CS203942B2 - Herbicide and process for prearing effective compound - Google Patents
Herbicide and process for prearing effective compound Download PDFInfo
- Publication number
- CS203942B2 CS203942B2 CS79507A CS50779A CS203942B2 CS 203942 B2 CS203942 B2 CS 203942B2 CS 79507 A CS79507 A CS 79507A CS 50779 A CS50779 A CS 50779A CS 203942 B2 CS203942 B2 CS 203942B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- acid
- formula
- yloxy
- phenoxy
- active ingredient
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 22
- 230000002363 herbicidal effect Effects 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 9
- 239000004009 herbicide Substances 0.000 title description 3
- 239000000203 mixture Substances 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 22
- 239000004480 active ingredient Substances 0.000 claims description 19
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 19
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 16
- -1 aminoalkyl ester Chemical class 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 235000019260 propionic acid Nutrition 0.000 claims description 6
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- WYYFNMXLUUHRAU-UHFFFAOYSA-N 2-phenoxy-2-pyridin-2-yloxypropanoic acid Chemical compound C=1C=CC=NC=1OC(C(O)=O)(C)OC1=CC=CC=C1 WYYFNMXLUUHRAU-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical group CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims description 2
- UVSPBAFXKQMDBG-UHFFFAOYSA-N 2-(dimethylamino)ethyl propanoate Chemical compound CCC(=O)OCCN(C)C UVSPBAFXKQMDBG-UHFFFAOYSA-N 0.000 claims description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- IYLIXOSUWQUYIH-UHFFFAOYSA-N 2-(diethylamino)ethyl propanoate Chemical compound CCN(CC)CCOC(=O)CC IYLIXOSUWQUYIH-UHFFFAOYSA-N 0.000 claims 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims 1
- VKYWIZKLWBZIGD-UHFFFAOYSA-N S-[2-(diethylamino)ethyl] propanethioate Chemical compound CCN(CC)CCSC(=O)CC VKYWIZKLWBZIGD-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 15
- 241000209140 Triticum Species 0.000 description 11
- 235000021307 Triticum Nutrition 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000013543 active substance Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- 241000209761 Avena Species 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- 235000007319 Avena orientalis Nutrition 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 241001148683 Zostera marina Species 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 244000038559 crop plants Species 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 206010011878 Deafness Diseases 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000004563 wettable powder Substances 0.000 description 5
- 239000005995 Aluminium silicate Substances 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 235000012211 aluminium silicate Nutrition 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- KOODSCBKXPPKHE-UHFFFAOYSA-N propanethioic s-acid Chemical class CCC(S)=O KOODSCBKXPPKHE-UHFFFAOYSA-N 0.000 description 4
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 240000005702 Galium aparine Species 0.000 description 3
- 235000014820 Galium aparine Nutrition 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 235000006463 Brassica alba Nutrition 0.000 description 2
- 244000140786 Brassica hirta Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 241000209510 Liliopsida Species 0.000 description 2
- 240000004296 Lolium perenne Species 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 240000004370 Pastinaca sativa Species 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 229910052979 sodium sulfide Inorganic materials 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- HKROQOWBHZLRCU-UHFFFAOYSA-N 2,2-diphenoxypropanoic acid Chemical class C=1C=CC=CC=1OC(C(O)=O)(C)OC1=CC=CC=C1 HKROQOWBHZLRCU-UHFFFAOYSA-N 0.000 description 1
- VSNYXNLUMZIEFR-UHFFFAOYSA-N 2-(4-pyridin-2-yloxyphenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=CC=N1 VSNYXNLUMZIEFR-UHFFFAOYSA-N 0.000 description 1
- BJTMVJGFUSFRHW-UHFFFAOYSA-N 2-[(4-oxo-3-phenyl-1h-pyridin-2-yl)oxy]-3-phenyl-1h-pyridin-4-one Chemical compound C=1C=CC=CC=1C=1C(=O)C=CNC=1OC=1NC=CC(=O)C=1C1=CC=CC=C1 BJTMVJGFUSFRHW-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical group CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 241000209134 Arundinaria Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000021537 Beetroot Nutrition 0.000 description 1
- 235000011371 Brassica hirta Nutrition 0.000 description 1
- 241001148727 Bromus tectorum Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000723353 Chrysanthemum Species 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 235000005633 Chrysanthemum balsamita Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000285774 Cyperus esculentus Species 0.000 description 1
- 235000005853 Cyperus esculentus Nutrition 0.000 description 1
- 235000002848 Cyperus flabelliformis Nutrition 0.000 description 1
- 240000001505 Cyperus odoratus Species 0.000 description 1
- RBNPOMFGQQGHHO-UWTATZPHSA-N D-glyceric acid Chemical compound OC[C@@H](O)C(O)=O RBNPOMFGQQGHHO-UWTATZPHSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 244000060234 Gmelina philippensis Species 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 240000004153 Hibiscus sabdariffa Species 0.000 description 1
- 235000001018 Hibiscus sabdariffa Nutrition 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000207890 Ipomoea purpurea Species 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 235000002769 Pastinaca sativa Nutrition 0.000 description 1
- 235000017769 Pastinaca sativa subsp sativa Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 240000001451 Rottboellia cochinchinensis Species 0.000 description 1
- 241000219053 Rumex Species 0.000 description 1
- 235000005291 Rumex acetosa Nutrition 0.000 description 1
- 240000005498 Setaria italica Species 0.000 description 1
- 235000007226 Setaria italica Nutrition 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- 244000061458 Solanum melongena Species 0.000 description 1
- 235000002594 Solanum nigrum Nutrition 0.000 description 1
- 244000061457 Solanum nigrum Species 0.000 description 1
- 240000003829 Sorghum propinquum Species 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- SXQXMCWCWVCFPC-UHFFFAOYSA-N aluminum;potassium;dioxido(oxo)silane Chemical compound [Al+3].[K+].[O-][Si]([O-])=O.[O-][Si]([O-])=O SXQXMCWCWVCFPC-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 239000004491 dispersible concentrate Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- ZKWFSTHEYLJLEL-UHFFFAOYSA-N morpholine-4-carboxamide Chemical compound NC(=O)N1CCOCC1 ZKWFSTHEYLJLEL-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 235000003513 sheep sorrel Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- RSPCKAHMRANGJZ-UHFFFAOYSA-N thiohydroxylamine Chemical compound SN RSPCKAHMRANGJZ-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH92878 | 1978-01-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS203942B2 true CS203942B2 (en) | 1981-03-31 |
Family
ID=4198428
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS79507A CS203942B2 (en) | 1978-01-27 | 1979-01-23 | Herbicide and process for prearing effective compound |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4213774A (tr) |
| EP (1) | EP0003313B1 (tr) |
| JP (1) | JPS54109982A (tr) |
| KR (1) | KR820001834B1 (tr) |
| AT (1) | AT370587B (tr) |
| AU (1) | AU527702B2 (tr) |
| BR (1) | BR7900495A (tr) |
| CA (1) | CA1100965A (tr) |
| CS (1) | CS203942B2 (tr) |
| DD (1) | DD141775A5 (tr) |
| DE (1) | DE2960106D1 (tr) |
| ES (1) | ES477179A1 (tr) |
| HU (1) | HU181862B (tr) |
| IL (1) | IL56498A (tr) |
| MX (1) | MX5877E (tr) |
| NZ (1) | NZ189483A (tr) |
| PH (1) | PH15227A (tr) |
| RO (1) | RO76447A (tr) |
| TR (1) | TR20197A (tr) |
| ZA (1) | ZA79336B (tr) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2961736D1 (en) * | 1978-03-17 | 1982-02-25 | Ciba Geigy Ag | Derivatives of phenoxy-alkanecarboxylic acids, their preparation, weed-killing products containing them and their use |
| US4309210A (en) * | 1978-12-01 | 1982-01-05 | Ciba-Geigy Corporation | Preemergence method of selectively controlling weeds in crops of cereals and composition therefor |
| US4374396A (en) * | 1979-04-26 | 1983-02-15 | Robert Bosch Gmbh | Chrominance sub-carrier modifier for PAL-color television signals |
| US4326880A (en) * | 1979-08-14 | 1982-04-27 | Ciba-Geigy Corporation | Derivatives of 5-(pyridyl-2-oxy)-2-nitrobenzoic acid, and herbicidal compositions containing them, and herbicidal methods for using same |
| US4311513A (en) * | 1979-08-24 | 1982-01-19 | Ciba-Geigy Corporation | Herbicidal α-phenoxypropionylazoles, compositions containing them, and method of use thereof |
| US4326879A (en) * | 1980-02-04 | 1982-04-27 | Sandoz, Inc. | 1-Phenoxy-4-pyridylbutanes and derivatives |
| US4330321A (en) * | 1981-03-16 | 1982-05-18 | The Dow Chemical Company | Compounds and method for selectively controlling grassy weeds in broadleaved crops |
| ZA828142B (en) * | 1981-11-16 | 1984-06-27 | Dow Chemical Co | Inhibiting the antagonism between pyridyloxy-phenoxyalkanoate herbicides and benzothiadiazinone herbicides in post-emergent applications |
| US4447259A (en) * | 1981-12-18 | 1984-05-08 | Hokko Chemical Industry Co., Ltd. | 2-(Substituted phenoxy)propionic acid derivatives and their uses for herbicidal purposes |
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
| US4518416A (en) * | 1982-06-04 | 1985-05-21 | Bayer Aktiengesellschaft | Certain trimethyl silyl-lower-alkyl esters of pyridyloxy-phenoxy-lower alkanoic acids, compositions containing same and herbicidal method of use |
| IL68822A (en) * | 1982-06-18 | 1990-07-12 | Dow Chemical Co | Pyridyl(oxy/thio)phenoxy compounds,herbicidal compositions and methods of using them |
| EP0113831A3 (de) * | 1982-12-17 | 1984-11-07 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Carbaminsäureester, Verfahren zu deren Herstellung und deren Verwendung |
| JPS59172440A (ja) * | 1983-03-23 | 1984-09-29 | Nippon Tokushu Noyaku Seizo Kk | 置換フエノキシプロピオン酸エステル及びその中間体、それらの製法並びに除草剤 |
| US4576631A (en) * | 1984-06-25 | 1986-03-18 | Stauffer Chemical Company | Certain aryloxyphenoxy oxoimidazolidines and method of use |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| US4775410A (en) * | 1985-08-19 | 1988-10-04 | Sandoz Ltd. | 2-[4-(2-pyridinyloxy)phenoxy]propionyl-2-oxazolidinones |
| DE3664043D1 (en) * | 1985-08-19 | 1989-07-27 | Sandoz Ag | Pyridyloxyphenoxypropionic acid derivatives |
| US5324711A (en) * | 1988-11-03 | 1994-06-28 | American Cyanamid Company | Aryloxy benzotriazole herbicidal agents and methods for the preparation thereof |
| IL91997A0 (en) * | 1988-11-03 | 1990-07-12 | American Cyanamid Co | Aryloxy benzotriazole herbicidal agents and methods for the preparation thereof |
| HU208311B (en) * | 1989-11-02 | 1993-09-28 | Alkaloida Vegyeszeti Gyar | Resolving process for producing enantiomers of 2-/4-(5-trifluoromethyl-2-pyridyloxy)-phenoxy/-propanoic acid |
| IL109104A (en) * | 1993-03-26 | 1998-08-16 | Shell Int Research | History of pyridine from wool - 2,6 Preparation and use as herbicides containing them |
| CA2415297A1 (en) | 2000-07-15 | 2002-01-24 | Glaxo Group Limited | Medicament dispenser |
| CN105712946A (zh) * | 2014-12-02 | 2016-06-29 | 沈阳中化农药化工研发有限公司 | 季铵盐类化合物及其应用 |
| CN105646328B (zh) * | 2014-12-02 | 2018-07-20 | 沈阳中化农药化工研发有限公司 | 一种季铵盐类化合物及其应用 |
| US12391648B2 (en) | 2018-12-27 | 2025-08-19 | Qingdao Kingagroot Chemical Compound Co., Ltd. | Pyridyloxy thioester derivative and preparation method therefor, herbicidal composition, and application |
| CN109400526B (zh) * | 2018-12-27 | 2020-10-16 | 青岛清原化合物有限公司 | 吡啶氧基硫酯衍生物及其制备方法、除草组合物和应用 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1134751A (en) * | 1909-09-02 | 1915-04-06 | Harvey A Moyer | Platen-operating mechanism. |
| US4092151A (en) * | 1974-10-17 | 1978-05-30 | Ishihara Sangyo Kaisha, Ltd. | Herbicidal compound, herbicidal composition containing the same and method of use thereof |
| US4115102A (en) * | 1974-10-17 | 1978-09-19 | Ishihara Sangyo Kaisha, Ltd. | Pyridyl compound, herbicidal composition containing the same and method of use thereof |
| US4083714A (en) * | 1974-10-17 | 1978-04-11 | Ishihara Sangyo Kaisha, Ltd. | Alkoxyalkyl esters of substituted pyridyloxyphenoxy-2-propanoic acids, herbicidal composition containing the same and method of use thereof |
| US4133675A (en) * | 1976-07-23 | 1979-01-09 | Ciba-Geigy Corporation | Pyridyloxy-phenoxy-alkanecarboxylic acid derivatives which are effective as herbicides and as agents regulating plant growth |
-
1979
- 1979-01-17 DE DE7979100127T patent/DE2960106D1/de not_active Expired
- 1979-01-17 EP EP79100127A patent/EP0003313B1/de not_active Expired
- 1979-01-22 US US06/005,538 patent/US4213774A/en not_active Expired - Lifetime
- 1979-01-22 PH PH22094A patent/PH15227A/en unknown
- 1979-01-23 MX MX797675U patent/MX5877E/es unknown
- 1979-01-23 CS CS79507A patent/CS203942B2/cs unknown
- 1979-01-25 RO RO7996388A patent/RO76447A/ro unknown
- 1979-01-25 CA CA320,291A patent/CA1100965A/en not_active Expired
- 1979-01-25 IL IL56498A patent/IL56498A/xx unknown
- 1979-01-25 TR TR20197A patent/TR20197A/tr unknown
- 1979-01-26 KR KR7900223A patent/KR820001834B1/ko not_active Expired
- 1979-01-26 HU HU79CI1900A patent/HU181862B/hu unknown
- 1979-01-26 AU AU43698/79A patent/AU527702B2/en not_active Ceased
- 1979-01-26 BR BR7900495A patent/BR7900495A/pt unknown
- 1979-01-26 JP JP865379A patent/JPS54109982A/ja active Granted
- 1979-01-26 NZ NZ189483A patent/NZ189483A/xx unknown
- 1979-01-26 AT AT0060179A patent/AT370587B/de not_active IP Right Cessation
- 1979-01-26 DD DD79210662A patent/DD141775A5/de unknown
- 1979-01-26 ES ES477179A patent/ES477179A1/es not_active Expired
- 1979-01-26 ZA ZA79336A patent/ZA79336B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0003313A1 (de) | 1979-08-08 |
| AU4369879A (en) | 1979-08-02 |
| RO76447A (ro) | 1981-03-30 |
| TR20197A (tr) | 1980-11-01 |
| ATA60179A (de) | 1982-09-15 |
| MX5877E (es) | 1984-08-16 |
| IL56498A (en) | 1982-07-30 |
| US4213774A (en) | 1980-07-22 |
| DE2960106D1 (en) | 1981-02-26 |
| AU527702B2 (en) | 1983-03-17 |
| ES477179A1 (es) | 1979-07-16 |
| BR7900495A (pt) | 1979-08-28 |
| EP0003313B1 (de) | 1981-01-07 |
| NZ189483A (en) | 1982-03-09 |
| JPS54109982A (en) | 1979-08-29 |
| DD141775A5 (de) | 1980-05-21 |
| KR820001834B1 (ko) | 1982-10-13 |
| CA1100965A (en) | 1981-05-12 |
| PH15227A (en) | 1982-10-01 |
| HU181862B (en) | 1983-11-28 |
| JPH0217545B2 (tr) | 1990-04-20 |
| ZA79336B (en) | 1980-02-27 |
| AT370587B (de) | 1983-04-11 |
| IL56498A0 (en) | 1979-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS203942B2 (en) | Herbicide and process for prearing effective compound | |
| US4300944A (en) | Herbicidally active unsaturated esters of halogenated α-[4-(pyridyl-2'-oxy)-phenoxy]-propionic acids | |
| CA1101867A (en) | Phenoxy-alkanecarboxylic acid derivatives, their production, and their use | |
| CA1109480A (en) | Phenoxyphenoxy-propionic acid derivatives | |
| US4417918A (en) | Herbicidal α-[3-(2-halo-4-trifluoromethylphenoxy)-6-halophenoxy]propionic acid thio esters and acids | |
| JPS62142156A (ja) | ピリジル(オキシ/チオ)フエノキシ化合物およびそれを有効成分とする除草剤 | |
| US4376646A (en) | Herbicidal N-[4-(3'-alkoxyphenoxy)-phenyl]-N'-methylureas | |
| KR840002123B1 (ko) | 0-(피리딜옥시-페닐)-락트산에스테르의 제조방법 | |
| US4493730A (en) | Phenoxypyridine useful as a herbicide | |
| JPS6147835B2 (tr) | ||
| US4251258A (en) | N-(Substituted carbonyl) derivatives of N-phosphinylmethylglycinates and the herbicidal use thereof | |
| US4298375A (en) | 2-Substituted-5-phenyl-4-thiazolecarboxylic acids and their derivatives as safening agents | |
| CS204044B2 (en) | Herbicidal means and method of making the active substance | |
| CS203944B2 (en) | Herbicide and process for preparing effective compound | |
| CS210604B2 (en) | Herbicide and preparation method of active substance | |
| CA1196644A (en) | Substituted phenoxypropionic acid esters and intermediates thereof, processes for production thereof and herbicide | |
| JPS5899448A (ja) | ジフエニルエ−テル、その製造方法ならびにこの化合物を含有する除草剤および葉乾燥剤 | |
| US4422867A (en) | Herbicidally active unsaturated esters of halogenated α-[4-(pyridyl-2'-oxy)-phenoxy]-propionic acids | |
| NO833797L (no) | 2-fenoxypropionsyrederivater av pentitere samt herbiside midler inneholdende disse | |
| US4397680A (en) | Herbicidally active oxime esters of halogenated α-[4-(pyridyl-2'-oxy)phenoxy]-propionic acids | |
| US4746359A (en) | Hydroxyacetic acid amide derivatives, and herbicidal compositions containing them | |
| KR880002413B1 (ko) | 페녹시프로피오네이트 제조방법 | |
| EP0201775A2 (en) | Derivative of propionic acid and selective herbicide containing the same | |
| CA1097650A (en) | Herbicidal compounds | |
| GB2058748A (en) | Salts of herbicidal 1,2,4- thiadiazolyl-5-urea derivatives |