CS212751B2 - Diaphragm coated cathode for the use in chloroalkaline electrolytic cell and method of manufacturing same - Google Patents
Diaphragm coated cathode for the use in chloroalkaline electrolytic cell and method of manufacturing same Download PDFInfo
- Publication number
- CS212751B2 CS212751B2 CS74270A CS27074A CS212751B2 CS 212751 B2 CS212751 B2 CS 212751B2 CS 74270 A CS74270 A CS 74270A CS 27074 A CS27074 A CS 27074A CS 212751 B2 CS212751 B2 CS 212751B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- polymer
- cathode
- asbestos
- slurry
- coated
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 229920000642 polymer Polymers 0.000 claims abstract description 52
- 239000010425 asbestos Substances 0.000 claims abstract description 50
- 229910052895 riebeckite Inorganic materials 0.000 claims abstract description 50
- 238000000576 coating method Methods 0.000 claims abstract description 16
- 239000011248 coating agent Substances 0.000 claims abstract description 15
- 239000002002 slurry Substances 0.000 claims abstract description 14
- 239000000203 mixture Substances 0.000 claims abstract description 10
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims abstract description 10
- 239000004810 polytetrafluoroethylene Substances 0.000 claims abstract description 10
- 239000008187 granular material Substances 0.000 claims abstract description 7
- 239000003513 alkali Substances 0.000 claims abstract description 6
- 229920001169 thermoplastic Polymers 0.000 claims abstract description 6
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 4
- 239000012528 membrane Substances 0.000 claims description 53
- 239000000835 fiber Substances 0.000 claims description 44
- -1 polytetrafluoroethylene Polymers 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- 230000008569 process Effects 0.000 claims description 10
- 229920005594 polymer fiber Polymers 0.000 claims description 7
- 238000002844 melting Methods 0.000 claims description 6
- 230000008018 melting Effects 0.000 claims description 6
- 239000002245 particle Substances 0.000 claims description 6
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract description 24
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 abstract description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 9
- 238000010438 heat treatment Methods 0.000 abstract description 8
- 239000011780 sodium chloride Substances 0.000 abstract description 8
- 229920001577 copolymer Polymers 0.000 abstract description 5
- 239000004094 surface-active agent Substances 0.000 abstract description 5
- 239000002033 PVDF binder Substances 0.000 abstract description 4
- 229920002981 polyvinylidene fluoride Polymers 0.000 abstract description 4
- 239000012736 aqueous medium Substances 0.000 abstract description 3
- 238000000151 deposition Methods 0.000 abstract description 3
- 229910052751 metal Inorganic materials 0.000 abstract description 3
- 239000002184 metal Substances 0.000 abstract description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 abstract description 3
- 229910000831 Steel Inorganic materials 0.000 abstract description 2
- 239000012267 brine Substances 0.000 abstract description 2
- 229910003460 diamond Inorganic materials 0.000 abstract description 2
- 239000010432 diamond Substances 0.000 abstract description 2
- 229920002620 polyvinyl fluoride Polymers 0.000 abstract description 2
- 239000010959 steel Substances 0.000 abstract description 2
- 229920002313 fluoropolymer Polymers 0.000 abstract 3
- PEVRKKOYEFPFMN-UHFFFAOYSA-N 1,1,2,3,3,3-hexafluoroprop-1-ene;1,1,2,2-tetrafluoroethene Chemical compound FC(F)=C(F)F.FC(F)=C(F)C(F)(F)F PEVRKKOYEFPFMN-UHFFFAOYSA-N 0.000 abstract 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 abstract 1
- 239000005977 Ethylene Substances 0.000 abstract 1
- 235000008098 Oxalis acetosella Nutrition 0.000 abstract 1
- 240000007930 Oxalis acetosella Species 0.000 abstract 1
- 230000001464 adherent effect Effects 0.000 abstract 1
- 238000001816 cooling Methods 0.000 abstract 1
- 229920001519 homopolymer Polymers 0.000 abstract 1
- 239000000725 suspension Substances 0.000 description 10
- 239000007788 liquid Substances 0.000 description 7
- 230000008901 benefit Effects 0.000 description 6
- UUAGAQFQZIEFAH-UHFFFAOYSA-N chlorotrifluoroethylene Chemical group FC(F)=C(F)Cl UUAGAQFQZIEFAH-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000035699 permeability Effects 0.000 description 4
- 238000011049 filling Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229940074404 sodium succinate Drugs 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 239000012815 thermoplastic material Substances 0.000 description 2
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000004812 Fluorinated ethylene propylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920006370 Kynar Polymers 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 239000013504 Triton X-100 Substances 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910001902 chlorine oxide Inorganic materials 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000005087 leaf formation Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229920009441 perflouroethylene propylene Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B13/00—Diaphragms; Spacing elements
- C25B13/04—Diaphragms; Spacing elements characterised by the material
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Reinforced Plastic Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/324,508 US4410411A (en) | 1973-01-17 | 1973-01-17 | Dimensionally stable asbestos diaphragms |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS212751B2 true CS212751B2 (en) | 1982-03-26 |
Family
ID=23263900
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS74270A CS212751B2 (en) | 1973-01-17 | 1974-01-16 | Diaphragm coated cathode for the use in chloroalkaline electrolytic cell and method of manufacturing same |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4410411A (OSRAM) |
| JP (1) | JPS5343149B2 (OSRAM) |
| AR (1) | AR200170A1 (OSRAM) |
| AT (1) | AT327957B (OSRAM) |
| AU (1) | AU466303B2 (OSRAM) |
| BE (1) | BE809822A (OSRAM) |
| BR (1) | BR7400298D0 (OSRAM) |
| CA (1) | CA1057699A (OSRAM) |
| CS (1) | CS212751B2 (OSRAM) |
| DD (1) | DD109322A5 (OSRAM) |
| DE (1) | DE2401942B2 (OSRAM) |
| FI (1) | FI58795C (OSRAM) |
| FR (1) | FR2213805B1 (OSRAM) |
| GB (1) | GB1410313A (OSRAM) |
| HU (1) | HU166833B (OSRAM) |
| IL (1) | IL44017A (OSRAM) |
| IN (1) | IN137805B (OSRAM) |
| IT (1) | IT1008702B (OSRAM) |
| NL (1) | NL7400587A (OSRAM) |
| PL (1) | PL88547B1 (OSRAM) |
| RO (1) | RO65954A (OSRAM) |
| SU (1) | SU910126A3 (OSRAM) |
| ZA (1) | ZA74315B (OSRAM) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4489025A (en) * | 1973-01-17 | 1984-12-18 | Diamond Shamrock Chemicals Company | Preparation of dimensionally stable asbestos diaphragms |
| US4701250A (en) * | 1973-01-17 | 1987-10-20 | Eltech Systems Corporation | Dimensionally stable asbestos diaphragm coated foraminous cathode |
| FR2229739B1 (OSRAM) * | 1973-05-18 | 1976-09-17 | Rhone Progil | |
| US4089758A (en) | 1974-05-24 | 1978-05-16 | Imperial Chemical Industries Limited | Electrolytic process |
| FR2280609A1 (fr) * | 1974-07-31 | 1976-02-27 | Rhone Poulenc Ind | Nappe a base de fibres d'amiante et procede d'obtention |
| JPS5146582A (en) * | 1974-10-21 | 1976-04-21 | Kureha Chemical Ind Co Ltd | Denkaiyokakumakuno seizohoho |
| US4210515A (en) * | 1975-02-10 | 1980-07-01 | Basf Wyandotte Corporation | Thermoplastic fibers as separator or diaphragm in electrochemical cells |
| CA1079225A (en) * | 1975-02-10 | 1980-06-10 | Eugene Y. Weissman | Bonding of fibers for diaphragms in electrolytic cells |
| JPS51117979A (en) * | 1975-04-09 | 1976-10-16 | Hooker Chemicals Plastics Corp | Improved diaphragm for electrolytic cell |
| JPS597795B2 (ja) * | 1975-04-17 | 1984-02-21 | 株式会社トクヤマ | 電解用陰極鑵 |
| JPS581191B2 (ja) * | 1975-04-24 | 1983-01-10 | 呉羽化学工業株式会社 | デンカイヨウアスベストカクマクノ セイゾウホウホウ |
| US4036728A (en) * | 1976-05-21 | 1977-07-19 | Diamond Shamrock Corporation | Converting a diaphragm electrolytic cell to a membrane electrolytic cell |
| JPS52144379A (en) * | 1976-05-28 | 1977-12-01 | Teijin Ltd | Production of binding material for fibrous diaphragm and diaphragm made of asbestos fibers |
| US4032423A (en) * | 1976-06-09 | 1977-06-28 | Ppg Industries, Inc. | Method of assembling a bipolar electrolyzer |
| LU78350A1 (fr) * | 1977-10-19 | 1979-06-01 | Solvay | Procede de fabrication d'un diaphragme permeable pour cellule d'electrolyse |
| US4196070A (en) * | 1977-12-12 | 1980-04-01 | Nuclepore Corporation | Method for forming microporous fluorocarbon polymer sheet and product |
| JPS5499271A (en) * | 1978-01-20 | 1979-08-04 | Sato Tadao | Filter |
| US4186065A (en) * | 1978-04-27 | 1980-01-29 | Ppg Industries, Inc. | Method of preparing a resin-containing asbestos diaphragm |
| US4256845A (en) * | 1979-02-15 | 1981-03-17 | Glasrock Products, Inc. | Porous sheets and method of manufacture |
| DE2938069A1 (de) * | 1979-09-20 | 1981-04-02 | Siemens AG, 1000 Berlin und 8000 München | Asbestdiaphragmen fuer elektrochemische zellen und deren herstellung |
| US4444640A (en) * | 1980-09-22 | 1984-04-24 | Diamond Shamrock Corporation | Dimensionally stable asbestos-polytetrafluoroethylene diaphragms for chloralkali electrolytic cells |
| CA1207705A (en) * | 1980-09-22 | 1986-07-15 | Shan-Pu Tsai | Dimensionally stable asbestos-polytetrafluoroethylene diaphragms for chlor-alkali electrolytic cells |
| US4447566A (en) * | 1983-01-27 | 1984-05-08 | Eltech Systems Corp. | Modified liquid permeable asbestos diaphragms with improved dimensional stability |
| US4665120A (en) * | 1983-01-27 | 1987-05-12 | Eltech Systems Corporation | Modified liquid permeable asbestos diaphragms with improved dimensional stability |
| US4563260A (en) * | 1983-01-27 | 1986-01-07 | Eltech Systems Corporation | Modified liquid permeable asbestos diaphragms with improved dimensional stability |
| US4853101A (en) * | 1984-09-17 | 1989-08-01 | Eltech Systems Corporation | Porous separator comprising inorganic/polymer composite fiber and method of making same |
| US4666573A (en) * | 1985-09-05 | 1987-05-19 | Ppg Industries, Inc. | Synthetic diaphragm and process of use thereof |
| US4603165A (en) * | 1985-11-29 | 1986-07-29 | Gte Government Systems Corporation | Material suitable for thermal protection of electrochemical cells and other articles |
| US4741813A (en) * | 1986-12-15 | 1988-05-03 | Oxytech Systems, Inc. | Diaphragm for an electrolytic cell |
| FR2650842B1 (fr) * | 1989-08-10 | 1992-01-17 | Rhone Poulenc Chimie | Perfectionnement d'un diaphragme comprenant des fibres d'amiante, association d'un tel diaphragme a un element cathodique et leur procede d'obtention |
| US5205911A (en) * | 1990-11-13 | 1993-04-27 | Oxytech Systems, Inc. | Cathode restoration |
| US5498321A (en) | 1994-07-28 | 1996-03-12 | Oxytech Systems, Inc. | Electrolysis cell diaphragm reclamation |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1862244A (en) * | 1932-06-07 | K e stuart | ||
| US2338602A (en) * | 1939-12-04 | 1944-01-04 | Reconstruction Finance Corp | Fabrication of wet-strengthened papers |
| BE475208A (OSRAM) * | 1942-05-25 | 1900-01-01 | ||
| US2568144A (en) * | 1945-12-05 | 1951-09-18 | Union Asbestos & Rubber Co | Felted material and method of making the same |
| US2626213A (en) * | 1948-12-21 | 1953-01-20 | Raybestos Manhattan Inc | Asbestos dispersions and method of forming same |
| US2962414A (en) * | 1956-03-05 | 1960-11-29 | Hurlbut Paper Company | High strength specialty papers and processes for producing the same |
| NL135829C (OSRAM) * | 1961-11-02 | |||
| US3320107A (en) * | 1963-01-30 | 1967-05-16 | Gen Motors Corp | Method of making a facing for use in energy transmitting device |
| US3369948A (en) * | 1964-11-12 | 1968-02-20 | Du Pont | Method of producing a pile fabric |
| CA845032A (en) * | 1966-12-03 | 1970-06-23 | Hacker Heinz | Gas-tight diaphragms for electrochemical cells |
| NL133247C (OSRAM) * | 1967-05-18 | |||
| US3694281A (en) * | 1969-04-28 | 1972-09-26 | Pullman Inc | Process for forming a diaphragm for use in an electrolytic cell |
| US3723264A (en) | 1969-04-28 | 1973-03-27 | Pullman Inc | Electrochemical oxidation of olefinic compounds |
| DE2134126B2 (de) | 1970-07-09 | 1973-09-06 | Nippon Soda Co Ltd , Tokio | Diaphragma fuer die chloralkali-elektrolyse |
| US4070257A (en) * | 1970-08-13 | 1978-01-24 | Electrode Corporation | Electrolytic process using novel diaphragm |
| JPS4832515B1 (OSRAM) | 1970-08-13 | 1973-10-06 | ||
| US3989615A (en) * | 1971-07-06 | 1976-11-02 | Nippon Soda Company Limited | Diaphragm process electrolytic cell |
| US3721637A (en) * | 1971-11-08 | 1973-03-20 | H Fogel | Method for dispersing asbestos fibers |
| WO2013035012A2 (en) * | 2011-09-06 | 2013-03-14 | Koninklijke Philips Electronics N.V. | Wire-based lighting module with 3d topography |
-
1973
- 1973-01-16 ZA ZA00740315A patent/ZA74315B/xx unknown
- 1973-01-17 US US05/324,508 patent/US4410411A/en not_active Expired - Lifetime
- 1973-09-11 JP JP10174773A patent/JPS5343149B2/ja not_active Expired
-
1974
- 1974-01-13 IT IT47756/74A patent/IT1008702B/it active
- 1974-01-14 FI FI91/74A patent/FI58795C/fi active
- 1974-01-14 IN IN89/CAL/74A patent/IN137805B/en unknown
- 1974-01-15 DD DD176017A patent/DD109322A5/xx unknown
- 1974-01-15 PL PL1974168111A patent/PL88547B1/pl unknown
- 1974-01-15 AU AU64522/74A patent/AU466303B2/en not_active Expired
- 1974-01-15 FR FR7401234A patent/FR2213805B1/fr not_active Expired
- 1974-01-15 RO RO7477288A patent/RO65954A/ro unknown
- 1974-01-16 CA CA190,290A patent/CA1057699A/en not_active Expired
- 1974-01-16 CS CS74270A patent/CS212751B2/cs unknown
- 1974-01-16 IL IL44017A patent/IL44017A/en unknown
- 1974-01-16 GB GB205174A patent/GB1410313A/en not_active Expired
- 1974-01-16 NL NL7400587A patent/NL7400587A/xx unknown
- 1974-01-16 BE BE139877A patent/BE809822A/xx not_active IP Right Cessation
- 1974-01-16 SU SU741997951A patent/SU910126A3/ru active
- 1974-01-16 DE DE19742401942 patent/DE2401942B2/de not_active Ceased
- 1974-01-16 AR AR251959A patent/AR200170A1/es active
- 1974-01-16 BR BR74298A patent/BR7400298D0/pt unknown
- 1974-01-16 HU HUDI243A patent/HU166833B/hu unknown
- 1974-01-17 AT AT36374*#A patent/AT327957B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT327957B (de) | 1976-02-25 |
| BR7400298D0 (pt) | 1974-08-22 |
| HU166833B (OSRAM) | 1975-06-28 |
| DE2401942A1 (de) | 1974-08-01 |
| SU910126A3 (ru) | 1982-02-28 |
| BE809822A (fr) | 1974-07-16 |
| FI58795C (fi) | 1981-04-10 |
| IN137805B (OSRAM) | 1975-09-20 |
| CA1057699A (en) | 1979-07-03 |
| IL44017A0 (en) | 1974-05-16 |
| IT1008702B (it) | 1976-11-30 |
| JPS49102578A (OSRAM) | 1974-09-27 |
| ZA74315B (en) | 1975-03-26 |
| ATA36374A (de) | 1975-05-15 |
| RO65954A (ro) | 1980-06-15 |
| DE2401942B2 (de) | 1977-08-04 |
| GB1410313A (en) | 1975-10-15 |
| US4410411A (en) | 1983-10-18 |
| FR2213805B1 (OSRAM) | 1977-09-09 |
| JPS5343149B2 (OSRAM) | 1978-11-17 |
| AU6452274A (en) | 1975-10-23 |
| FI58795B (fi) | 1980-12-31 |
| AU466303B2 (en) | 1975-10-23 |
| FR2213805A1 (OSRAM) | 1974-08-09 |
| PL88547B1 (OSRAM) | 1976-09-30 |
| IL44017A (en) | 1976-12-31 |
| DD109322A5 (OSRAM) | 1974-11-05 |
| NL7400587A (OSRAM) | 1974-07-19 |
| AR200170A1 (es) | 1974-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS212751B2 (en) | Diaphragm coated cathode for the use in chloroalkaline electrolytic cell and method of manufacturing same | |
| US5094895A (en) | Composite, porous diaphragm | |
| US4186076A (en) | Composite diaphragms | |
| US4606805A (en) | Electrolyte permeable diaphragm and method of making same | |
| US4680101A (en) | Electrolyte permeable diaphragm including a polymeric metal oxide | |
| US4272560A (en) | Method of depositing cation exchange membrane on a foraminous cathode | |
| JPS6075593A (ja) | 導電性繊維を主体とする陰極要素の製造方法 | |
| US3944477A (en) | Diaphragm for electrolytic cell for chlorine production | |
| US4036728A (en) | Converting a diaphragm electrolytic cell to a membrane electrolytic cell | |
| US4311566A (en) | Electrolyte permeable diaphragm | |
| US4065534A (en) | Method of providing a resin reinforced asbestos diaphragm | |
| US4666573A (en) | Synthetic diaphragm and process of use thereof | |
| CA1131175A (en) | Chlorotrifluoroethylene containing polymer diaphragm | |
| US4070257A (en) | Electrolytic process using novel diaphragm | |
| US5023127A (en) | Microporous composites and electrolytic applications thereof | |
| FI61920C (fi) | Foerfarande foer framstaellning av en katod belagd med en vaetskegenomslaeppande diafragma och saohaer framstaelld katod | |
| US4701250A (en) | Dimensionally stable asbestos diaphragm coated foraminous cathode | |
| US4204938A (en) | Method of making porous plastic diaphragms and the resulting novel diaphragms | |
| US4489025A (en) | Preparation of dimensionally stable asbestos diaphragms | |
| USRE34233E (en) | Electrically conductive fibrous web substrate and cathodic element comprised thereof | |
| JPS6283383A (ja) | 微孔性材料、その製造方法及びそれを用いた陰極の製造 | |
| US4482441A (en) | Permeable diaphragm, made from a hydrophobic organic polymeric material, for a cell for the electrolysis of aqueous solutions of an alkali metal halide | |
| FI64816B (fi) | Permeabelt membran foer elektrokemisk cell | |
| US4879009A (en) | Method of preparing an asbestos diaphragm | |
| JPH08505189A (ja) | 微孔性隔膜の製造方法 |