15 | 1955-10-19 | Emi Ltd | Improvements relating to number registers suitable for use in binary computing devices |
| IT494727A (enExample) * | 1951-12-31 | |||
| US2816226A (en) * | 1952-02-21 | 1957-12-10 | Hughes Aircraft Co | Counter circuit |
| US2808203A (en) * | 1952-02-28 | 1957-10-01 | Gen Electric | Binary shift register |
| US2647999A (en) * | 1952-05-01 | 1953-08-04 | Research Corp | Bistable circuits |
| IT505655A (enExample) * | 1952-07-21 | |||
| NL105202C (enExample) * | 1953-04-20 | |||
| US2802940A (en) * | 1953-06-26 | 1957-08-13 | Bell Telephone Labor Inc | Multivibrator circuit |
| US2706811A (en) * | 1954-02-12 | 1955-04-19 | Digital Control Systems Inc | Combination of low level swing flipflops and a diode gating network |
-
0
- NL NL127923D patent/NL127923C/xx active
- BE BE542893D patent/BE542893A/xx unknown
- CA CA583272A patent/CA583272A/en not_active Expired
- NL NL202100D patent/NL202100A/xx unknown
-
1954
- 1954-11-19 US US469895A patent/US2988701A/en not_active Expired - Lifetime
-
1955
- 1955-11-08 FR FR1152098D patent/FR1152098A/fr not_active Expired
- 1955-11-18 GB GB33070/55A patent/GB806457A/en not_active Expired
- 1955-11-18 CH CH338316D patent/CH338316A/fr unknown
- 1955-11-19 DE DEI10914A patent/DE1044465B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| NL127923C (enExample) | |
| CA583272A (en) | 1959-09-15 |
| CH338316A (fr) | 1959-05-15 |
| GB806457A (en) | 1958-12-23 |
| FR1152098A (fr) | 1958-02-11 |
| NL202100A (enExample) | |
| BE542893A (enExample) | |
| US2988701A (en) | 1961-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1045450B (de) | Verschiebespeicher mit Transistoren | |
| DE2145295A1 (de) | Schaltungsanordnung für ein Schieberegister | |
| DE1030071B (de) | Stellenverschieberegister bzw. Ringzaehler | |
| DE1067618B (de) | Mehrstufige Anordnung zur Speicherung und Stellenverschiebung in Rechenmaschinen | |
| DE2549626B2 (de) | Analog-Digital-Wandler | |
| DE2349399A1 (de) | Gasentladungssystem | |
| DE1143231B (de) | Elektronische Schaltungsanordnung mit drei stabilen Betriebszustaenden | |
| DE1474388A1 (de) | Speicheranordnung mit Feldeffekttransistoren | |
| DE1044465B (de) | Schieberegister mit einer Kette von Triggerkreisen | |
| DE1046376B (de) | Integrationseinrichtung | |
| DE2640653C2 (de) | Durch logische Verknüpfungsglieder gebildete bistabile Kippstufe | |
| DE1080803B (de) | Kommutatorkette | |
| DE854441C (de) | Verfahren und Schaltanordnung zur Veraenderung der elektrischen Darstellung einer Zahlengroesse | |
| DE1073222B (de) | Programmschritt Steuerung fur elek ironische Rechenmaschinen 14 1 5^ V St Amerika | |
| DE1140601B (de) | Schaltungsanordnung fuer eine elektronische Zaehl- oder Speicherkette | |
| DE906705C (de) | Kippschaltung fuer zwei stabile Zustaende mit zwei Kipproehren | |
| DE1524897A1 (de) | Schaltung zum Durchschalten und Speichern eines zyklisch auftretenden elektrischen Signals | |
| DE3046772C2 (de) | Taktgenerator | |
| DE2103276C3 (de) | Dynamisches Schieberegister | |
| DE1574660A1 (de) | Schieberegister hoher Geschwindigkeit | |
| DE1007085B (de) | Elektronisch arbeitender Zaehler | |
| DE1240928B (de) | Gleichstromgekoppelter elektronischer Binaerzaehler | |
| DE1032321B (de) | Schaltung zum Vergleich zweier durch elektrische Impulse dargestellter binaerer Kodezahlen | |
| DE1146921B (de) | Schaltungsanordnung fuer Binaer-Zaehlwerke | |
| DE1172307B (de) | Elektrische Zaehl- und Speichereinrichtung |