DE10145773A1 - ABS-Zusammensetzungen mit verbesserten Eigenschaftskombinationen - Google Patents
ABS-Zusammensetzungen mit verbesserten EigenschaftskombinationenInfo
- Publication number
- DE10145773A1 DE10145773A1 DE10145773A DE10145773A DE10145773A1 DE 10145773 A1 DE10145773 A1 DE 10145773A1 DE 10145773 A DE10145773 A DE 10145773A DE 10145773 A DE10145773 A DE 10145773A DE 10145773 A1 DE10145773 A1 DE 10145773A1
- Authority
- DE
- Germany
- Prior art keywords
- rubber
- graft
- compositions according
- weight
- acrylonitrile
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 71
- 229920001971 elastomer Polymers 0.000 claims description 108
- 239000005060 rubber Substances 0.000 claims description 108
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 80
- 229920000126 latex Polymers 0.000 claims description 67
- 239000002245 particle Substances 0.000 claims description 60
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 44
- 239000000178 monomer Substances 0.000 claims description 39
- 238000009826 distribution Methods 0.000 claims description 34
- 238000004519 manufacturing process Methods 0.000 claims description 25
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 19
- 230000002902 bimodal effect Effects 0.000 claims description 19
- 229920002554 vinyl polymer Polymers 0.000 claims description 19
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 18
- HIDBROSJWZYGSZ-UHFFFAOYSA-N 1-phenylpyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C1=CC=CC=C1 HIDBROSJWZYGSZ-UHFFFAOYSA-N 0.000 claims description 17
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 17
- 239000004816 latex Substances 0.000 claims description 17
- -1 peroxodisulfate compound Chemical class 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 15
- 229920002857 polybutadiene Polymers 0.000 claims description 15
- 229920000642 polymer Polymers 0.000 claims description 15
- 238000007720 emulsion polymerization reaction Methods 0.000 claims description 14
- 239000005062 Polybutadiene Substances 0.000 claims description 13
- 229920001577 copolymer Polymers 0.000 claims description 13
- 239000003999 initiator Substances 0.000 claims description 13
- 238000012662 bulk polymerization Methods 0.000 claims description 11
- 229920000578 graft copolymer Polymers 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 9
- 238000010528 free radical solution polymerization reaction Methods 0.000 claims description 8
- 230000009477 glass transition Effects 0.000 claims description 8
- 229920000728 polyester Polymers 0.000 claims description 8
- 238000010557 suspension polymerization reaction Methods 0.000 claims description 8
- 229920001169 thermoplastic Polymers 0.000 claims description 8
- 239000004416 thermosoftening plastic Substances 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical class OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims description 6
- 239000004952 Polyamide Substances 0.000 claims description 6
- 239000003638 chemical reducing agent Substances 0.000 claims description 6
- 229920002647 polyamide Polymers 0.000 claims description 6
- 229920005992 thermoplastic resin Polymers 0.000 claims description 6
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 5
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 5
- 239000007800 oxidant agent Substances 0.000 claims description 5
- 229920000515 polycarbonate Polymers 0.000 claims description 5
- 239000004417 polycarbonate Substances 0.000 claims description 5
- XWGJFPHUCFXLBL-UHFFFAOYSA-M rongalite Chemical compound [Na+].OCS([O-])=O XWGJFPHUCFXLBL-UHFFFAOYSA-M 0.000 claims description 5
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 claims description 5
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 claims description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical class [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 claims description 4
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 3
- 235000010323 ascorbic acid Nutrition 0.000 claims description 3
- 239000011668 ascorbic acid Chemical class 0.000 claims description 3
- 229960005070 ascorbic acid Drugs 0.000 claims description 3
- 239000008121 dextrose Substances 0.000 claims description 3
- 229920005989 resin Polymers 0.000 claims description 3
- 239000011347 resin Substances 0.000 claims description 3
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims description 2
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 claims description 2
- 229940120503 dihydroxyacetone Drugs 0.000 claims description 2
- 239000008103 glucose Substances 0.000 claims description 2
- XLSMFKSTNGKWQX-UHFFFAOYSA-N hydroxyacetone Chemical compound CC(=O)CO XLSMFKSTNGKWQX-UHFFFAOYSA-N 0.000 claims description 2
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical class [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 claims description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 claims description 2
- 235000010265 sodium sulphite Nutrition 0.000 claims description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical class [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 2
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 claims description 2
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical class OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 claims description 2
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical class [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 230000000977 initiatory effect Effects 0.000 claims 1
- MJOXZELXZLIYPI-UHFFFAOYSA-N titanium(2+) Chemical class [Ti+2] MJOXZELXZLIYPI-UHFFFAOYSA-N 0.000 claims 1
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 18
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 11
- 238000000465 moulding Methods 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 9
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 6
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- YAJYJWXEWKRTPO-UHFFFAOYSA-N 2,3,3,4,4,5-hexamethylhexane-2-thiol Chemical compound CC(C)C(C)(C)C(C)(C)C(C)(C)S YAJYJWXEWKRTPO-UHFFFAOYSA-N 0.000 description 4
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 4
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 4
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical group OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 238000010559 graft polymerization reaction Methods 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 4
- 238000006068 polycondensation reaction Methods 0.000 description 4
- 239000012966 redox initiator Substances 0.000 description 4
- 229920006114 semi-crystalline semi-aromatic polyamide Polymers 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229920006020 amorphous polyamide Polymers 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 229920002521 macromolecule Polymers 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- JCUZDQXWVYNXHD-UHFFFAOYSA-N 2,2,4-trimethylhexane-1,6-diamine Chemical compound NCCC(C)CC(C)(C)CN JCUZDQXWVYNXHD-UHFFFAOYSA-N 0.000 description 2
- DPQHRXRAZHNGRU-UHFFFAOYSA-N 2,4,4-trimethylhexane-1,6-diamine Chemical compound NCC(C)CC(C)(C)CCN DPQHRXRAZHNGRU-UHFFFAOYSA-N 0.000 description 2
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 2
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 2
- IGSBHTZEJMPDSZ-UHFFFAOYSA-N 4-[(4-amino-3-methylcyclohexyl)methyl]-2-methylcyclohexan-1-amine Chemical compound C1CC(N)C(C)CC1CC1CC(C)C(N)CC1 IGSBHTZEJMPDSZ-UHFFFAOYSA-N 0.000 description 2
- UMPGNGRIGSEMTC-UHFFFAOYSA-N 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol Chemical compound C1C(C)CC(C)(C)CC1(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 UMPGNGRIGSEMTC-UHFFFAOYSA-N 0.000 description 2
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 2
- 229920001634 Copolyester Polymers 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- MOYAFQVGZZPNRA-UHFFFAOYSA-N Terpinolene Chemical compound CC(C)=C1CCC(C)=CC1 MOYAFQVGZZPNRA-UHFFFAOYSA-N 0.000 description 2
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 2
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000005250 alkyl acrylate group Chemical group 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- 239000006085 branching agent Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002530 phenolic antioxidant Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001195 polyisoprene Polymers 0.000 description 2
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- MRERMGPPCLQIPD-NBVRZTHBSA-N (3beta,5alpha,9alpha,22E,24R)-3,5,9-Trihydroxy-23-methylergosta-7,22-dien-6-one Chemical compound C1C(O)CCC2(C)C(CCC3(C(C(C)/C=C(\C)C(C)C(C)C)CCC33)C)(O)C3=CC(=O)C21O MRERMGPPCLQIPD-NBVRZTHBSA-N 0.000 description 1
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 1
- XSZYESUNPWGWFQ-UHFFFAOYSA-N 1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane Chemical compound CC1CCC(C(C)(C)OO)CC1 XSZYESUNPWGWFQ-UHFFFAOYSA-N 0.000 description 1
- PBLZLIFKVPJDCO-UHFFFAOYSA-N 12-aminododecanoic acid Chemical compound NCCCCCCCCCCCC(O)=O PBLZLIFKVPJDCO-UHFFFAOYSA-N 0.000 description 1
- FQXGHZNSUOHCLO-UHFFFAOYSA-N 2,2,4,4-tetramethyl-1,3-cyclobutanediol Chemical compound CC1(C)C(O)C(C)(C)C1O FQXGHZNSUOHCLO-UHFFFAOYSA-N 0.000 description 1
- RLEQVGMLDNITBW-UHFFFAOYSA-N 2,4,4-trimethylhexanedioic acid Chemical compound OC(=O)C(C)CC(C)(C)CC(O)=O RLEQVGMLDNITBW-UHFFFAOYSA-N 0.000 description 1
- KDBZVULQVCUNNA-UHFFFAOYSA-N 2,5-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(C(C)(C)C)C(O)=C1 KDBZVULQVCUNNA-UHFFFAOYSA-N 0.000 description 1
- KAIRTVANLJFYQS-UHFFFAOYSA-N 2-(3,5-dimethylheptyl)phenol Chemical compound CCC(C)CC(C)CCC1=CC=CC=C1O KAIRTVANLJFYQS-UHFFFAOYSA-N 0.000 description 1
- RWLALWYNXFYRGW-UHFFFAOYSA-N 2-Ethyl-1,3-hexanediol Chemical compound CCCC(O)C(CC)CO RWLALWYNXFYRGW-UHFFFAOYSA-N 0.000 description 1
- ICPXIRMAMWRMAD-UHFFFAOYSA-N 2-[3-[2-[3-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol Chemical compound C=1C=CC(OCCO)=CC=1C(C)(C)C1=CC=CC(OCCO)=C1 ICPXIRMAMWRMAD-UHFFFAOYSA-N 0.000 description 1
- WTPYFJNYAMXZJG-UHFFFAOYSA-N 2-[4-(2-hydroxyethoxy)phenoxy]ethanol Chemical compound OCCOC1=CC=C(OCCO)C=C1 WTPYFJNYAMXZJG-UHFFFAOYSA-N 0.000 description 1
- MVDKKZZVTWHVMC-UHFFFAOYSA-N 2-hexadecylpropanedioic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C(O)=O MVDKKZZVTWHVMC-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- CPHURRLSZSRQFS-UHFFFAOYSA-N 3-[4-[2-[4-(3-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-1-ol Chemical compound C=1C=C(OCCCO)C=CC=1C(C)(C)C1=CC=C(OCCCO)C=C1 CPHURRLSZSRQFS-UHFFFAOYSA-N 0.000 description 1
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 1
- CUAUDSWILJWDOD-UHFFFAOYSA-N 4-(3,5-dimethylheptyl)phenol Chemical compound CCC(C)CC(C)CCC1=CC=C(O)C=C1 CUAUDSWILJWDOD-UHFFFAOYSA-N 0.000 description 1
- KJWMCPYEODZESQ-UHFFFAOYSA-N 4-Dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=C(O)C=C1 KJWMCPYEODZESQ-UHFFFAOYSA-N 0.000 description 1
- DVHUSRBSKJDAJH-UHFFFAOYSA-N 4-[1-(4-hydroxyphenyl)-3,3,5,5-tetramethylcyclohexyl]phenol Chemical compound C1C(C)(C)CC(C)(C)CC1(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 DVHUSRBSKJDAJH-UHFFFAOYSA-N 0.000 description 1
- IIQVXZZBIGSGIL-UHFFFAOYSA-N 4-[1-(4-hydroxyphenyl)-3,3-dimethylcyclohexyl]phenol Chemical compound C1C(C)(C)CCCC1(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 IIQVXZZBIGSGIL-UHFFFAOYSA-N 0.000 description 1
- BDBZTOMUANOKRT-UHFFFAOYSA-N 4-[2-(4-aminocyclohexyl)propan-2-yl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1C(C)(C)C1CCC(N)CC1 BDBZTOMUANOKRT-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- NIRYBKWMEWFDPM-UHFFFAOYSA-N 4-[3-(4-hydroxyphenyl)-3-methylbutyl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)CCC1=CC=C(O)C=C1 NIRYBKWMEWFDPM-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical compound CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- OTKFKCIRTBTDKK-UHFFFAOYSA-N [3-(aminomethyl)-5-bicyclo[2.2.1]heptanyl]methanamine Chemical compound C1C(CN)C2C(CN)CC1C2 OTKFKCIRTBTDKK-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- 239000012935 ammoniumperoxodisulfate Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- KQBTUOVABZLXGP-UHFFFAOYSA-N butane-1,4-diol;ethane-1,2-diol Chemical compound OCCO.OCCCCO KQBTUOVABZLXGP-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical compound OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000001142 dicarboxylic acid group Chemical group 0.000 description 1
- KEIQPMUPONZJJH-UHFFFAOYSA-N dicyclohexylmethanediamine Chemical class C1CCCCC1C(N)(N)C1CCCCC1 KEIQPMUPONZJJH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- ZZTCPWRAHWXWCH-UHFFFAOYSA-N diphenylmethanediamine Chemical compound C=1C=CC=CC=1C(N)(N)C1=CC=CC=C1 ZZTCPWRAHWXWCH-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- MTQJEPDPRQNPFK-UHFFFAOYSA-N ethane-1,2-diamine;n-octadecyloctadecan-1-amine Chemical compound NCCN.CCCCCCCCCCCCCCCCCCNCCCCCCCCCCCCCCCCCC MTQJEPDPRQNPFK-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229920006017 homo-polyamide Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229940117969 neopentyl glycol Drugs 0.000 description 1
- JFNLZVQOOSMTJK-KNVOCYPGSA-N norbornene Chemical compound C1[C@@H]2CC[C@H]1C=C2 JFNLZVQOOSMTJK-KNVOCYPGSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- GJVFBWCTGUSGDD-UHFFFAOYSA-L pentamethonium bromide Chemical compound [Br-].[Br-].C[N+](C)(C)CCCCC[N+](C)(C)C GJVFBWCTGUSGDD-UHFFFAOYSA-L 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000005385 peroxodisulfate group Chemical group 0.000 description 1
- 230000005501 phase interface Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- XRVCFZPJAHWYTB-UHFFFAOYSA-N prenderol Chemical compound CCC(CC)(CO)CO XRVCFZPJAHWYTB-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- 235000003441 saturated fatty acids Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000010378 sodium ascorbate Nutrition 0.000 description 1
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 description 1
- 229960005055 sodium ascorbate Drugs 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 229920006301 statistical copolymer Polymers 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- CMWCOKOTCLFJOP-UHFFFAOYSA-N titanium(3+) Chemical class [Ti+3] CMWCOKOTCLFJOP-UHFFFAOYSA-N 0.000 description 1
- SOBXOQKKUVQETK-UHFFFAOYSA-H titanium(3+);trisulfate Chemical compound [Ti+3].[Ti+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O SOBXOQKKUVQETK-UHFFFAOYSA-H 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- 238000005199 ultracentrifugation Methods 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L51/00—Compositions of graft polymers in which the grafted component is obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers
- C08L51/04—Compositions of graft polymers in which the grafted component is obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers grafted on to rubbers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L55/00—Compositions of homopolymers or copolymers, obtained by polymerisation reactions only involving carbon-to-carbon unsaturated bonds, not provided for in groups C08L23/00 - C08L53/00
- C08L55/02—ABS [Acrylonitrile-Butadiene-Styrene] polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Dental Preparations (AREA)
- Curing Cements, Concrete, And Artificial Stone (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10145773A DE10145773A1 (de) | 2001-09-17 | 2001-09-17 | ABS-Zusammensetzungen mit verbesserten Eigenschaftskombinationen |
| PCT/EP2002/009872 WO2003025061A2 (de) | 2001-09-17 | 2002-09-04 | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen |
| EP02776980A EP1440120B8 (de) | 2001-09-17 | 2002-09-04 | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen |
| DE60232000T DE60232000D1 (de) | 2001-09-17 | 2002-09-04 | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen |
| AU2002339484A AU2002339484A1 (en) | 2001-09-17 | 2002-09-04 | Abs compositions with improved characteristic combinations |
| AT02776980T ATE428750T1 (de) | 2001-09-17 | 2002-09-04 | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen |
| JP2003529846A JP4224399B2 (ja) | 2001-09-17 | 2002-09-04 | 改良された特性の組み合わせを有するabs組成物 |
| CNB028181999A CN1269900C (zh) | 2001-09-17 | 2002-09-04 | 综合性能改善的abs组合物 |
| KR1020047003866A KR100852580B1 (ko) | 2001-09-17 | 2002-09-04 | 향상된 특성이 조합된 abs 조성물 |
| ES02776980T ES2322944T3 (es) | 2001-09-17 | 2002-09-04 | Composiciones de abs con combinaciones de propiedades mejoradas. |
| US10/242,991 US6727319B2 (en) | 2001-09-17 | 2002-09-13 | ABS compositions having improved combinations of properties |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10145773A DE10145773A1 (de) | 2001-09-17 | 2001-09-17 | ABS-Zusammensetzungen mit verbesserten Eigenschaftskombinationen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE10145773A1 true DE10145773A1 (de) | 2003-04-03 |
Family
ID=7699309
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE10145773A Withdrawn DE10145773A1 (de) | 2001-09-17 | 2001-09-17 | ABS-Zusammensetzungen mit verbesserten Eigenschaftskombinationen |
| DE60232000T Expired - Fee Related DE60232000D1 (de) | 2001-09-17 | 2002-09-04 | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE60232000T Expired - Fee Related DE60232000D1 (de) | 2001-09-17 | 2002-09-04 | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US6727319B2 (enExample) |
| EP (1) | EP1440120B8 (enExample) |
| JP (1) | JP4224399B2 (enExample) |
| KR (1) | KR100852580B1 (enExample) |
| CN (1) | CN1269900C (enExample) |
| AT (1) | ATE428750T1 (enExample) |
| AU (1) | AU2002339484A1 (enExample) |
| DE (2) | DE10145773A1 (enExample) |
| ES (1) | ES2322944T3 (enExample) |
| WO (1) | WO2003025061A2 (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10060410A1 (de) * | 2000-12-05 | 2002-06-06 | Bayer Ag | Thermoplastische Formmassen |
| JP2003081937A (ja) | 2001-09-07 | 2003-03-19 | Bayer Ag | ベンゼンスルホンアミド誘導体 |
| DE10145775A1 (de) * | 2001-09-17 | 2003-04-03 | Bayer Ag | ABS-Zusammensetzungen mit verbesserten Eigenschaftskombinationen |
| US7799855B2 (en) | 2001-11-12 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polycarbonate compositions, use and method thereof |
| ATE413178T1 (de) | 2003-03-24 | 2008-11-15 | Actimis Pharmaceuticals Inc | 2-phenoxy- und 2-phenylsulfanyl-benzenesulfonamid derivate mit ccr3 antagonistischer aktivität zur behandlung von asthma und anderen entzündlichen oder immunologischen erkrankungen |
| US7223804B2 (en) | 2003-12-30 | 2007-05-29 | General Electric Company | Polycarbonate composition |
| US7638091B2 (en) * | 2004-07-02 | 2009-12-29 | Sabic Innovative Plastics Ip B. V. | Methods of sterilizing polycarbonate articles and methods of manufacture |
| US20060004154A1 (en) * | 2004-07-02 | 2006-01-05 | Derudder James L | Thermoplastic polycarbonate compositions, method of manufacture, and method of use thereof |
| US7119140B2 (en) * | 2004-07-22 | 2006-10-10 | Ronald Basham | Transparent films, compositions, and method of manufacture thereof |
| US20090023871A9 (en) * | 2004-08-05 | 2009-01-22 | General Electric Company | Flame retardant thermoplastic polycarbonate compositions, method of manufacture, and method of use thereof |
| US20060030647A1 (en) * | 2004-08-05 | 2006-02-09 | Thomas Ebeling | Flame retardant thermoplastic polycarbonate compositions, use, and method of manufacture thereof |
| US7365125B2 (en) | 2004-08-16 | 2008-04-29 | General Electric Company | Polycarbonate compositions, articles, and method of manufacture |
| US20060142486A1 (en) * | 2004-12-23 | 2006-06-29 | Derudder James L | Thermoplastic polycarbonate compositions, articles made therefrom and method of manufacture |
| US7227149B2 (en) * | 2004-12-30 | 2007-06-05 | General Electric Company | Method and system for positron emission tomography image reconstruction |
| US7432327B2 (en) | 2004-12-30 | 2008-10-07 | Sabic Innovative Plastics Ip B.V. | Transparent polymeric compositions comprising polysiloxane-polycarbonate copolymer, articles made therefrom and methods of making same |
| US7498401B2 (en) | 2005-03-03 | 2009-03-03 | Sabic Innovative Plastics Ip B.V. | Thermoplastic polycarbonate compositions, articles made therefrom and method of manufacture |
| US20070072961A1 (en) * | 2005-09-28 | 2007-03-29 | General Electric Company | Thermoplastic polycarbonate compositions, method of manufacture, and method of use thereof |
| US20070072960A1 (en) * | 2005-09-28 | 2007-03-29 | General Electric Company | Thermoplastic polycarbonate compositions, method of manufacture, and method of use thereof |
| US7544745B2 (en) * | 2005-10-25 | 2009-06-09 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polycarbonate compositions, method of manufacture, and method of use thereof |
| US7649051B2 (en) | 2005-10-25 | 2010-01-19 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polycarbonate compositions |
| US20070135569A1 (en) * | 2005-12-14 | 2007-06-14 | General Electric Company | Thermoplastic polycarbonate compositions, method of manufacture, and method of use thereof |
| FR2896028B1 (fr) | 2006-01-06 | 2008-07-04 | Air Liquide | Procede et dispositif de remplissage de conteneurs de gaz sous pression |
| US8674007B2 (en) | 2006-07-12 | 2014-03-18 | Sabic Innovative Plastics Ip B.V. | Flame retardant and scratch resistant thermoplastic polycarbonate compositions |
| CN101139417B (zh) * | 2006-09-05 | 2010-05-12 | 中国石油天然气股份有限公司 | 一种马来酰亚胺类耐热树脂乳液的制备方法 |
| US8222350B2 (en) * | 2007-02-12 | 2012-07-17 | Sabic Innovative Plastics Ip B.V. | Low gloss polycarbonate compositions |
| US8222351B2 (en) * | 2007-02-12 | 2012-07-17 | Sabic Innovative Plastics Ip B.V. | Low gloss polycarbonate compositions |
| US20080306204A1 (en) * | 2007-06-06 | 2008-12-11 | Brett David Ermi | Black-colored thermoplastic compositions, articles, and methods |
| US20080306205A1 (en) * | 2007-06-06 | 2008-12-11 | Brett David Ermi | Black-colored thermoplastic compositions, articles, and methods |
| US7999040B2 (en) * | 2007-09-25 | 2011-08-16 | Nanochem Solutions, Inc. | Method of making graft copolymers from sodium poly(aspartate) and the resulting graft copolymer |
| KR100992537B1 (ko) * | 2007-12-31 | 2010-11-05 | 제일모직주식회사 | 표면 질감이 우수한 저광 열가소성 수지 조성물 및 그 성형품 |
| CN101503542B (zh) * | 2008-02-04 | 2011-05-25 | 中国石油天然气股份有限公司 | 一种耐热阻燃树脂组合物及其制备方法 |
| BRPI0909118A2 (pt) | 2008-03-22 | 2015-11-24 | Bayer Materialscience Ag | composições de policarbonato com resiliência modificada contendo uma boa combinação de tons crus, estabilidade a hidrólise e estabilidade a fusão. |
| CN101885894B (zh) * | 2009-05-13 | 2012-05-30 | 中国石油化工股份有限公司 | 改性abs树脂及其制备方法 |
| US8741894B2 (en) | 2010-03-17 | 2014-06-03 | Axikin Pharmaceuticals, Inc. | Arylsulfonamide CCR3 antagonists |
| CN102633950B (zh) * | 2011-02-10 | 2013-11-06 | 中国石油天然气股份有限公司 | 多峰分布abs接枝共聚物的合成方法 |
| CN102746631B (zh) * | 2011-04-20 | 2015-01-07 | 中国石油化工股份有限公司 | 耐低温冲击的聚碳酸酯/abs树脂塑料合金 |
| EP2537895B1 (en) | 2011-06-20 | 2014-06-04 | Styrolution (Jersey) Limited | Impact modified polycarbonate compositions |
| CN105694437B (zh) * | 2014-11-26 | 2018-03-13 | 中国石油天然气股份有限公司 | 丙烯腈‑丁二烯‑苯乙烯/尼龙共混物合金的制备方法 |
| EP3344442B1 (en) * | 2015-09-04 | 2020-04-29 | SABIC Global Technologies B.V. | Powder compositions, method of preparing articles and coatings from the powder compositions, and articles prepared therefrom |
| CN105601769A (zh) * | 2016-03-03 | 2016-05-25 | 天津大沽化工股份有限公司 | 一种改善abs树脂基色的接枝胶乳凝聚方法 |
| KR102044364B1 (ko) * | 2016-11-11 | 2019-11-13 | 주식회사 엘지화학 | 열가소성 수지 및 열가소성 수지 조성물 |
| KR102395471B1 (ko) * | 2016-12-28 | 2022-05-09 | 코베스트로 도이칠란트 아게 | 우수한 저온 인성, 고광택, 및 높은 가공 안정성을 갖는 조성물 및 열가소성 성형 배합물 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2420358B2 (de) * | 1974-04-26 | 1980-02-07 | Bayer Ag, 5090 Leverkusen | Formmassen |
| DE2724360C3 (de) * | 1977-05-28 | 1988-03-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von thermoplastischen Formmassen auf Basis von Vinylpolymerisaten |
| US4233409A (en) | 1979-07-05 | 1980-11-11 | Monsanto Company | Polymeric blend |
| DE3044110A1 (de) * | 1980-11-24 | 1982-06-24 | Basf Ag, 6700 Ludwigshafen | Thermoplastische formmasse und formteile aus dieser |
| US4713420A (en) * | 1982-05-21 | 1987-12-15 | The Dow Chemical Company | ABS compositions having trimodal rubber particle distributions |
| AU594039B2 (en) * | 1985-02-01 | 1990-03-01 | Dow Chemical Company, The | ABS compositions having trimodal rubber particle distributions and process |
| WO1989005836A1 (en) * | 1987-12-14 | 1989-06-29 | The Dow Chemical Company | Abs compositions having trimodal rubber particle distributions |
| US5041498A (en) * | 1990-01-02 | 1991-08-20 | The Dow Chemical Company | Trimodal ABS compositions having good gloss and reduced gloss sensitivity |
| US5270387A (en) * | 1990-01-02 | 1993-12-14 | The Dow Chemical Company | High heat styrenic copolymer blends having improved tensile properties |
| TW202470B (enExample) * | 1990-04-16 | 1993-03-21 | Sumitomo Chemical Co | |
| DE4404749A1 (de) | 1994-02-15 | 1995-08-17 | Bayer Ag | ABS-Polymer-Zusammensetzungen mit gleichmäßiger matter Oberfläche |
| DE19507749A1 (de) * | 1995-03-06 | 1996-09-12 | Bayer Ag | Thermoplastische Formmassen vom ABS-Typ |
| DE19518025A1 (de) * | 1995-05-17 | 1996-11-21 | Bayer Ag | Thermoplastische ABS-Formmassen |
| DE19649249A1 (de) | 1996-11-28 | 1998-06-04 | Bayer Ag | Verbesserte thermoplastische Formmassen vom ABS-Typ |
| DE10008419A1 (de) * | 2000-02-23 | 2001-08-30 | Bayer Ag | Polymerzusammensetzungen mit verbesserter Eigenschaftskonstanz |
| DE10008420A1 (de) * | 2000-02-23 | 2001-08-30 | Bayer Ag | Polymerzusammensetzungen mit verbesserter Eigenschaftskonstanz |
-
2001
- 2001-09-17 DE DE10145773A patent/DE10145773A1/de not_active Withdrawn
-
2002
- 2002-09-04 JP JP2003529846A patent/JP4224399B2/ja not_active Expired - Fee Related
- 2002-09-04 KR KR1020047003866A patent/KR100852580B1/ko not_active Expired - Fee Related
- 2002-09-04 EP EP02776980A patent/EP1440120B8/de not_active Expired - Lifetime
- 2002-09-04 CN CNB028181999A patent/CN1269900C/zh not_active Expired - Fee Related
- 2002-09-04 AU AU2002339484A patent/AU2002339484A1/en not_active Abandoned
- 2002-09-04 ES ES02776980T patent/ES2322944T3/es not_active Expired - Lifetime
- 2002-09-04 WO PCT/EP2002/009872 patent/WO2003025061A2/de not_active Ceased
- 2002-09-04 AT AT02776980T patent/ATE428750T1/de not_active IP Right Cessation
- 2002-09-04 DE DE60232000T patent/DE60232000D1/de not_active Expired - Fee Related
- 2002-09-13 US US10/242,991 patent/US6727319B2/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US6727319B2 (en) | 2004-04-27 |
| JP4224399B2 (ja) | 2009-02-12 |
| CN1269900C (zh) | 2006-08-16 |
| EP1440120A2 (en) | 2004-07-28 |
| JP2005503465A (ja) | 2005-02-03 |
| DE60232000D1 (de) | 2009-05-28 |
| WO2003025061A2 (de) | 2003-03-27 |
| EP1440120B1 (de) | 2009-04-15 |
| AU2002339484A1 (en) | 2003-04-01 |
| ES2322944T3 (es) | 2009-07-02 |
| US20030092837A1 (en) | 2003-05-15 |
| KR20040039363A (ko) | 2004-05-10 |
| ATE428750T1 (de) | 2009-05-15 |
| WO2003025061A3 (de) | 2003-09-25 |
| EP1440120B8 (de) | 2009-06-17 |
| KR100852580B1 (ko) | 2008-08-14 |
| CN1555398A (zh) | 2004-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1440120B8 (de) | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen | |
| EP1446449B1 (de) | Abs-zusammensetzungen mit verbesserten eigenschaftskombinationen | |
| EP0845496B1 (de) | Thermoplastische Hochglanz-Formmassen vom ABS-Typ | |
| EP1268662B1 (de) | Polymerzusammensetzungen mit verbesserter eigenschaftskonstanz | |
| EP0845497B1 (de) | Verbesserte thermoplastische Formmassen vom ABS-Typ | |
| EP0745624B1 (de) | ABS-Formmassen mit verbesserten Eigenschaften | |
| EP1263879B1 (de) | Abs-formmassen mit verbesserter verarbeitbarkeit und hohem glanz | |
| EP1263822A1 (de) | Polymerzusammensetzungen mit verbesserter eigenschaftskonstanz | |
| EP0818480B1 (de) | Hochzähe ABS-Formmassen | |
| EP1098918B1 (de) | Thermoplastische formmassen auf basis hochwirksamer pfropfkautschukkomponenten | |
| EP1141057B1 (de) | Abs-formmassen mit verbesserter eigenschaftskombination | |
| EP1341844B1 (de) | Thermoplastische formmassen | |
| EP1141123B1 (de) | Hochschlagzähe thermoplastische formmassen | |
| EP1098919B1 (de) | Thermoplastische formmassen auf basis spezieller hocheffektiver pfropfpolymerkomponenten | |
| EP1414899B1 (de) | Polymerzusammensetzungen mit verbesserter eigenschaftskonstanz | |
| EP1341845A2 (de) | Thermoplastische formmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |