CS200467B2 - Process for preparing 2,2,6,6-tetramethyl-4-oxopiperidine - Google Patents
Process for preparing 2,2,6,6-tetramethyl-4-oxopiperidine Download PDFInfo
- Publication number
- CS200467B2 CS200467B2 CS744395A CS439574A CS200467B2 CS 200467 B2 CS200467 B2 CS 200467B2 CS 744395 A CS744395 A CS 744395A CS 439574 A CS439574 A CS 439574A CS 200467 B2 CS200467 B2 CS 200467B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- acetone
- acetonine
- water
- hydrate
- process according
- Prior art date
Links
- JWUXJYZVKZKLTJ-UHFFFAOYSA-N Triacetonamine Chemical compound CC1(C)CC(=O)CC(C)(C)N1 JWUXJYZVKZKLTJ-UHFFFAOYSA-N 0.000 title abstract description 9
- 238000004519 manufacturing process Methods 0.000 title 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims abstract description 64
- PIFBMJMXJMZZRG-UHFFFAOYSA-N 2,2,4,6,6-pentamethyl-1,5-dihydropyrimidine Chemical compound CC1=NC(C)(C)NC(C)(C)C1 PIFBMJMXJMZZRG-UHFFFAOYSA-N 0.000 claims abstract description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 19
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000007859 condensation product Substances 0.000 claims abstract description 6
- 239000002904 solvent Substances 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 11
- CQTRUFMMCCOKTA-UHFFFAOYSA-N 4-amino-4-methylpentan-2-one Chemical compound CC(=O)CC(C)(C)N CQTRUFMMCCOKTA-UHFFFAOYSA-N 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Natural products CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 2
- BCDGQXUMWHRQCB-UHFFFAOYSA-N glycine methyl ketone Natural products CC(=O)CN BCDGQXUMWHRQCB-UHFFFAOYSA-N 0.000 claims description 2
- 239000003791 organic solvent mixture Substances 0.000 claims 2
- 125000004386 diacrylate group Chemical group 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 claims 1
- OZXIZRZFGJZWBF-UHFFFAOYSA-N 1,3,5-trimethyl-2-(2,4,6-trimethylphenoxy)benzene Chemical compound CC1=CC(C)=CC(C)=C1OC1=C(C)C=C(C)C=C1C OZXIZRZFGJZWBF-UHFFFAOYSA-N 0.000 abstract description 4
- SHOJXDKTYKFBRD-UHFFFAOYSA-N mesityl oxide Natural products CC(C)=CC(C)=O SHOJXDKTYKFBRD-UHFFFAOYSA-N 0.000 abstract description 4
- 239000003960 organic solvent Substances 0.000 abstract description 4
- 150000001298 alcohols Chemical class 0.000 abstract description 3
- 150000002170 ethers Chemical class 0.000 abstract description 3
- 150000003839 salts Chemical class 0.000 abstract description 3
- 239000002253 acid Substances 0.000 abstract description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 abstract description 2
- 229930195733 hydrocarbon Natural products 0.000 abstract description 2
- 150000002430 hydrocarbons Chemical class 0.000 abstract description 2
- 239000002798 polar solvent Substances 0.000 abstract description 2
- 238000010438 heat treatment Methods 0.000 abstract 2
- FTVFPPFZRRKJIH-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-amine Chemical compound CC1(C)CC(N)CC(C)(C)N1 FTVFPPFZRRKJIH-UHFFFAOYSA-N 0.000 abstract 1
- 239000003377 acid catalyst Substances 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 150000002825 nitriles Chemical class 0.000 abstract 1
- MTZWHHIREPJPTG-UHFFFAOYSA-N phorone Chemical compound CC(C)=CC(=O)C=C(C)C MTZWHHIREPJPTG-UHFFFAOYSA-N 0.000 abstract 1
- 229930193351 phorone Natural products 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 238000004821 distillation Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- -1 methylene chloride Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003518 caustics Substances 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- KXZUWTXQPYQEFV-UHFFFAOYSA-N 1,3-dihydroxybutan-2-one Chemical compound CC(O)C(=O)CO KXZUWTXQPYQEFV-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 102000007469 Actins Human genes 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- KVSASDOGYIBWTA-UHFFFAOYSA-N chloro benzoate Chemical compound ClOC(=O)C1=CC=CC=C1 KVSASDOGYIBWTA-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- LSYJHRREPKXURZ-UHFFFAOYSA-N pyrimidine;hydrate Chemical compound O.C1=CN=CN=C1 LSYJHRREPKXURZ-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH950673A CH574413A5 (en) | 1973-06-29 | 1973-06-29 | 2,2,6,6-Tetra-methyl-4-oxo-piperidine prepn. - from 2,2,4,4,6-penta-methyl-2,3,4,5-tetra-hydro-pyrimidine by heating in anhydrous medium |
| CH544074A CH582145A5 (en) | 1974-04-19 | 1974-04-19 | 2,2,6,6-Tetra-methyl-4-oxo-piperidine prepn. - from 2,2,4,4,6-penta-methyl-2,3,4,5-tetra-hydro-pyrimidine by heating in anhydrous medium |
| CH701974 | 1974-05-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS200467B2 true CS200467B2 (en) | 1980-09-15 |
Family
ID=27175211
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS744395A CS200467B2 (en) | 1973-06-29 | 1974-06-21 | Process for preparing 2,2,6,6-tetramethyl-4-oxopiperidine |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3960875A (enExample) |
| JP (1) | JPS5036474A (enExample) |
| AR (1) | AR208393A1 (enExample) |
| AT (1) | AT338263B (enExample) |
| BG (1) | BG27081A3 (enExample) |
| BR (1) | BR7405080D0 (enExample) |
| CA (1) | CA1027952A (enExample) |
| CS (1) | CS200467B2 (enExample) |
| DD (1) | DD112444A5 (enExample) |
| DE (1) | DE2429935C3 (enExample) |
| DK (1) | DK140406B (enExample) |
| EG (1) | EG11230A (enExample) |
| ES (1) | ES427548A1 (enExample) |
| FI (1) | FI190674A7 (enExample) |
| FR (1) | FR2235118B1 (enExample) |
| GB (1) | GB1461701A (enExample) |
| HU (1) | HU169841B (enExample) |
| IE (1) | IE39521B1 (enExample) |
| IL (1) | IL45092A (enExample) |
| IT (1) | IT1021055B (enExample) |
| LU (1) | LU70388A1 (enExample) |
| NL (1) | NL7408411A (enExample) |
| NO (1) | NO742233L (enExample) |
| RO (1) | RO67193A (enExample) |
| SE (1) | SE7408173L (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2916471A1 (de) * | 1979-04-24 | 1980-11-06 | Hoechst Ag | Verfahren zur herstellung von 2,2, 6,6-tetramethylpiperidon-4 |
| US4734502A (en) * | 1986-12-22 | 1988-03-29 | Ici Americas Inc. | Process for the preparation of 2,2,6,6-tetramethyl-4-oxopiperidine |
| DE102012215903A1 (de) | 2012-09-07 | 2014-03-13 | Evonik Industries Ag | Verfahren zur Behandlung eines Abwasserstroms, der bei der Aufarbeitung eines Triacetonamin-haltigen Reaktionsgemisches entsteht |
| DE102012215900A1 (de) | 2012-09-07 | 2014-05-15 | Evonik Industries Ag | Verfahren zur Herstellung und Aufarbeitung eines Triacetonamin-haltigen Reaktionsgemisches |
| CN108383776A (zh) * | 2018-05-01 | 2018-08-10 | 衡水凯亚化工有限公司 | 一种利用丙酮和合成三丙酮胺过程副产物制备三丙酮胺 |
| CN108484482A (zh) * | 2018-05-01 | 2018-09-04 | 衡水凯亚化工有限公司 | 一种利用合成三丙酮胺过程副产物制备三丙酮胺的方法 |
| EP3663284B1 (de) | 2018-12-07 | 2021-02-03 | Evonik Operations GmbH | Verbessertes verfahren zur herstellung von triacetonamin |
| EP3750876A1 (de) | 2019-06-13 | 2020-12-16 | Evonik Operations GmbH | Verfahren zur herstellung von triacetonamin, 2,2,4,6-tetramethylpiperidin und/oder den salzen des 2,2,4,6-tetramethylpiperidins |
| US11731940B2 (en) | 2020-05-07 | 2023-08-22 | Evonik Operations Gmbh | Process for preparing triacetonamine |
| EP4279484A1 (de) | 2022-05-17 | 2023-11-22 | Sabo GmbH | Verbessertes verfahren zur herstellung von triacetonamin |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3513170A (en) * | 1966-07-23 | 1970-05-19 | Sankyo Co | Preparation of 2,2,6,6-tetramethyl-4-oxopiperidine |
-
1974
- 1974-01-01 AR AR254315A patent/AR208393A1/es active
- 1974-06-19 NO NO742233A patent/NO742233L/no unknown
- 1974-06-20 SE SE7408173A patent/SE7408173L/xx unknown
- 1974-06-20 DK DK330974AA patent/DK140406B/da unknown
- 1974-06-20 FI FI1906/74A patent/FI190674A7/fi unknown
- 1974-06-21 DD DD179371A patent/DD112444A5/xx unknown
- 1974-06-21 IT IT24296/74A patent/IT1021055B/it active
- 1974-06-21 JP JP49071217A patent/JPS5036474A/ja active Pending
- 1974-06-21 US US05/481,935 patent/US3960875A/en not_active Expired - Lifetime
- 1974-06-21 FR FR7421685A patent/FR2235118B1/fr not_active Expired
- 1974-06-21 IL IL45092A patent/IL45092A/en unknown
- 1974-06-21 ES ES427548A patent/ES427548A1/es not_active Expired
- 1974-06-21 CS CS744395A patent/CS200467B2/cs unknown
- 1974-06-21 HU HUCI1484A patent/HU169841B/hu unknown
- 1974-06-21 DE DE2429935A patent/DE2429935C3/de not_active Expired
- 1974-06-21 BG BG027041A patent/BG27081A3/xx unknown
- 1974-06-21 GB GB2760274A patent/GB1461701A/en not_active Expired
- 1974-06-21 AT AT517874A patent/AT338263B/de not_active IP Right Cessation
- 1974-06-21 LU LU70388*A patent/LU70388A1/xx unknown
- 1974-06-21 CA CA203,061A patent/CA1027952A/en not_active Expired
- 1974-06-21 RO RO7479252A patent/RO67193A/ro unknown
- 1974-06-21 BR BR5080/74A patent/BR7405080D0/pt unknown
- 1974-06-21 NL NL7408411A patent/NL7408411A/xx not_active Application Discontinuation
- 1974-06-21 IE IE1300/74A patent/IE39521B1/xx unknown
- 1974-06-24 EG EG242/74A patent/EG11230A/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| IE39521B1 (en) | 1978-10-25 |
| FR2235118B1 (enExample) | 1978-01-13 |
| IL45092A0 (en) | 1974-09-10 |
| DK140406C (enExample) | 1980-01-21 |
| LU70388A1 (enExample) | 1976-04-13 |
| ES427548A1 (es) | 1976-08-01 |
| AT338263B (de) | 1977-08-10 |
| US3960875A (en) | 1976-06-01 |
| DD112444A5 (enExample) | 1975-04-12 |
| DE2429935B2 (de) | 1980-10-02 |
| NO742233L (enExample) | 1975-01-27 |
| RO67193A (fr) | 1979-06-15 |
| DE2429935A1 (de) | 1975-01-16 |
| BR7405080D0 (pt) | 1975-01-21 |
| EG11230A (en) | 1977-01-31 |
| BG27081A3 (bg) | 1979-08-15 |
| NL7408411A (enExample) | 1974-12-31 |
| FR2235118A1 (enExample) | 1975-01-24 |
| DE2429935C3 (de) | 1981-07-23 |
| AR208393A1 (es) | 1976-12-27 |
| HU169841B (enExample) | 1977-02-28 |
| GB1461701A (en) | 1977-01-19 |
| DK330974A (enExample) | 1975-02-17 |
| IT1021055B (it) | 1978-01-30 |
| ATA517874A (de) | 1976-12-15 |
| IE39521L (en) | 1974-12-26 |
| IL45092A (en) | 1976-12-31 |
| DK140406B (da) | 1979-08-20 |
| FI190674A7 (enExample) | 1974-12-30 |
| JPS5036474A (enExample) | 1975-04-05 |
| CA1027952A (en) | 1978-03-14 |
| AU7033774A (en) | 1976-01-08 |
| SE7408173L (enExample) | 1974-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Martin et al. | Synthesis of 1, 4-substituted imidazoles | |
| CS200467B2 (en) | Process for preparing 2,2,6,6-tetramethyl-4-oxopiperidine | |
| US4384144A (en) | Process for preparing cyclopentenone derivatives | |
| HU176760B (en) | Process for producing 2,2,6,6-tetramethyl-4-oxopiperidine bracket triacetonamine bracket closed | |
| EP0550762B1 (en) | Process for producing nitrile | |
| US3969355A (en) | 5-Aminoethyl-2,4-diphenylpyrimidine dihydrobromide | |
| US3954794A (en) | Heterocyclic compounds | |
| RU2117007C1 (ru) | Способ получения 2-замещенных 4,6-диалкоксипиримидинов,2-n-бутиламино-4,6-диметоксипиримидин и способ получения галогенпроизводных пиримидина | |
| CA2170588A1 (en) | Process for the methylation of 2,2,6,6-tetramethylpiperidin-4-one | |
| US3944581A (en) | 5-Substituted-2,4-diphenylpyrimidines | |
| SU1301311A3 (ru) | Способ получени производных гексагидроазепина или пиперидина, или пирролидина (его варианты) | |
| KR950003331B1 (ko) | α,β-불포화 케톤의 합성방법 | |
| US3384641A (en) | 2-methylene-3-quinuclidones | |
| YAMANAKA et al. | Studies on Pyrimidine Derivatives. XVIII. Reaction of Active Methyl Groups on Pyrimidine N-Oxides | |
| US4492792A (en) | Process for preparing 4-amino-5-dialkoxy-methylpyrimidine derivatives | |
| KR870000234B1 (ko) | 트랜스-dI-5-치환된-7-임의 치환된-4,4a,5,6,7,8,8a,9-옥타하이드로-1H(및 2H)피라졸로[3,4-g] 퀴나졸린의 제조 방법 | |
| US5310947A (en) | Process for the production of tetronic acid alkyl esters | |
| Demopoulos et al. | Synthesis of 6, 7, 8, 9‐tetrahydro‐N, N‐di‐n‐propyl‐1H‐benz [g] indol‐7‐amine, a potential dopamine receptor agonist | |
| US5276152A (en) | Process for the production of 4,6-dialkoxypyrimidines | |
| US3845076A (en) | Method of preparing aldehydes | |
| US3219668A (en) | Etihnylated lactams and process for their production | |
| EP0347866B1 (en) | Anilinopyrimidine derivatives | |
| SU620210A3 (ru) | Способ получени 2,4,5-триметилтиено (3,2- ) морфана или его солей | |
| US4431827A (en) | Pentadecanolide derivatives | |
| US4123434A (en) | Process for preparing trimeric Δ1 -piperideins and trimeric 1-pyrroline |