CS198189B2 - Fungicide and precess for preparing effective compound thereof - Google Patents
Fungicide and precess for preparing effective compound thereof Download PDFInfo
- Publication number
- CS198189B2 CS198189B2 CS763770A CS377076A CS198189B2 CS 198189 B2 CS198189 B2 CS 198189B2 CS 763770 A CS763770 A CS 763770A CS 377076 A CS377076 A CS 377076A CS 198189 B2 CS198189 B2 CS 198189B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- oxadiazolidin
- formula
- dimethyl
- ones
- ketone
- Prior art date
Links
- 230000000855 fungicidal effect Effects 0.000 title claims description 7
- 150000001875 compounds Chemical class 0.000 title abstract description 30
- 239000000417 fungicide Substances 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims abstract description 20
- 150000002576 ketones Chemical class 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 3
- JGDQLDVVLNXDPQ-UHFFFAOYSA-N 1,2,4-oxadiazolidin-3-one Chemical class O=C1NCON1 JGDQLDVVLNXDPQ-UHFFFAOYSA-N 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 abstract description 3
- YMUIBJJOQYTBIY-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=C(Cl)C(Cl)=C1 YMUIBJJOQYTBIY-UHFFFAOYSA-N 0.000 abstract description 3
- 239000007787 solid Substances 0.000 abstract description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 125000001624 naphthyl group Chemical group 0.000 abstract 1
- 230000000361 pesticidal effect Effects 0.000 abstract 1
- 150000003672 ureas Chemical class 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 241000234282 Allium Species 0.000 description 5
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- SYAKKVMBRZNPGL-UHFFFAOYSA-N 4-(3-chlorophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=CC(Cl)=C1 SYAKKVMBRZNPGL-UHFFFAOYSA-N 0.000 description 3
- 241000223602 Alternaria alternata Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 3
- 241000233866 Fungi Species 0.000 description 3
- 241000223194 Fusarium culmorum Species 0.000 description 3
- 241000209510 Liliopsida Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 241001233957 eudicotyledons Species 0.000 description 3
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 235000009973 maize Nutrition 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- IKYLYRBWLURWDH-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-hydroxyurea Chemical compound ONC(=O)NC1=CC=CC(Cl)=C1 IKYLYRBWLURWDH-UHFFFAOYSA-N 0.000 description 2
- JMBUHOZATJCSBD-UHFFFAOYSA-N 4-(4-bromophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=C(Br)C=C1 JMBUHOZATJCSBD-UHFFFAOYSA-N 0.000 description 2
- IXZJCUVEVLXDPN-UHFFFAOYSA-N 5,5-dimethyl-4-phenyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=CC=C1 IXZJCUVEVLXDPN-UHFFFAOYSA-N 0.000 description 2
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 2
- 244000237956 Amaranthus retroflexus Species 0.000 description 2
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 2
- 244000003416 Asparagus officinalis Species 0.000 description 2
- 235000005340 Asparagus officinalis Nutrition 0.000 description 2
- 240000006122 Chenopodium album Species 0.000 description 2
- 235000009344 Chenopodium album Nutrition 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000005789 Folpet Substances 0.000 description 2
- 241000223218 Fusarium Species 0.000 description 2
- 239000005802 Mancozeb Substances 0.000 description 2
- -1 N-chlorophenyl-N-hydroxyurea Chemical compound 0.000 description 2
- 241001464837 Viridiplantae Species 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- FAQXQMYKPGNBSE-UHFFFAOYSA-N 4-(2-chlorophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=CC=C1Cl FAQXQMYKPGNBSE-UHFFFAOYSA-N 0.000 description 1
- YONRHSYABRDBNR-UHFFFAOYSA-N 4-(3-chlorophenyl)-5,5-diethyl-1,2,4-oxadiazolidin-3-one Chemical compound CCC1(CC)ONC(=O)N1C1=CC=CC(Cl)=C1 YONRHSYABRDBNR-UHFFFAOYSA-N 0.000 description 1
- LYQKCLZEDOCGBI-UHFFFAOYSA-N 4-(4-chlorophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=C(Cl)C=C1 LYQKCLZEDOCGBI-UHFFFAOYSA-N 0.000 description 1
- NAKBBPBCCGQMSL-UHFFFAOYSA-N 5,5-dimethyl-4-(4-methylphenyl)-1,2,4-oxadiazolidin-3-one Chemical compound C1=CC(C)=CC=C1N1C(C)(C)ONC1=O NAKBBPBCCGQMSL-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- MGCARKPFWGPADM-UHFFFAOYSA-N CC1(N(C(=O)NO1)C2=CC=C(C=C2)F)C Chemical compound CC1(N(C(=O)NO1)C2=CC=C(C=C2)F)C MGCARKPFWGPADM-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 244000060234 Gmelina philippensis Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241001310793 Podium Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229960001330 hydroxycarbamide Drugs 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/12—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU75EA148A HU177086B (en) | 1975-06-09 | 1975-06-09 | Herbicide and fungicide preparation containing substituted 1,2,4-oxadiazolidin-3-one derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS198189B2 true CS198189B2 (en) | 1980-05-30 |
Family
ID=10995099
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS763770A CS198189B2 (en) | 1975-06-09 | 1976-06-08 | Fungicide and precess for preparing effective compound thereof |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4193922A (ro) |
| AT (1) | AT347939B (ro) |
| BE (1) | BE842740A (ro) |
| CA (1) | CA1036609A (ro) |
| CH (1) | CH620433A5 (ro) |
| CS (1) | CS198189B2 (ro) |
| DD (2) | DD126227A5 (ro) |
| DE (1) | DE2625848C2 (ro) |
| DK (1) | DK252576A (ro) |
| FR (1) | FR2314184A1 (ro) |
| GB (1) | GB1481158A (ro) |
| HU (1) | HU177086B (ro) |
| IE (1) | IE43116B1 (ro) |
| IT (1) | IT1062322B (ro) |
| LU (1) | LU75126A1 (ro) |
| NL (1) | NL7606175A (ro) |
| PL (2) | PL101489B1 (ro) |
| RO (1) | RO70236A (ro) |
| SU (2) | SU867305A3 (ro) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL73611A0 (en) * | 1983-12-06 | 1985-02-28 | Nippon Soda Co | 1,2,4-oxa-and thiadiazolin-3-one derivatives,their preparation and their use as insecticides and fungicides |
| US5066662A (en) * | 1990-05-21 | 1991-11-19 | Warner-Lambert Company | Substituted oxazolidin-2-ones and 1,2,4-oxadiazolin-5-ones and derivatives thereof acting at muscarinic receptors |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2852523A (en) * | 1957-09-13 | 1958-09-16 | American Cyanamid Co | 5, 5-diphenyl-1, 2, 4-oxadiazolidine-3-ones |
| IL31990A (en) * | 1968-04-26 | 1974-05-16 | Chinoin Gyogyszer Es Vegyeszet | Pyridyl 1,2,4-oxadiazole derivatives,process for the preparation thereof and pharmaceutical compositions containing same |
| DE2207576C2 (de) * | 1972-02-18 | 1985-07-25 | Basf Ag, 6700 Ludwigshafen | Oxazolidinderivate |
-
1975
- 1975-06-09 HU HU75EA148A patent/HU177086B/hu not_active IP Right Cessation
-
1976
- 1976-06-03 IE IE1192/76A patent/IE43116B1/en unknown
- 1976-06-04 CA CA254,114A patent/CA1036609A/en not_active Expired
- 1976-06-04 FR FR7616971A patent/FR2314184A1/fr active Granted
- 1976-06-08 NL NL7606175A patent/NL7606175A/xx not_active Application Discontinuation
- 1976-06-08 US US05/693,892 patent/US4193922A/en not_active Expired - Lifetime
- 1976-06-08 DK DK252576A patent/DK252576A/da unknown
- 1976-06-08 DD DD193230A patent/DD126227A5/xx unknown
- 1976-06-08 RO RO7686395A patent/RO70236A/ro unknown
- 1976-06-08 DD DD7600199804A patent/DD131126A5/xx unknown
- 1976-06-08 IT IT68388/76A patent/IT1062322B/it active
- 1976-06-08 CS CS763770A patent/CS198189B2/cs unknown
- 1976-06-08 AT AT418276A patent/AT347939B/de not_active IP Right Cessation
- 1976-06-09 PL PL1976203429A patent/PL101489B1/pl unknown
- 1976-06-09 BE BE167748A patent/BE842740A/xx not_active IP Right Cessation
- 1976-06-09 CH CH726876A patent/CH620433A5/de not_active IP Right Cessation
- 1976-06-09 LU LU75126A patent/LU75126A1/xx unknown
- 1976-06-09 PL PL1976190257A patent/PL99825B1/pl unknown
- 1976-06-09 GB GB23914/76A patent/GB1481158A/en not_active Expired
- 1976-06-09 SU SU762367751A patent/SU867305A3/ru active
- 1976-06-09 DE DE2625848A patent/DE2625848C2/de not_active Expired
-
1977
- 1977-03-03 SU SU772456904A patent/SU727103A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| SU727103A3 (ru) | 1980-04-05 |
| HU177086B (en) | 1981-07-28 |
| DD131126A5 (de) | 1978-06-07 |
| IE43116B1 (en) | 1980-12-17 |
| PL99825B1 (pl) | 1978-08-31 |
| US4193922A (en) | 1980-03-18 |
| GB1481158A (en) | 1977-07-27 |
| PL101489B1 (pl) | 1978-12-30 |
| CH620433A5 (ro) | 1980-11-28 |
| NL7606175A (nl) | 1976-12-13 |
| AT347939B (de) | 1979-01-25 |
| DE2625848C2 (de) | 1986-02-27 |
| BE842740A (fr) | 1976-10-01 |
| DK252576A (da) | 1976-12-10 |
| FR2314184B1 (ro) | 1980-04-25 |
| IE43116L (en) | 1976-12-09 |
| SU867305A3 (ru) | 1981-09-23 |
| DE2625848A1 (de) | 1976-12-16 |
| IT1062322B (it) | 1984-10-10 |
| LU75126A1 (ro) | 1977-01-25 |
| RO70236A (ro) | 1980-05-15 |
| FR2314184A1 (fr) | 1977-01-07 |
| ATA418276A (de) | 1978-06-15 |
| DD126227A5 (ro) | 1977-07-06 |
| CA1036609A (en) | 1978-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3157234B2 (ja) | 除草性カルボキシアミド誘導体 | |
| RU2140739C1 (ru) | Способ подавления роста нежелательной растительности, замещенные гетероциклами пиридины, способы их получения и гербицидная композиция | |
| US4543413A (en) | Sulphonyl derivatives of N-phenyl pyridineamines | |
| USRE30574E (en) | Herbicidal tetrahydrofuran derivatives | |
| IE51408B1 (en) | New aniline derivatives | |
| RU2017725C1 (ru) | Производные бензанилидов или бензиламидов, гербицидная композиция и способ борьбы с ростом нежелательной растительности | |
| CA1094573A (en) | Herbicidal and fungicidal agents | |
| US6251829B1 (en) | Herbicidal benzoyloxy carboxylates and carboxamides | |
| EP0015628B1 (en) | Use as fungicides of pyridyliminomethylbenzene derivatives and acid-addition salts thereof; pyridyliminomethylbenzene derivatives and their acid-addition salts; a process for preparing such compounds and intermediates for use in such process; and fungicidal compositions comprising such compounds | |
| EP0185401B1 (en) | Heterocyclic herbicides | |
| RU2070883C1 (ru) | Производные пиколинамида, способы их получения, промежуточные соединения для получения производных пиколинамида, способ их получения, способы борьбы с нежелательной растительностью | |
| US4623377A (en) | 1,2,3,4-tetrahydroquinolin-1-ylcarbonylimidazoles and herbicidal use thereof | |
| JPS6147835B2 (ro) | ||
| CS198189B2 (en) | Fungicide and precess for preparing effective compound thereof | |
| CS270566B2 (en) | Fungicide and method of its active substance production | |
| DK165636B (da) | 1,5-disubstituerede imidazolderivater, fremgangsmaade til fremstilling af saadanne forbindelser, fungicidt praeparat indeholdende saadanne forbindelser samt anvendelse af saadanne forbindelser som fungicider | |
| US4453972A (en) | Phenoxy pyridine derivatives and herbicidal compositions containing same | |
| EP0149269B1 (en) | Heterocyclic herbicides | |
| EP0280367B1 (en) | Glycine compounds | |
| US4049820A (en) | Substituted urazole and thiourazole compounds as agricultural fungicidal agents | |
| EP0152131B1 (en) | Carboxamide derivatives, their preparation and their use as fungicides | |
| EP0184256B1 (en) | Diphenyl ether herbicides | |
| US4675044A (en) | 3-aryl-5,6-dihydro-1,4,2-oxathiazines and their oxides | |
| US4552586A (en) | Certain 2-pyridyloxyacetanilides and their use as herbicides | |
| EP0123327B1 (en) | Chloroacetanilides, their preparation, their use, compositions containing them, and method of combating undesired plant growth |