CS194235B2 - Method of preparing high crystalline quickly crystallizing,thermoplastic copolyester of terephthalic acid - Google Patents
Method of preparing high crystalline quickly crystallizing,thermoplastic copolyester of terephthalic acidInfo
- Publication number
- CS194235B2 CS194235B2 CS761141A CS114176A CS194235B2 CS 194235 B2 CS194235 B2 CS 194235B2 CS 761141 A CS761141 A CS 761141A CS 114176 A CS114176 A CS 114176A CS 194235 B2 CS194235 B2 CS 194235B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- terephthalic acid
- preparing high
- high crystalline
- thermoplastic copolyester
- quickly crystallizing
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 2
- 229920006344 thermoplastic copolyester Polymers 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/12—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/16—Dicarboxylic acids and dihydroxy compounds
- C08G63/18—Dicarboxylic acids and dihydroxy compounds the acids or hydroxy compounds containing carbocyclic rings
- C08G63/181—Acids containing aromatic rings
- C08G63/183—Terephthalic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752507674 DE2507674A1 (de) | 1975-02-22 | 1975-02-22 | Schnellkristallisierende poly(aethylen/alkylen)-terephthalate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS194235B2 true CS194235B2 (en) | 1979-11-30 |
Family
ID=5939534
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS761141A CS194235B2 (en) | 1975-02-22 | 1976-02-20 | Method of preparing high crystalline quickly crystallizing,thermoplastic copolyester of terephthalic acid |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4086212A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS614842B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE838778A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1076738A (cg-RX-API-DMAC7.html) |
| CH (1) | CH602819A5 (cg-RX-API-DMAC7.html) |
| CS (1) | CS194235B2 (cg-RX-API-DMAC7.html) |
| DD (1) | DD126600A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2507674A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2301546A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1505599A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1053880B (cg-RX-API-DMAC7.html) |
| NL (1) | NL167179C (cg-RX-API-DMAC7.html) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2545720A1 (de) * | 1975-10-11 | 1977-04-21 | Bayer Ag | Schnellkristallisierende blockcopolyester |
| US4207230A (en) * | 1977-02-01 | 1980-06-10 | Bayer Aktiengesellschaft | Block copolyesters which crystallize rapidly |
| DE2706123A1 (de) | 1977-02-14 | 1978-08-17 | Bayer Ag | Schnell kristallisierende polyaethylenterephthalate und verfahren zu ihrer herstellung |
| DE2715932A1 (de) | 1977-04-09 | 1978-10-19 | Bayer Ag | Schnellkristallisierende poly(aethylen/alkylen)-terephthalate |
| DE2834438C3 (de) * | 1978-08-05 | 1987-12-03 | Fa. Carl Freudenberg, 6940 Weinheim | Spinnvliesstoff aus Polyester-Filamenten zur Verwendung als Trägermaterial für einen tiefziehfähigen Tufting-Teppich |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4483948A (en) * | 1980-09-24 | 1984-11-20 | Ppg Industries, Inc. | Antioxidants and reinforced polymers and oil-in-water emulsions of antioxidants |
| US4425470A (en) | 1982-08-06 | 1984-01-10 | E. I. Du Pont De Nemours And Company | Alkali metal salts of low molecular weight polyethylene terephthalate as nucleating agents for polyethylene terephthalates |
| DE3532033A1 (de) * | 1985-09-09 | 1987-03-19 | Hoechst Ag | Schnellkristallisierende polyestermassen und verfahren zu deren herstellung |
| DE69214686T2 (de) * | 1991-02-28 | 1997-06-05 | Agfa Gevaert Nv | Verfahren zur Herstellung von Polyestern mit verbesserter thermooxydativer Stabilität |
| US5446122A (en) * | 1994-11-30 | 1995-08-29 | General Electric Company | Process for preparing macrocyclic polyesters |
| DE19512407A1 (de) * | 1995-04-03 | 1996-10-10 | Basf Ag | Flammgeschützte thermoplastische Formmassen |
| US6271291B1 (en) * | 1998-12-18 | 2001-08-07 | Eastman Chemical Company | Extrudable masterbatch |
| DE102004014590A1 (de) * | 2004-03-23 | 2005-10-20 | Buehler Ag | Teilkristallines Polyethylenterephthalat |
| CA2562745A1 (en) * | 2004-04-15 | 2005-11-10 | Federal-Mogul Corporation | An integrated sensor-seal module for detecting angular position of a crankshaft |
| CN1993424B (zh) * | 2004-08-11 | 2010-05-05 | 东丽株式会社 | 光反射体用聚酯树脂组合物 |
| EP1976695B1 (en) * | 2006-01-24 | 2018-11-21 | Cryovac, Inc. | Multilayer oriented film |
| EP2168783A1 (de) | 2008-09-24 | 2010-03-31 | Bayer MaterialScience AG | Verwendung einer Kunststoff-Folie im Farblaserdruck |
| EP2172336A1 (de) | 2008-09-24 | 2010-04-07 | Bayer MaterialScience AG | Fälschungssichere Sicherheitsmerkmale in Sicherheits- oder Wertdokumenten |
| EP2218579A1 (de) | 2009-02-13 | 2010-08-18 | Bayer MaterialScience AG | Verbessertes Verfahren zur Herstellung eines laminierten Schichtverbundes |
| DE102009024340A1 (de) | 2009-06-09 | 2010-12-16 | Bayer Materialscience Ag | Hochfließfähige Polymerzusammensetzung und Verfahren zu ihrer Herstellung |
| EP3613602A1 (de) | 2018-08-23 | 2020-02-26 | Covestro Deutschland AG | Verbessertes verfahren für das partielle einfärben von kunststoffteilen |
| KR20210099555A (ko) | 2018-12-03 | 2021-08-12 | 코베스트로 인텔렉쳐 프로퍼티 게엠베하 운트 콤파니 카게 | 층상 구조물에서의 높은 비캣 연화 온도를 갖는 플라스틱 필름 |
| WO2021099248A1 (de) | 2019-11-22 | 2021-05-27 | Covestro Intellectual Property Gmbh & Co. Kg | Schichtaufbau mit veränderter struktur sowie deren herstellung |
| US12365775B2 (en) | 2021-04-14 | 2025-07-22 | Covestro Deutschland Ag | Process for partial colouring of plastic parts using solid colourants in colour- carrier layers |
| WO2023110961A1 (en) | 2021-12-17 | 2023-06-22 | Covestro Deutschland Ag | At least partially biobased layered structure with good favourable properties |
| EP4197783A1 (en) | 2021-12-17 | 2023-06-21 | Covestro Deutschland AG | At least partially biobased layered structure with good flame resistance |
| CN115672362B (zh) * | 2022-11-01 | 2023-12-19 | 西南科技大学 | 用于光催化还原铀的氧化红磷的制备及应用 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD82803A (cg-RX-API-DMAC7.html) * | ||||
| BE551439A (cg-RX-API-DMAC7.html) * | 1955-10-07 | |||
| DE1774044U (de) | 1958-06-07 | 1958-09-11 | Merkur Werk Emil Hermes | Mehrzweck-damenrasierapparat. |
| NL131746C (cg-RX-API-DMAC7.html) * | 1960-07-11 | |||
| DE1153897B (de) * | 1960-10-15 | 1963-09-05 | Hoechst Ag | Verwendung von Mischpolyestern aus Terephthalsaeure und Diolen zum Herstellen von Folien |
| US3407112A (en) * | 1963-04-09 | 1968-10-22 | Du Pont | Polyethylene terepthalate film and process of preparation thereof |
| GB1118538A (en) * | 1965-11-08 | 1968-07-03 | Goodyear Tire & Rubber | Electrostatic printing materials containing polyesters |
| GB1246448A (en) * | 1967-11-27 | 1971-09-15 | Ici Ltd | Production of aromatic copolyesters |
| DE1770044A1 (de) * | 1968-03-23 | 1971-09-23 | Hoechst Ag | Glasklare,thermoplastische Formmassen auf Polyesterbasis und Verfahren zu ihrer Herstellung |
| DE1769035A1 (de) * | 1968-03-23 | 1971-10-07 | Hoechst Ag | Thermoplastische Polyesterformmassen |
| DE1770823A1 (de) * | 1968-07-09 | 1972-10-19 | Hoechst Ag | Thermoplastische Formmassen aus Blockcopolyestern |
| US3498952A (en) * | 1968-10-03 | 1970-03-03 | Goodyear Tire & Rubber | Polyester resins from 2-methyl-2-phenyl-1,3-propanediol |
| FR2023326A1 (cg-RX-API-DMAC7.html) * | 1968-10-25 | 1970-08-21 | Huels Chemische Werke Ag | |
| DE2023527B2 (de) * | 1970-05-14 | 1973-07-12 | Farbwerke Hoechst AG, vormals Meister Lucius & Brüning, 6000 Frankfurt | Fasern und faeden aus mit 2,2dimethylpropandiol-1,3 modifiziertem polyaethylenterephthalat |
| US3669921A (en) * | 1971-02-08 | 1972-06-13 | Eastman Kodak Co | Copolyester melt adhesive |
| DE2109560A1 (de) * | 1971-03-01 | 1972-09-14 | Hoechst Ag | Glasklare, thermoplastische Formmassen |
| US3953394A (en) * | 1971-11-15 | 1976-04-27 | General Electric Company | Polyester alloys and molding compositions containing the same |
| GB1428751A (en) * | 1972-10-04 | 1976-03-17 | Gen Electric | Reinforced rapidly crystallizable copolyester resin compo sition |
| JPS588673A (ja) * | 1981-07-09 | 1983-01-18 | Brother Ind Ltd | サ−マルヘツド |
-
1975
- 1975-02-22 DE DE19752507674 patent/DE2507674A1/de active Granted
-
1976
- 1976-01-27 NL NL7600808.A patent/NL167179C/xx not_active IP Right Cessation
- 1976-02-17 US US05/658,816 patent/US4086212A/en not_active Expired - Lifetime
- 1976-02-20 DD DD191382A patent/DD126600A5/xx unknown
- 1976-02-20 CS CS761141A patent/CS194235B2/cs unknown
- 1976-02-20 JP JP51017186A patent/JPS614842B2/ja not_active Expired
- 1976-02-20 CH CH210176A patent/CH602819A5/xx not_active IP Right Cessation
- 1976-02-20 BE BE164496A patent/BE838778A/xx not_active IP Right Cessation
- 1976-02-20 GB GB6793/76A patent/GB1505599A/en not_active Expired
- 1976-02-20 IT IT48200/76A patent/IT1053880B/it active
- 1976-02-20 CA CA246,192A patent/CA1076738A/en not_active Expired
- 1976-02-20 FR FR7604786A patent/FR2301546A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS614842B2 (cg-RX-API-DMAC7.html) | 1986-02-13 |
| DE2507674C2 (cg-RX-API-DMAC7.html) | 1988-12-01 |
| CA1076738A (en) | 1980-04-29 |
| CH602819A5 (cg-RX-API-DMAC7.html) | 1978-08-15 |
| GB1505599A (en) | 1978-03-30 |
| FR2301546B1 (cg-RX-API-DMAC7.html) | 1979-05-04 |
| NL167179B (nl) | 1981-06-16 |
| FR2301546A1 (fr) | 1976-09-17 |
| NL7600808A (nl) | 1976-08-24 |
| BE838778A (fr) | 1976-08-20 |
| US4086212A (en) | 1978-04-25 |
| JPS51107396A (cg-RX-API-DMAC7.html) | 1976-09-22 |
| DD126600A5 (cg-RX-API-DMAC7.html) | 1977-08-03 |
| NL167179C (nl) | 1981-11-16 |
| DE2507674A1 (de) | 1976-09-09 |
| IT1053880B (it) | 1981-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS194235B2 (en) | Method of preparing high crystalline quickly crystallizing,thermoplastic copolyester of terephthalic acid | |
| CS193064B2 (en) | Process for preparing crystalline,rapid crystallizing copolyesters of terephthalic acid | |
| EG11555A (en) | Terephthalic acid recovery by crystallization | |
| HU172304B (hu) | Sposob poluchenija proizvodnykh 7-tiazolilacetamido-cef-3-em-4-karbonovojj kisloty | |
| CS194694B2 (en) | Method of producing terephthalic acid | |
| CS188273B2 (en) | Process for preparing 2-oxo-4-quinolylalkanoic acids | |
| GB1554487A (en) | Process for producing terephthalic acid | |
| GB1538731A (en) | Process for producing terephthalic acid | |
| IT1064942B (it) | Procedimento per produrre acido tereftalico | |
| HU174553B (hu) | Sposob poluchenija proizvodnykh 7-beta-amino-3-cefem-3-ol-4-karbonovykh kislot | |
| GB2008105B (en) | Process for preparing terephthalic acid | |
| PT67039B (en) | Continuous process for producing terephthalic acid | |
| GB2009735B (en) | Process for producing terephthalic acid with high purity | |
| PT67455A (en) | Process for preparing of 7epsilon-(alkoxycarbonyl)-6epsilon-alkyl/halo-17-hydroxy-3-oxo-17alpha-pregn-4-ene-21-carboxylic acid gamma-lactones and corresponding 21-carboxylic acids,their salts and esters | |
| PT65510B (en) | Process of preparation of purified terephthalic acid | |
| YU256777A (en) | Process for obtaining terephthalic acid | |
| HU170951B (hu) | Novyj sposob poluchenija hinolin-3-karbonovykh kislot | |
| PH14541A (en) | Process for producing terephthalic acid | |
| HU171208B (hu) | Sposob poluchenija proizvodnykh 7-amino-3-metil-cef-3-em-4-karbonovojj kisloty | |
| CA983518A (en) | Process for the preparation of terephthalic acid | |
| HU172925B (hu) | Sposob poluchenija al'fa-/m-benzoil-fenil/-propionovoj kisloty | |
| CA1011762A (en) | Process for the preparation of terephthalic acid | |
| YU33976A (en) | Process for producing diacetone-2-ketogulonic acid | |
| HU172484B (hu) | Sposob poluchenija 2-alkoksikarbonilamino-5/6/-fenil-sul'foniloksi-benzimidazolov s antgel'minticheskoj aktivnost'ju | |
| GB2006191B (en) | Process for producing terephthalic acid |