DD111388B1 - Verfahren zur strahlenchemischen halogenierung von trockenen polyvinylhalogeniden - Google Patents
Verfahren zur strahlenchemischen halogenierung von trockenen polyvinylhalogeniden Download PDFInfo
- Publication number
- DD111388B1 DD111388B1 DD17854474A DD17854474A DD111388B1 DD 111388 B1 DD111388 B1 DD 111388B1 DD 17854474 A DD17854474 A DD 17854474A DD 17854474 A DD17854474 A DD 17854474A DD 111388 B1 DD111388 B1 DD 111388B1
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- polymers
- halogenation
- radiation
- vinyl
- polyvinyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 15
- 239000000126 substance Substances 0.000 title claims description 8
- 230000005855 radiation Effects 0.000 title claims description 7
- 229920002554 vinyl polymer Polymers 0.000 title claims description 3
- 229920000642 polymer Polymers 0.000 claims description 36
- 230000026030 halogenation Effects 0.000 claims description 23
- 238000005658 halogenation reaction Methods 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 17
- 229920001291 polyvinyl halide Polymers 0.000 claims description 14
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 13
- 239000004800 polyvinyl chloride Substances 0.000 claims description 12
- 238000005660 chlorination reaction Methods 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- -1 polyethylene Polymers 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000000843 powder Substances 0.000 claims description 7
- 229920001577 copolymer Polymers 0.000 claims description 6
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 5
- 229920000515 polycarbonate Polymers 0.000 claims description 5
- 239000004417 polycarbonate Substances 0.000 claims description 5
- 230000035484 reaction time Effects 0.000 claims description 5
- 238000003682 fluorination reaction Methods 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 3
- 239000004743 Polypropylene Substances 0.000 claims description 3
- 239000004793 Polystyrene Substances 0.000 claims description 3
- 230000032683 aging Effects 0.000 claims description 3
- 239000004014 plasticizer Substances 0.000 claims description 3
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims description 3
- 229920000573 polyethylene Polymers 0.000 claims description 3
- 229920000098 polyolefin Polymers 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 239000012495 reaction gas Substances 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- 238000010521 absorption reaction Methods 0.000 claims description 2
- 230000015556 catabolic process Effects 0.000 claims description 2
- 238000006731 degradation reaction Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 claims 4
- 238000004132 cross linking Methods 0.000 claims 2
- 229920000578 graft copolymer Polymers 0.000 claims 2
- 229920001083 polybutene Polymers 0.000 claims 2
- 230000002411 adverse Effects 0.000 claims 1
- 238000001311 chemical methods and process Methods 0.000 claims 1
- 230000018109 developmental process Effects 0.000 claims 1
- 238000001035 drying Methods 0.000 claims 1
- 150000008282 halocarbons Chemical class 0.000 claims 1
- 230000000977 initiatory effect Effects 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 229920002521 macromolecule Polymers 0.000 claims 1
- 238000011084 recovery Methods 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 239000000375 suspending agent Substances 0.000 claims 1
- 229920001169 thermoplastic Polymers 0.000 claims 1
- 239000004416 thermosoftening plastic Substances 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 12
- 229910052801 chlorine Inorganic materials 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 239000004801 Chlorinated PVC Substances 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229920002959 polymer blend Polymers 0.000 description 3
- 238000005096 rolling process Methods 0.000 description 3
- 238000010557 suspension polymerization reaction Methods 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- 238000012662 bulk polymerization Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000004438 BET method Methods 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- RGWMBYHTBXZOTN-UHFFFAOYSA-J barium(2+);cadmium(2+);octadecanoate Chemical compound [Cd+2].[Ba+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O RGWMBYHTBXZOTN-UHFFFAOYSA-J 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 238000012673 precipitation polymerization Methods 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical group [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003260 vortexing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Landscapes
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD17854474A DD111388B1 (de) | 1974-05-16 | 1974-05-16 | Verfahren zur strahlenchemischen halogenierung von trockenen polyvinylhalogeniden |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD17854474A DD111388B1 (de) | 1974-05-16 | 1974-05-16 | Verfahren zur strahlenchemischen halogenierung von trockenen polyvinylhalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DD111388A1 DD111388A1 (enExample) | 1975-02-12 |
| DD111388B1 true DD111388B1 (de) | 1989-05-24 |
Family
ID=5495780
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD17854474A DD111388B1 (de) | 1974-05-16 | 1974-05-16 | Verfahren zur strahlenchemischen halogenierung von trockenen polyvinylhalogeniden |
Country Status (1)
| Country | Link |
|---|---|
| DD (1) | DD111388B1 (enExample) |
-
1974
- 1974-05-16 DD DD17854474A patent/DD111388B1/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD111388A1 (enExample) | 1975-02-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2236456C3 (de) | Verfahren zum Herstellen eines gemischten Polymerisats | |
| EP0139931A2 (en) | Process for neutralizing halogens and acids released in the processing of polymers | |
| DE2200757A1 (de) | Peroxydzusammensetzungen und Verfahren zu ihrer Herstellung | |
| DE1729513C3 (de) | Verfahren zur Herstellung von trockenen, teilchenförmigen Polymerisaten oder Mischpolymerisaten des Vinylchlorids | |
| DE69028704T2 (de) | Flammhemmende polymerzusammensetzungen | |
| DE2650548C3 (de) | Verfahren zur Herstellung von Schaumstoffen aus chlorierten Vinylchloridpolymeren | |
| EP0111761B1 (de) | Chlorpolyethylen, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE2222640A1 (de) | Verfahren zur Herstellung von chlorierten polymeren Materialien | |
| DD111388B1 (de) | Verfahren zur strahlenchemischen halogenierung von trockenen polyvinylhalogeniden | |
| DE3540280A1 (de) | Verfahren zur umwandlung von fluorhaltigen hochpolymeren in polymere mit niedrigerem molekulargewicht | |
| EP0915931A1 (de) | Verfahren zur herstellung von porösen polymerkugeln | |
| DE1932589B2 (de) | Verfahren zum chlorieren von pulverfoermigen polyvinylchloridpolymerisaten | |
| DE2623503A1 (de) | Verfahren zur pfropfung von vinylchlorid auf aethylen-vinylacetat- bzw. -alkylacrylat-copolymerisate | |
| DE1070826B (de) | Verfahren zur Halogenierung von Polymerisaten olefinisch ungesättigter Kohlenwasserstoffe | |
| DE3505886A1 (de) | Verfestigung eines radioaktiven abfall-loesungsmittels | |
| JP3174598B2 (ja) | 塩化ビニル系樹脂組成物の製造方法 | |
| DD242416A1 (de) | Verfahren zur trockenchlorierung von vinylchlorid-polymerisaten | |
| DE2238556A1 (de) | Polymerisatmischung | |
| DE10132836A1 (de) | Verwendung von Aminouracilen zur Stabilisierung von antistatisch ausgerüsteten halogenhaltigen organischen Kunststoffen | |
| DE1061074B (de) | Verfahren zur Chlorierung von Polyolefinen | |
| DE1669998C3 (de) | Selbstlöschende Äthylenmischpolymerisatschäume | |
| DE1745083A1 (de) | Verfahren zur Halogenierung von Vinylpolymeren | |
| DE1770672A1 (de) | Verfahren zur Erzeugung von Homopolymerisaten des Vinylidenfluorids oder von Mischpolymerisaten desselben mit anderen polymerisationsfaehigen Verbindungen | |
| DD155821A1 (de) | Verfahren zur strahlenchemischen chlorierung von vinylchloridpolymeren | |
| DE1469849C (de) | Thermoplastische Massen |