DD202150A5 - Neues verfahren zur herstellung von oxadiazolin-derivaten - Google Patents
Neues verfahren zur herstellung von oxadiazolin-derivaten Download PDFInfo
- Publication number
- DD202150A5 DD202150A5 DD82237117A DD23711782A DD202150A5 DD 202150 A5 DD202150 A5 DD 202150A5 DD 82237117 A DD82237117 A DD 82237117A DD 23711782 A DD23711782 A DD 23711782A DD 202150 A5 DD202150 A5 DD 202150A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- reactor
- reaction
- defined above
- general formula
- unit
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 35
- 238000004519 manufacturing process Methods 0.000 title description 3
- JKNSMBZZZFGYCB-UHFFFAOYSA-N 4,5-dihydrooxadiazole Chemical class C1CN=NO1 JKNSMBZZZFGYCB-UHFFFAOYSA-N 0.000 title 1
- 239000012948 isocyanate Substances 0.000 claims abstract description 19
- 150000002513 isocyanates Chemical class 0.000 claims abstract description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 15
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 150000002828 nitro derivatives Chemical class 0.000 claims abstract description 10
- 238000002360 preparation method Methods 0.000 claims abstract description 9
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims abstract description 8
- DTHHUAXKOMWYBI-UHFFFAOYSA-N oxadiazolidine Chemical class C1CONN1 DTHHUAXKOMWYBI-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000002443 hydroxylamines Chemical class 0.000 claims abstract description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 29
- 239000011541 reaction mixture Substances 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 23
- 101000588924 Anthopleura elegantissima Delta-actitoxin-Ael1a Proteins 0.000 claims description 17
- -1 alkyl chloroformate Chemical compound 0.000 claims description 16
- 239000000243 solution Substances 0.000 claims description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 9
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 5
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- 239000000741 silica gel Substances 0.000 claims description 5
- 229910002027 silica gel Inorganic materials 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 150000003672 ureas Chemical class 0.000 claims description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 238000002425 crystallisation Methods 0.000 claims description 4
- 230000008025 crystallization Effects 0.000 claims description 4
- 238000002955 isolation Methods 0.000 claims description 4
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 238000001914 filtration Methods 0.000 claims description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 210000000988 bone and bone Anatomy 0.000 claims description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 239000008262 pumice Substances 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims 2
- 241001122767 Theaceae Species 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 abstract description 2
- 230000002363 herbicidal effect Effects 0.000 abstract description 2
- 239000004009 herbicide Substances 0.000 abstract description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 40
- 238000006722 reduction reaction Methods 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 238000001816 cooling Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 150000001447 alkali salts Chemical class 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 229960001866 silicon dioxide Drugs 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 3
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CMVQZRLQEOAYSW-UHFFFAOYSA-N 1,2-dichloro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(Cl)=C1Cl CMVQZRLQEOAYSW-UHFFFAOYSA-N 0.000 description 2
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003905 agrochemical Substances 0.000 description 2
- 230000021235 carbamoylation Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- BLWJJPNXUDWVCG-UHFFFAOYSA-N 1,2,4-oxadiazolidine Chemical class C1NCON1 BLWJJPNXUDWVCG-UHFFFAOYSA-N 0.000 description 1
- SHCJTIUGKXHXGW-UHFFFAOYSA-N 2-methyl-1,2,4-oxadiazolidine-3,5-dione Chemical compound CN1OC(=O)NC1=O SHCJTIUGKXHXGW-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 206010067484 Adverse reaction Diseases 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CKRZKMFTZCFYGB-UHFFFAOYSA-N N-phenylhydroxylamine Chemical class ONC1=CC=CC=C1 CKRZKMFTZCFYGB-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 230000006838 adverse reaction Effects 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 1
- GAUZCKBSTZFWCT-UHFFFAOYSA-N azoxybenzene Chemical compound C=1C=CC=CC=1[N+]([O-])=NC1=CC=CC=C1 GAUZCKBSTZFWCT-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- SNVGDEMHOMCIMA-UHFFFAOYSA-N ethyl n-carbonochloridoyl-n-methylcarbamate Chemical compound CCOC(=O)N(C)C(Cl)=O SNVGDEMHOMCIMA-UHFFFAOYSA-N 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- AKSIQQBEDAZPLD-UHFFFAOYSA-N n-(3,4-dichlorophenyl)hydroxylamine Chemical compound ONC1=CC=C(Cl)C(Cl)=C1 AKSIQQBEDAZPLD-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- NLRKCXQQSUWLCH-UHFFFAOYSA-N nitrosobenzene Chemical compound O=NC1=CC=CC=C1 NLRKCXQQSUWLCH-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU20681 | 1981-01-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD202150A5 true DD202150A5 (de) | 1983-08-31 |
Family
ID=10948475
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD82237117A DD202150A5 (de) | 1981-01-30 | 1982-02-01 | Neues verfahren zur herstellung von oxadiazolin-derivaten |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS57183765A (ru) |
| BR (1) | BR8200516A (ru) |
| DD (1) | DD202150A5 (ru) |
| ES (1) | ES8304955A1 (ru) |
| GB (1) | GB2095660B (ru) |
| IT (1) | IT1155457B (ru) |
| SU (1) | SU1181542A3 (ru) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0740615B2 (ja) * | 1986-04-15 | 1995-05-01 | 日本電気株式会社 | パルスレ−ザ発振器 |
| US5803076A (en) * | 1996-04-15 | 1998-09-08 | Myers; Warren R. | Vacuum adherent face mask |
-
1982
- 1982-01-28 GB GB8202453A patent/GB2095660B/en not_active Expired
- 1982-01-28 IT IT67084/82A patent/IT1155457B/it active
- 1982-01-29 ES ES509991A patent/ES8304955A1/es not_active Expired
- 1982-01-29 BR BR8200516A patent/BR8200516A/pt unknown
- 1982-01-29 SU SU823381946A patent/SU1181542A3/ru active
- 1982-01-29 JP JP57011902A patent/JPS57183765A/ja active Pending
- 1982-02-01 DD DD82237117A patent/DD202150A5/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR8200516A (pt) | 1982-12-07 |
| SU1181542A3 (ru) | 1985-09-23 |
| JPS57183765A (en) | 1982-11-12 |
| GB2095660A (en) | 1982-10-06 |
| IT8267084A0 (it) | 1982-01-28 |
| GB2095660B (en) | 1985-02-20 |
| ES509991A0 (es) | 1983-04-16 |
| IT1155457B (it) | 1987-01-28 |
| ES8304955A1 (es) | 1983-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0201030A2 (de) | Verfahren zur Herstellung von 1,3,5-Triazintrionen | |
| CH646156A5 (de) | Schwefelhaltige benzimidazol-derivate und verfahren zu ihrer herstellung. | |
| EP0380712B1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| EP0508191B1 (de) | Verfahren zur Herstellung von 1-Carbamoyl-pyrazolen | |
| DD202150A5 (de) | Neues verfahren zur herstellung von oxadiazolin-derivaten | |
| EP0057871B1 (de) | Verfahren zur Herstellung von gegebenenfalls p-chlor-substituiertem 2,6-Diaminotoluol | |
| EP1173407B1 (de) | Verfahren zur nitrierung von anilinderivaten | |
| DE1770658A1 (de) | N-Hydroxi-benzimidazole,ihre Herstellung und Verwendung als Herbicide | |
| DE2701707C2 (de) | Chinoxalin-di-N-oxid-Derivate | |
| DE2932305C2 (ru) | ||
| EP0004529B1 (de) | Tantomere Arylaminoimidazolinderivate, deren Herstellung und sie enthaltende Arzneimittel zur Bekämpfung von Schmerzzuständen | |
| DE3921035A1 (de) | Verfahren zur herstellung von jodalkinylcarbamaten | |
| DE2440238C3 (de) | Verfahren zur Herstellung von organisch substituierter Hydrazine | |
| EP0027960B1 (de) | Verfahren zur Herstellung von 1,2,4-Triazol | |
| DE1161905B (de) | Verfahren zur Herstellung von neuen Kondensationsprodukten tetramerer Halogencyane | |
| EP0062853B1 (de) | Verfahren zur Herstellung von substituierten 3-Hydroxy-1,2,4-triazolen | |
| EP0355024B1 (de) | Verfahren zur Herstellung von cyclischen Harnstoffen | |
| DE3015834C2 (de) | Verfahren zur Herstellung von 5-Amino-1,2,3-thiadiazolen | |
| DE2527157C2 (de) | Verfahren zur Herstellung von 2-Formylchinoxalin-N↑1↑,N↑4↑-dioxyddimethylacetal | |
| EP0045371B1 (de) | Verfahren zur Herstellung von in 4-Stellung monosubstituierten 1,2,4-Triazolidin-3,5-dionen | |
| DE2206167C3 (de) | Herstellung von herbicid wirksamen 3-(Halogenphenyl)-1,1 -dialkylharnstoffen | |
| EP0110116B1 (de) | Verfahren zur Herstellung von Keten-O,N-acetalen | |
| DE2743610B2 (de) | Verfahren zur Herstellung von chlorsubstituierten aromatischen Aminen | |
| EP0156198B1 (de) | Verfahren zur Herstellung von Isocyanaten | |
| DE3716293A1 (de) | Verfahren zur herstellung von pyrazolen |