CS202001B2 - Process for preparing derivative of imidazole - Google Patents
Process for preparing derivative of imidazole Download PDFInfo
- Publication number
- CS202001B2 CS202001B2 CS48576A CS48576A CS202001B2 CS 202001 B2 CS202001 B2 CS 202001B2 CS 48576 A CS48576 A CS 48576A CS 48576 A CS48576 A CS 48576A CS 202001 B2 CS202001 B2 CS 202001B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- parts
- imidazole
- dichlorophenyl
- ylmethyl
- dioxolane
- Prior art date
Links
- 150000002460 imidazoles Chemical class 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 177
- -1 halothienyl Chemical group 0.000 claims description 120
- 150000003839 salts Chemical class 0.000 claims description 95
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 68
- 239000002253 acid Substances 0.000 claims description 64
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 61
- 238000000034 method Methods 0.000 claims description 61
- 150000001875 compounds Chemical class 0.000 claims description 44
- 125000005997 bromomethyl group Chemical group 0.000 claims description 35
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 229910052751 metal Chemical class 0.000 claims description 16
- 239000002184 metal Chemical class 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 12
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 7
- 235000011181 potassium carbonates Nutrition 0.000 claims description 7
- 239000004305 biphenyl Substances 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000006331 halo benzoyl group Chemical group 0.000 claims description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 4
- 229910001511 metal iodide Inorganic materials 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 230000003287 optical effect Effects 0.000 claims description 4
- 235000015497 potassium bicarbonate Nutrition 0.000 claims description 4
- 235000015424 sodium Nutrition 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- IRAFXGAHTMFJLR-UHFFFAOYSA-N 2-(bromomethyl)-4-[(4-bromophenoxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1C1(CBr)OC(COC=2C=CC(Br)=CC=2)CO1 IRAFXGAHTMFJLR-UHFFFAOYSA-N 0.000 claims description 3
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims 1
- GNZHVEIGGFMLSP-UHFFFAOYSA-N 1-[[2-(2,4-dichlorophenyl)-4-[(4-phenylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1C1(CN2C=NC=C2)OC(COC=2C=CC(=CC=2)C=2C=CC=CC=2)CO1 GNZHVEIGGFMLSP-UHFFFAOYSA-N 0.000 claims 1
- WIZMVGOIBVVWHI-UHFFFAOYSA-N 1-[[2-(2,4-dichlorophenyl)-4-ethyl-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound O1C(CC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 WIZMVGOIBVVWHI-UHFFFAOYSA-N 0.000 claims 1
- AQJXVDWOEYEFCB-UHFFFAOYSA-N 1-[[2-(2-chloro-4-fluorophenyl)-4-ethyl-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound O1C(CC)COC1(C=1C(=CC(F)=CC=1)Cl)CN1C=NC=C1 AQJXVDWOEYEFCB-UHFFFAOYSA-N 0.000 claims 1
- CXLVPVKGMHGKMB-UHFFFAOYSA-N 1-[[2-(4-bromo-2-chlorophenyl)-4-ethyl-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound O1C(CC)COC1(C=1C(=CC(Br)=CC=1)Cl)CN1C=NC=C1 CXLVPVKGMHGKMB-UHFFFAOYSA-N 0.000 claims 1
- FGSKNRQPUTXJPG-UHFFFAOYSA-N 1-[[4-[(4-bromophenoxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1C1(CN2C=NC=C2)OC(COC=2C=CC(Br)=CC=2)CO1 FGSKNRQPUTXJPG-UHFFFAOYSA-N 0.000 claims 1
- FJSKMXIPXNDQOG-UHFFFAOYSA-N 1-[[4-[(4-bromophenoxy)methyl]-2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound C1=CC(Cl)=CC=C1C1(CN2C=NC=C2)OC(COC=2C=CC(Br)=CC=2)CO1 FJSKMXIPXNDQOG-UHFFFAOYSA-N 0.000 claims 1
- LVWCKDSNNFNNTH-UHFFFAOYSA-N 2-(4-bromo-2-chlorophenyl)-4-ethyl-1,3-dioxolane Chemical compound BrC1=CC(=C(C=C1)C1OCC(O1)CC)Cl LVWCKDSNNFNNTH-UHFFFAOYSA-N 0.000 claims 1
- NPNHFVNLKKJVSS-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-[(4-methoxyphenoxy)methyl]-1,3-dioxolane Chemical compound BrCC1(OCC(O1)COC1=CC=C(C=C1)OC)C1=C(C=C(C=C1)Cl)Cl NPNHFVNLKKJVSS-UHFFFAOYSA-N 0.000 claims 1
- IJFQVWIAHXOHTM-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-[(4-phenylphenoxy)methyl]-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1C1(CBr)OC(COC=2C=CC(=CC=2)C=2C=CC=CC=2)CO1 IJFQVWIAHXOHTM-UHFFFAOYSA-N 0.000 claims 1
- WVOHJAWNRZYVCS-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-ethyl-1,3-dioxolane Chemical compound O1C(CC)COC1(CBr)C1=CC=C(Cl)C=C1Cl WVOHJAWNRZYVCS-UHFFFAOYSA-N 0.000 claims 1
- YDOYEJFHCXCCDZ-UHFFFAOYSA-N 2-(bromomethyl)-4-[(4-bromophenoxy)methyl]-2-(4-chlorophenyl)-1,3-dioxolane Chemical compound BrCC1(OCC(O1)COC1=CC=C(C=C1)Br)C1=CC=C(C=C1)Cl YDOYEJFHCXCCDZ-UHFFFAOYSA-N 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000004970 halomethyl group Chemical group 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 239000011593 sulfur Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 120
- 239000000203 mixture Substances 0.000 description 109
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 109
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 93
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 69
- 229910017604 nitric acid Inorganic materials 0.000 description 69
- 239000000047 product Substances 0.000 description 62
- 239000000243 solution Substances 0.000 description 57
- 239000011541 reaction mixture Substances 0.000 description 55
- 239000003480 eluent Substances 0.000 description 53
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 52
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 44
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 41
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 40
- 239000000460 chlorine Substances 0.000 description 40
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 38
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 35
- 229960001701 chloroform Drugs 0.000 description 35
- 239000000284 extract Substances 0.000 description 35
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 32
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 31
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 30
- 239000002904 solvent Substances 0.000 description 28
- 239000007858 starting material Substances 0.000 description 28
- 150000002823 nitrates Chemical class 0.000 description 27
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 23
- 238000010898 silica gel chromatography Methods 0.000 description 23
- 239000000706 filtrate Substances 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 17
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 230000000843 anti-fungal effect Effects 0.000 description 14
- VFNGKCDDZUSWLR-UHFFFAOYSA-L disulfate(2-) Chemical compound [O-]S(=O)(=O)OS([O-])(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-L 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 229940121375 antifungal agent Drugs 0.000 description 12
- 230000003385 bacteriostatic effect Effects 0.000 description 12
- 235000010290 biphenyl Nutrition 0.000 description 12
- 239000012258 stirred mixture Substances 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 11
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 239000002585 base Substances 0.000 description 10
- 150000004862 dioxolanes Chemical group 0.000 description 10
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 229910002651 NO3 Inorganic materials 0.000 description 9
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Natural products OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- DASJDMQCPIDJIF-UHFFFAOYSA-N 2-bromo-1-(2,4-dichlorophenyl)ethanone Chemical compound ClC1=CC=C(C(=O)CBr)C(Cl)=C1 DASJDMQCPIDJIF-UHFFFAOYSA-N 0.000 description 7
- 241000894006 Bacteria Species 0.000 description 7
- 241000233866 Fungi Species 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- 125000001309 chloro group Chemical group Cl* 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 230000000844 anti-bacterial effect Effects 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- 235000009518 sodium iodide Nutrition 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- FLAYZKKEOIAALB-UHFFFAOYSA-N 2-bromo-1-(4-chlorophenyl)ethanone Chemical compound ClC1=CC=C(C(=O)CBr)C=C1 FLAYZKKEOIAALB-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 4
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 3
- XKTYXVDYIKIYJP-UHFFFAOYSA-N 3h-dioxole Chemical compound C1OOC=C1 XKTYXVDYIKIYJP-UHFFFAOYSA-N 0.000 description 3
- KBIWNQVZKHSHTI-UHFFFAOYSA-N 4-n,4-n-dimethylbenzene-1,4-diamine;oxalic acid Chemical compound OC(=O)C(O)=O.CN(C)C1=CC=C(N)C=C1 KBIWNQVZKHSHTI-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 125000005998 bromoethyl group Chemical group 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000005907 ketalization reaction Methods 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BOULDCYZLOKTGR-UHFFFAOYSA-N 1-(2-chloro-4-fluorophenyl)-2-imidazol-1-ylethanone;hydrochloride Chemical compound Cl.ClC1=CC(F)=CC=C1C(=O)CN1C=NC=C1 BOULDCYZLOKTGR-UHFFFAOYSA-N 0.000 description 2
- PDJLFESXPVLVMR-UHFFFAOYSA-N 1-(3-bromo-4-methylphenyl)ethanone Chemical compound CC(=O)C1=CC=C(C)C(Br)=C1 PDJLFESXPVLVMR-UHFFFAOYSA-N 0.000 description 2
- AKIAOKWHBCDYGR-UHFFFAOYSA-N 1-(4-chloro-2-methoxyphenyl)ethanone Chemical compound COC1=CC(Cl)=CC=C1C(C)=O AKIAOKWHBCDYGR-UHFFFAOYSA-N 0.000 description 2
- IAKDLHAKDXXZBW-UHFFFAOYSA-N 1-but-3-enyl-4-phenylbenzene Chemical group C1=CC(CCC=C)=CC=C1C1=CC=CC=C1 IAKDLHAKDXXZBW-UHFFFAOYSA-N 0.000 description 2
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- IRSVDHPYXFLLDS-UHFFFAOYSA-N 2,4-dichloro-1-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1Cl IRSVDHPYXFLLDS-UHFFFAOYSA-N 0.000 description 2
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 2
- YFRGZQBENALZLU-UHFFFAOYSA-N 2-(bromomethyl)-2-(2-chlorophenyl)-4-(4-chlorophenyl)-1,3-dioxolane Chemical compound C1=CC(Cl)=CC=C1C1OC(CBr)(C=2C(=CC=CC=2)Cl)OC1 YFRGZQBENALZLU-UHFFFAOYSA-N 0.000 description 2
- SMKKEOQDQNCTGL-UHFFFAOYSA-N 2-[(2-nitrophenoxy)methyl]oxirane Chemical compound [O-][N+](=O)C1=CC=CC=C1OCC1OC1 SMKKEOQDQNCTGL-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- JTVKNGZCUGWDET-UHFFFAOYSA-N 3-(2-chloro-4-phenylphenoxy)propane-1,2-diol Chemical compound C1=C(Cl)C(OCC(O)CO)=CC=C1C1=CC=CC=C1 JTVKNGZCUGWDET-UHFFFAOYSA-N 0.000 description 2
- WGWZRXZUUBPRKT-UHFFFAOYSA-N 3-(5-chloro-2-methylphenoxy)propane-1,2-diol Chemical compound CC1=CC=C(Cl)C=C1OCC(O)CO WGWZRXZUUBPRKT-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- LJANCPRIUMHGJE-UHFFFAOYSA-N 4-(2-bromoacetyl)benzonitrile Chemical compound BrCC(=O)C1=CC=C(C#N)C=C1 LJANCPRIUMHGJE-UHFFFAOYSA-N 0.000 description 2
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- 241001155428 Ambloplites cavifrons Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- 241000192125 Firmicutes Species 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- 241000235395 Mucor Species 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-L Oxalate Chemical compound [O-]C(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-L 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 2
- BMRWNKZVCUKKSR-UHFFFAOYSA-N butane-1,2-diol Chemical compound CCC(O)CO BMRWNKZVCUKKSR-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 239000002054 inoculum Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 1
- BOHGAOWOIJMTPZ-UHFFFAOYSA-N 1,3-dioxolan-4-ylmethanol Chemical compound OCC1COCO1 BOHGAOWOIJMTPZ-UHFFFAOYSA-N 0.000 description 1
- OPPQOJRXXODMKR-UHFFFAOYSA-N 1-(2,4,5-trichlorophenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(Cl)C=C1Cl OPPQOJRXXODMKR-UHFFFAOYSA-N 0.000 description 1
- YIXIFRPLPBELQD-UHFFFAOYSA-N 1-(2,4-dibromophenyl)-2-imidazol-1-ylethanone;hydrochloride Chemical compound Cl.BrC1=CC(Br)=CC=C1C(=O)CN1C=NC=C1 YIXIFRPLPBELQD-UHFFFAOYSA-N 0.000 description 1
- PFNFQYGPUFVXPB-UHFFFAOYSA-N 1-(2,4-dibromophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Br)C=C1Br PFNFQYGPUFVXPB-UHFFFAOYSA-N 0.000 description 1
- HZAZETJSOZQUJL-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)ethane-1,2-diol Chemical compound OCC(O)C1=CC=C(Cl)C=C1Cl HZAZETJSOZQUJL-UHFFFAOYSA-N 0.000 description 1
- QIVMDIMEYSDOSD-UHFFFAOYSA-N 1-(4-chlorophenyl)ethane-1,2-diol Chemical compound OCC(O)C1=CC=C(Cl)C=C1 QIVMDIMEYSDOSD-UHFFFAOYSA-N 0.000 description 1
- HLQZCRVEEQKNMS-UHFFFAOYSA-N 1-(chloromethyl)-4-phenylbenzene Chemical group C1=CC(CCl)=CC=C1C1=CC=CC=C1 HLQZCRVEEQKNMS-UHFFFAOYSA-N 0.000 description 1
- PWMWNFMRSKOCEY-UHFFFAOYSA-N 1-Phenyl-1,2-ethanediol Chemical compound OCC(O)C1=CC=CC=C1 PWMWNFMRSKOCEY-UHFFFAOYSA-N 0.000 description 1
- BTFMCMVEUCGQDX-UHFFFAOYSA-N 1-[10-[3-[4-(2-hydroxyethyl)-1-piperidinyl]propyl]-2-phenothiazinyl]ethanone Chemical compound C12=CC(C(=O)C)=CC=C2SC2=CC=CC=C2N1CCCN1CCC(CCO)CC1 BTFMCMVEUCGQDX-UHFFFAOYSA-N 0.000 description 1
- DLZJKMXJMXKFKW-UHFFFAOYSA-N 1-[[2-(2-chlorophenyl)-4-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound C1=CC(Cl)=CC=C1C1OC(CN2C=NC=C2)(C=2C(=CC=CC=2)Cl)OC1 DLZJKMXJMXKFKW-UHFFFAOYSA-N 0.000 description 1
- CNTTWQOWWZEXEQ-UHFFFAOYSA-N 1-[[2-(4-chlorophenyl)-4-phenyl-1,3-dioxolan-2-yl]methyl]imidazole Chemical compound C1=CC(Cl)=CC=C1C1(CN2C=NC=C2)OC(C=2C=CC=CC=2)CO1 CNTTWQOWWZEXEQ-UHFFFAOYSA-N 0.000 description 1
- UYCYGSBJRFEXKQ-UHFFFAOYSA-N 1-chloro-4-(2,4-dichlorophenyl)butan-2-ol Chemical compound ClCC(O)CCC1=CC=C(Cl)C=C1Cl UYCYGSBJRFEXKQ-UHFFFAOYSA-N 0.000 description 1
- NYFIDHXRJSCAOZ-UHFFFAOYSA-N 1-fluoro-4-prop-2-enylbenzene Chemical compound FC1=CC=C(CC=C)C=C1 NYFIDHXRJSCAOZ-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical class C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- QSWSKDXFOIOXKW-UHFFFAOYSA-N 1h-imidazole;nitric acid Chemical compound O[N+]([O-])=O.C1=CNC=N1 QSWSKDXFOIOXKW-UHFFFAOYSA-N 0.000 description 1
- QHXXHJLSKPQNAQ-UHFFFAOYSA-N 2-(1,3-dioxolan-2-ylmethyl)-1h-imidazole Chemical class N=1C=CNC=1CC1OCCO1 QHXXHJLSKPQNAQ-UHFFFAOYSA-N 0.000 description 1
- 125000003070 2-(2-chlorophenyl)ethyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- FCVQDADWCGVNDK-UHFFFAOYSA-N 2-(2-methylphenyl)naphthalene Chemical compound CC1=CC=CC=C1C1=CC=C(C=CC=C2)C2=C1 FCVQDADWCGVNDK-UHFFFAOYSA-N 0.000 description 1
- SOUWNEVAZOQRDI-UHFFFAOYSA-N 2-(bromomethyl)-2,4-bis(4-chlorophenyl)-1,3-dioxolane Chemical compound C1=CC(Cl)=CC=C1C1OC(CBr)(C=2C=CC(Cl)=CC=2)OC1 SOUWNEVAZOQRDI-UHFFFAOYSA-N 0.000 description 1
- PIVQOLRJROCTMB-UHFFFAOYSA-N 2-(bromomethyl)-2,4-diphenyl-1,3-dioxolane Chemical compound O1C(CBr)(C=2C=CC=CC=2)OCC1C1=CC=CC=C1 PIVQOLRJROCTMB-UHFFFAOYSA-N 0.000 description 1
- LWWXFTYNQHKYBW-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-(2-phenylethyl)-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1C1(CBr)OC(CCC=2C=CC=CC=2)CO1 LWWXFTYNQHKYBW-UHFFFAOYSA-N 0.000 description 1
- KMOSIJXDCFLUJW-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-[2-(2,4-dichlorophenyl)ethyl]-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1CCC1OC(CBr)(C=2C(=CC(Cl)=CC=2)Cl)OC1 KMOSIJXDCFLUJW-UHFFFAOYSA-N 0.000 description 1
- HMGCTAYTBAOBHQ-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-[2-(2,6-dichlorophenyl)ethyl]-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1C1(CBr)OC(CCC=2C(=CC=CC=2Cl)Cl)CO1 HMGCTAYTBAOBHQ-UHFFFAOYSA-N 0.000 description 1
- SXLADSHRRRNPCI-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-[2-(4-methylphenyl)ethyl]-1,3-dioxolane Chemical compound C1=CC(C)=CC=C1CCC1OC(CBr)(C=2C(=CC(Cl)=CC=2)Cl)OC1 SXLADSHRRRNPCI-UHFFFAOYSA-N 0.000 description 1
- IQDVZFOQDWRRNS-UHFFFAOYSA-N 2-(bromomethyl)-2-(4-chloro-2-methylphenyl)-1,3-dioxolane Chemical compound CC1=CC(Cl)=CC=C1C1(CBr)OCCO1 IQDVZFOQDWRRNS-UHFFFAOYSA-N 0.000 description 1
- ROVBCJBEIFIHMH-UHFFFAOYSA-N 2-(bromomethyl)-4-[(2-chloro-5-methylphenoxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound CC1=CC=C(Cl)C(OCC2OC(CBr)(OC2)C=2C(=CC(Cl)=CC=2)Cl)=C1 ROVBCJBEIFIHMH-UHFFFAOYSA-N 0.000 description 1
- ORQAJYGSKYQVAT-UHFFFAOYSA-N 2-(bromomethyl)-4-[(4-bromophenyl)sulfanylmethyl]-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1C1(CBr)OC(CSC=2C=CC(Br)=CC=2)CO1 ORQAJYGSKYQVAT-UHFFFAOYSA-N 0.000 description 1
- PYRRPRGFBHNGMK-UHFFFAOYSA-N 2-(bromomethyl)-4-[(5-chloro-2-methylphenoxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound CC1=CC=C(Cl)C=C1OCC1OC(CBr)(C=2C(=CC(Cl)=CC=2)Cl)OC1 PYRRPRGFBHNGMK-UHFFFAOYSA-N 0.000 description 1
- XZMIERJCHDPBSY-UHFFFAOYSA-N 2-(bromomethyl)-4-[2-(2-chlorophenyl)ethyl]-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1C1(CBr)OC(CCC=2C(=CC=CC=2)Cl)CO1 XZMIERJCHDPBSY-UHFFFAOYSA-N 0.000 description 1
- DDNXBEXPEJSQKS-UHFFFAOYSA-N 2-(bromomethyl)-4-[2-(4-chlorophenyl)ethyl]-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound C1=CC(Cl)=CC=C1CCC1OC(CBr)(C=2C(=CC(Cl)=CC=2)Cl)OC1 DDNXBEXPEJSQKS-UHFFFAOYSA-N 0.000 description 1
- DSSOLAACUJVYTK-UHFFFAOYSA-N 2-(chloromethyl)-4-[(2,4-dichlorophenoxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound O1C(CCl)(C=2C(=CC(Cl)=CC=2)Cl)OCC1COC1=CC=C(Cl)C=C1Cl DSSOLAACUJVYTK-UHFFFAOYSA-N 0.000 description 1
- DAGBZRAFMXTXNY-UHFFFAOYSA-N 2-[(2-chloro-5-methylphenoxy)methyl]oxirane Chemical compound CC1=CC=C(Cl)C(OCC2OC2)=C1 DAGBZRAFMXTXNY-UHFFFAOYSA-N 0.000 description 1
- QCILLASWZBODND-UHFFFAOYSA-N 2-[(3,4,5-trichlorophenoxy)methyl]oxirane Chemical compound ClC1=C(Cl)C(Cl)=CC(OCC2OC2)=C1 QCILLASWZBODND-UHFFFAOYSA-N 0.000 description 1
- KAKVFQDCNJBRFO-UHFFFAOYSA-N 2-[(4-fluorophenyl)methyl]oxirane Chemical compound C1=CC(F)=CC=C1CC1OC1 KAKVFQDCNJBRFO-UHFFFAOYSA-N 0.000 description 1
- RCLSWDFGAPNVGZ-UHFFFAOYSA-N 2-[2-(2,4-dichlorophenyl)ethyl]oxirane Chemical compound ClC1=CC(Cl)=CC=C1CCC1OC1 RCLSWDFGAPNVGZ-UHFFFAOYSA-N 0.000 description 1
- GPPRXWUEJFPEDL-UHFFFAOYSA-N 2-bromo-1-(2-chloro-4-fluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CBr)C(Cl)=C1 GPPRXWUEJFPEDL-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZIBOAPBPXIPVLG-UHFFFAOYSA-N 3-(2,4-dichlorophenoxy)propane-1,2-diol Chemical compound OCC(O)COC1=CC=C(Cl)C=C1Cl ZIBOAPBPXIPVLG-UHFFFAOYSA-N 0.000 description 1
- QCCWKOASVQZXJG-UHFFFAOYSA-N 3-(2,5-dimethylphenoxy)propane-1,2-diol Chemical compound CC1=CC=C(C)C(OCC(O)CO)=C1 QCCWKOASVQZXJG-UHFFFAOYSA-N 0.000 description 1
- VYYIKGCZHKHONW-UHFFFAOYSA-N 3-(2-nitrophenoxy)propane-1,2-diol Chemical compound OCC(O)COC1=CC=CC=C1[N+]([O-])=O VYYIKGCZHKHONW-UHFFFAOYSA-N 0.000 description 1
- BWAUGRRSICBHBP-UHFFFAOYSA-N 3-(4-benzylphenoxy)propane-1,2-diol Chemical compound C1=CC(OCC(O)CO)=CC=C1CC1=CC=CC=C1 BWAUGRRSICBHBP-UHFFFAOYSA-N 0.000 description 1
- FZGZDDRZAZBANV-UHFFFAOYSA-N 3-(4-bromophenoxy)propane-1,2-diol Chemical compound OCC(O)COC1=CC=C(Br)C=C1 FZGZDDRZAZBANV-UHFFFAOYSA-N 0.000 description 1
- CKHZHKCVWQOOGA-UHFFFAOYSA-N 3-(4-bromophenyl)sulfanylpropane-1,2-diol Chemical compound OCC(O)CSC1=CC=C(Br)C=C1 CKHZHKCVWQOOGA-UHFFFAOYSA-N 0.000 description 1
- LWPDMZCIJPWDLC-UHFFFAOYSA-N 3-(4-chloronaphthalen-1-yl)oxypropane-1,2-diol Chemical compound C1=CC=C2C(OCC(O)CO)=CC=C(Cl)C2=C1 LWPDMZCIJPWDLC-UHFFFAOYSA-N 0.000 description 1
- IMXUYOYYNZMNDM-UHFFFAOYSA-N 3-(4-phenylphenoxy)propane-1,2-diol Chemical compound C1=CC(OCC(O)CO)=CC=C1C1=CC=CC=C1 IMXUYOYYNZMNDM-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- MOQVHOPVBREXLY-UHFFFAOYSA-N 3h-dioxol-4-ylmethanol Chemical compound OCC1=COOC1 MOQVHOPVBREXLY-UHFFFAOYSA-N 0.000 description 1
- GFMKMFIVDBJZPZ-UHFFFAOYSA-N 4-(2,4-dichlorophenyl)butane-2,2-diol Chemical compound CC(O)(O)CCC1=CC=C(Cl)C=C1Cl GFMKMFIVDBJZPZ-UHFFFAOYSA-N 0.000 description 1
- JAUIFSGPFIKAFA-UHFFFAOYSA-N 4-(2-chlorophenyl)butane-2,2-diol Chemical compound CC(O)(O)CCC1=CC=CC=C1Cl JAUIFSGPFIKAFA-UHFFFAOYSA-N 0.000 description 1
- ZFHUHPNDGVGXMS-UHFFFAOYSA-N 4-(hydroxymethyl)benzaldehyde Chemical compound OCC1=CC=C(C=O)C=C1 ZFHUHPNDGVGXMS-UHFFFAOYSA-N 0.000 description 1
- UPIQMVADUQYNGB-UHFFFAOYSA-N 4-[2-(bromomethyl)-1,3-dioxolan-2-yl]benzonitrile Chemical compound C=1C=C(C#N)C=CC=1C1(CBr)OCCO1 UPIQMVADUQYNGB-UHFFFAOYSA-N 0.000 description 1
- XRUKSARUAXTNEA-UHFFFAOYSA-N 4-amino-2-hydroxybenzoic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1.NC1=CC=C(C(O)=O)C(O)=C1 XRUKSARUAXTNEA-UHFFFAOYSA-N 0.000 description 1
- LVSPDZAGCBEQAV-UHFFFAOYSA-N 4-chloronaphthalen-1-ol Chemical compound C1=CC=C2C(O)=CC=C(Cl)C2=C1 LVSPDZAGCBEQAV-UHFFFAOYSA-N 0.000 description 1
- GBPBXBUHZSOKTH-UHFFFAOYSA-N 4-chloropiperidine Chemical compound ClC1CCNCC1 GBPBXBUHZSOKTH-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- LVQFHDAKZHGEAJ-UHFFFAOYSA-M 4-methylbenzenesulfonate Chemical compound [CH2]C1=CC=C(S([O-])(=O)=O)C=C1 LVQFHDAKZHGEAJ-UHFFFAOYSA-M 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001225321 Aspergillus fumigatus Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241001341614 Basidiobolus meristosporus Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100231508 Caenorhabditis elegans ceh-5 gene Proteins 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 241000222178 Candida tropicalis Species 0.000 description 1
- 229910020194 CeH2 Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 201000007336 Cryptococcosis Diseases 0.000 description 1
- 241000221204 Cryptococcus neoformans Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000186810 Erysipelothrix rhusiopathiae Species 0.000 description 1
- PLUBXMRUUVWRLT-UHFFFAOYSA-N Ethyl methanesulfonate Chemical group CCOS(C)(=O)=O PLUBXMRUUVWRLT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000144128 Lichtheimia corymbifera Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 241000893980 Microsporum canis Species 0.000 description 1
- 241000235575 Mortierella Species 0.000 description 1
- VIHYIVKEECZGOU-UHFFFAOYSA-N N-acetylimidazole Chemical compound CC(=O)N1C=CN=C1 VIHYIVKEECZGOU-UHFFFAOYSA-N 0.000 description 1
- MMPOTNFPDMJTRR-UHFFFAOYSA-N OOOOOOOOOOO Chemical compound OOOOOOOOOOO MMPOTNFPDMJTRR-UHFFFAOYSA-N 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- 241001531356 Phialophora verrucosa Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000235527 Rhizopus Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000607683 Salmonella enterica subsp. enterica serovar Pullorum Species 0.000 description 1
- 241000233667 Saprolegnia Species 0.000 description 1
- 241001149963 Sporothrix schenckii Species 0.000 description 1
- 241000191984 Staphylococcus haemolyticus Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 1
- 241000223229 Trichophyton rubrum Species 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- VJZJGRMLFMJRGG-BXUZGUMPSA-N [(2s,4r)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol Chemical compound O1[C@H](CO)CO[C@]1(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 VJZJGRMLFMJRGG-BXUZGUMPSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 210000000436 anus Anatomy 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229940091771 aspergillus fumigatus Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- QSOGFAUURRNUSX-UHFFFAOYSA-N benzaldehyde;nitric acid Chemical compound O[N+]([O-])=O.O=CC1=CC=CC=C1 QSOGFAUURRNUSX-UHFFFAOYSA-N 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- OZYLKGCKPZLAKG-UHFFFAOYSA-N butan-1-ol;4-methylbenzenesulfonic acid Chemical compound CCCCO.CC1=CC=C(S(O)(=O)=O)C=C1 OZYLKGCKPZLAKG-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- MYTMXVHNEWBFAL-UHFFFAOYSA-L dipotassium;carbonate;hydrate Chemical compound O.[K+].[K+].[O-]C([O-])=O MYTMXVHNEWBFAL-UHFFFAOYSA-L 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- HCPOCMMGKBZWSJ-UHFFFAOYSA-N ethyl 3-hydrazinyl-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)NN HCPOCMMGKBZWSJ-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 239000005414 inactive ingredient Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 1
- 244000000010 microbial pathogen Species 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 231100000194 ovacidal Toxicity 0.000 description 1
- 230000003151 ovacidal effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 229960004265 piperacetazine Drugs 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- LJZPPWWHKPGCHS-UHFFFAOYSA-N propargyl chloride Chemical compound ClCC#C LJZPPWWHKPGCHS-UHFFFAOYSA-N 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- LACHTKPTWJUZBJ-UHFFFAOYSA-N sulfo hydrogen sulfate;hydrate Chemical compound O.OS(=O)(=O)OS(O)(=O)=O LACHTKPTWJUZBJ-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-N trans-cinnamic acid Chemical compound OC(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/544,157 US3936470A (en) | 1975-01-27 | 1975-01-27 | 1,3-Dioxolan-2-ylmethylimidazoles |
| US61986375A | 1975-10-06 | 1975-10-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS202001B2 true CS202001B2 (en) | 1980-12-31 |
Family
ID=27067525
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS48576A CS202001B2 (en) | 1975-01-27 | 1976-01-26 | Process for preparing derivative of imidazole |
Country Status (14)
| Country | Link |
|---|---|
| CS (1) | CS202001B2 (xx) |
| DK (1) | DK157300C (xx) |
| ES (1) | ES444667A1 (xx) |
| FI (1) | FI62081C (xx) |
| HU (1) | HU174593B (xx) |
| IE (1) | IE43157B1 (xx) |
| IL (1) | IL48902A (xx) |
| MX (1) | MX3143E (xx) |
| NZ (1) | NZ179231A (xx) |
| PH (1) | PH13605A (xx) |
| PL (1) | PL101460B1 (xx) |
| PT (1) | PT64741B (xx) |
| SU (1) | SU850006A3 (xx) |
| YU (1) | YU39956B (xx) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3575999A (en) * | 1968-08-19 | 1971-04-20 | Janssen Pharmaceutica Nv | Ketal derivatives of imidazole |
-
1975
- 1975-11-12 NZ NZ17923175A patent/NZ179231A/xx unknown
- 1975-12-03 MX MX46175U patent/MX3143E/es unknown
- 1975-12-29 PH PH17929A patent/PH13605A/en unknown
-
1976
- 1976-01-15 YU YU11276A patent/YU39956B/xx unknown
- 1976-01-21 SU SU762312703A patent/SU850006A3/ru active
- 1976-01-26 IL IL48902A patent/IL48902A/xx unknown
- 1976-01-26 DK DK30276A patent/DK157300C/da not_active IP Right Cessation
- 1976-01-26 FI FI760175A patent/FI62081C/fi not_active IP Right Cessation
- 1976-01-26 PT PT6474176A patent/PT64741B/pt unknown
- 1976-01-26 PL PL18681476A patent/PL101460B1/pl unknown
- 1976-01-26 IE IE13976A patent/IE43157B1/en unknown
- 1976-01-26 HU HU76JA748A patent/HU174593B/hu not_active IP Right Cessation
- 1976-01-26 CS CS48576A patent/CS202001B2/cs unknown
- 1976-01-27 ES ES444667A patent/ES444667A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL48902A0 (en) | 1976-03-31 |
| PT64741B (fr) | 1978-01-04 |
| NZ179231A (en) | 1978-03-06 |
| PH13605A (en) | 1980-08-05 |
| PT64741A (fr) | 1976-02-01 |
| DK30276A (da) | 1976-07-28 |
| MX3143E (es) | 1980-05-09 |
| YU11276A (en) | 1983-01-21 |
| FI62081C (fi) | 1982-11-10 |
| SU850006A3 (ru) | 1981-07-23 |
| DK157300B (da) | 1989-12-04 |
| PL101460B1 (pl) | 1978-12-30 |
| IE43157L (en) | 1976-07-27 |
| FI62081B (fi) | 1982-07-30 |
| IL48902A (en) | 1979-10-31 |
| ES444667A1 (es) | 1977-11-16 |
| IE43157B1 (en) | 1980-12-31 |
| HU174593B (hu) | 1980-02-28 |
| YU39956B (en) | 1985-06-30 |
| DK157300C (da) | 1990-05-07 |
| FI760175A7 (xx) | 1976-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4139540A (en) | 2-Aryl-2-halomethyl-4-alkenyl-1,3-dioxolanes | |
| US4160838A (en) | Antimicrobial and plant-growth-regulating triazole derivatives | |
| US4079062A (en) | Triazole derivatives | |
| CS203098B2 (en) | Fungicide and agent for growth plants regulator and process for preparing efective compound | |
| US4916134A (en) | 4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1H-azolylmethyl)-1,3-dioxolan-4-yl]me]phenyl]-1-piperazinyl]phenyl]triazolones | |
| FI88505C (fi) | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara //4-/4-(4-fenyl-1-piperazinyl)fenoximetyl/-1,3-dioxolan-2-yl/metyl-1H-imidazol- och -1H-1,2,4-triazolderivat | |
| US4101664A (en) | 1-(2-Ar-4-aryloxymethyl-1,3-dioxolan-2-ylmethyl)-imidazoles | |
| AU600107B2 (en) | 4-(4-(4-((2-(2,4-difluorophenyl)-2-(1h-azolylmethyl)-1,3- dioxolan-4-yl)methoxy)phenyl)-1-piperazinyl)phenyl) triazolones | |
| HU194483B (en) | Fungicides containing as active substance derivatives of hydroxi-alkyl-asole and process for production of the active substances | |
| HU177458B (en) | Process for preparing new 1-/1,3-dioxolan-2-yl-methyl/-1h-imidazole derivatives | |
| CA1065873A (en) | Imidazole derivatives | |
| EP1654254A4 (en) | Antifungal azole derivatives having a fluorovinyl moiety and process for the preparation thereof | |
| HU189293B (en) | Fungicide compositions containing hydroxy-alkinyl-azolyl derivatives as active agents and process for producing the active agents | |
| SE434641B (sv) | 1-(2-aryl-1,3-dioxolan-2-ylmetyl)-1h-1,2,4-triazol-derivat och komposition for bekempning av svamp innehallande detta | |
| IL94660A (en) | 4-] 4-] 4-] 4 -]] 2-) 2,4-difluorophenyl (- H) -12-azolylmethyl (1,3-dioxolan-4-yl [methoxy] phenyl [-1-piprazinol [ Phenyl [triazelones and imidazole | |
| US4209447A (en) | Imidazole derivatives and intermediates in their preparation | |
| CS202001B2 (en) | Process for preparing derivative of imidazole | |
| US4141908A (en) | 2-Aryl-1,3-dioxolanes | |
| EP2907814A1 (en) | Method for producing cycloalkanol derivative, and method for producing azole derivative | |
| JPS59104381A (ja) | 抗糸状菌剤 | |
| Talismanov et al. | 3-(IMIDAZOL-1-YL) PROPANE-1, 2-DIOL AND 3-(1, 2, 4-TRIAZOL-1-YL) PROPANE-1, 2-DIOL: SYNTHESIS AND THEIR TRANSFORMATION TO BIOACTIVE CYCLIC KETALS. | |
| KR800000531B1 (ko) | 신규 이미다졸 유도체의 제조방법 | |
| TALISMANOV et al. | Synthesis of 3-(1H-azole-1-yl) propane-1, 2-diols and their use in the synthesis of biologically active 2, 2-disubstituted 4-(azole-1-ylmethyl)-1, 3-dioxolanes. | |
| KR810000676B1 (ko) | 디옥소란의 헤테로 고리치환체 제조방법 | |
| EP1395579B1 (de) | Verfahren zur herstellung von triazolymethyloxiranen |