CS258493B2 - Method of diphosphonic acids' derivatives production - Google Patents
Method of diphosphonic acids' derivatives production Download PDFInfo
- Publication number
- CS258493B2 CS258493B2 CS868154A CS815486A CS258493B2 CS 258493 B2 CS258493 B2 CS 258493B2 CS 868154 A CS868154 A CS 868154A CS 815486 A CS815486 A CS 815486A CS 258493 B2 CS258493 B2 CS 258493B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- acid
- yield
- group
- diphosphonic
- hydrogen atom
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 12
- 239000002253 acid Substances 0.000 title claims description 11
- 150000007513 acids Chemical class 0.000 title claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 125000002252 acyl group Chemical group 0.000 claims abstract description 3
- 125000003277 amino group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 21
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 16
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 1
- -1 Y is a valency bond Chemical group 0.000 abstract description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 3
- 238000002360 preparation method Methods 0.000 abstract description 2
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 208000022458 calcium metabolism disease Diseases 0.000 abstract 1
- XQRLCLUYWUNEEH-UHFFFAOYSA-L diphosphonate(2-) Chemical class [O-]P(=O)OP([O-])=O XQRLCLUYWUNEEH-UHFFFAOYSA-L 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000000047 product Substances 0.000 description 27
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- 239000003054 catalyst Substances 0.000 description 14
- 229910052697 platinum Inorganic materials 0.000 description 13
- 238000000354 decomposition reaction Methods 0.000 description 12
- 238000005984 hydrogenation reaction Methods 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 5
- 238000005342 ion exchange Methods 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 150000004682 monohydrates Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- BZFFVCNZMXNODA-UHFFFAOYSA-N 2-(3-aminocyclohexyl)acetic acid Chemical compound NC1CCCC(CC(O)=O)C1 BZFFVCNZMXNODA-UHFFFAOYSA-N 0.000 description 3
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 210000000988 bone and bone Anatomy 0.000 description 3
- 229920001429 chelating resin Polymers 0.000 description 3
- 239000008139 complexing agent Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001962 electrophoresis Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- CSEWAUGPAQPMDC-UHFFFAOYSA-N 2-(4-aminophenyl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)C=C1 CSEWAUGPAQPMDC-UHFFFAOYSA-N 0.000 description 2
- BBQDLDVSEDAYAA-AATRIKPKSA-N 2-nitrocinnamic acid Chemical compound OC(=O)\C=C\C1=CC=CC=C1[N+]([O-])=O BBQDLDVSEDAYAA-AATRIKPKSA-N 0.000 description 2
- XZTZPFMLEDLZLP-UHFFFAOYSA-N 3-(2-acetamidocyclohexyl)propanoic acid Chemical compound CC(=O)NC1CCCCC1CCC(O)=O XZTZPFMLEDLZLP-UHFFFAOYSA-N 0.000 description 2
- HFTGWHYUKOUNOV-UHFFFAOYSA-N 4-(2-aminoethyl)cyclohexane-1-carboxylic acid Chemical compound NCCC1CCC(C(O)=O)CC1 HFTGWHYUKOUNOV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 208000010191 Osteitis Deformans Diseases 0.000 description 2
- 208000027868 Paget disease Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- MHQBSYCLGRWLGX-UHFFFAOYSA-N [3-(2-acetamidocyclohexyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound CC(=O)NC1CCCCC1CCC(O)(P(O)(O)=O)P(O)(O)=O MHQBSYCLGRWLGX-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 208000027202 mammary Paget disease Diseases 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 201000008482 osteoarthritis Diseases 0.000 description 2
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- POTIYWUALSJREP-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical compound N1CCCC2CCCCC21 POTIYWUALSJREP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZWXDAANEJMSCEX-UHFFFAOYSA-N 1-(3-anilinophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(NC=2C=CC=CC=2)=C1 ZWXDAANEJMSCEX-UHFFFAOYSA-N 0.000 description 1
- APGGSERFJKEWFG-UHFFFAOYSA-N 1-(chloromethyl)-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(CCl)=C1 APGGSERFJKEWFG-UHFFFAOYSA-N 0.000 description 1
- IVFGIXMLURJXBZ-UHFFFAOYSA-N 1-phosphonopropylphosphonic acid Chemical compound CCC(P(O)(O)=O)P(O)(O)=O IVFGIXMLURJXBZ-UHFFFAOYSA-N 0.000 description 1
- XUSKZLBLGHBCLD-UHFFFAOYSA-N 2-(3-aminophenyl)acetic acid Chemical compound NC1=CC=CC(CC(O)=O)=C1 XUSKZLBLGHBCLD-UHFFFAOYSA-N 0.000 description 1
- OJUYMNBOHOCPDY-UHFFFAOYSA-N 2-(4-aminocyclohexyl)propanoic acid Chemical compound OC(=O)C(C)C1CCC(N)CC1 OJUYMNBOHOCPDY-UHFFFAOYSA-N 0.000 description 1
- XVDSFSRMHSDHGJ-UHFFFAOYSA-N 2-(4-azaniumylcyclohexyl)acetate Chemical compound NC1CCC(CC(O)=O)CC1 XVDSFSRMHSDHGJ-UHFFFAOYSA-N 0.000 description 1
- WEBXRQONNWEETE-UHFFFAOYSA-N 2-(4-cyanophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(C#N)C=C1 WEBXRQONNWEETE-UHFFFAOYSA-N 0.000 description 1
- VMTBKRPFIUIKPK-UHFFFAOYSA-N 2-[2-(aminomethyl)cyclohexyl]acetic acid Chemical compound NCC1CCCCC1CC(O)=O VMTBKRPFIUIKPK-UHFFFAOYSA-N 0.000 description 1
- VLOIVYPDUSVCLZ-UHFFFAOYSA-N 2-[2-(azaniumylmethyl)phenyl]acetate Chemical compound NCC1=CC=CC=C1CC(O)=O VLOIVYPDUSVCLZ-UHFFFAOYSA-N 0.000 description 1
- MESNBSCCFMELNF-UHFFFAOYSA-N 2-[3-(aminomethyl)cyclohexyl]acetic acid Chemical compound NCC1CCCC(CC(O)=O)C1 MESNBSCCFMELNF-UHFFFAOYSA-N 0.000 description 1
- OILYAPVNRYNPRT-UHFFFAOYSA-N 2-[4-(aminomethyl)cyclohexyl]acetic acid Chemical compound NCC1CCC(CC(O)=O)CC1 OILYAPVNRYNPRT-UHFFFAOYSA-N 0.000 description 1
- SCJHPUGWYHCYAZ-UHFFFAOYSA-N 3,5-diethyl-2-propylpyridine Chemical compound CCCC1=NC=C(CC)C=C1CC SCJHPUGWYHCYAZ-UHFFFAOYSA-N 0.000 description 1
- VKNHHWZFHYIZSU-UHFFFAOYSA-N 3-(2-acetamido-3-methylphenyl)propanoic acid Chemical compound CC(=O)NC1=C(C)C=CC=C1CCC(O)=O VKNHHWZFHYIZSU-UHFFFAOYSA-N 0.000 description 1
- ANVZQEASRUZEQM-UHFFFAOYSA-N 3-(2-acetamidophenyl)prop-2-enoic acid Chemical compound CC(=O)NC1=CC=CC=C1C=CC(O)=O ANVZQEASRUZEQM-UHFFFAOYSA-N 0.000 description 1
- DSRBFCLILYNHOL-UHFFFAOYSA-N 3-(2-aminocyclopentyl)propanoic acid;hydrochloride Chemical compound Cl.NC1CCCC1CCC(O)=O DSRBFCLILYNHOL-UHFFFAOYSA-N 0.000 description 1
- LAOMDZFORKFNPV-UHFFFAOYSA-N 3-(2-aminophenyl)propanoic acid Chemical compound NC1=CC=CC=C1CCC(O)=O LAOMDZFORKFNPV-UHFFFAOYSA-N 0.000 description 1
- SBHFVSXLYOBZKD-UHFFFAOYSA-N 3-(3-aminophenyl)propanoic acid Chemical compound NC1=CC=CC(CCC(O)=O)=C1 SBHFVSXLYOBZKD-UHFFFAOYSA-N 0.000 description 1
- HSZWZTVUABCVCQ-UHFFFAOYSA-N 3-(3-azaniumylcyclohexyl)propanoate Chemical compound NC1CCCC(CCC(O)=O)C1 HSZWZTVUABCVCQ-UHFFFAOYSA-N 0.000 description 1
- XBZCHMBWCIQQOX-UHFFFAOYSA-N 3-(3-methyl-2-nitrophenyl)prop-2-enoic acid Chemical compound CC1=CC=CC(C=CC(O)=O)=C1[N+]([O-])=O XBZCHMBWCIQQOX-UHFFFAOYSA-N 0.000 description 1
- LYRQHZCLXXBANV-UHFFFAOYSA-N 3-(aminomethyl)cyclohexane-1-carboxylic acid Chemical compound NCC1CCCC(C(O)=O)C1 LYRQHZCLXXBANV-UHFFFAOYSA-N 0.000 description 1
- GSWYUZQBLVUEPH-UHFFFAOYSA-N 3-(azaniumylmethyl)benzoate Chemical compound NCC1=CC=CC(C(O)=O)=C1 GSWYUZQBLVUEPH-UHFFFAOYSA-N 0.000 description 1
- MONBJNZNUKSTOE-KZYPOYLOSA-N 3-[(1s,2r)-2-aminocyclohexyl]propanoic acid;hydrochloride Chemical compound Cl.N[C@@H]1CCCC[C@H]1CCC(O)=O MONBJNZNUKSTOE-KZYPOYLOSA-N 0.000 description 1
- ZMYACGUVFRGOBG-UHFFFAOYSA-N 3-[2-(dimethylamino)cyclohexyl]propanoic acid Chemical compound CN(C)C1CCCCC1CCC(O)=O ZMYACGUVFRGOBG-UHFFFAOYSA-N 0.000 description 1
- PKBMLTLHQCUFOM-UHFFFAOYSA-N 3-[2-(dimethylamino)phenyl]propanoic acid Chemical compound CN(C)C1=CC=CC=C1CCC(O)=O PKBMLTLHQCUFOM-UHFFFAOYSA-N 0.000 description 1
- XFDUHJPVQKIXHO-UHFFFAOYSA-N 3-aminobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1 XFDUHJPVQKIXHO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- GYLKKXHEIIFTJH-UHFFFAOYSA-N 3-cyanobenzoic acid Chemical compound OC(=O)C1=CC=CC(C#N)=C1 GYLKKXHEIIFTJH-UHFFFAOYSA-N 0.000 description 1
- HAGUMWGXABFJMN-UHFFFAOYSA-N 3-methyl-2-nitrobenzaldehyde Chemical compound CC1=CC=CC(C=O)=C1[N+]([O-])=O HAGUMWGXABFJMN-UHFFFAOYSA-N 0.000 description 1
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 1
- CWNPOQFCIIFQDM-UHFFFAOYSA-N 3-nitrobenzyl alcohol Chemical compound OCC1=CC=CC([N+]([O-])=O)=C1 CWNPOQFCIIFQDM-UHFFFAOYSA-N 0.000 description 1
- WWXMVRYHLZMQIG-SNAWJCMRSA-N 3-nitrocinnamic acid Chemical compound OC(=O)\C=C\C1=CC=CC([N+]([O-])=O)=C1 WWXMVRYHLZMQIG-SNAWJCMRSA-N 0.000 description 1
- QCJPGIFKFKZXAQ-UHFFFAOYSA-N 4-(3-fluoroazetidin-1-yl)piperidine Chemical compound C1C(F)CN1C1CCNCC1 QCJPGIFKFKZXAQ-UHFFFAOYSA-N 0.000 description 1
- CQQSQBRPAJSTFB-UHFFFAOYSA-N 4-(bromomethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(CBr)C=C1 CQQSQBRPAJSTFB-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- DRNGLYHKYPNTEA-UHFFFAOYSA-N 4-azaniumylcyclohexane-1-carboxylate Chemical compound NC1CCC(C(O)=O)CC1 DRNGLYHKYPNTEA-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002556 Ankylosing Spondylitis Diseases 0.000 description 1
- 208000006386 Bone Resorption Diseases 0.000 description 1
- 206010007027 Calculus urinary Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RIVAPBNCTYUTPU-UHFFFAOYSA-N Cl.OC(=O)CCC1(N)CCCCC1 Chemical compound Cl.OC(=O)CCC1(N)CCCCC1 RIVAPBNCTYUTPU-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000034970 Heterotopic Ossification Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 206010027452 Metastases to bone Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XZXSEOWALBCZML-MEZFUOHNSA-M NC[C@H](CC1)CC[C@@H]1C(O)(P([O-])(O)=O)P(O)(O)=O.[Na+] Chemical compound NC[C@H](CC1)CC[C@@H]1C(O)(P([O-])(O)=O)P(O)(O)=O.[Na+] XZXSEOWALBCZML-MEZFUOHNSA-M 0.000 description 1
- 208000001132 Osteoporosis Diseases 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- GYDJEQRTZSCIOI-UHFFFAOYSA-N Tranexamic acid Chemical compound NCC1CCC(C(O)=O)CC1 GYDJEQRTZSCIOI-UHFFFAOYSA-N 0.000 description 1
- TWAJKNCHFANWLK-UHFFFAOYSA-N [2-(2-aminocyclohexyl)-1-hydroxy-1-phosphonoethyl]phosphonic acid Chemical compound NC1CCCCC1CC(O)(P(O)(O)=O)P(O)(O)=O TWAJKNCHFANWLK-UHFFFAOYSA-N 0.000 description 1
- WUNZLCRDVSFVTQ-UHFFFAOYSA-N [2-(3-amino-2-bicyclo[2.2.1]heptanyl)-1-hydroxy-1-phosphonoethyl]phosphonic acid Chemical compound C1CC2C(N)C(CC(O)(P(O)(O)=O)P(O)(O)=O)C1C2 WUNZLCRDVSFVTQ-UHFFFAOYSA-N 0.000 description 1
- PRUKWZBUQSWFHD-UHFFFAOYSA-N [2-(3-aminocyclohexyl)-1-hydroxy-1-phosphonoethyl]phosphonic acid Chemical compound NC1CCCC(CC(O)(P(O)(O)=O)P(O)(O)=O)C1 PRUKWZBUQSWFHD-UHFFFAOYSA-N 0.000 description 1
- LBCJZPMKVGASNI-UHFFFAOYSA-N [2-(4-acetamidocyclohexyl)-1-hydroxy-1-phosphonoethyl]phosphonic acid Chemical compound CC(=O)NC1CCC(CC(O)(P(O)(O)=O)P(O)(O)=O)CC1 LBCJZPMKVGASNI-UHFFFAOYSA-N 0.000 description 1
- LFFPZMGNONJABC-UHFFFAOYSA-N [2-(4-aminocyclohexyl)-1-hydroxy-1-phosphonoethyl]phosphonic acid Chemical compound NC1CCC(CC(O)(P(O)(O)=O)P(O)(O)=O)CC1 LFFPZMGNONJABC-UHFFFAOYSA-N 0.000 description 1
- MVTVQHDYEFGJAW-UHFFFAOYSA-N [2-[2-(aminomethyl)cyclohexyl]-1-hydroxy-1-phosphonoethyl]phosphonic acid Chemical compound NCC1CCCCC1CC(O)(P(O)(O)=O)P(O)(O)=O MVTVQHDYEFGJAW-UHFFFAOYSA-N 0.000 description 1
- JFTWZPZFQTYXCR-UHFFFAOYSA-N [2-[4-(aminomethyl)cyclohexyl]-1-hydroxy-1-phosphonoethyl]phosphonic acid Chemical compound NCC1CCC(CC(O)(P(O)(O)=O)P(O)(O)=O)CC1 JFTWZPZFQTYXCR-UHFFFAOYSA-N 0.000 description 1
- HGYQRPPKBRWERE-UHFFFAOYSA-N [3-(1-aminocycloheptyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound OP(=O)(O)C(O)(P(O)(O)=O)CCC1(N)CCCCCC1 HGYQRPPKBRWERE-UHFFFAOYSA-N 0.000 description 1
- LEBXQIXJQSBROB-UHFFFAOYSA-N [3-(1-aminocyclopentyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound OP(=O)(O)C(O)(P(O)(O)=O)CCC1(N)CCCC1 LEBXQIXJQSBROB-UHFFFAOYSA-N 0.000 description 1
- JLEZKKRBQLQEKZ-UHFFFAOYSA-N [3-(2-amino-3-methylcyclohexyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound CC1CCCC(CCC(O)(P(O)(O)=O)P(O)(O)=O)C1N JLEZKKRBQLQEKZ-UHFFFAOYSA-N 0.000 description 1
- SYUKTIBBXPDKPD-UHFFFAOYSA-N [3-(2-amino-3-methylphenyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound CC1=CC=CC(CCC(O)(P(O)(O)=O)P(O)(O)=O)=C1N SYUKTIBBXPDKPD-UHFFFAOYSA-N 0.000 description 1
- VDLNLFNQSIKMFR-UHFFFAOYSA-N [3-(2-aminocycloheptyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound NC1CCCCCC1CCC(O)(P(O)(O)=O)P(O)(O)=O VDLNLFNQSIKMFR-UHFFFAOYSA-N 0.000 description 1
- YQCBUDQWQHHTEB-UHFFFAOYSA-N [3-(2-aminocyclohexyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound NC1CCCCC1CCC(O)(P(O)(O)=O)P(O)(O)=O YQCBUDQWQHHTEB-UHFFFAOYSA-N 0.000 description 1
- PPAYLPFSVCYSPF-UHFFFAOYSA-N [3-(2-aminocyclohexyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid trihydrate Chemical compound O.O.O.NC1CCCCC1CCC(O)(P(O)(O)=O)P(O)(O)=O.NC1CCCCC1CCC(O)(P(O)(O)=O)P(O)(O)=O PPAYLPFSVCYSPF-UHFFFAOYSA-N 0.000 description 1
- QIVIEHXLPOMUCC-UHFFFAOYSA-N [3-(2-aminocyclopentyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound NC1CCCC1CCC(O)(P(O)(O)=O)P(O)(O)=O QIVIEHXLPOMUCC-UHFFFAOYSA-N 0.000 description 1
- UXVHURONHIWNHQ-UHFFFAOYSA-N [3-(3-amino-2-bicyclo[2.2.1]heptanyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound C1CC2C(N)C(CCC(O)(P(O)(O)=O)P(O)(O)=O)C1C2 UXVHURONHIWNHQ-UHFFFAOYSA-N 0.000 description 1
- ODIDQLPWBUNBML-UHFFFAOYSA-N [3-(3-amino-2-bicyclo[2.2.2]octanyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound C1CC2C(N)C(CCC(O)(P(O)(O)=O)P(O)(O)=O)C1CC2 ODIDQLPWBUNBML-UHFFFAOYSA-N 0.000 description 1
- RQDRIBOXOIDAFV-UHFFFAOYSA-N [3-(3-aminocyclohexyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound NC1CCCC(CCC(O)(P(O)(O)=O)P(O)(O)=O)C1 RQDRIBOXOIDAFV-UHFFFAOYSA-N 0.000 description 1
- WCLKMWKDZMQQPY-UHFFFAOYSA-N [3-(4-aminocyclohexyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound NC1CCC(CCC(O)(P(O)(O)=O)P(O)(O)=O)CC1 WCLKMWKDZMQQPY-UHFFFAOYSA-N 0.000 description 1
- YQCBUDQWQHHTEB-JGVFFNPUSA-N [3-[(1s,2r)-2-aminocyclohexyl]-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound N[C@@H]1CCCC[C@H]1CCC(O)(P(O)(O)=O)P(O)(O)=O YQCBUDQWQHHTEB-JGVFFNPUSA-N 0.000 description 1
- FSJKCJMNDLLJFG-UHFFFAOYSA-N [3-[2-(dimethylamino)cyclohexyl]-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound CN(C)C1CCCCC1CCC(O)(P(O)(O)=O)P(O)(O)=O FSJKCJMNDLLJFG-UHFFFAOYSA-N 0.000 description 1
- AWDQSOUPDXNZLY-UHFFFAOYSA-N [3-amino-3-(2-aminocyclohexyl)-1-hydroxy-1-phosphonopropyl]phosphonic acid Chemical compound OP(=O)(O)C(O)(P(O)(O)=O)CC(N)C1CCCCC1N AWDQSOUPDXNZLY-UHFFFAOYSA-N 0.000 description 1
- UEMUHTQQRCZBRS-UHFFFAOYSA-N [4-(carboxymethyl)cyclohexyl]azanium;chloride Chemical compound Cl.NC1CCC(CC(O)=O)CC1 UEMUHTQQRCZBRS-UHFFFAOYSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- KOAXBCQGRLVISA-UHFFFAOYSA-N [[2-(aminomethyl)cyclohexyl]-hydroxy-phosphonomethyl]phosphonic acid Chemical compound NCC1CCCCC1C(O)(P(O)(O)=O)P(O)(O)=O KOAXBCQGRLVISA-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000024279 bone resorption Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 230000003913 calcium metabolism Effects 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- HXCKCCRKGXHOBK-UHFFFAOYSA-N cycloheptane Chemical compound [CH]1CCCCCC1 HXCKCCRKGXHOBK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000003412 degenerative effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000007941 heterotopic ossification Effects 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- UJLFLOAXKVGYIA-UHFFFAOYSA-N indan-2-one oxime Chemical compound C1=CC=C2CC(=NO)CC2=C1 UJLFLOAXKVGYIA-UHFFFAOYSA-N 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000004255 ion exchange chromatography Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003951 lactams Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- XRZGMNGGCZTNGE-UHFFFAOYSA-N methyl 4-(cyanomethyl)benzoate Chemical compound COC(=O)C1=CC=C(CC#N)C=C1 XRZGMNGGCZTNGE-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- ZAJNGDIORYACQU-UHFFFAOYSA-N methyl n-octyl ketone Natural products CCCCCCCCC(C)=O ZAJNGDIORYACQU-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical group [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000002271 resection Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- BWAUQTFFVCLSOS-UHFFFAOYSA-N sodiosodium hydrate Chemical compound O.[Na].[Na] BWAUQTFFVCLSOS-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 208000008281 urolithiasis Diseases 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4025—Esters of poly(thio)phosphonic acids
- C07F9/405—Esters of poly(thio)phosphonic acids containing nitrogen substituent, e.g. N.....H or N-hydrocarbon group which can be substituted by halogen or nitro(so), N.....O, N.....S, N.....C(=X)- (X =O, S), N.....N, N...C(=X)...N (X =O, S)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/02—Nutrients, e.g. vitamins, minerals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/12—Drugs for disorders of the metabolism for electrolyte homeostasis
- A61P3/14—Drugs for disorders of the metabolism for electrolyte homeostasis for calcium homeostasis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3839—Polyphosphonic acids
- C07F9/3873—Polyphosphonic acids containing nitrogen substituent, e.g. N.....H or N-hydrocarbon group which can be substituted by halogen or nitro(so), N.....O, N.....S, N.....C(=X)- (X =O, S), N.....N, N...C(=X)...N (X =O, S)
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Obesity (AREA)
- Veterinary Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Nutrition Science (AREA)
- Endocrinology (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853540150 DE3540150A1 (de) | 1985-11-13 | 1985-11-13 | Neue diphosphonsaeurederivate, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS815486A2 CS815486A2 (en) | 1987-12-17 |
| CS258493B2 true CS258493B2 (en) | 1988-08-16 |
Family
ID=6285806
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS868154A CS258493B2 (en) | 1985-11-13 | 1986-11-11 | Method of diphosphonic acids' derivatives production |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4719203A (fi) |
| EP (1) | EP0224751B1 (fi) |
| JP (1) | JPS62114994A (fi) |
| AT (1) | ATE49766T1 (fi) |
| AU (1) | AU584759B2 (fi) |
| CA (1) | CA1289569C (fi) |
| CS (1) | CS258493B2 (fi) |
| DD (1) | DD255163A5 (fi) |
| DE (2) | DE3540150A1 (fi) |
| DK (1) | DK538686A (fi) |
| ES (1) | ES2014220B3 (fi) |
| FI (1) | FI864614A (fi) |
| HU (1) | HU195829B (fi) |
| IL (1) | IL80570A0 (fi) |
| ZA (1) | ZA868514B (fi) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL77243A (en) * | 1984-12-21 | 1996-11-14 | Procter & Gamble | Pharmaceutical compositions containing geminal diphosphonic acid compounds and certain such novel compounds |
| DE3770982D1 (de) * | 1986-04-24 | 1991-08-01 | Fujisawa Pharmaceutical Co | Diphosphonsaeure-verbindungen, verfahren zu deren herstellung und sie enthaltende arzneimittel. |
| DE3623397A1 (de) * | 1986-07-11 | 1988-01-14 | Boehringer Mannheim Gmbh | Neue diphosphonsaeurederivate, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel |
| ATE64397T1 (de) * | 1986-11-21 | 1991-06-15 | Ciba Geigy Ag | Aromatisch substituierte azacycloalkylalkandiphosphons|uren. |
| US4868164A (en) * | 1986-12-19 | 1989-09-19 | Norwich Eaton Pharmaceuticals, Inc. | Octahydro-pyridine diphosphonate compounds, pharmaceutical compositions, and methods for treating abnormal calcium and phosphate metabolism |
| US5071840A (en) * | 1986-12-19 | 1991-12-10 | Norwich Eaton Pharmaceuticals, Inc. | Certain heterocyclic substituted diphosphonate compounds pharmaceutical compositions, and methods of treating abnormal calcium and phosphate metabolism |
| US4963681A (en) * | 1987-07-06 | 1990-10-16 | Norwich Eaton Pharmaceuticals, Inc. | Process for synthesis of aminomethylene phosphonoalkylphosphinates |
| IL86951A (en) * | 1987-07-06 | 1996-07-23 | Procter & Gamble Pharma | Methylene phosphonoalkylphosphinates and pharmaceutical preparations containing them |
| US5190930A (en) * | 1987-12-11 | 1993-03-02 | Ciba-Geigy Corporation | Araliphatylaminoalkanediphosphonic acids |
| US5110807A (en) * | 1988-12-01 | 1992-05-05 | Ciba-Geigy Corporation | Araliphatylaminoalkanediphosphonic acids |
| CA1339805C (en) * | 1988-01-20 | 1998-04-07 | Yasuo Isomura | (cycloalkylamino)methylenebis(phosphonic acid) and medicines containing the same as an active |
| TW198039B (fi) * | 1988-11-28 | 1993-01-11 | Ciba Geigy Ag | |
| US5227506A (en) * | 1989-09-06 | 1993-07-13 | Merck & Co., Inc. | Acyloxymethyl esters of bisphosphonic acids as bone resorption inhibitors |
| IE912115A1 (en) * | 1990-06-25 | 1992-01-01 | Takeda Chemical Industries Ltd | Bisphosphonic acid derivatives, their production and use |
| DE69108733T2 (de) * | 1990-08-21 | 1995-09-14 | Upjohn Co | Bisphosphonsäurederivate als antiarthritische mittel. |
| CA2058012A1 (en) * | 1990-12-19 | 1992-06-20 | Takashi Sohda | Bisphosphonic acid derivatives, their production and use |
| EP0541037A3 (en) * | 1991-11-06 | 1997-02-26 | Takeda Chemical Industries Ltd | Squalene synthetase inhibitory composition and use thereof |
| KR100192215B1 (ko) * | 1996-09-03 | 1999-06-15 | 강재헌 | 3-아미노-1-히드록시프로판-1,1-디포스폰산의 제조방법 |
| US6677320B2 (en) | 2000-01-20 | 2004-01-13 | Hoffmann-La Roches Inc. | Parenteral bisphosphonate composition with improved local tolerance |
| PE20011061A1 (es) | 2000-02-01 | 2001-11-20 | Procter & Gamble | Cristalizacion selectiva del acido 3-piridil-1-hidroxi-etiliden-1,1-bisfosfonico sodio como el hemipentahidrato o el monohidrato |
| PE20011065A1 (es) | 2000-02-01 | 2001-11-21 | Procter & Gamble | Proceso para fabricar bisfosfonatos geminales |
| EP1284754B1 (en) | 2000-05-05 | 2006-01-04 | F. Hoffmann-La Roche Ag | Gel-like pharmaceutical composition for subcutaneous administration comprising bisphosphonic acids or their salts |
| KR100638122B1 (ko) * | 2001-12-21 | 2006-10-24 | 더 프록터 앤드 갬블 캄파니 | 골 장애의 치료 방법 |
| PT1506041E (pt) * | 2002-05-10 | 2007-12-28 | Hoffmann La Roche | Ácido ibandrónico para o tratamento e a prevenção da osteoporose |
| SI1790347T1 (sl) * | 2002-12-20 | 2015-03-31 | F. Hoffmann-La Roche Ag | Formulacija z visokim odmerkom ibandronata |
| SI2317852T1 (sl) | 2008-07-16 | 2015-04-30 | Richter Gedeon Nyrt. | Farmacevtske formulacije, ki vsebujejo ligande dopaminskega receptorja |
| HU229858B1 (en) | 2008-12-17 | 2014-10-28 | Richter Gedeon Nyrt | Process for the preparation of trans 4-amino-cyclohexyl acetic acid ethyl ester hcl |
| US8748097B1 (en) | 2011-12-02 | 2014-06-10 | President And Fellows Of Harvard College | Identification of agents for treating calcium disorders and uses thereof |
| PL407922A1 (pl) | 2014-04-16 | 2015-10-26 | Wrocławskie Centrum Badań Eit + Spółka Z Ograniczoną Odpowiedzialnością | Nowe bisfosfoniany i ich zastosowanie |
| TWI730039B (zh) | 2016-01-29 | 2021-06-11 | 日商富士藥品股份有限公司 | 新穎雙膦酸化合物 |
| US11274087B2 (en) | 2016-07-08 | 2022-03-15 | Richter Gedeon Nyrt. | Industrial process for the preparation of cariprazine |
| WO2019076269A1 (zh) | 2017-10-16 | 2019-04-25 | 清华大学 | 甲羟戊酸通路抑制剂及其药物组合物 |
| US11547707B2 (en) | 2019-04-10 | 2023-01-10 | Richter Gedeon Nyrt. | Carbamoyl cyclohexane derivatives for treating autism spectrum disorder |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1002355C2 (de) * | 1954-05-03 | 1957-07-25 | Thomae Gmbh Dr K | Verfahren zur Herstellung von ª‡-prim.-Amino-diphosphonsaeuren und deren Estern |
| DE1302557B (fi) * | 1963-04-09 | 1971-08-26 | ||
| FR96342E (fi) * | 1967-12-09 | 1972-06-16 | ||
| PH9853A (en) * | 1972-06-08 | 1976-04-13 | M Francis | Compositions for inhibiting mobilization of calcium phosphate in animal tissue and method of use thereof |
| DE2405254C2 (de) * | 1974-02-04 | 1982-05-27 | Henkel KGaA, 4000 Düsseldorf | Verwendung von 3-Amino-1-Hydroxypropan-1, 1-diphosphonsäure oder ihrer wasserlöslichen Salze bei der Beeinflußung von Calciumstoffwechselstörungen im menschlichen oder tierischen Körper |
| DE2534391C2 (de) * | 1975-08-01 | 1983-01-13 | Henkel KGaA, 4000 Düsseldorf | 1-Hydroxy-3-aminoalkan-1,1-diphosphonsäuren |
| DE2534390C2 (de) * | 1975-08-01 | 1983-01-13 | Henkel KGaA, 4000 Düsseldorf | 1,3-Di-aminoalkan-1,1-diphosphonsäuren |
| DE2745083C2 (de) * | 1977-10-07 | 1985-05-02 | Henkel KGaA, 4000 Düsseldorf | Hydroxydiphosphonsäuren und Verfahren zu deren Herstellung |
| DE3016289A1 (de) * | 1980-04-28 | 1981-10-29 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung von omega -amino-1-hydroxyalkyliden-1,1-bis-phosphonsaeuren |
| US4304734A (en) * | 1980-10-16 | 1981-12-08 | Vysoka Skola Chemicko-Technologicka | 6-Amino-1-hydroxyhexylidene diphosphonic acid, salts and a process for production thereof |
| IT1201087B (it) * | 1982-04-15 | 1989-01-27 | Gentili Ist Spa | Bifosfonati farmacologicamente attivi,procedimento per la loro preparazione e relative composizioni farmaceutiche |
| DE3428524A1 (de) * | 1984-08-02 | 1986-02-13 | Boehringer Mannheim Gmbh, 6800 Mannheim | Neue diphosphonsaeurederivate, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel |
| DE3434667A1 (de) * | 1984-09-21 | 1986-04-03 | Henkel KGaA, 4000 Düsseldorf | 4-dimethylamino-1-hydroxybutan-1,1-diphosphonsaeure, deren wasserloesliche salze, verfahren zu ihrer herstellung sowie ihre verwendung |
-
1985
- 1985-11-13 DE DE19853540150 patent/DE3540150A1/de not_active Withdrawn
-
1986
- 1986-11-07 DE DE8686115428T patent/DE3668459D1/de not_active Expired - Lifetime
- 1986-11-07 ES ES86115428T patent/ES2014220B3/es not_active Expired - Lifetime
- 1986-11-07 EP EP86115428A patent/EP0224751B1/de not_active Expired - Lifetime
- 1986-11-07 AT AT86115428T patent/ATE49766T1/de not_active IP Right Cessation
- 1986-11-10 ZA ZA868514A patent/ZA868514B/xx unknown
- 1986-11-10 IL IL80570A patent/IL80570A0/xx unknown
- 1986-11-10 DD DD86296129A patent/DD255163A5/de unknown
- 1986-11-11 CS CS868154A patent/CS258493B2/cs unknown
- 1986-11-11 DK DK538686A patent/DK538686A/da not_active Application Discontinuation
- 1986-11-12 US US06/930,331 patent/US4719203A/en not_active Expired - Lifetime
- 1986-11-12 AU AU65090/86A patent/AU584759B2/en not_active Ceased
- 1986-11-12 HU HU864676A patent/HU195829B/hu not_active IP Right Cessation
- 1986-11-12 FI FI864614A patent/FI864614A/fi not_active Application Discontinuation
- 1986-11-12 JP JP61267906A patent/JPS62114994A/ja active Pending
- 1986-11-12 CA CA000522806A patent/CA1289569C/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL80570A0 (en) | 1987-02-27 |
| HU195829B (en) | 1988-07-28 |
| AU6509086A (en) | 1987-05-21 |
| AU584759B2 (en) | 1989-06-01 |
| FI864614A (fi) | 1987-05-14 |
| CA1289569C (en) | 1991-09-24 |
| DK538686D0 (da) | 1986-11-11 |
| JPS62114994A (ja) | 1987-05-26 |
| DD255163A5 (de) | 1988-03-23 |
| ATE49766T1 (de) | 1990-02-15 |
| CS815486A2 (en) | 1987-12-17 |
| US4719203A (en) | 1988-01-12 |
| HUT42496A (en) | 1987-07-28 |
| EP0224751B1 (de) | 1990-01-24 |
| DK538686A (da) | 1987-05-14 |
| DE3540150A1 (de) | 1987-05-14 |
| DE3668459D1 (de) | 1990-03-01 |
| EP0224751A1 (de) | 1987-06-10 |
| FI864614A0 (fi) | 1986-11-12 |
| ES2014220B3 (es) | 1990-07-01 |
| ZA868514B (en) | 1987-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS258493B2 (en) | Method of diphosphonic acids' derivatives production | |
| US5002937A (en) | Diphosphonic acid compounds and use for calcium metabolism disorders | |
| EP0252505B1 (de) | 1-Hydroxy-3-(N-methyl-N-propylamino)propan-1,1-diphosphonsäure; Verfahren zu dessen Herstellung und diese Verbindung enthaltende Arzneimittel | |
| EP0273190B1 (de) | Neue Diphosphonsäurederivate, Verfahren zu deren Herstellung und diese Verbindung enthaltende Arzneimittel | |
| US5538957A (en) | Phosphonosuccinic acid derivatives, processes for their preparation and medicaments containing these compounds | |
| US5393748A (en) | Methylenebisphosphonic acid derivatives | |
| EP0563096B1 (en) | Novel methylenebisphosphonic acid derivatives | |
| KR100246809B1 (ko) | 비고리형 아미딘기 함유 디포스폰산유도체, 이들의 제조방법 및 이들을 포함하는 의약조성물 | |
| EP0584115B1 (de) | Arzneimittel enthaltend azacyclodiphosphonsäurederivate, neue azacyclodiphosphonsäurederivate sowie verfahren zu deren herstellung | |
| US6518258B1 (en) | 6-sulphamoyl -3-quinolyphosphonic acid compounds | |
| EP0627438A1 (en) | Methanediphosphonate derivative, process for producing the same, and pharmaceutical use thereof |