CS200485B2 - Process for preparing 2-/4'-aminophenyl/-5-aminobenzimidazole - Google Patents
Process for preparing 2-/4'-aminophenyl/-5-aminobenzimidazole Download PDFInfo
- Publication number
- CS200485B2 CS200485B2 CS76190A CS19076A CS200485B2 CS 200485 B2 CS200485 B2 CS 200485B2 CS 76190 A CS76190 A CS 76190A CS 19076 A CS19076 A CS 19076A CS 200485 B2 CS200485 B2 CS 200485B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- aniline
- acid
- parts
- nitrobenzoyl
- aminophenyl
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 22
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910017604 nitric acid Inorganic materials 0.000 claims abstract description 8
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 37
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 20
- 238000002360 preparation method Methods 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- XAFOTXWPFVZQAZ-UHFFFAOYSA-N 2-(4-aminophenyl)-3h-benzimidazol-5-amine Chemical compound C1=CC(N)=CC=C1C1=NC2=CC=C(N)C=C2N1 XAFOTXWPFVZQAZ-UHFFFAOYSA-N 0.000 claims description 5
- 229920001021 polysulfide Polymers 0.000 claims description 5
- 239000005077 polysulfide Substances 0.000 claims description 5
- 150000008117 polysulfides Polymers 0.000 claims description 5
- KCBREZOWOLOPLW-UHFFFAOYSA-N 4-nitro-n-phenylbenzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)NC1=CC=CC=C1 KCBREZOWOLOPLW-UHFFFAOYSA-N 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 238000006396 nitration reaction Methods 0.000 claims description 4
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- HNTAKXSYJOAFSG-UHFFFAOYSA-N n-(2,4-dinitrophenyl)-4-nitrobenzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HNTAKXSYJOAFSG-UHFFFAOYSA-N 0.000 claims description 3
- 230000002829 reductive effect Effects 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 238000006210 cyclodehydration reaction Methods 0.000 claims 4
- ZGSDJMADBJCNPN-UHFFFAOYSA-N [S-][NH3+] Chemical compound [S-][NH3+] ZGSDJMADBJCNPN-UHFFFAOYSA-N 0.000 claims 1
- HIVLDXAAFGCOFU-UHFFFAOYSA-N ammonium hydrosulfide Chemical compound [NH4+].[SH-] HIVLDXAAFGCOFU-UHFFFAOYSA-N 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 12
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- 230000002140 halogenating effect Effects 0.000 abstract description 3
- 150000004820 halides Chemical class 0.000 abstract 3
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 abstract 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 abstract 1
- WFRXSXUDWCVSPI-UHFFFAOYSA-N 3h-benzimidazol-5-amine Chemical compound NC1=CC=C2NC=NC2=C1 WFRXSXUDWCVSPI-UHFFFAOYSA-N 0.000 abstract 1
- 230000004048 modification Effects 0.000 abstract 1
- 238000012986 modification Methods 0.000 abstract 1
- 238000003786 synthesis reaction Methods 0.000 abstract 1
- 239000000047 product Substances 0.000 description 26
- 239000000203 mixture Substances 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 238000010992 reflux Methods 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- -1 4-pyridinylphenyl Chemical group 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 3
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- DWYHDSLIWMUSOO-UHFFFAOYSA-N 2-phenyl-1h-benzimidazole Chemical class C1=CC=CC=C1C1=NC2=CC=CC=C2N1 DWYHDSLIWMUSOO-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000005708 Sodium hypochlorite Substances 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical group [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- OIOHBLGJVHERKJ-UHFFFAOYSA-N 2-(4-aminophenyl)-3H-benzimidazol-5-amine hydrochloride Chemical compound [Cl-].C1=CC(N)=CC=C1C1=[NH+]C2=CC(N)=CC=C2N1 OIOHBLGJVHERKJ-UHFFFAOYSA-N 0.000 description 1
- BWWHTIHDQBHTHP-UHFFFAOYSA-N 2-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1C(Cl)=O BWWHTIHDQBHTHP-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000003113 alkalizing effect Effects 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- ZLCCLBKPLLUIJC-UHFFFAOYSA-L disodium tetrasulfane-1,4-diide Chemical compound [Na+].[Na+].[S-]SS[S-] ZLCCLBKPLLUIJC-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical class Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- MPYOKHFSBKUKPQ-UHFFFAOYSA-N n'-phenylbenzenecarboximidamide Chemical class C=1C=CC=CC=1C(N)=NC1=CC=CC=C1 MPYOKHFSBKUKPQ-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000007243 oxidative cyclization reaction Methods 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006476 reductive cyclization reaction Methods 0.000 description 1
- SRRKNRDXURUMPP-UHFFFAOYSA-N sodium disulfide Chemical compound [Na+].[Na+].[S-][S-] SRRKNRDXURUMPP-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/18—Benzimidazoles; Hydrogenated benzimidazoles with aryl radicals directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7500924A FR2297849A1 (fr) | 1975-01-14 | 1975-01-14 | Nouveau procede de preparation du (amino-4' phenyl)-2 amino-5 benzimidazole |
| FR7535129A FR2332273A2 (fr) | 1975-11-18 | 1975-11-18 | Nouveau procede de preparation du (amino-4' phenyl)-2 amino-5 benzimidazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS200485B2 true CS200485B2 (en) | 1980-09-15 |
Family
ID=26218685
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS76190A CS200485B2 (en) | 1975-01-14 | 1976-01-12 | Process for preparing 2-/4'-aminophenyl/-5-aminobenzimidazole |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4109093A (enExample) |
| JP (1) | JPS5840545B2 (enExample) |
| BR (1) | BR7600157A (enExample) |
| CH (1) | CH612940A5 (enExample) |
| CS (1) | CS200485B2 (enExample) |
| DE (1) | DE2601041A1 (enExample) |
| GB (1) | GB1531161A (enExample) |
| IT (1) | IT1055787B (enExample) |
| NL (1) | NL7600274A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2742093A1 (de) * | 1977-09-19 | 1979-03-29 | Cassella Ag | Verfahren zur herstellung von 2-(3'- bzw. 4'-aminophenyl)-5(bzw. 6) -aminobenzimidazolen |
| FR2502151A1 (fr) * | 1981-03-20 | 1982-09-24 | Ugine Kuhlmann | Procede de preparation de l'(amino-4 phenyl)-2 amino-5 benzimidazole et de derives substitues |
| GB2125790A (en) * | 1982-08-24 | 1984-03-14 | Ici Plc | Manufacture of substituted phenylaminobenzimidazoles |
| JPS6012658U (ja) * | 1983-07-06 | 1985-01-28 | 本田技研工業株式会社 | 気化器 |
| RU2283307C1 (ru) * | 2005-07-18 | 2006-09-10 | Открытое акционерное общество "Каменскволокно" (ОАО "Каменскволокно") | Способ получения 5(6)-амино-2(4'-аминофенил)-бензимидазола |
| RU2348612C2 (ru) * | 2006-06-30 | 2009-03-10 | Евгений Львович Вулах | Способ получения 2',4,4'-тринитробензанилида |
| RU2345988C2 (ru) * | 2006-06-30 | 2009-02-10 | Евгений Львович Вулах | Способ получения 5(6)-амино-2-(4-аминофенил)бензимидазола |
| RU2394810C2 (ru) * | 2007-12-11 | 2010-07-20 | Евгений Львович Вулах | Способ получения 2', 4, 4'-тринитробензанилида |
| RU2547210C2 (ru) * | 2013-08-07 | 2015-04-10 | Общество с ограниченной ответственностью "Фенил" (ООО "Фенил") | Способ получения 5(6)-амино-2-(4-аминофенил)бензимидазола |
| EA024484B1 (ru) * | 2014-03-17 | 2016-09-30 | Публичное акционерное общество "Химпром" | Способ получения 5-амино-2-(4-аминофенил)-1н-бензимидазола |
| RU2560881C1 (ru) * | 2014-06-10 | 2015-08-20 | Общество с ограниченной ответственностью "Фенил" (ООО "Фенил") | Способ получения 2',4,4'-тринитробензанилида из анилина и 4-нитробензойной кислоты |
| CN115850188A (zh) * | 2022-11-25 | 2023-03-28 | 常州市阳光药业有限公司 | 2-(2-氯-4-氨基苯基)-5-氨基苯并咪唑的合成方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE70862C (de) * | FARBWERKE VORM. MEISTER LUCIUS & BRÜNING in Höchst a. M | Verfahren zur Darstellung des p-Diamidophenylbenzimidazols | ||
| US3235559A (en) * | 1966-02-15 | Process for the production of z-mercaptobenzimidazole | ||
| US3192226A (en) * | 1965-06-29 | Certain l-axyl-z-(z -naphthyl)-benzim- i idazqle compounds | ||
| US3161678A (en) * | 1956-12-17 | 1964-12-15 | Ile De France | Process for making "ortho-chloroprocaine amide" |
| US3013051A (en) * | 1958-10-20 | 1961-12-12 | Velsicol Chemical Corp | 2-methoxy-5-nitro-3, 6-dichloro-benzoates |
| CH483276A (de) * | 1959-09-23 | 1969-12-31 | Ciba Geigy | Verwendung von 2-Phenyl-benzazolen als Schutzmittel vor ultravioletter Strahlung ausserhalb der Textilindustrie |
| CH457453A (de) * | 1964-01-24 | 1968-06-15 | Shionogi & Co | Verfahren zur Herstellung neuer 1H-Naphto(2,3-d)imidazol-Derivate |
| US3632397A (en) * | 1966-01-26 | 1972-01-04 | Lilly Co Eli | Method of controlling weeds pre-emergently |
| NL6715600A (enExample) * | 1966-12-02 | 1968-06-04 | ||
| US3485865A (en) * | 1967-04-05 | 1969-12-23 | Velsicol Chemical Corp | N-methoxy and n-ethoxy benzamides |
| DE1770658A1 (de) * | 1968-06-19 | 1971-11-11 | Hoechst Ag | N-Hydroxi-benzimidazole,ihre Herstellung und Verwendung als Herbicide |
| DE2213799A1 (de) * | 1972-03-22 | 1973-09-27 | Bayer Ag | Verfahren zur herstellung von 2,5dichlor-3-nitro-benzoesaeure |
-
1976
- 1976-01-07 US US05/647,240 patent/US4109093A/en not_active Expired - Lifetime
- 1976-01-12 CS CS76190A patent/CS200485B2/cs unknown
- 1976-01-13 NL NL7600274A patent/NL7600274A/xx not_active Application Discontinuation
- 1976-01-13 BR BR7600157A patent/BR7600157A/pt unknown
- 1976-01-13 GB GB1146/76A patent/GB1531161A/en not_active Expired
- 1976-01-13 DE DE19762601041 patent/DE2601041A1/de not_active Ceased
- 1976-01-13 CH CH32876A patent/CH612940A5/xx not_active IP Right Cessation
- 1976-01-14 JP JP51003741A patent/JPS5840545B2/ja not_active Expired
- 1976-01-14 IT IT67073/76A patent/IT1055787B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5840545B2 (ja) | 1983-09-06 |
| NL7600274A (nl) | 1976-07-16 |
| IT1055787B (it) | 1982-01-11 |
| JPS5195072A (en) | 1976-08-20 |
| US4109093A (en) | 1978-08-22 |
| BR7600157A (pt) | 1976-08-31 |
| DE2601041A1 (de) | 1976-07-15 |
| CH612940A5 (enExample) | 1979-08-31 |
| GB1531161A (en) | 1978-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS200485B2 (en) | Process for preparing 2-/4'-aminophenyl/-5-aminobenzimidazole | |
| US4122118A (en) | Copper-N-methylpyrrolidone catalyst useful in the production of nitrodiphenyl amines | |
| US4452738A (en) | Process for the manufacture of 5-carbamoyl-10-oxo-10,11-dihydro-5H-dibenz[b,]azepine | |
| JP5525515B2 (ja) | 2−ハロ−4−ニトロイミダゾール及びその中間体の製造方法 | |
| US4192947A (en) | Process for the production of aminophenylaminobenzimidazoles | |
| Nielsen et al. | Synthesis of polynitro compounds. Peroxydisulfuric acid oxidation of polynitroarylamines to polynitro aromatics | |
| US3192263A (en) | Production of dinitrophenyl and diaminophenyl ethers | |
| Stadlbauer et al. | Thermal cyclization of 4‐azido‐3‐nitropyridines to furoxanes | |
| JPS6147829B2 (enExample) | ||
| US5262539A (en) | Process for the preparation of aromatic amines | |
| RU2283307C1 (ru) | Способ получения 5(6)-амино-2(4'-аминофенил)-бензимидазола | |
| RU2345988C2 (ru) | Способ получения 5(6)-амино-2-(4-аминофенил)бензимидазола | |
| GB1581407A (en) | Production of condensed triazoles | |
| US4302599A (en) | Process for nitrating anilides | |
| US3101344A (en) | Process for preparing tetracyano-1,4-dithiin | |
| US2216515A (en) | Production of nitro-mercaptodiphenylamines | |
| NO160510B (no) | Fremgangsm te fo separere nitreringsisomerer av subuerte benzenforbindelser. | |
| US3719717A (en) | Process for the production of aromatic dinitrohalogen compounds | |
| NO132800B (enExample) | ||
| SU897108A3 (ru) | Способ получени 2,6-динитропроизводных N-алкил или N,N-диалкиланилинов | |
| RU2053223C1 (ru) | Способ получения 6-бром-2-амино-4-нитрофенола | |
| US4451681A (en) | Methods of preparing pentanitrotoluene | |
| PL103750B1 (pl) | Sposob wytwarzania n-cykloheksylo-n-metylo-n-(2-amino-3,5-dwubromobenzylo)-aminy | |
| KR800000992B1 (ko) | 0-(2, 6-디클로로 아닐리노) 페닐 초산의 제조방법 | |
| Johnson et al. | HYDANTOINS: SYNTHESIS OF THE HYDANTOIN OF 3-AMINO-TYROSINE.[SEVENTEENTH PAPER.] |