DD260493A5 - Verfahren zur herstellung von alkylsulfonylalkychlorbenzolen - Google Patents
Verfahren zur herstellung von alkylsulfonylalkychlorbenzolen Download PDFInfo
- Publication number
- DD260493A5 DD260493A5 DD87300941A DD30094187A DD260493A5 DD 260493 A5 DD260493 A5 DD 260493A5 DD 87300941 A DD87300941 A DD 87300941A DD 30094187 A DD30094187 A DD 30094187A DD 260493 A5 DD260493 A5 DD 260493A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- catalyst
- lower alkyl
- temperature
- alkychlorobenzene
- sulfuryl chloride
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 18
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical class O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 title 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- 229910001507 metal halide Inorganic materials 0.000 claims abstract description 3
- 150000005309 metal halides Chemical class 0.000 claims abstract description 3
- 239000003054 catalyst Substances 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- DAMJCWMGELCIMI-UHFFFAOYSA-N benzyl n-(2-oxopyrrolidin-3-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC1CCNC1=O DAMJCWMGELCIMI-UHFFFAOYSA-N 0.000 claims description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical group Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 3
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 2
- 150000007517 lewis acids Chemical group 0.000 claims description 2
- 239000011592 zinc chloride Substances 0.000 claims description 2
- 235000005074 zinc chloride Nutrition 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 239000012535 impurity Substances 0.000 abstract description 5
- 230000015572 biosynthetic process Effects 0.000 abstract description 3
- 239000000543 intermediate Substances 0.000 abstract description 3
- 239000000575 pesticide Substances 0.000 abstract description 2
- 238000003786 synthesis reaction Methods 0.000 abstract description 2
- 230000003197 catalytic effect Effects 0.000 abstract 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- YYDNBUBMBZRNQQ-UHFFFAOYSA-N 1-methyl-4-methylsulfonylbenzene Chemical compound CC1=CC=C(S(C)(=O)=O)C=C1 YYDNBUBMBZRNQQ-UHFFFAOYSA-N 0.000 description 3
- 239000012320 chlorinating reagent Substances 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- YHIYSPGAOWANSA-UHFFFAOYSA-N 2-chloro-1-methyl-4-methylsulfonylbenzene Chemical compound CC1=CC=C(S(C)(=O)=O)C=C1Cl YHIYSPGAOWANSA-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/842,693 US4675447A (en) | 1986-03-21 | 1986-03-21 | Method for preparation of alkylsulfonyl alkylchlorobenzenes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD260493A5 true DD260493A5 (de) | 1988-09-28 |
Family
ID=25288015
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD87300941A DD260493A5 (de) | 1986-03-21 | 1987-03-19 | Verfahren zur herstellung von alkylsulfonylalkychlorbenzolen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4675447A (cs) |
| CS (1) | CS186887A2 (cs) |
| DD (1) | DD260493A5 (cs) |
| HU (1) | HUT43036A (cs) |
| PL (1) | PL264722A1 (cs) |
| YU (1) | YU47287A (cs) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0639561A1 (de) * | 1993-08-17 | 1995-02-22 | Bayer Ag | Verfahren zur Herstellung von Alkyl-(3-chlorphenyl)-sulfonen |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3937282A1 (de) * | 1989-11-09 | 1991-05-16 | Hoechst Ag | Verfahren zur herstellung von alkyl-(3-chlorphenyl)-sulfonen |
| US5055605A (en) * | 1990-10-15 | 1991-10-08 | Imperial Chemical Industries Plc | Preparation of trisubstituted benzoic acid precursors |
| JPH0532612A (ja) * | 1990-10-19 | 1993-02-09 | Nissan Chem Ind Ltd | ４−アルキルスルホニル−２−クロロ−ｍ−キシレンの製法 |
| WO1992014700A1 (de) * | 1991-02-14 | 1992-09-03 | Hoechst Aktiengesellschaft | Verfahren zur herstellung von 4-alkylsulfonyl-1-alkyl-2-chlorbenzolen und derartige verbindungen |
| DE4311079A1 (de) * | 1993-04-03 | 1994-10-06 | Hoechst Ag | 4-Alkyl-3-chlor-benzolsulfinsäuren, 4-Alkyl-3-chlor-benzolsulfonylcarbonsäuren, 4-Alkyl-3-chlor-alkylsulfonylbenzole und Verfahren zu ihrer Herstellung |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB193200A (en) * | 1921-12-16 | 1923-02-22 | Boake Roberts & Co Ltd A | Improvements in and relating to the chlorination of organic compounds |
| US2302228A (en) * | 1940-04-02 | 1942-11-17 | Du Pont | Method of chlorination with sulphuryl chloride and production of monochloro-trimethyl acetic acid |
| US2777002A (en) * | 1953-04-27 | 1957-01-08 | Monsanto Chemicals | Para-halogenation of phenols |
| US3879472A (en) * | 1973-09-06 | 1975-04-22 | Du Pont | (Substituted dialkylphenyl) alkyl sulfides, sulfoxides and sulfones |
| US4345097A (en) * | 1980-01-21 | 1982-08-17 | Vertac Chemical Corporation | Chlorination of phenols and phenoxyacetic acids with sulfuryl chloride |
| US4386221A (en) * | 1981-10-28 | 1983-05-31 | Eastman Kodak Company | Process for the preparation of aryl alkyl sulfones and aryl vinyl sulfones |
-
1986
- 1986-03-21 US US06/842,693 patent/US4675447A/en not_active Expired - Lifetime
-
1987
- 1987-03-19 PL PL1987264722A patent/PL264722A1/xx unknown
- 1987-03-19 YU YU00472/87A patent/YU47287A/xx unknown
- 1987-03-19 CS CS871868A patent/CS186887A2/cs unknown
- 1987-03-19 DD DD87300941A patent/DD260493A5/de unknown
- 1987-03-20 HU HU871267A patent/HUT43036A/hu unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0639561A1 (de) * | 1993-08-17 | 1995-02-22 | Bayer Ag | Verfahren zur Herstellung von Alkyl-(3-chlorphenyl)-sulfonen |
Also Published As
| Publication number | Publication date |
|---|---|
| US4675447A (en) | 1987-06-23 |
| YU47287A (en) | 1988-04-30 |
| HUT43036A (en) | 1987-09-28 |
| CS186887A2 (en) | 1989-04-14 |
| PL264722A1 (en) | 1988-02-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0027189A1 (de) | Derivat des 2.5-Diketopiperazines, Verfahren zu seiner Herstellung und seine Verwendung | |
| DD260493A5 (de) | Verfahren zur herstellung von alkylsulfonylalkychlorbenzolen | |
| DE2630633C2 (cs) | ||
| EP0176026A1 (de) | Verfahren zur Herstellung von 2,4-Dichlor-5-fluor-benzoesäure | |
| EP0095637A2 (de) | Verfahren zur Herstellung von in alpha-Stellung chlorierten Stickstoff-Heterocyclen | |
| CH636103A5 (de) | Verfahren zum herstellen von auranofin. | |
| DE2352922A1 (de) | Verfahren zur herstellung von perchlormethylmercaptan | |
| DE3632464C2 (cs) | ||
| DE2624360A1 (de) | Verfahren zur herstellung von gegebenenfalls substituiertem 3-phenoxybenzaldehyd | |
| DE69118175T2 (de) | Neues disulfidderivat | |
| DE2636384C2 (de) | Verfahren zur Herstellung von N,N-Diethyl-2-(α-naphthoxy)-propionamid | |
| DE60000560T2 (de) | Verfahren zur Herstellung einer sehr sauberen Phenotiazin Verbindung | |
| DE4225763A1 (de) | Verfahren zur Herstellung von Halogenaromaten | |
| EP0036441B1 (de) | Verfahren zur Herstellung von Carbonsäurecyaniden | |
| DE69203856T2 (de) | Verfahren zur Herstellung von 1,3A,8-Trimethyl-1,2,3,3A,8,8A-HEXAHYDROPYROLO(2,3-B)INDOL-5(3AS,8AR)-HEPTYLCARBAMAT. | |
| DE3122261C2 (cs) | ||
| DE2231438B2 (de) | Verfahren zur Herstellung von 2-Alkyl-2-formyl-1,3-dithiacyclopentanen bzw. 1,3-dithiacyclohexanen | |
| DE69227890T2 (de) | Verfahren zur herstellung von 5-amino-3-methylpyrazol | |
| EP0073871B1 (de) | Verfahren zur Herstellung von N-substituierten N-Acetyl-2,6-dialkylanilinen | |
| EP0066806B1 (de) | Verfahren zur Herstellung von 4,7-Dichlor-3-hydroxythionaphthen | |
| EP0308740A1 (de) | Verfahren zur Herstellung von 2,4-Dichlor-5-dichlormethyl-thiazol | |
| DE3140634A1 (de) | Verfahren zur herstellung von kernfluorierten benzoylfluoriden | |
| AT372940B (de) | Verfahren zur herstellung von (d)-(-)-phydroxyphenylglycylchlorid-hydrochlorid | |
| EP0157225A1 (de) | Verfahren zur Herstellung von Benzimidazolyl,-Benzoxazolyl- und Benzthiazolyloxyphenoxypropionsäurederivaten | |
| AT258264B (de) | Verfahren zur Herstellung von 5-(3'-Methylaminopropyl)-5H-dibenzo[a,d] cyclohepten |