CN102639487A - 治疗性芳基-酰氨基-芳基化合物以及它们的应用 - Google Patents
治疗性芳基-酰氨基-芳基化合物以及它们的应用 Download PDFInfo
- Publication number
- CN102639487A CN102639487A CN2010800493386A CN201080049338A CN102639487A CN 102639487 A CN102639487 A CN 102639487A CN 2010800493386 A CN2010800493386 A CN 2010800493386A CN 201080049338 A CN201080049338 A CN 201080049338A CN 102639487 A CN102639487 A CN 102639487A
- Authority
- CN
- China
- Prior art keywords
- independently
- compound according
- compound
- olr
- present
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000001225 therapeutic effect Effects 0.000 title abstract description 10
- 150000001875 compounds Chemical class 0.000 claims abstract description 544
- 239000000203 mixture Substances 0.000 claims abstract description 149
- 238000011282 treatment Methods 0.000 claims abstract description 132
- 208000024827 Alzheimer disease Diseases 0.000 claims abstract description 76
- 208000010877 cognitive disease Diseases 0.000 claims abstract description 26
- 208000028698 Cognitive impairment Diseases 0.000 claims abstract description 14
- 206010027175 memory impairment Diseases 0.000 claims abstract description 9
- 208000027061 mild cognitive impairment Diseases 0.000 claims abstract description 8
- 208000000044 Amnesia Diseases 0.000 claims abstract description 7
- 206010039966 Senile dementia Diseases 0.000 claims abstract description 6
- 238000000034 method Methods 0.000 claims description 153
- 125000000217 alkyl group Chemical group 0.000 claims description 46
- 125000001931 aliphatic group Chemical group 0.000 claims description 44
- 150000003839 salts Chemical class 0.000 claims description 27
- 238000002560 therapeutic procedure Methods 0.000 claims description 24
- 238000004519 manufacturing process Methods 0.000 claims description 21
- 239000012453 solvate Substances 0.000 claims description 20
- 150000004677 hydrates Chemical class 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- 239000003085 diluting agent Substances 0.000 claims description 13
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 10
- 239000003937 drug carrier Substances 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 125000004193 piperazinyl group Chemical group 0.000 claims description 8
- 241001465754 Metazoa Species 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 6
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000004076 pyridyl group Chemical group 0.000 claims description 6
- 208000031091 Amnestic disease Diseases 0.000 claims description 5
- 230000006986 amnesia Effects 0.000 claims description 5
- PISPFRJRNGKTDT-UHFFFAOYSA-N 4-[(3,4,5-triethoxybenzoyl)amino]benzoic acid Chemical compound CCOC1=C(OCC)C(OCC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 PISPFRJRNGKTDT-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229940095102 methyl benzoate Drugs 0.000 claims description 4
- 125000002757 morpholinyl group Chemical group 0.000 claims description 4
- 125000003386 piperidinyl group Chemical group 0.000 claims description 4
- CSHJCFPMERZZTN-UHFFFAOYSA-N 4-[(3,4,5-trimethoxybenzoyl)amino]benzoic acid Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 CSHJCFPMERZZTN-UHFFFAOYSA-N 0.000 claims description 3
- ZKPSTNOENWFZGP-UHFFFAOYSA-N 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]benzoic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 ZKPSTNOENWFZGP-UHFFFAOYSA-N 0.000 claims description 3
- GHEJAAXZTTXGRW-UHFFFAOYSA-N 4-[(3,5-dichloro-4-methoxybenzoyl)amino]benzoic acid Chemical compound C1=C(Cl)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 GHEJAAXZTTXGRW-UHFFFAOYSA-N 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000002393 azetidinyl group Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 2
- VMXWDJRQPCIYDZ-UHFFFAOYSA-N 6-[(3,4,5-trimethoxybenzoyl)amino]pyridine-3-carboxylic acid Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NC=2N=CC(=CC=2)C(O)=O)=C1 VMXWDJRQPCIYDZ-UHFFFAOYSA-N 0.000 claims 2
- FYKZBCFBSMYGLP-UHFFFAOYSA-N 3,4,5-trimethoxy-n-[4-(piperidine-1-carbonyl)phenyl]benzamide Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NC=2C=CC(=CC=2)C(=O)N2CCCCC2)=C1 FYKZBCFBSMYGLP-UHFFFAOYSA-N 0.000 claims 1
- 229940124810 Alzheimer's drug Drugs 0.000 claims 1
- 125000002098 pyridazinyl group Chemical group 0.000 claims 1
- -1 AAA compounds Chemical class 0.000 abstract description 220
- 239000000556 agonist Substances 0.000 abstract description 31
- 238000001727 in vivo Methods 0.000 abstract description 25
- 238000000338 in vitro Methods 0.000 abstract description 21
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 15
- 102100023606 Retinoic acid receptor alpha Human genes 0.000 abstract description 14
- 108091008726 retinoic acid receptors α Proteins 0.000 abstract description 14
- 230000004913 activation Effects 0.000 abstract description 9
- 230000001404 mediated effect Effects 0.000 abstract description 6
- 208000026139 Memory disease Diseases 0.000 abstract description 4
- 230000006984 memory degeneration Effects 0.000 abstract description 2
- 208000023060 memory loss Diseases 0.000 abstract description 2
- 230000007278 cognition impairment Effects 0.000 abstract 1
- 208000037765 diseases and disorders Diseases 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 176
- 238000005481 NMR spectroscopy Methods 0.000 description 150
- 238000003786 synthesis reaction Methods 0.000 description 123
- 230000015572 biosynthetic process Effects 0.000 description 119
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 115
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 111
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 107
- 235000019439 ethyl acetate Nutrition 0.000 description 87
- 239000002904 solvent Substances 0.000 description 81
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 78
- 239000000243 solution Substances 0.000 description 77
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 76
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 69
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 52
- NNXRUAHRXFENDC-UHFFFAOYSA-N methyl 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]-2-methylbenzoate Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(=O)OC)C(C)=C1 NNXRUAHRXFENDC-UHFFFAOYSA-N 0.000 description 52
- 239000011541 reaction mixture Substances 0.000 description 52
- 239000007787 solid Substances 0.000 description 52
- RRNWAHCJTJOZAX-UHFFFAOYSA-N 3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenol Chemical compound CC(C)(C)[Si](C)(C)OCC1=CC(O)=C(F)C(O[Si](C)(C)C(C)(C)C)=C1 RRNWAHCJTJOZAX-UHFFFAOYSA-N 0.000 description 44
- 239000012267 brine Substances 0.000 description 43
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 43
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 42
- 102100033909 Retinoic acid receptor beta Human genes 0.000 description 40
- 108091008761 retinoic acid receptors β Proteins 0.000 description 40
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 39
- 238000010898 silica gel chromatography Methods 0.000 description 39
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 37
- 239000002585 base Substances 0.000 description 37
- 210000003618 cortical neuron Anatomy 0.000 description 37
- NRTWXBXJSGGTTE-UHFFFAOYSA-N methyl 4-amino-2-methylbenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1C NRTWXBXJSGGTTE-UHFFFAOYSA-N 0.000 description 37
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 36
- 230000000694 effects Effects 0.000 description 36
- LZXXNPOYQCLXRS-UHFFFAOYSA-N methyl 4-aminobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1 LZXXNPOYQCLXRS-UHFFFAOYSA-N 0.000 description 33
- 239000002552 dosage form Substances 0.000 description 31
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 31
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000003814 drug Substances 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 27
- VBYQCKBTFLYTTH-UHFFFAOYSA-N methyl 4-[(3,5-dichloro-4-hydroxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(O)C(Cl)=C1 VBYQCKBTFLYTTH-UHFFFAOYSA-N 0.000 description 27
- VXAQPSDNOMOLCN-UHFFFAOYSA-N 3,5-dichloro-4-cyclopentyloxybenzoic acid Chemical compound ClC1=CC(C(=O)O)=CC(Cl)=C1OC1CCCC1 VXAQPSDNOMOLCN-UHFFFAOYSA-N 0.000 description 25
- 101710137189 Amyloid-beta A4 protein Proteins 0.000 description 25
- 101710151993 Amyloid-beta precursor protein Proteins 0.000 description 25
- 102100022704 Amyloid-beta precursor protein Human genes 0.000 description 25
- DZHSAHHDTRWUTF-SIQRNXPUSA-N amyloid-beta polypeptide 42 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)CC)C(C)C)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(C)C)C1=CC=CC=C1 DZHSAHHDTRWUTF-SIQRNXPUSA-N 0.000 description 25
- SXYGOCJUQOJEPU-UHFFFAOYSA-N 3,5-dichloro-4-ethoxybenzoic acid Chemical compound CCOC1=C(Cl)C=C(C(O)=O)C=C1Cl SXYGOCJUQOJEPU-UHFFFAOYSA-N 0.000 description 24
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 24
- 229930002330 retinoic acid Natural products 0.000 description 24
- LHOPUIURBJGDGM-UHFFFAOYSA-N methyl 4-[(3-chloro-4-methoxy-5-propan-2-yloxybenzoyl)amino]-2-methylbenzoate Chemical compound C1=C(C)C(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(OC)C(OC(C)C)=C1 LHOPUIURBJGDGM-UHFFFAOYSA-N 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 22
- UPQBAMQSQHBEGZ-UHFFFAOYSA-N methyl 4-[(3-chloro-5-cyclohexyloxy-4-phenylmethoxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C(C=C1OC2CCCCC2)=CC(Cl)=C1OCC1=CC=CC=C1 UPQBAMQSQHBEGZ-UHFFFAOYSA-N 0.000 description 22
- 239000012071 phase Substances 0.000 description 22
- 108010058699 Choline O-acetyltransferase Proteins 0.000 description 21
- 102100023460 Choline O-acetyltransferase Human genes 0.000 description 21
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 20
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- 125000006239 protecting group Chemical class 0.000 description 20
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 19
- QUDLOMMIINAJER-UHFFFAOYSA-N methyl 4-[[3,4-di(propan-2-yloxy)-5-(trifluoromethyl)benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(OC(C)C)=C(OC(C)C)C(C(F)(F)F)=C1 QUDLOMMIINAJER-UHFFFAOYSA-N 0.000 description 19
- 108010064539 amyloid beta-protein (1-42) Proteins 0.000 description 18
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- 102000003702 retinoic acid receptors Human genes 0.000 description 18
- 108090000064 retinoic acid receptors Proteins 0.000 description 18
- 238000005160 1H NMR spectroscopy Methods 0.000 description 17
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 17
- 239000012044 organic layer Substances 0.000 description 17
- 239000000725 suspension Substances 0.000 description 17
- 235000010233 benzoic acid Nutrition 0.000 description 16
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 16
- 239000007924 injection Substances 0.000 description 16
- 238000002347 injection Methods 0.000 description 16
- 239000000463 material Substances 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- 239000005711 Benzoic acid Substances 0.000 description 15
- 241000699670 Mus sp. Species 0.000 description 15
- 229960004365 benzoic acid Drugs 0.000 description 15
- 210000004027 cell Anatomy 0.000 description 15
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 15
- 235000019341 magnesium sulphate Nutrition 0.000 description 15
- 102100033912 Retinoic acid receptor gamma Human genes 0.000 description 14
- 239000007788 liquid Substances 0.000 description 14
- 239000012074 organic phase Substances 0.000 description 14
- 108091008760 retinoic acid receptors γ Proteins 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 201000010099 disease Diseases 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 108010064397 amyloid beta-protein (1-40) Proteins 0.000 description 12
- 125000000524 functional group Chemical group 0.000 description 12
- BPAKMNNACPYTAY-UHFFFAOYSA-N methyl 4-amino-2-fluorobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1F BPAKMNNACPYTAY-UHFFFAOYSA-N 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 11
- 230000008878 coupling Effects 0.000 description 11
- 238000010168 coupling process Methods 0.000 description 11
- 238000005859 coupling reaction Methods 0.000 description 11
- 108090000623 proteins and genes Proteins 0.000 description 11
- 230000011664 signaling Effects 0.000 description 11
- PWMYGZVAXFXPNQ-UHFFFAOYSA-N 3-chloro-4-methoxy-5-propan-2-yloxybenzoic acid Chemical compound COC1=C(Cl)C=C(C(O)=O)C=C1OC(C)C PWMYGZVAXFXPNQ-UHFFFAOYSA-N 0.000 description 10
- 210000004556 brain Anatomy 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- 210000002569 neuron Anatomy 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 238000000746 purification Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 230000003213 activating effect Effects 0.000 description 9
- 230000001054 cortical effect Effects 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- DCGQWSOVPCJUAF-UHFFFAOYSA-N methyl 4-[(3,4-dichloro-5-propan-2-yloxybenzoyl)amino]-2-methylbenzoate Chemical compound C1=C(C)C(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(Cl)C(OC(C)C)=C1 DCGQWSOVPCJUAF-UHFFFAOYSA-N 0.000 description 9
- 239000000651 prodrug Substances 0.000 description 9
- 229940002612 prodrug Drugs 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- 229960001727 tretinoin Drugs 0.000 description 9
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- 239000008346 aqueous phase Substances 0.000 description 8
- 238000003556 assay Methods 0.000 description 8
- KXVUSQIDCZRUKF-UHFFFAOYSA-N bromocyclobutane Chemical compound BrC1CCC1 KXVUSQIDCZRUKF-UHFFFAOYSA-N 0.000 description 8
- 239000000969 carrier Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000007796 conventional method Methods 0.000 description 8
- 239000006071 cream Substances 0.000 description 8
- 230000002222 downregulating effect Effects 0.000 description 8
- FBSFWRHWHYMIOG-UHFFFAOYSA-N methyl 3,4,5-trihydroxybenzoate Chemical compound COC(=O)C1=CC(O)=C(O)C(O)=C1 FBSFWRHWHYMIOG-UHFFFAOYSA-N 0.000 description 8
- 235000011181 potassium carbonates Nutrition 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- GARITQDVXIYUQC-UHFFFAOYSA-N 4-[[4-ethoxy-3-(trifluoromethyl)benzoyl]amino]-2,6-difluorobenzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=CC=C1C(=O)NC1=CC(F)=C(C(O)=O)C(F)=C1 GARITQDVXIYUQC-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 7
- 230000001713 cholinergic effect Effects 0.000 description 7
- 239000000356 contaminant Substances 0.000 description 7
- 229940079593 drug Drugs 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- 239000005457 ice water Substances 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 150000004492 retinoid derivatives Chemical class 0.000 description 7
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 6
- NUTRHYYFCDEALP-UHFFFAOYSA-N 4-bromo-3,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=C(Br)C(O)=C1 NUTRHYYFCDEALP-UHFFFAOYSA-N 0.000 description 6
- WPUUKDLXIOXKKB-UHFFFAOYSA-N 4-chloro-3,5-di(propan-2-yloxy)benzoic acid Chemical compound CC(C)OC1=CC(C(O)=O)=CC(OC(C)C)=C1Cl WPUUKDLXIOXKKB-UHFFFAOYSA-N 0.000 description 6
- PCQCNQWJSNVRKE-UHFFFAOYSA-N 4-ethoxy-3,5-di(propan-2-yloxy)benzoic acid Chemical compound CCOC1=C(OC(C)C)C=C(C(O)=O)C=C1OC(C)C PCQCNQWJSNVRKE-UHFFFAOYSA-N 0.000 description 6
- 108010090849 Amyloid beta-Peptides Proteins 0.000 description 6
- 102000013455 Amyloid beta-Peptides Human genes 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000007821 HATU Substances 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 208000035475 disorder Diseases 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 238000005984 hydrogenation reaction Methods 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- DDIPPLCXJIEZOH-UHFFFAOYSA-N methyl 4-[(4-chloro-3-ethoxy-5-pentan-3-yloxybenzoyl)amino]benzoate Chemical compound CCC(CC)OC1=C(Cl)C(OCC)=CC(C(=O)NC=2C=CC(=CC=2)C(=O)OC)=C1 DDIPPLCXJIEZOH-UHFFFAOYSA-N 0.000 description 6
- DBNQIOANXZVWIP-UHFFFAOYSA-N n,n-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine Chemical compound CC(C)(C)OC(N(C)C)OC(C)(C)C DBNQIOANXZVWIP-UHFFFAOYSA-N 0.000 description 6
- QQOXBFUTRLDXDP-UHFFFAOYSA-N p-Aminosalicylic acid methyl ester Chemical compound COC(=O)C1=CC=C(N)C=C1O QQOXBFUTRLDXDP-UHFFFAOYSA-N 0.000 description 6
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 6
- 208000024891 symptom Diseases 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 0 *C(C1=NC=C(*c2cc(I)c(*)c(*)c2)**1)=O Chemical compound *C(C1=NC=C(*c2cc(I)c(*)c(*)c2)**1)=O 0.000 description 5
- RZSCGLIHJLHASZ-UHFFFAOYSA-N 2-chloro-5-iodo-1,3-dimethoxybenzene Chemical compound COC1=CC(I)=CC(OC)=C1Cl RZSCGLIHJLHASZ-UHFFFAOYSA-N 0.000 description 5
- JDVPVUPAFTXQDR-UHFFFAOYSA-N 3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid Chemical compound COC1=C(Cl)C=C(C(O)=O)C=C1C(F)(F)F JDVPVUPAFTXQDR-UHFFFAOYSA-N 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- CMRZPMQBTOOCQR-UHFFFAOYSA-N 4-chloro-3-ethoxy-5-pentan-3-yloxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC(OC(CC)CC)=C1Cl CMRZPMQBTOOCQR-UHFFFAOYSA-N 0.000 description 5
- DPVRVZQEDJVWLS-UHFFFAOYSA-N 4-hydroxy-3-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(O)C(C(F)(F)F)=C1 DPVRVZQEDJVWLS-UHFFFAOYSA-N 0.000 description 5
- 102000002659 Amyloid Precursor Protein Secretases Human genes 0.000 description 5
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000000853 adhesive Substances 0.000 description 5
- 230000001070 adhesive effect Effects 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- ALYNCZNDIQEVRV-UHFFFAOYSA-N aniline-p-carboxylic acid Natural products NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 5
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 230000003828 downregulation Effects 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- PCEBAZIVZVIQEO-UHFFFAOYSA-N iodocyclopentane Chemical compound IC1CCCC1 PCEBAZIVZVIQEO-UHFFFAOYSA-N 0.000 description 5
- 125000000468 ketone group Chemical group 0.000 description 5
- 239000007937 lozenge Substances 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- SWRZROKGZUCAQN-UHFFFAOYSA-N methyl 3-chloro-4,5-dihydroxybenzoate Chemical compound COC(=O)C1=CC(O)=C(O)C(Cl)=C1 SWRZROKGZUCAQN-UHFFFAOYSA-N 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 230000016273 neuron death Effects 0.000 description 5
- 235000010603 pastilles Nutrition 0.000 description 5
- 230000029279 positive regulation of transcription, DNA-dependent Effects 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 230000001105 regulatory effect Effects 0.000 description 5
- 238000011160 research Methods 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- RVAIEOIDJDTMJC-UHFFFAOYSA-N 3,5-dibromo-4-ethoxyaniline Chemical compound CCOC1=C(Br)C=C(N)C=C1Br RVAIEOIDJDTMJC-UHFFFAOYSA-N 0.000 description 4
- JCYWFHRQFXSCCN-UHFFFAOYSA-N 3,5-dichloro-4-ethoxyaniline Chemical compound CCOC1=C(Cl)C=C(N)C=C1Cl JCYWFHRQFXSCCN-UHFFFAOYSA-N 0.000 description 4
- GNTMPTOVLRQSBQ-UHFFFAOYSA-N 3,5-dichloro-4-phenylmethoxybenzoic acid Chemical compound ClC1=CC(C(=O)O)=CC(Cl)=C1OCC1=CC=CC=C1 GNTMPTOVLRQSBQ-UHFFFAOYSA-N 0.000 description 4
- VTOQFOCYBTVOJZ-UHFFFAOYSA-N 3-bromopentane Chemical compound CCC(Br)CC VTOQFOCYBTVOJZ-UHFFFAOYSA-N 0.000 description 4
- AJMYKGXDSRNBQP-UHFFFAOYSA-N 3-chloro-4-ethoxy-5-(trifluoromethyl)benzoic acid Chemical compound CCOC1=C(Cl)C=C(C(O)=O)C=C1C(F)(F)F AJMYKGXDSRNBQP-UHFFFAOYSA-N 0.000 description 4
- HAZWGQHRMHZOOS-UHFFFAOYSA-N 4-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(=O)NC1=CC(Cl)=C(O)C(Cl)=C1 HAZWGQHRMHZOOS-UHFFFAOYSA-N 0.000 description 4
- AWWNUYPZDLCQEH-UHFFFAOYSA-N 4-[(3-chloro-4-ethoxy-5-methoxybenzoyl)amino]benzoic acid Chemical compound C1=C(OC)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 AWWNUYPZDLCQEH-UHFFFAOYSA-N 0.000 description 4
- LLEUFOLRXBSBKC-UHFFFAOYSA-N 4-[[3-chloro-4-cyclobutyloxy-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1C(F)(F)F)=CC(Cl)=C1OC1CCC1 LLEUFOLRXBSBKC-UHFFFAOYSA-N 0.000 description 4
- JROYETJFPWLMSK-UHFFFAOYSA-N 4-[[4-ethoxy-3,5-bis(trifluoromethyl)phenyl]carbamoyl]benzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(C(F)(F)F)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 JROYETJFPWLMSK-UHFFFAOYSA-N 0.000 description 4
- JZKLPOCJBKWSSH-UHFFFAOYSA-N 4-[[4-ethoxy-3-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=CC=C1C(=O)NC1=CC=C(C(O)=O)C=C1 JZKLPOCJBKWSSH-UHFFFAOYSA-N 0.000 description 4
- RZYUIHNYUYKPOQ-UHFFFAOYSA-N 4-amino-2,6-difluorobenzoic acid Chemical compound NC1=CC(F)=C(C(O)=O)C(F)=C1 RZYUIHNYUYKPOQ-UHFFFAOYSA-N 0.000 description 4
- SHBZNZUCWSBBIC-UHFFFAOYSA-N 4-bromo-3,5-di(propan-2-yloxy)benzoic acid Chemical compound CC(C)OC1=CC(C(O)=O)=CC(OC(C)C)=C1Br SHBZNZUCWSBBIC-UHFFFAOYSA-N 0.000 description 4
- REIDAMBAPLIATC-UHFFFAOYSA-N 4-methoxycarbonylbenzoic acid Chemical compound COC(=O)C1=CC=C(C(O)=O)C=C1 REIDAMBAPLIATC-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- 108010043324 Amyloid Precursor Protein Secretases Proteins 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 241000699666 Mus <mouse, genus> Species 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 208000010011 Vitamin A Deficiency Diseases 0.000 description 4
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 4
- 229960004373 acetylcholine Drugs 0.000 description 4
- 125000005907 alkyl ester group Chemical group 0.000 description 4
- 238000013459 approach Methods 0.000 description 4
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 4
- 229910052796 boron Inorganic materials 0.000 description 4
- 230000006999 cognitive decline Effects 0.000 description 4
- 239000006196 drop Substances 0.000 description 4
- QUPULIZWXWBCIV-UHFFFAOYSA-N ethyl 4-[(3,5-dichloro-4-ethoxyphenyl)carbamoyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C(=O)NC1=CC(Cl)=C(OCC)C(Cl)=C1 QUPULIZWXWBCIV-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000003925 fat Substances 0.000 description 4
- 235000019197 fats Nutrition 0.000 description 4
- 239000000499 gel Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 4
- 230000000155 isotopic effect Effects 0.000 description 4
- 239000002502 liposome Substances 0.000 description 4
- XUOMUTYNGPAHPH-UHFFFAOYSA-N methyl 3-amino-4-chloro-5-methoxybenzoate Chemical compound COC(=O)C1=CC(N)=C(Cl)C(OC)=C1 XUOMUTYNGPAHPH-UHFFFAOYSA-N 0.000 description 4
- NDAGZUHCIOWOMZ-UHFFFAOYSA-N methyl 3-chloro-4-hydroxy-5-propan-2-yloxybenzoate Chemical compound COC(=O)C1=CC(Cl)=C(O)C(OC(C)C)=C1 NDAGZUHCIOWOMZ-UHFFFAOYSA-N 0.000 description 4
- MTDWVZOLFHDYNL-UHFFFAOYSA-N methyl 3-chloro-5-hydroxy-4-phenylmethoxybenzoate Chemical compound ClC1=CC(C(=O)OC)=CC(O)=C1OCC1=CC=CC=C1 MTDWVZOLFHDYNL-UHFFFAOYSA-N 0.000 description 4
- RTTABJSYPXYQCK-UHFFFAOYSA-N methyl 4-[[4-ethoxy-3,5-bis(trifluoromethyl)phenyl]carbamoyl]benzoate Chemical compound C1=C(C(F)(F)F)C(OCC)=C(C(F)(F)F)C=C1NC(=O)C1=CC=C(C(=O)OC)C=C1 RTTABJSYPXYQCK-UHFFFAOYSA-N 0.000 description 4
- QNYHMMOXMRPWTK-UHFFFAOYSA-N methyl 4-chloro-3-methoxy-5-nitrobenzoate Chemical compound COC(=O)C1=CC(OC)=C(Cl)C([N+]([O-])=O)=C1 QNYHMMOXMRPWTK-UHFFFAOYSA-N 0.000 description 4
- 239000002324 mouth wash Substances 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- 239000006072 paste Substances 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- 238000010189 synthetic method Methods 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 230000003827 upregulation Effects 0.000 description 4
- KULJJMKQXQWECK-UHFFFAOYSA-N (2-chloro-3-hydroxy-5-iodophenyl) acetate Chemical compound CC(=O)OC1=CC(I)=CC(O)=C1Cl KULJJMKQXQWECK-UHFFFAOYSA-N 0.000 description 3
- UXGQLGNVHKQQTD-UHFFFAOYSA-N (3-acetyloxy-2-chloro-5-iodophenyl) acetate Chemical compound CC(=O)OC1=CC(I)=CC(OC(C)=O)=C1Cl UXGQLGNVHKQQTD-UHFFFAOYSA-N 0.000 description 3
- 102000008645 11-beta-Hydroxysteroid Dehydrogenase Type 1 Human genes 0.000 description 3
- 108010088011 11-beta-Hydroxysteroid Dehydrogenase Type 1 Proteins 0.000 description 3
- AYPPRNVBAUCYSV-UHFFFAOYSA-N 2-chloro-3-ethoxy-5-iodophenol Chemical compound CCOC1=CC(I)=CC(O)=C1Cl AYPPRNVBAUCYSV-UHFFFAOYSA-N 0.000 description 3
- LNSSIPSRJAPLTG-UHFFFAOYSA-N 2-chloro-5-iodo-1-methoxy-3-propan-2-yloxybenzene Chemical compound COC1=CC(I)=CC(OC(C)C)=C1Cl LNSSIPSRJAPLTG-UHFFFAOYSA-N 0.000 description 3
- INUJRKDHLZTNKP-UHFFFAOYSA-N 2-chloro-5-iodo-3-methoxyphenol Chemical compound COC1=CC(I)=CC(O)=C1Cl INUJRKDHLZTNKP-UHFFFAOYSA-N 0.000 description 3
- LZIPYMGKWBMRPG-UHFFFAOYSA-N 2-chloro-5-iodobenzene-1,3-diol Chemical compound OC1=CC(I)=CC(O)=C1Cl LZIPYMGKWBMRPG-UHFFFAOYSA-N 0.000 description 3
- LWOOZMQIIGXFGC-UHFFFAOYSA-N 2-ethoxy-5-nitro-1,3-bis(trifluoromethyl)benzene Chemical compound CCOC1=C(C(F)(F)F)C=C([N+]([O-])=O)C=C1C(F)(F)F LWOOZMQIIGXFGC-UHFFFAOYSA-N 0.000 description 3
- RGYOYFIMSWZBKB-UHFFFAOYSA-N 2-methoxy-6-(trifluoromethyl)phenol Chemical compound COC1=CC=CC(C(F)(F)F)=C1O RGYOYFIMSWZBKB-UHFFFAOYSA-N 0.000 description 3
- YIVQPHODGWUJQX-UHFFFAOYSA-N 3,4-di(propan-2-yloxy)-5-(trifluoromethyl)benzoic acid Chemical compound CC(C)OC1=CC(C(O)=O)=CC(C(F)(F)F)=C1OC(C)C YIVQPHODGWUJQX-UHFFFAOYSA-N 0.000 description 3
- LVFSEVVQHBJLQX-UHFFFAOYSA-N 3,4-dichloro-5-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=C(Cl)C(Cl)=C1 LVFSEVVQHBJLQX-UHFFFAOYSA-N 0.000 description 3
- ZFLNBZJNBVNOFV-UHFFFAOYSA-N 3,4-dichloro-5-propan-2-yloxybenzoic acid Chemical compound CC(C)OC1=CC(C(O)=O)=CC(Cl)=C1Cl ZFLNBZJNBVNOFV-UHFFFAOYSA-N 0.000 description 3
- JQBAIOXESIUXAI-UHFFFAOYSA-N 3,4-dihydroxy-5-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(C(F)(F)F)=C1 JQBAIOXESIUXAI-UHFFFAOYSA-N 0.000 description 3
- GXHCVRWADGCMEV-UHFFFAOYSA-N 3-bromo-4-ethoxy-5-(trifluoromethyl)benzoic acid Chemical compound CCOC1=C(Br)C=C(C(O)=O)C=C1C(F)(F)F GXHCVRWADGCMEV-UHFFFAOYSA-N 0.000 description 3
- WEUDMFOQOJBIRY-UHFFFAOYSA-N 3-chloro-4,5-bis[(2-methylpropan-2-yl)oxy]benzoic acid Chemical compound CC(C)(C)OC1=CC(C(O)=O)=CC(Cl)=C1OC(C)(C)C WEUDMFOQOJBIRY-UHFFFAOYSA-N 0.000 description 3
- DQPMJINVCPRSSM-UHFFFAOYSA-N 3-chloro-4,5-di(cyclobutyloxy)benzoic acid Chemical compound C1CCC1OC1=CC(C(=O)O)=CC(Cl)=C1OC1CCC1 DQPMJINVCPRSSM-UHFFFAOYSA-N 0.000 description 3
- DQOBNYGMBNPROL-UHFFFAOYSA-N 3-chloro-4,5-dicyclopentyloxybenzoic acid Chemical compound C1CCCC1OC1=CC(C(=O)O)=CC(Cl)=C1OC1CCCC1 DQOBNYGMBNPROL-UHFFFAOYSA-N 0.000 description 3
- GGUNECQLDCNDDY-UHFFFAOYSA-N 3-chloro-4,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(Cl)=C1 GGUNECQLDCNDDY-UHFFFAOYSA-N 0.000 description 3
- JVMOVETVCDRYIV-UHFFFAOYSA-N 3-chloro-4-ethoxy-5-methoxybenzoic acid Chemical compound CCOC1=C(Cl)C=C(C(O)=O)C=C1OC JVMOVETVCDRYIV-UHFFFAOYSA-N 0.000 description 3
- WPFOYFQOBBHOTE-UHFFFAOYSA-N 3-chloro-4-hydroxy-5-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(O)C(C(F)(F)F)=C1 WPFOYFQOBBHOTE-UHFFFAOYSA-N 0.000 description 3
- QFQMJAKEDAMRHJ-UHFFFAOYSA-N 3-chloro-4-propan-2-yloxy-5-(trifluoromethyl)benzoic acid Chemical compound CC(C)OC1=C(Cl)C=C(C(O)=O)C=C1C(F)(F)F QFQMJAKEDAMRHJ-UHFFFAOYSA-N 0.000 description 3
- CRJQHRJDQPWWTL-UHFFFAOYSA-N 3-chloro-5-cyclohexyloxy-4-phenylmethoxybenzoic acid Chemical compound C1CCCCC1OC1=CC(C(=O)O)=CC(Cl)=C1OCC1=CC=CC=C1 CRJQHRJDQPWWTL-UHFFFAOYSA-N 0.000 description 3
- RFMDPKRRCOPWDE-UHFFFAOYSA-N 4-[(3,4-dichloro-5-propan-2-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound ClC1=C(Cl)C(OC(C)C)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 RFMDPKRRCOPWDE-UHFFFAOYSA-N 0.000 description 3
- XHKMPUKCRAEIRF-UHFFFAOYSA-N 4-[(3,5-dibromo-4-ethoxyphenyl)carbamoyl]benzoic acid Chemical compound C1=C(Br)C(OCC)=C(Br)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 XHKMPUKCRAEIRF-UHFFFAOYSA-N 0.000 description 3
- QKRBHDLDRUSVHH-UHFFFAOYSA-N 4-[(3,5-dichloro-4-cyclopentyloxybenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OC1CCCC1 QKRBHDLDRUSVHH-UHFFFAOYSA-N 0.000 description 3
- KFELTBOHQLRBBX-UHFFFAOYSA-N 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]-2-hydroxybenzoic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(O)=C1 KFELTBOHQLRBBX-UHFFFAOYSA-N 0.000 description 3
- TXZJTZPBACTXGL-UHFFFAOYSA-N 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 TXZJTZPBACTXGL-UHFFFAOYSA-N 0.000 description 3
- FTFOHDMOBCZCMA-UHFFFAOYSA-N 4-[(3,5-dichloro-4-ethoxyphenyl)carbamoyl]benzoic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 FTFOHDMOBCZCMA-UHFFFAOYSA-N 0.000 description 3
- FYAYPXZARCBNAV-UHFFFAOYSA-N 4-[(3-chloro-4,5-dicyclohexyloxybenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1OC2CCCCC2)=CC(Cl)=C1OC1CCCCC1 FYAYPXZARCBNAV-UHFFFAOYSA-N 0.000 description 3
- ULVXRZNMPNRMBL-UHFFFAOYSA-N 4-[(3-chloro-4,5-dicyclopentyloxybenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1OC2CCCC2)=CC(Cl)=C1OC1CCCC1 ULVXRZNMPNRMBL-UHFFFAOYSA-N 0.000 description 3
- RYOUVSCJCQTOSA-UHFFFAOYSA-N 4-[(3-chloro-4-ethoxy-5-methoxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(OC)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 RYOUVSCJCQTOSA-UHFFFAOYSA-N 0.000 description 3
- ZAADKSCOCXBQRA-UHFFFAOYSA-N 4-[(3-chloro-5-fluoro-4-propan-2-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(Cl)C(OC(C)C)=C(F)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 ZAADKSCOCXBQRA-UHFFFAOYSA-N 0.000 description 3
- ZEQWJWKVWVAXJZ-UHFFFAOYSA-N 4-[(4-chloro-3-ethoxy-5-pentan-3-yloxybenzoyl)amino]benzoic acid Chemical compound CCC(CC)OC1=C(Cl)C(OCC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 ZEQWJWKVWVAXJZ-UHFFFAOYSA-N 0.000 description 3
- IBYJWIXYMURCKS-UHFFFAOYSA-N 4-[(4-chloro-3-methoxy-5-propan-2-yloxybenzoyl)amino]benzoic acid Chemical compound CC(C)OC1=C(Cl)C(OC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 IBYJWIXYMURCKS-UHFFFAOYSA-N 0.000 description 3
- GYNOMWDIFUXJBS-UHFFFAOYSA-N 4-[[3,4-di(propan-2-yloxy)-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound FC(F)(F)C1=C(OC(C)C)C(OC(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 GYNOMWDIFUXJBS-UHFFFAOYSA-N 0.000 description 3
- ROFQZPNVSNGRPP-UHFFFAOYSA-N 4-[[3,5-dichloro-4-(cyclopropylmethoxy)benzoyl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OCC1CC1 ROFQZPNVSNGRPP-UHFFFAOYSA-N 0.000 description 3
- GEMOPXMOCZLJDH-UHFFFAOYSA-N 4-[[3,5-dichloro-4-[(2-methylpropan-2-yl)oxy]benzoyl]amino]benzoic acid Chemical compound C1=C(Cl)C(OC(C)(C)C)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 GEMOPXMOCZLJDH-UHFFFAOYSA-N 0.000 description 3
- TVIDQTCKLQNPGV-UHFFFAOYSA-N 4-[[3-chloro-4,5-bis[(2-methylpropan-2-yl)oxy]benzoyl]amino]benzoic acid Chemical compound ClC1=C(OC(C)(C)C)C(OC(C)(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 TVIDQTCKLQNPGV-UHFFFAOYSA-N 0.000 description 3
- KNBNQKZMTPYPAS-UHFFFAOYSA-N 4-[[3-chloro-4,5-di(cyclobutyloxy)benzoyl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1OC2CCC2)=CC(Cl)=C1OC1CCC1 KNBNQKZMTPYPAS-UHFFFAOYSA-N 0.000 description 3
- GISHBPXVPBXZQK-UHFFFAOYSA-N 4-[[3-chloro-4,5-di(propan-2-yloxy)benzoyl]amino]benzoic acid Chemical compound ClC1=C(OC(C)C)C(OC(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 GISHBPXVPBXZQK-UHFFFAOYSA-N 0.000 description 3
- UTTKSBXKHMBDJY-UHFFFAOYSA-N 4-[[4-chloro-3,5-di(propan-2-yloxy)benzoyl]amino]-2-methylbenzoic acid Chemical compound CC(C)OC1=C(Cl)C(OC(C)C)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 UTTKSBXKHMBDJY-UHFFFAOYSA-N 0.000 description 3
- BTJZNXUNTLKUAH-UHFFFAOYSA-N 4-[[4-chloro-3,5-di(propan-2-yloxy)benzoyl]amino]benzoic acid Chemical compound CC(C)OC1=C(Cl)C(OC(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 BTJZNXUNTLKUAH-UHFFFAOYSA-N 0.000 description 3
- PWSVCWWENVVNSN-UHFFFAOYSA-N 4-[[4-ethoxy-3,5-di(propan-2-yloxy)benzoyl]amino]-2-fluorobenzoic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(OC(C)C)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 PWSVCWWENVVNSN-UHFFFAOYSA-N 0.000 description 3
- AQDBPLBJXTYUGR-UHFFFAOYSA-N 4-[[4-fluoro-3,5-di(propan-2-yloxy)benzoyl]amino]benzoic acid Chemical compound CC(C)OC1=C(F)C(OC(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 AQDBPLBJXTYUGR-UHFFFAOYSA-N 0.000 description 3
- KGEXISHTCZHGFT-UHFFFAOYSA-N 4-azaniumyl-2,6-dichlorophenolate Chemical compound NC1=CC(Cl)=C(O)C(Cl)=C1 KGEXISHTCZHGFT-UHFFFAOYSA-N 0.000 description 3
- SQVGSLMYJNTJQV-UHFFFAOYSA-N 4-chloro-3,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=C(Cl)C(O)=C1 SQVGSLMYJNTJQV-UHFFFAOYSA-N 0.000 description 3
- SGDVJEPMJMYMEV-UHFFFAOYSA-N 4-chloro-3,5-dimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1Cl SGDVJEPMJMYMEV-UHFFFAOYSA-N 0.000 description 3
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 3
- PYJJUFAPAUXZRU-UHFFFAOYSA-N 4-ethoxy-3,5-bis(trifluoromethyl)aniline Chemical compound CCOC1=C(C(F)(F)F)C=C(N)C=C1C(F)(F)F PYJJUFAPAUXZRU-UHFFFAOYSA-N 0.000 description 3
- NXHGTWUYTBQXSE-UHFFFAOYSA-N 4-fluoro-3,5-di(propan-2-yloxy)benzoic acid Chemical compound CC(C)OC1=CC(C(O)=O)=CC(OC(C)C)=C1F NXHGTWUYTBQXSE-UHFFFAOYSA-N 0.000 description 3
- IDHLTDAHMWZQQR-UHFFFAOYSA-N 4-hydroxy-3-methoxy-5-(trifluoromethyl)benzaldehyde Chemical compound COC1=CC(C=O)=CC(C(F)(F)F)=C1O IDHLTDAHMWZQQR-UHFFFAOYSA-N 0.000 description 3
- GAFKNRNLXMOIPE-UHFFFAOYSA-N 4-hydroxy-3-methoxy-5-(trifluoromethyl)benzoic acid Chemical compound COC1=CC(C(O)=O)=CC(C(F)(F)F)=C1O GAFKNRNLXMOIPE-UHFFFAOYSA-N 0.000 description 3
- IPSXWJIHOWZUGF-UHFFFAOYSA-N 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenol Chemical compound CC(C)(C)[Si](C)(C)OCC1=CC=C(F)C(O)=C1 IPSXWJIHOWZUGF-UHFFFAOYSA-N 0.000 description 3
- UGMNSELRLDIOGH-UHFFFAOYSA-N 6-[(3,5-dichloro-4-ethoxyphenyl)carbamoyl]pyridine-3-carboxylic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1NC(=O)C1=CC=C(C(O)=O)C=N1 UGMNSELRLDIOGH-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 229930194542 Keto Natural products 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 229930182555 Penicillin Natural products 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- VXPLOIIWYKIDRV-UHFFFAOYSA-N [4-fluoro-3,5-di(propan-2-yloxy)phenyl]methanol Chemical compound CC(C)OC1=CC(CO)=CC(OC(C)C)=C1F VXPLOIIWYKIDRV-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 3
- 230000001668 ameliorated effect Effects 0.000 description 3
- 229960004050 aminobenzoic acid Drugs 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- BNUZPSHNZDBXSU-UHFFFAOYSA-N aniline methyl formate Chemical compound NC1=CC=CC=C1.C(=O)OC BNUZPSHNZDBXSU-UHFFFAOYSA-N 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- HPYSNQHDVOVQIN-UHFFFAOYSA-N benzyl 4-amino-2,6-difluorobenzoate Chemical compound FC1=CC(N)=CC(F)=C1C(=O)OCC1=CC=CC=C1 HPYSNQHDVOVQIN-UHFFFAOYSA-N 0.000 description 3
- 230000004071 biological effect Effects 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 235000011148 calcium chloride Nutrition 0.000 description 3
- 229910001628 calcium chloride Inorganic materials 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000002843 carboxylic acid group Chemical group 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 238000002648 combination therapy Methods 0.000 description 3
- 239000000306 component Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 235000005911 diet Nutrition 0.000 description 3
- 230000037213 diet Effects 0.000 description 3
- 231100000673 dose–response relationship Toxicity 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 150000002085 enols Chemical class 0.000 description 3
- PFGLBPRANZHDKB-UHFFFAOYSA-N ethyl 4-chloro-3,5-dimethoxybenzoate Chemical compound CCOC(=O)C1=CC(OC)=C(Cl)C(OC)=C1 PFGLBPRANZHDKB-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000013355 food flavoring agent Nutrition 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010914 gene-directed enzyme pro-drug therapy Methods 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000006210 lotion Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 3
- MQHJSECPEIUQBC-UHFFFAOYSA-N methyl 3,4-dichloro-5-methoxybenzoate Chemical compound COC(=O)C1=CC(Cl)=C(Cl)C(OC)=C1 MQHJSECPEIUQBC-UHFFFAOYSA-N 0.000 description 3
- UKMOOQFHBGTLAO-UHFFFAOYSA-N methyl 3,5-dichloro-4-hydroxybenzoate Chemical compound COC(=O)C1=CC(Cl)=C(O)C(Cl)=C1 UKMOOQFHBGTLAO-UHFFFAOYSA-N 0.000 description 3
- OFKVEADPXVQPMB-UHFFFAOYSA-N methyl 3-chloro-4-methoxy-5-propan-2-yloxybenzoate Chemical compound COC(=O)C1=CC(Cl)=C(OC)C(OC(C)C)=C1 OFKVEADPXVQPMB-UHFFFAOYSA-N 0.000 description 3
- PSAAMNNDCPJQCD-UHFFFAOYSA-N methyl 3-chloro-5-cyclohexyloxy-4-phenylmethoxybenzoate Chemical compound C1CCCCC1OC1=CC(C(=O)OC)=CC(Cl)=C1OCC1=CC=CC=C1 PSAAMNNDCPJQCD-UHFFFAOYSA-N 0.000 description 3
- HLJNRQRZUOXPMZ-UHFFFAOYSA-N methyl 4-[(3,5-dibromo-4-ethoxyphenyl)carbamoyl]benzoate Chemical compound C1=C(Br)C(OCC)=C(Br)C=C1NC(=O)C1=CC=C(C(=O)OC)C=C1 HLJNRQRZUOXPMZ-UHFFFAOYSA-N 0.000 description 3
- DCYIYCZNLMCYGY-UHFFFAOYSA-N methyl 4-[(3,5-dichloro-4-phenylmethoxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OCC1=CC=CC=C1 DCYIYCZNLMCYGY-UHFFFAOYSA-N 0.000 description 3
- AZLIPVZYYRQBQH-UHFFFAOYSA-N methyl 4-[(3-chloro-4,5-dicyclopentyloxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C(C=C1OC2CCCC2)=CC(Cl)=C1OC1CCCC1 AZLIPVZYYRQBQH-UHFFFAOYSA-N 0.000 description 3
- JWDRYMWOJIRTNI-UHFFFAOYSA-N methyl 4-[(3-chloro-5-cyclohexyloxy-4-hydroxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(O)C(OC2CCCCC2)=C1 JWDRYMWOJIRTNI-UHFFFAOYSA-N 0.000 description 3
- LFVAZQAQWOGYHR-UHFFFAOYSA-N methyl 4-[[3,5-dichloro-4-(cyclopropylmethoxy)benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OCC1CC1 LFVAZQAQWOGYHR-UHFFFAOYSA-N 0.000 description 3
- WCVAJMSDRJZLKM-UHFFFAOYSA-N methyl 4-[[3-chloro-4,5-bis[(2-methylpropan-2-yl)oxy]benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(OC(C)(C)C)C(OC(C)(C)C)=C1 WCVAJMSDRJZLKM-UHFFFAOYSA-N 0.000 description 3
- MLXNSUNNLBASTJ-UHFFFAOYSA-N methyl 4-[[3-chloro-4-hydroxy-5-(trifluoromethyl)benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(O)C(C(F)(F)F)=C1 MLXNSUNNLBASTJ-UHFFFAOYSA-N 0.000 description 3
- HETZEDPQFXHFDB-UHFFFAOYSA-N methyl 4-[[4-chloro-3,5-di(propan-2-yloxy)benzoyl]amino]-2-methylbenzoate Chemical compound C1=C(C)C(C(=O)OC)=CC=C1NC(=O)C1=CC(OC(C)C)=C(Cl)C(OC(C)C)=C1 HETZEDPQFXHFDB-UHFFFAOYSA-N 0.000 description 3
- FKFNFTIARDONOK-UHFFFAOYSA-N methyl 4-[[4-chloro-3,5-di(propan-2-yloxy)benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(OC(C)C)=C(Cl)C(OC(C)C)=C1 FKFNFTIARDONOK-UHFFFAOYSA-N 0.000 description 3
- ZPYHRVOQAVEFTC-UHFFFAOYSA-N methyl 4-amino-3,5-di(propan-2-yloxy)benzoate Chemical compound COC(=O)C1=CC(OC(C)C)=C(N)C(OC(C)C)=C1 ZPYHRVOQAVEFTC-UHFFFAOYSA-N 0.000 description 3
- CLVTWUZBOKTCQB-UHFFFAOYSA-N methyl 4-chloro-3,5-di(propan-2-yloxy)benzoate Chemical compound COC(=O)C1=CC(OC(C)C)=C(Cl)C(OC(C)C)=C1 CLVTWUZBOKTCQB-UHFFFAOYSA-N 0.000 description 3
- ZQIHGTCQYHQBMY-UHFFFAOYSA-N methyl 4-hydroxy-3-methoxy-5-nitrobenzoate Chemical compound COC(=O)C1=CC(OC)=C(O)C([N+]([O-])=O)=C1 ZQIHGTCQYHQBMY-UHFFFAOYSA-N 0.000 description 3
- SWYKJLNFHIIJPQ-UHFFFAOYSA-N methyl 4-nitro-3,5-di(propan-2-yloxy)benzoate Chemical compound COC(=O)C1=CC(OC(C)C)=C([N+]([O-])=O)C(OC(C)C)=C1 SWYKJLNFHIIJPQ-UHFFFAOYSA-N 0.000 description 3
- FIRCHZBVGVABCQ-UHFFFAOYSA-N methyl 6-[(3,5-dichloro-4-ethoxyphenyl)carbamoyl]pyridine-3-carboxylate Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1NC(=O)C1=CC=C(C(=O)OC)C=N1 FIRCHZBVGVABCQ-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 230000035772 mutation Effects 0.000 description 3
- JWBXFZUNIADZOI-UHFFFAOYSA-N n-(4-carbamoylphenyl)-3,5-dichloro-4-ethoxybenzamide Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(N)=O)C=C1 JWBXFZUNIADZOI-UHFFFAOYSA-N 0.000 description 3
- 230000001537 neural effect Effects 0.000 description 3
- 230000006576 neuronal survival Effects 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 150000003077 polyols Chemical class 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 230000002685 pulmonary effect Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000012799 strong cation exchange Methods 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- JHLUGEWQCKDIDU-UHFFFAOYSA-N tert-butyl 2-methoxy-4-nitrobenzoate Chemical compound COC1=CC([N+]([O-])=O)=CC=C1C(=O)OC(C)(C)C JHLUGEWQCKDIDU-UHFFFAOYSA-N 0.000 description 3
- BZXSOMGDXLCMQF-UHFFFAOYSA-N tert-butyl 4-amino-2-methoxybenzoate Chemical compound COC1=CC(N)=CC=C1C(=O)OC(C)(C)C BZXSOMGDXLCMQF-UHFFFAOYSA-N 0.000 description 3
- GXKANKGLUSMDFP-UHFFFAOYSA-N tert-butyl-[(4-fluorophenyl)methoxy]-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)OCC1=CC=C(F)C=C1 GXKANKGLUSMDFP-UHFFFAOYSA-N 0.000 description 3
- ABNGEOWOTKDJKG-UHFFFAOYSA-N tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-4-fluorophenyl]methoxy]-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)OCC1=CC=C(F)C(O[Si](C)(C)C(C)(C)C)=C1 ABNGEOWOTKDJKG-UHFFFAOYSA-N 0.000 description 3
- TUXDCEGPMLOKIA-UHFFFAOYSA-N tert-butyl-[[4-fluoro-3,5-di(propan-2-yloxy)phenyl]methoxy]-dimethylsilane Chemical compound CC(C)OC1=CC(CO[Si](C)(C)C(C)(C)C)=CC(OC(C)C)=C1F TUXDCEGPMLOKIA-UHFFFAOYSA-N 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- PRDFBSVERLRRMY-UHFFFAOYSA-N 2'-(4-ethoxyphenyl)-5-(4-methylpiperazin-1-yl)-2,5'-bibenzimidazole Chemical compound C1=CC(OCC)=CC=C1C1=NC2=CC=C(C=3NC4=CC(=CC=C4N=3)N3CCN(C)CC3)C=C2N1 PRDFBSVERLRRMY-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZUBCKHKTDHQPPY-UHFFFAOYSA-N 2-chloro-1-ethoxy-5-iodo-3-pentan-3-yloxybenzene Chemical compound CCOC1=CC(I)=CC(OC(CC)CC)=C1Cl ZUBCKHKTDHQPPY-UHFFFAOYSA-N 0.000 description 2
- YCENSLDYFDZUMO-UHFFFAOYSA-N 3,4,5-triethoxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC(OCC)=C1OCC YCENSLDYFDZUMO-UHFFFAOYSA-N 0.000 description 2
- AEAHIAGEQXNSMO-UHFFFAOYSA-N 3,5-dibromo-4-ethoxybenzoic acid Chemical compound CCOC1=C(Br)C=C(C(O)=O)C=C1Br AEAHIAGEQXNSMO-UHFFFAOYSA-N 0.000 description 2
- PHWAJJWKNLWZGJ-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(Br)=C(O)C(Br)=C1 PHWAJJWKNLWZGJ-UHFFFAOYSA-N 0.000 description 2
- UYEMGAFJOZZIFP-UHFFFAOYSA-N 3,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC(O)=C1 UYEMGAFJOZZIFP-UHFFFAOYSA-N 0.000 description 2
- GQYKAUQVEPYHHY-UHFFFAOYSA-N 3-chloro-4,5-di(propan-2-yloxy)benzoic acid Chemical compound CC(C)OC1=CC(C(O)=O)=CC(Cl)=C1OC(C)C GQYKAUQVEPYHHY-UHFFFAOYSA-N 0.000 description 2
- XBRYEHVBBMSSCG-UHFFFAOYSA-N 3-chloro-4-hydroxy-5-methoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC(Cl)=C1O XBRYEHVBBMSSCG-UHFFFAOYSA-N 0.000 description 2
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 2
- LMDRHWMJJZPPFH-UHFFFAOYSA-N 4-[(3,4-diethoxy-5-propan-2-yloxybenzoyl)amino]benzoic acid Chemical compound CC(C)OC1=C(OCC)C(OCC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 LMDRHWMJJZPPFH-UHFFFAOYSA-N 0.000 description 2
- CQJKRXZUEJPURO-UHFFFAOYSA-N 4-[(3,5-dibromo-4-ethoxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(Br)C(OCC)=C(Br)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 CQJKRXZUEJPURO-UHFFFAOYSA-N 0.000 description 2
- DDWUBZBAJAGRLI-UHFFFAOYSA-N 4-[(3,5-dibromo-4-ethoxybenzoyl)amino]benzoic acid Chemical compound C1=C(Br)C(OCC)=C(Br)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 DDWUBZBAJAGRLI-UHFFFAOYSA-N 0.000 description 2
- NQIRSCBXSCSZDT-UHFFFAOYSA-N 4-[(3,5-dibromo-4-propan-2-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(Br)C(OC(C)C)=C(Br)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 NQIRSCBXSCSZDT-UHFFFAOYSA-N 0.000 description 2
- YWYBCEYSUXAJLK-UHFFFAOYSA-N 4-[(3,5-dichloro-4-cyclobutyloxybenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OC1CCC1 YWYBCEYSUXAJLK-UHFFFAOYSA-N 0.000 description 2
- LPDHUZLMVFWBFW-UHFFFAOYSA-N 4-[(3,5-dichloro-4-cyclopentyloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(C(O)=O)C(C)=CC(NC(=O)C=2C=C(Cl)C(OC3CCCC3)=C(Cl)C=2)=C1 LPDHUZLMVFWBFW-UHFFFAOYSA-N 0.000 description 2
- QBGYZBJDXAKWHC-UHFFFAOYSA-N 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]-2-(trifluoromethyl)benzoic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C(F)(F)F)=C1 QBGYZBJDXAKWHC-UHFFFAOYSA-N 0.000 description 2
- LQTSHDRHSARGHD-UHFFFAOYSA-N 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]-2-fluorobenzoic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 LQTSHDRHSARGHD-UHFFFAOYSA-N 0.000 description 2
- FCVFPHQNMRVIKE-UHFFFAOYSA-N 4-[(3,5-dichloro-4-methoxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(Cl)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 FCVFPHQNMRVIKE-UHFFFAOYSA-N 0.000 description 2
- ISSWNTGWCNUBMI-UHFFFAOYSA-N 4-[(3,5-dichloro-4-phenylmethoxybenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OCC1=CC=CC=C1 ISSWNTGWCNUBMI-UHFFFAOYSA-N 0.000 description 2
- QYKQJKMDSDBOCB-UHFFFAOYSA-N 4-[(3,5-dichloro-4-propan-2-yloxybenzoyl)amino]benzoic acid Chemical compound C1=C(Cl)C(OC(C)C)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 QYKQJKMDSDBOCB-UHFFFAOYSA-N 0.000 description 2
- IAJYGLWDIJOHTK-UHFFFAOYSA-N 4-[(3,5-dichloro-4-propoxybenzoyl)amino]benzoic acid Chemical compound C1=C(Cl)C(OCCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 IAJYGLWDIJOHTK-UHFFFAOYSA-N 0.000 description 2
- LQMCIHFGIGMYME-UHFFFAOYSA-N 4-[(3,5-dichlorobenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C1=CC(Cl)=CC(Cl)=C1 LQMCIHFGIGMYME-UHFFFAOYSA-N 0.000 description 2
- HRFAJPYTYYJKGH-UHFFFAOYSA-N 4-[(3-chloro-4,5-dicyclopentyloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(C(O)=O)C(C)=CC(NC(=O)C=2C=C(OC3CCCC3)C(OC3CCCC3)=C(Cl)C=2)=C1 HRFAJPYTYYJKGH-UHFFFAOYSA-N 0.000 description 2
- MMQHKOLUVZIWFK-UHFFFAOYSA-N 4-[(3-chloro-4-cyclopentyloxy-5-methoxybenzoyl)amino]benzoic acid Chemical compound COC1=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=CC(Cl)=C1OC1CCCC1 MMQHKOLUVZIWFK-UHFFFAOYSA-N 0.000 description 2
- ZTWNATMKSJDNMB-UHFFFAOYSA-N 4-[(3-chloro-4-ethoxy-5-propan-2-yloxybenzoyl)amino]-2-fluorobenzoic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 ZTWNATMKSJDNMB-UHFFFAOYSA-N 0.000 description 2
- BBQHSIPWWVNDFV-UHFFFAOYSA-N 4-[(3-chloro-4-ethoxy-5-propan-2-yloxybenzoyl)amino]-2-hydroxybenzoic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(O)=C1 BBQHSIPWWVNDFV-UHFFFAOYSA-N 0.000 description 2
- ZWBXDTPGJLLDCM-UHFFFAOYSA-N 4-[(3-chloro-4-ethoxy-5-propan-2-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 ZWBXDTPGJLLDCM-UHFFFAOYSA-N 0.000 description 2
- LEFYAWNORVVOOT-UHFFFAOYSA-N 4-[(3-chloro-4-ethoxy-5-propan-2-yloxybenzoyl)amino]benzoic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 LEFYAWNORVVOOT-UHFFFAOYSA-N 0.000 description 2
- IQMDVIXPFGJYDI-UHFFFAOYSA-N 4-[(3-chloro-4-methoxy-5-pentan-3-yloxybenzoyl)amino]-2-fluorobenzoic acid Chemical compound ClC1=C(OC)C(OC(CC)CC)=CC(C(=O)NC=2C=C(F)C(C(O)=O)=CC=2)=C1 IQMDVIXPFGJYDI-UHFFFAOYSA-N 0.000 description 2
- LYKXVVQVFPENNI-UHFFFAOYSA-N 4-[(3-chloro-4-methoxy-5-pentan-3-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound ClC1=C(OC)C(OC(CC)CC)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 LYKXVVQVFPENNI-UHFFFAOYSA-N 0.000 description 2
- WRVMJOWZMVWZGC-UHFFFAOYSA-N 4-[(3-chloro-4-methoxy-5-pentan-3-yloxybenzoyl)amino]benzoic acid Chemical compound ClC1=C(OC)C(OC(CC)CC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 WRVMJOWZMVWZGC-UHFFFAOYSA-N 0.000 description 2
- VHYSMIKRWYWVFI-UHFFFAOYSA-N 4-[(3-chloro-4-methoxy-5-propan-2-yloxybenzoyl)amino]-2-fluorobenzoic acid Chemical compound C1=C(OC(C)C)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 VHYSMIKRWYWVFI-UHFFFAOYSA-N 0.000 description 2
- NYELPSPJJUSESF-UHFFFAOYSA-N 4-[(3-chloro-4-methoxy-5-propan-2-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound C1=C(OC(C)C)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 NYELPSPJJUSESF-UHFFFAOYSA-N 0.000 description 2
- PDVCKFFYLUHHTF-UHFFFAOYSA-N 4-[(3-chloro-4-methoxy-5-propan-2-yloxybenzoyl)amino]benzoic acid Chemical compound C1=C(OC(C)C)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 PDVCKFFYLUHHTF-UHFFFAOYSA-N 0.000 description 2
- TVLKLUPWFSTFGV-UHFFFAOYSA-N 4-[(3-chloro-5-cyclobutyloxy-4-ethoxybenzoyl)amino]-2-methylbenzoic acid Chemical compound CCOC1=C(Cl)C=C(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)C=C1OC1CCC1 TVLKLUPWFSTFGV-UHFFFAOYSA-N 0.000 description 2
- ATQQHJSUVFXYNV-UHFFFAOYSA-N 4-[(3-chloro-5-cyclobutyloxy-4-ethoxybenzoyl)amino]benzoic acid Chemical compound CCOC1=C(Cl)C=C(C(=O)NC=2C=CC(=CC=2)C(O)=O)C=C1OC1CCC1 ATQQHJSUVFXYNV-UHFFFAOYSA-N 0.000 description 2
- BBAALDCKGUGSGP-UHFFFAOYSA-N 4-[(3-chloro-5-cyclobutyloxy-4-methoxybenzoyl)amino]-2-fluorobenzoic acid Chemical compound COC1=C(Cl)C=C(C(=O)NC=2C=C(F)C(C(O)=O)=CC=2)C=C1OC1CCC1 BBAALDCKGUGSGP-UHFFFAOYSA-N 0.000 description 2
- KRIREXWJXHKAHF-UHFFFAOYSA-N 4-[(3-chloro-5-cyclobutyloxy-4-methoxybenzoyl)amino]-2-methylbenzoic acid Chemical compound COC1=C(Cl)C=C(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)C=C1OC1CCC1 KRIREXWJXHKAHF-UHFFFAOYSA-N 0.000 description 2
- ZZOYFIFJZPGWKT-UHFFFAOYSA-N 4-[(3-chloro-5-cyclobutyloxy-4-methoxybenzoyl)amino]benzoic acid Chemical compound COC1=C(Cl)C=C(C(=O)NC=2C=CC(=CC=2)C(O)=O)C=C1OC1CCC1 ZZOYFIFJZPGWKT-UHFFFAOYSA-N 0.000 description 2
- FOJNVMFYFQHSQW-UHFFFAOYSA-N 4-[(3-chloro-5-ethoxy-4-propan-2-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound ClC1=C(OC(C)C)C(OCC)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 FOJNVMFYFQHSQW-UHFFFAOYSA-N 0.000 description 2
- PTNIHKQMCKUQCC-UHFFFAOYSA-N 4-[(3-chloro-5-ethoxy-4-propan-2-yloxybenzoyl)amino]benzoic acid Chemical compound ClC1=C(OC(C)C)C(OCC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 PTNIHKQMCKUQCC-UHFFFAOYSA-N 0.000 description 2
- FCJOJRWGHRJGLP-UHFFFAOYSA-N 4-[(3-chloro-5-methoxy-4-propan-2-yloxybenzoyl)amino]benzoic acid Chemical compound ClC1=C(OC(C)C)C(OC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 FCJOJRWGHRJGLP-UHFFFAOYSA-N 0.000 description 2
- YPWYFZPLXASVOX-UHFFFAOYSA-N 4-[(4-bromo-3,5-diethoxybenzoyl)amino]benzoic acid Chemical compound CCOC1=C(Br)C(OCC)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 YPWYFZPLXASVOX-UHFFFAOYSA-N 0.000 description 2
- YPCASGURDZCROC-UHFFFAOYSA-N 4-[(4-chloro-3-ethoxy-5-pentan-3-yloxybenzoyl)amino]-2-fluorobenzoic acid Chemical compound CCC(CC)OC1=C(Cl)C(OCC)=CC(C(=O)NC=2C=C(F)C(C(O)=O)=CC=2)=C1 YPCASGURDZCROC-UHFFFAOYSA-N 0.000 description 2
- ZACINXXAFZMLSI-UHFFFAOYSA-N 4-[(4-chloro-3-ethoxy-5-pentan-3-yloxybenzoyl)amino]-2-methylbenzoic acid Chemical compound CCC(CC)OC1=C(Cl)C(OCC)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 ZACINXXAFZMLSI-UHFFFAOYSA-N 0.000 description 2
- FAJKEPNHUIABED-UHFFFAOYSA-N 4-[(4-ethoxy-3,5-difluorobenzoyl)amino]benzoic acid Chemical compound C1=C(F)C(OCC)=C(F)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 FAJKEPNHUIABED-UHFFFAOYSA-N 0.000 description 2
- UYMDDTDYVOCYPI-UHFFFAOYSA-N 4-[(4-ethoxy-3,5-difluorophenyl)carbamoyl]benzoic acid Chemical compound C1=C(F)C(OCC)=C(F)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 UYMDDTDYVOCYPI-UHFFFAOYSA-N 0.000 description 2
- KDWXHHXNLVCLSQ-UHFFFAOYSA-N 4-[[3,4,5-tri(propan-2-yloxy)benzoyl]amino]benzoic acid Chemical compound CC(C)OC1=C(OC(C)C)C(OC(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 KDWXHHXNLVCLSQ-UHFFFAOYSA-N 0.000 description 2
- WLIPQZSQJXYXMR-UHFFFAOYSA-N 4-[[3,4,5-tris[(2-methylpropan-2-yl)oxy]benzoyl]amino]benzoic acid Chemical compound CC(C)(C)OC1=C(OC(C)(C)C)C(OC(C)(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 WLIPQZSQJXYXMR-UHFFFAOYSA-N 0.000 description 2
- HORUERRUMILOAR-UHFFFAOYSA-N 4-[[3,5-dichloro-4-[(2-methylpropan-2-yl)oxy]benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(O)=O)C(C)=CC(NC(=O)C=2C=C(Cl)C(OC(C)(C)C)=C(Cl)C=2)=C1 HORUERRUMILOAR-UHFFFAOYSA-N 0.000 description 2
- HGNWEQBIOBWTJV-UHFFFAOYSA-N 4-[[3-bromo-4-ethoxy-5-(trifluoromethyl)benzoyl]amino]-2-fluorobenzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(Br)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 HGNWEQBIOBWTJV-UHFFFAOYSA-N 0.000 description 2
- LXEAVUFPGWIFFQ-UHFFFAOYSA-N 4-[[3-bromo-4-ethoxy-5-(trifluoromethyl)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(Br)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 LXEAVUFPGWIFFQ-UHFFFAOYSA-N 0.000 description 2
- QUFRBCDHVCWFKU-UHFFFAOYSA-N 4-[[3-bromo-4-ethoxy-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(Br)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 QUFRBCDHVCWFKU-UHFFFAOYSA-N 0.000 description 2
- AKKPXHTZWZPWHL-UHFFFAOYSA-N 4-[[3-chloro-4,5-bis(phenylmethoxy)benzoyl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1OCC=2C=CC=CC=2)=CC(Cl)=C1OCC1=CC=CC=C1 AKKPXHTZWZPWHL-UHFFFAOYSA-N 0.000 description 2
- MWOFCNGBYHCSRO-UHFFFAOYSA-N 4-[[3-chloro-4,5-bis[(2-methylpropan-2-yl)oxy]benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(O)=O)C(C)=CC(NC(=O)C=2C=C(OC(C)(C)C)C(OC(C)(C)C)=C(Cl)C=2)=C1 MWOFCNGBYHCSRO-UHFFFAOYSA-N 0.000 description 2
- OPVWNSQNNDMCNM-UHFFFAOYSA-N 4-[[3-chloro-4,5-di(propan-2-yloxy)benzoyl]amino]-2-fluorobenzoic acid Chemical compound ClC1=C(OC(C)C)C(OC(C)C)=CC(C(=O)NC=2C=C(F)C(C(O)=O)=CC=2)=C1 OPVWNSQNNDMCNM-UHFFFAOYSA-N 0.000 description 2
- GRMKAEXRVVYPHF-UHFFFAOYSA-N 4-[[3-chloro-4-[(2-methylpropan-2-yl)oxy]-5-(trifluoromethyl)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(O)=O)C(C)=CC(NC(=O)C=2C=C(C(OC(C)(C)C)=C(Cl)C=2)C(F)(F)F)=C1 GRMKAEXRVVYPHF-UHFFFAOYSA-N 0.000 description 2
- BMCVOASPLMBAIS-UHFFFAOYSA-N 4-[[3-chloro-4-[(2-methylpropan-2-yl)oxy]-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=C(C(F)(F)F)C(OC(C)(C)C)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 BMCVOASPLMBAIS-UHFFFAOYSA-N 0.000 description 2
- GOTRCGZXZVJFHI-UHFFFAOYSA-N 4-[[3-chloro-4-cyclopentyloxy-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1C(F)(F)F)=CC(Cl)=C1OC1CCCC1 GOTRCGZXZVJFHI-UHFFFAOYSA-N 0.000 description 2
- OJGFMBUWIKFTCZ-UHFFFAOYSA-N 4-[[3-chloro-4-ethoxy-5-(trifluoromethyl)benzoyl]amino]-2,6-difluorobenzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(Cl)C=C1C(=O)NC1=CC(F)=C(C(O)=O)C(F)=C1 OJGFMBUWIKFTCZ-UHFFFAOYSA-N 0.000 description 2
- WSIAGAGISUORJG-UHFFFAOYSA-N 4-[[3-chloro-4-ethoxy-5-(trifluoromethyl)benzoyl]amino]-2-fluorobenzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 WSIAGAGISUORJG-UHFFFAOYSA-N 0.000 description 2
- XXLMSENYYDTEKD-UHFFFAOYSA-N 4-[[3-chloro-4-ethoxy-5-(trifluoromethyl)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 XXLMSENYYDTEKD-UHFFFAOYSA-N 0.000 description 2
- RBYWAJGSZJPJKK-UHFFFAOYSA-N 4-[[3-chloro-4-ethoxy-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=C(C(F)(F)F)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 RBYWAJGSZJPJKK-UHFFFAOYSA-N 0.000 description 2
- JBWJERLEAALZMN-UHFFFAOYSA-N 4-[[3-chloro-4-methoxy-5-(2-methoxyethoxy)benzoyl]amino]-2-fluorobenzoic acid Chemical compound ClC1=C(OC)C(OCCOC)=CC(C(=O)NC=2C=C(F)C(C(O)=O)=CC=2)=C1 JBWJERLEAALZMN-UHFFFAOYSA-N 0.000 description 2
- ADIBBUXLGCSNDB-UHFFFAOYSA-N 4-[[3-chloro-4-methoxy-5-(trifluoromethyl)benzoyl]amino]-2-fluorobenzoic acid Chemical compound C1=C(C(F)(F)F)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 ADIBBUXLGCSNDB-UHFFFAOYSA-N 0.000 description 2
- JOMSZIRAZRHDLZ-UHFFFAOYSA-N 4-[[3-chloro-4-methoxy-5-(trifluoromethyl)benzoyl]amino]-2-hydroxybenzoic acid Chemical compound C1=C(C(F)(F)F)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(O)=C1 JOMSZIRAZRHDLZ-UHFFFAOYSA-N 0.000 description 2
- SBDSIFKZNHCQAA-UHFFFAOYSA-N 4-[[3-chloro-4-methoxy-5-(trifluoromethyl)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(F)(F)F)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 SBDSIFKZNHCQAA-UHFFFAOYSA-N 0.000 description 2
- CSMHVBQOKILYHE-UHFFFAOYSA-N 4-[[3-chloro-4-methoxy-5-(trifluoromethyl)benzoyl]amino]-3-fluorobenzoic acid Chemical compound C1=C(C(F)(F)F)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1F CSMHVBQOKILYHE-UHFFFAOYSA-N 0.000 description 2
- QOXOHBVOHPQYGD-UHFFFAOYSA-N 4-[[3-chloro-4-methoxy-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=C(C(F)(F)F)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 QOXOHBVOHPQYGD-UHFFFAOYSA-N 0.000 description 2
- GJJCJHAHSNDMMF-UHFFFAOYSA-N 4-[[3-chloro-4-propan-2-yloxy-5-(trifluoromethyl)benzoyl]amino]-2-fluorobenzoic acid Chemical compound C1=C(C(F)(F)F)C(OC(C)C)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(F)=C1 GJJCJHAHSNDMMF-UHFFFAOYSA-N 0.000 description 2
- UXBBTYKKWVXFPP-UHFFFAOYSA-N 4-[[3-chloro-4-propan-2-yloxy-5-(trifluoromethyl)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(F)(F)F)C(OC(C)C)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 UXBBTYKKWVXFPP-UHFFFAOYSA-N 0.000 description 2
- HVRLIOWYYYLQAH-UHFFFAOYSA-N 4-[[3-chloro-5-(2,2-dimethylpropoxy)-4-methoxybenzoyl]amino]benzoic acid Chemical compound C1=C(OCC(C)(C)C)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 HVRLIOWYYYLQAH-UHFFFAOYSA-N 0.000 description 2
- IBQKOHNUDSREMI-UHFFFAOYSA-N 4-[[3-chloro-5-(cyclopropylmethoxy)-4-ethoxybenzoyl]amino]-2-hydroxybenzoic acid Chemical compound CCOC1=C(Cl)C=C(C(=O)NC=2C=C(O)C(C(O)=O)=CC=2)C=C1OCC1CC1 IBQKOHNUDSREMI-UHFFFAOYSA-N 0.000 description 2
- DVBLSHILALNPSL-UHFFFAOYSA-N 4-[[3-chloro-5-(cyclopropylmethoxy)-4-ethoxybenzoyl]amino]-2-methylbenzoic acid Chemical compound CCOC1=C(Cl)C=C(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)C=C1OCC1CC1 DVBLSHILALNPSL-UHFFFAOYSA-N 0.000 description 2
- VKGMSJNRNKCLTM-UHFFFAOYSA-N 4-[[3-chloro-5-(cyclopropylmethoxy)-4-ethoxybenzoyl]amino]benzoic acid Chemical compound CCOC1=C(Cl)C=C(C(=O)NC=2C=CC(=CC=2)C(O)=O)C=C1OCC1CC1 VKGMSJNRNKCLTM-UHFFFAOYSA-N 0.000 description 2
- UEQWYGUDZBNHCX-UHFFFAOYSA-N 4-[[4-bromo-3,5-di(propan-2-yloxy)benzoyl]amino]-2-fluorobenzoic acid Chemical compound CC(C)OC1=C(Br)C(OC(C)C)=CC(C(=O)NC=2C=C(F)C(C(O)=O)=CC=2)=C1 UEQWYGUDZBNHCX-UHFFFAOYSA-N 0.000 description 2
- INWHHEOTPXALAJ-UHFFFAOYSA-N 4-[[4-bromo-3,5-di(propan-2-yloxy)benzoyl]amino]-2-hydroxybenzoic acid Chemical compound CC(C)OC1=C(Br)C(OC(C)C)=CC(C(=O)NC=2C=C(O)C(C(O)=O)=CC=2)=C1 INWHHEOTPXALAJ-UHFFFAOYSA-N 0.000 description 2
- UPSCKONPFADQBL-UHFFFAOYSA-N 4-[[4-bromo-3,5-di(propan-2-yloxy)benzoyl]amino]benzoic acid Chemical compound CC(C)OC1=C(Br)C(OC(C)C)=CC(C(=O)NC=2C=CC(=CC=2)C(O)=O)=C1 UPSCKONPFADQBL-UHFFFAOYSA-N 0.000 description 2
- YMLYNZLSCWASTL-UHFFFAOYSA-N 4-[[4-ethoxy-3,5-di(propan-2-yloxy)benzoyl]amino]benzoic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(OC(C)C)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 YMLYNZLSCWASTL-UHFFFAOYSA-N 0.000 description 2
- VZSJFSLHBCFJNH-UHFFFAOYSA-N 4-[[4-methoxy-3,5-di(propan-2-yloxy)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(OC(C)C)C(OC)=C(OC(C)C)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 VZSJFSLHBCFJNH-UHFFFAOYSA-N 0.000 description 2
- VRFBYTATEXYUHY-UHFFFAOYSA-N 4-[[4-methoxy-3,5-di(propan-2-yloxy)benzoyl]amino]benzoic acid Chemical compound C1=C(OC(C)C)C(OC)=C(OC(C)C)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 VRFBYTATEXYUHY-UHFFFAOYSA-N 0.000 description 2
- JNTZLNJZDRKPSU-UHFFFAOYSA-N 4-bromo-3,5-diethoxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC(OCC)=C1Br JNTZLNJZDRKPSU-UHFFFAOYSA-N 0.000 description 2
- KWEQYUCUGSDCHR-UHFFFAOYSA-N 4-ethoxy-3-(trifluoromethyl)benzoic acid Chemical compound CCOC1=CC=C(C(O)=O)C=C1C(F)(F)F KWEQYUCUGSDCHR-UHFFFAOYSA-N 0.000 description 2
- NGPJZYQZWLMFTE-UHFFFAOYSA-N 4-methoxy-3,5-di(propan-2-yloxy)benzoic acid Chemical compound COC1=C(OC(C)C)C=C(C(O)=O)C=C1OC(C)C NGPJZYQZWLMFTE-UHFFFAOYSA-N 0.000 description 2
- BLEQWWOUVBJBLK-UHFFFAOYSA-N 5-[(3,5-dichloro-4-ethoxybenzoyl)amino]pyridine-2-carboxylic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)N=C1 BLEQWWOUVBJBLK-UHFFFAOYSA-N 0.000 description 2
- QJFMDGBZPZWUKM-UHFFFAOYSA-N 6-[(3,5-dichloro-4-ethoxybenzoyl)amino]pyridine-3-carboxylic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=N1 QJFMDGBZPZWUKM-UHFFFAOYSA-N 0.000 description 2
- CUZGWEIZJZPYTI-UHFFFAOYSA-N 6-[(3-chloro-4-ethoxy-5-propan-2-yloxybenzoyl)amino]pyridazine-3-carboxylic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)N=N1 CUZGWEIZJZPYTI-UHFFFAOYSA-N 0.000 description 2
- 102000012440 Acetylcholinesterase Human genes 0.000 description 2
- 108010022752 Acetylcholinesterase Proteins 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 229910015845 BBr3 Inorganic materials 0.000 description 2
- 208000020084 Bone disease Diseases 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 241000282693 Cercopithecidae Species 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- 206010061818 Disease progression Diseases 0.000 description 2
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 2
- 241000792859 Enema Species 0.000 description 2
- 241000283073 Equus caballus Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- 101000823051 Homo sapiens Amyloid-beta precursor protein Proteins 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 102000007399 Nuclear hormone receptor Human genes 0.000 description 2
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 102000034527 Retinoid X Receptors Human genes 0.000 description 2
- 108010038912 Retinoid X Receptors Proteins 0.000 description 2
- 239000008156 Ringer's lactate solution Substances 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 229940116211 Vasopressin antagonist Drugs 0.000 description 2
- 230000009102 absorption Effects 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 229940022698 acetylcholinesterase Drugs 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001409 amidines Chemical class 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 238000010913 antigen-directed enzyme pro-drug therapy Methods 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- SLPJDJBKTWFTKC-UHFFFAOYSA-N benzyl 4-[[4-ethoxy-3-(trifluoromethyl)benzoyl]amino]-2,6-difluorobenzoate Chemical compound C1=C(C(F)(F)F)C(OCC)=CC=C1C(=O)NC(C=C1F)=CC(F)=C1C(=O)OCC1=CC=CC=C1 SLPJDJBKTWFTKC-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 238000004113 cell culture Methods 0.000 description 2
- 210000003710 cerebral cortex Anatomy 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 125000003636 chemical group Chemical group 0.000 description 2
- 230000006949 cholinergic function Effects 0.000 description 2
- 210000002932 cholinergic neuron Anatomy 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 239000002537 cosmetic Substances 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- 238000006264 debenzylation reaction Methods 0.000 description 2
- 230000006735 deficit Effects 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- 238000003745 diagnosis Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000005750 disease progression Effects 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- ADEBPBSSDYVVLD-UHFFFAOYSA-N donepezil Chemical compound O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 ADEBPBSSDYVVLD-UHFFFAOYSA-N 0.000 description 2
- 239000007920 enema Substances 0.000 description 2
- 229940095399 enema Drugs 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- UNWQLHONIWEPMU-UHFFFAOYSA-N ethyl 4-amino-2,6-difluorobenzoate Chemical compound CCOC(=O)C1=C(F)C=C(N)C=C1F UNWQLHONIWEPMU-UHFFFAOYSA-N 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000003889 eye drop Substances 0.000 description 2
- 229940012356 eye drops Drugs 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 230000037406 food intake Effects 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 230000000971 hippocampal effect Effects 0.000 description 2
- 102000046783 human APP Human genes 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000003550 marker Substances 0.000 description 2
- 230000000873 masking effect Effects 0.000 description 2
- DLGWBSDSACLMHQ-UHFFFAOYSA-N methyl 2-chloro-4-[(3,5-dichloro-4-ethoxybenzoyl)amino]benzoate Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(=O)OC)C(Cl)=C1 DLGWBSDSACLMHQ-UHFFFAOYSA-N 0.000 description 2
- DHYURVLPAOZDSO-UHFFFAOYSA-N methyl 3,5-dichloro-4-cyclopentyloxybenzoate Chemical compound ClC1=CC(C(=O)OC)=CC(Cl)=C1OC1CCCC1 DHYURVLPAOZDSO-UHFFFAOYSA-N 0.000 description 2
- HHJLUJGYZFXISM-UHFFFAOYSA-N methyl 3,5-dichloro-4-phenylmethoxybenzoate Chemical compound ClC1=CC(C(=O)OC)=CC(Cl)=C1OCC1=CC=CC=C1 HHJLUJGYZFXISM-UHFFFAOYSA-N 0.000 description 2
- PHHSJRDGRQHEEJ-UHFFFAOYSA-N methyl 3,5-dihydroxy-4-nitrobenzoate Chemical compound COC(=O)C1=CC(O)=C([N+]([O-])=O)C(O)=C1 PHHSJRDGRQHEEJ-UHFFFAOYSA-N 0.000 description 2
- RNVFYQUEEMZKLR-UHFFFAOYSA-N methyl 3,5-dihydroxybenzoate Chemical compound COC(=O)C1=CC(O)=CC(O)=C1 RNVFYQUEEMZKLR-UHFFFAOYSA-N 0.000 description 2
- PFAJDLXHPDDBFL-UHFFFAOYSA-N methyl 3-chloro-4,5-dicyclopentyloxybenzoate Chemical compound C1CCCC1OC1=CC(C(=O)OC)=CC(Cl)=C1OC1CCCC1 PFAJDLXHPDDBFL-UHFFFAOYSA-N 0.000 description 2
- HYSSDRVFOGJZSS-UHFFFAOYSA-N methyl 3-chloro-4-phenylmethoxy-5-propan-2-yloxybenzoate Chemical compound CC(C)OC1=CC(C(=O)OC)=CC(Cl)=C1OCC1=CC=CC=C1 HYSSDRVFOGJZSS-UHFFFAOYSA-N 0.000 description 2
- IIHVDCZTZOBXRM-UHFFFAOYSA-N methyl 4-[(3,5-dichloro-4-cyclopentyloxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OC1CCCC1 IIHVDCZTZOBXRM-UHFFFAOYSA-N 0.000 description 2
- KQABFTPMZIRTAJ-UHFFFAOYSA-N methyl 4-[(3-chloro-4,5-dicyclohexyloxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C(C=C1OC2CCCCC2)=CC(Cl)=C1OC1CCCCC1 KQABFTPMZIRTAJ-UHFFFAOYSA-N 0.000 description 2
- JNCQSYGQGSGKRM-UHFFFAOYSA-N methyl 4-[(4-chloro-3-methoxy-5-propan-2-yloxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(OC)=C(Cl)C(OC(C)C)=C1 JNCQSYGQGSGKRM-UHFFFAOYSA-N 0.000 description 2
- OGAJLAOOLAXRGZ-UHFFFAOYSA-N methyl 4-[[3,5-dichloro-4-[(2-methylpropan-2-yl)oxy]benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(OC(C)(C)C)C(Cl)=C1 OGAJLAOOLAXRGZ-UHFFFAOYSA-N 0.000 description 2
- IOSXTVBHCUKTTA-UHFFFAOYSA-N methyl 4-[[4-fluoro-3,5-di(propan-2-yloxy)benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C1=CC(OC(C)C)=C(F)C(OC(C)C)=C1 IOSXTVBHCUKTTA-UHFFFAOYSA-N 0.000 description 2
- DSHBGNPOIBSIOQ-UHFFFAOYSA-N methyl 4-amino-2-chlorobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1Cl DSHBGNPOIBSIOQ-UHFFFAOYSA-N 0.000 description 2
- CVXXHXPNTZBZEL-UHFFFAOYSA-N methyl 4-carbonochloridoylbenzoate Chemical compound COC(=O)C1=CC=C(C(Cl)=O)C=C1 CVXXHXPNTZBZEL-UHFFFAOYSA-N 0.000 description 2
- JACPDLJUQLKABC-UHFFFAOYSA-N methyl 6-aminopyridine-3-carboxylate Chemical compound COC(=O)C1=CC=C(N)N=C1 JACPDLJUQLKABC-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- BVWTXUYLKBHMOX-UHFFFAOYSA-N methyl vanillate Chemical compound COC(=O)C1=CC=C(O)C(OC)=C1 BVWTXUYLKBHMOX-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 239000011859 microparticle Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 239000007922 nasal spray Substances 0.000 description 2
- 230000001722 neurochemical effect Effects 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 238000010606 normalization Methods 0.000 description 2
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluenecarboxylic acid Natural products CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 2
- 239000003883 ointment base Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 150000002891 organic anions Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 238000002428 photodynamic therapy Methods 0.000 description 2
- 239000013612 plasmid Substances 0.000 description 2
- 239000011505 plaster Substances 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- GMYDGDLDEGLTAA-UHFFFAOYSA-N propan-2-yl 3,4-dichloro-5-propan-2-yloxybenzoate Chemical compound CC(C)OC(=O)C1=CC(Cl)=C(Cl)C(OC(C)C)=C1 GMYDGDLDEGLTAA-UHFFFAOYSA-N 0.000 description 2
- XFVINYCUOPRVQM-UHFFFAOYSA-N propan-2-yl 4-chloro-3,5-di(propan-2-yloxy)benzoate Chemical compound CC(C)OC(=O)C1=CC(OC(C)C)=C(Cl)C(OC(C)C)=C1 XFVINYCUOPRVQM-UHFFFAOYSA-N 0.000 description 2
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- XJMOSONTPMZWPB-UHFFFAOYSA-M propidium iodide Chemical compound [I-].[I-].C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CCC[N+](C)(CC)CC)=C1C1=CC=CC=C1 XJMOSONTPMZWPB-UHFFFAOYSA-M 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 102000027483 retinoid hormone receptors Human genes 0.000 description 2
- 108091008679 retinoid hormone receptors Proteins 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000010356 sorbitol Nutrition 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 230000003956 synaptic plasticity Effects 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- AHGAPDNLWMAHKO-UHFFFAOYSA-N tert-butyl 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]-2-methoxybenzoate Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(=O)OC(C)(C)C)C(OC)=C1 AHGAPDNLWMAHKO-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 2
- 239000012414 tert-butyl nitrite Substances 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000013518 transcription Methods 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 2
- 239000005051 trimethylchlorosilane Substances 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003038 vasopressin antagonist Substances 0.000 description 2
- 230000031836 visual learning Effects 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- GEZMEIHVFSWOCA-UHFFFAOYSA-N (4-fluorophenyl)methanol Chemical compound OCC1=CC=C(F)C=C1 GEZMEIHVFSWOCA-UHFFFAOYSA-N 0.000 description 1
- HBZBAMXERPYTFS-SECBINFHSA-N (4S)-2-(6,7-dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid Chemical compound OC(=O)[C@H]1CSC(=N1)c1nc2cc3CCNc3cc2s1 HBZBAMXERPYTFS-SECBINFHSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (e)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- LLNAMUJRIZIXHF-CLFYSBASSA-N (z)-2-methyl-3-phenylprop-2-en-1-ol Chemical compound OCC(/C)=C\C1=CC=CC=C1 LLNAMUJRIZIXHF-CLFYSBASSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- QMMJWQMCMRUYTG-UHFFFAOYSA-N 1,2,4,5-tetrachloro-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl QMMJWQMCMRUYTG-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- PGGZAZHZNVKDLG-UHFFFAOYSA-N 1,4-dioxane;hexane Chemical compound CCCCCC.C1COCCO1 PGGZAZHZNVKDLG-UHFFFAOYSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- DQFQCHIDRBIESA-UHFFFAOYSA-N 1-benzazepine Chemical compound N1C=CC=CC2=CC=CC=C12 DQFQCHIDRBIESA-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical class C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- CQWYAXCOVZKLHY-UHFFFAOYSA-N 1-bromo-2,2-dimethylpropane Chemical compound CC(C)(C)CBr CQWYAXCOVZKLHY-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- XHONYVFDZSPELQ-UHFFFAOYSA-N 1-methoxy-3-(trifluoromethyl)benzene Chemical compound COC1=CC=CC(C(F)(F)F)=C1 XHONYVFDZSPELQ-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- LGEZTMRIZWCDLW-UHFFFAOYSA-N 14-methylpentadecyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCC(C)C LGEZTMRIZWCDLW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LPXDXOWAAJJLOT-UHFFFAOYSA-N 2-bromo-4-(trifluoromethylsulfonyl)aniline Chemical compound NC1=CC=C(S(=O)(=O)C(F)(F)F)C=C1Br LPXDXOWAAJJLOT-UHFFFAOYSA-N 0.000 description 1
- YORXVDFXIQGHAF-UHFFFAOYSA-N 2-chloro-4-[(3,5-dichloro-4-ethoxybenzoyl)amino]benzoic acid Chemical compound C1=C(Cl)C(OCC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C(Cl)=C1 YORXVDFXIQGHAF-UHFFFAOYSA-N 0.000 description 1
- JLJXQPHWRCJCNB-UHFFFAOYSA-N 2-chloro-4-cyclopentyloxybenzoic acid Chemical compound C1=C(Cl)C(C(=O)O)=CC=C1OC1CCCC1 JLJXQPHWRCJCNB-UHFFFAOYSA-N 0.000 description 1
- SJPRFYFOKULKRF-UHFFFAOYSA-N 2-chloro-5-nitro-1,3-bis(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=C(Cl)C(C(F)(F)F)=C1 SJPRFYFOKULKRF-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- SFAAOBGYWOUHLU-UHFFFAOYSA-N 2-ethylhexyl hexadecanoate Chemical compound CCCCCCCCCCCCCCCC(=O)OCC(CC)CCCC SFAAOBGYWOUHLU-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- KPJXEWJRJKEOCD-UHFFFAOYSA-N 2-methoxy-4-nitrobenzoic acid Chemical compound COC1=CC([N+]([O-])=O)=CC=C1C(O)=O KPJXEWJRJKEOCD-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- BNDFFSXPXTYBBA-UHFFFAOYSA-N 3,4,5-tri(propan-2-yloxy)benzoic acid Chemical compound CC(C)OC1=CC(C(O)=O)=CC(OC(C)C)=C1OC(C)C BNDFFSXPXTYBBA-UHFFFAOYSA-N 0.000 description 1
- PJEWBYWFDZDVGG-UHFFFAOYSA-N 3,4,5-tris[(2-methylpropan-2-yl)oxy]benzoic acid Chemical compound CC(C)(C)OC1=CC(C(O)=O)=CC(OC(C)(C)C)=C1OC(C)(C)C PJEWBYWFDZDVGG-UHFFFAOYSA-N 0.000 description 1
- WNRGWPVJGDABME-UHFFFAOYSA-N 3,5-Dimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1 WNRGWPVJGDABME-UHFFFAOYSA-N 0.000 description 1
- JXBXPZOSSBPFEB-UHFFFAOYSA-N 3,5-dibromo-4-propan-2-yloxybenzoic acid Chemical compound CC(C)OC1=C(Br)C=C(C(O)=O)C=C1Br JXBXPZOSSBPFEB-UHFFFAOYSA-N 0.000 description 1
- IMSKTSQBDRLEBN-UHFFFAOYSA-N 3,5-dichloro-4-propoxybenzoic acid Chemical compound CCCOC1=C(Cl)C=C(C(O)=O)C=C1Cl IMSKTSQBDRLEBN-UHFFFAOYSA-N 0.000 description 1
- MHQZQHUERKESCR-UHFFFAOYSA-N 3,5-dicyclopentyloxy-4-ethoxybenzoic acid Chemical compound C1=C(C(O)=O)C=C(OC2CCCC2)C(OCC)=C1OC1CCCC1 MHQZQHUERKESCR-UHFFFAOYSA-N 0.000 description 1
- YOWQTTYAQQPSHM-UHFFFAOYSA-N 3,5-difluoro-4-methoxybenzoic acid Chemical compound COC1=C(F)C=C(C(O)=O)C=C1F YOWQTTYAQQPSHM-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- UOQHWNPVNXSDDO-UHFFFAOYSA-N 3-bromoimidazo[1,2-a]pyridine-6-carbonitrile Chemical compound C1=CC(C#N)=CN2C(Br)=CN=C21 UOQHWNPVNXSDDO-UHFFFAOYSA-N 0.000 description 1
- UYUBJGCPOOUMST-UHFFFAOYSA-N 3-chloro-4-cyclopentyloxy-5-methoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC(Cl)=C1OC1CCCC1 UYUBJGCPOOUMST-UHFFFAOYSA-N 0.000 description 1
- FDWCHZNFULHBCP-UHFFFAOYSA-N 3-chloro-5-fluoro-4-methoxybenzoic acid Chemical compound COC1=C(F)C=C(C(O)=O)C=C1Cl FDWCHZNFULHBCP-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- FWBHETKCLVMNFS-UHFFFAOYSA-N 4',6-Diamino-2-phenylindol Chemical compound C1=CC(C(=N)N)=CC=C1C1=CC2=CC=C(C(N)=N)C=C2N1 FWBHETKCLVMNFS-UHFFFAOYSA-N 0.000 description 1
- WZIYCIBURCPKAR-UHFFFAOYSA-N 4-(chloromethyl)pyridine Chemical compound ClCC1=CC=NC=C1 WZIYCIBURCPKAR-UHFFFAOYSA-N 0.000 description 1
- QTYUYYHXCZASSY-UHFFFAOYSA-N 4-[(3,5-dicyclopentyloxy-4-ethoxybenzoyl)amino]benzoic acid Chemical compound C1=C(C(=O)NC=2C=CC(=CC=2)C(O)=O)C=C(OC2CCCC2)C(OCC)=C1OC1CCCC1 QTYUYYHXCZASSY-UHFFFAOYSA-N 0.000 description 1
- MJOJSIZIWXMBKK-UHFFFAOYSA-N 4-[(4-bromo-3,5-diethoxybenzoyl)amino]-2-methylbenzoic acid Chemical compound CCOC1=C(Br)C(OCC)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 MJOJSIZIWXMBKK-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- BKPAYAHEPZTZKO-UHFFFAOYSA-N 4-[[3,5-dichloro-4-(pyridin-4-ylmethoxy)benzoyl]amino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC(=O)C(C=C1Cl)=CC(Cl)=C1OCC1=CC=NC=C1 BKPAYAHEPZTZKO-UHFFFAOYSA-N 0.000 description 1
- OAMJSCGXYMTLRF-UHFFFAOYSA-N 4-[[3-chloro-4,5-di(cyclobutyloxy)benzoyl]amino]-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC=C1NC(=O)C(C=C1OC2CCC2)=CC(Cl)=C1OC1CCC1 OAMJSCGXYMTLRF-UHFFFAOYSA-N 0.000 description 1
- BLANVKMJCFKBHG-UHFFFAOYSA-N 4-[[3-chloro-4,5-di(cyclobutyloxy)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(C(O)=O)C(C)=CC(NC(=O)C=2C=C(OC3CCC3)C(OC3CCC3)=C(Cl)C=2)=C1 BLANVKMJCFKBHG-UHFFFAOYSA-N 0.000 description 1
- ABYJTDKHFIYZPD-UHFFFAOYSA-N 4-[[3-chloro-4,5-di(propan-2-yloxy)benzoyl]amino]-2-hydroxybenzoic acid Chemical compound ClC1=C(OC(C)C)C(OC(C)C)=CC(C(=O)NC=2C=C(O)C(C(O)=O)=CC=2)=C1 ABYJTDKHFIYZPD-UHFFFAOYSA-N 0.000 description 1
- FEAXEVVDRJEOMX-UHFFFAOYSA-N 4-[[3-chloro-4,5-di(propan-2-yloxy)benzoyl]amino]-2-methylbenzoic acid Chemical compound ClC1=C(OC(C)C)C(OC(C)C)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 FEAXEVVDRJEOMX-UHFFFAOYSA-N 0.000 description 1
- AAPVXVBSUQFBKQ-UHFFFAOYSA-N 4-[[3-chloro-4-propan-2-yloxy-5-(trifluoromethyl)benzoyl]amino]benzoic acid Chemical compound C1=C(C(F)(F)F)C(OC(C)C)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=C1 AAPVXVBSUQFBKQ-UHFFFAOYSA-N 0.000 description 1
- KLJMMJDMUOQAQS-UHFFFAOYSA-N 4-[[4-bromo-3,5-di(propan-2-yloxy)benzoyl]amino]-2-methylbenzoic acid Chemical compound CC(C)OC1=C(Br)C(OC(C)C)=CC(C(=O)NC=2C=C(C)C(C(O)=O)=CC=2)=C1 KLJMMJDMUOQAQS-UHFFFAOYSA-N 0.000 description 1
- RJUCENBSWHSEET-UHFFFAOYSA-N 4-[[4-ethoxy-3,5-di(propan-2-yloxy)benzoyl]amino]-2-methylbenzoic acid Chemical compound C1=C(OC(C)C)C(OCC)=C(OC(C)C)C=C1C(=O)NC1=CC=C(C(O)=O)C(C)=C1 RJUCENBSWHSEET-UHFFFAOYSA-N 0.000 description 1
- HFYPXERYZGFDBD-UHFFFAOYSA-N 4-amino-2,6-dibromophenol Chemical compound NC1=CC(Br)=C(O)C(Br)=C1 HFYPXERYZGFDBD-UHFFFAOYSA-N 0.000 description 1
- AMVHEVZYTGHASE-UHFFFAOYSA-N 4-amino-2-(trifluoromethyl)benzoic acid Chemical compound NC1=CC=C(C(O)=O)C(C(F)(F)F)=C1 AMVHEVZYTGHASE-UHFFFAOYSA-N 0.000 description 1
- XRSQZFJLEPBPOZ-UHFFFAOYSA-N 4-amino-2-methylbenzoic acid Chemical compound CC1=CC(N)=CC=C1C(O)=O XRSQZFJLEPBPOZ-UHFFFAOYSA-N 0.000 description 1
- 150000005418 4-aminobenzoic acid derivatives Chemical class 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- QDBYWBVGALLLHU-UHFFFAOYSA-N 4-ethoxy-3,5-difluoroaniline Chemical compound CCOC1=C(F)C=C(N)C=C1F QDBYWBVGALLLHU-UHFFFAOYSA-N 0.000 description 1
- QCPWRWTXAQDVSY-UHFFFAOYSA-N 4-ethoxy-3,5-difluorobenzoic acid Chemical compound CCOC1=C(F)C=C(C(O)=O)C=C1F QCPWRWTXAQDVSY-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- WDJARUKOMOGTHA-UHFFFAOYSA-N 5-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=C(C(O)=O)N=C1 WDJARUKOMOGTHA-UHFFFAOYSA-N 0.000 description 1
- NTCKZTBRFXTYBD-UHFFFAOYSA-N 5-methoxycarbonylpyridine-2-carboxylic acid Chemical compound COC(=O)C1=CC=C(C(O)=O)N=C1 NTCKZTBRFXTYBD-UHFFFAOYSA-N 0.000 description 1
- ODTQHCQPFMKBNH-UHFFFAOYSA-N 6-[[3-chloro-4-methoxy-5-(trifluoromethyl)benzoyl]amino]pyridine-3-carboxylic acid Chemical compound C1=C(C(F)(F)F)C(OC)=C(Cl)C=C1C(=O)NC1=CC=C(C(O)=O)C=N1 ODTQHCQPFMKBNH-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- SHGAZHPCJJPHSC-ZVCIMWCZSA-N 9-cis-retinoic acid Chemical compound OC(=O)/C=C(\C)/C=C/C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-ZVCIMWCZSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 208000022099 Alzheimer disease 2 Diseases 0.000 description 1
- 208000037259 Amyloid Plaque Diseases 0.000 description 1
- 102100040038 Amyloid beta precursor like protein 2 Human genes 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 239000012583 B-27 Supplement Substances 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004358 Butane-1, 3-diol Substances 0.000 description 1
- HMHSEOXRZIQBJZ-UHFFFAOYSA-N CC(C)Oc1cc(CO)cc(OC(C)C)c1N Chemical compound CC(C)Oc1cc(CO)cc(OC(C)C)c1N HMHSEOXRZIQBJZ-UHFFFAOYSA-N 0.000 description 1
- BWRCMCJDXQPAGA-UHFFFAOYSA-N CC1[O](Cc2ccccc2)c(c(Cl)cc(C(OC)=O)c2)c2O1 Chemical compound CC1[O](Cc2ccccc2)c(c(Cl)cc(C(OC)=O)c2)c2O1 BWRCMCJDXQPAGA-UHFFFAOYSA-N 0.000 description 1
- ONHQYUZLIHPRMK-UHFFFAOYSA-N COC(c(cc1N=N)cc(OC)c1[O](C)=C)=O Chemical compound COC(c(cc1N=N)cc(OC)c1[O](C)=C)=O ONHQYUZLIHPRMK-UHFFFAOYSA-N 0.000 description 1
- QQDZRPJZLZWHJX-UHFFFAOYSA-N COc(cc(CO)cc1N=O)c1N Chemical compound COc(cc(CO)cc1N=O)c1N QQDZRPJZLZWHJX-UHFFFAOYSA-N 0.000 description 1
- PBFUETHMOZHHOH-UHFFFAOYSA-N C[O](c1cc(CO)ccc1N)=C Chemical compound C[O](c1cc(CO)ccc1N)=C PBFUETHMOZHHOH-UHFFFAOYSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 206010007559 Cardiac failure congestive Diseases 0.000 description 1
- 108010078791 Carrier Proteins Proteins 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 208000005145 Cerebral amyloid angiopathy Diseases 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- 241000251556 Chordata Species 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 229920002785 Croscarmellose sodium Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 206010012289 Dementia Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 101800001224 Disintegrin Proteins 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- 208000032928 Dyslipidaemia Diseases 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000289695 Eutheria Species 0.000 description 1
- 241000282324 Felis Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 1
- 108010001515 Galectin 4 Proteins 0.000 description 1
- 102100039556 Galectin-4 Human genes 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 241000282575 Gorilla Species 0.000 description 1
- 241000288105 Grus Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 101000890401 Homo sapiens Amyloid beta precursor like protein 2 Proteins 0.000 description 1
- 101000959356 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 10 Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000282620 Hylobates sp. Species 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000283953 Lagomorpha Species 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 208000017170 Lipid metabolism disease Diseases 0.000 description 1
- 108060001084 Luciferase Proteins 0.000 description 1
- 239000005089 Luciferase Substances 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 241000289581 Macropus sp. Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 102000005741 Metalloproteases Human genes 0.000 description 1
- 108010006035 Metalloproteases Proteins 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- 102000004868 N-Methyl-D-Aspartate Receptors Human genes 0.000 description 1
- 108090001041 N-Methyl-D-Aspartate Receptors Proteins 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- AXKGIPZJYUNAIW-UHFFFAOYSA-N Nc1ccc(CO)cc1 Chemical compound Nc1ccc(CO)cc1 AXKGIPZJYUNAIW-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- VYEAHXRPWKOEMY-UHFFFAOYSA-N O-(9H-fluoren-9-ylmethyl)hydroxylamine Chemical compound C1=CC=C2C(CON)C3=CC=CC=C3C2=C1 VYEAHXRPWKOEMY-UHFFFAOYSA-N 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 102000004279 Oxytocin receptors Human genes 0.000 description 1
- 108090000876 Oxytocin receptors Proteins 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 241000282577 Pan troglodytes Species 0.000 description 1
- 241001504519 Papio ursinus Species 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 241000282405 Pongo abelii Species 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 1
- LCTONWCANYUPML-UHFFFAOYSA-M Pyruvate Chemical compound CC(=O)C([O-])=O LCTONWCANYUPML-UHFFFAOYSA-M 0.000 description 1
- 108091027981 Response element Proteins 0.000 description 1
- 229940096885 Retinoic acid receptor agonist Drugs 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 108091006774 SLC18A3 Proteins 0.000 description 1
- 201000010001 Silicosis Diseases 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930182558 Sterol Natural products 0.000 description 1
- 238000000692 Student's t-test Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 235000004338 Syringa vulgaris Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- GAMYVSCDDLXAQW-AOIWZFSPSA-N Thermopsosid Natural products O(C)c1c(O)ccc(C=2Oc3c(c(O)cc(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)O4)c3)C(=O)C=2)c1 GAMYVSCDDLXAQW-AOIWZFSPSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- 206010047139 Vasoconstriction Diseases 0.000 description 1
- GXBMIBRIOWHPDT-UHFFFAOYSA-N Vasopressin Natural products N1C(=O)C(CC=2C=C(O)C=CC=2)NC(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CC1=CC=CC=C1 GXBMIBRIOWHPDT-UHFFFAOYSA-N 0.000 description 1
- 102000004136 Vasopressin Receptors Human genes 0.000 description 1
- 108090000643 Vasopressin Receptors Proteins 0.000 description 1
- 108010004977 Vasopressins Proteins 0.000 description 1
- 102000002852 Vasopressins Human genes 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 102000045965 Vesicular Acetylcholine Transport Proteins Human genes 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- 241000289674 Vombatidae Species 0.000 description 1
- CBFSOKBLQATTRC-UHFFFAOYSA-N [diphenyl(phenylmethoxy)methyl]benzene Chemical compound C=1C=CC=CC=1COC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CBFSOKBLQATTRC-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000016571 aggressive behavior Effects 0.000 description 1
- 229960001445 alitretinoin Drugs 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 108091007736 alpha-secretases Proteins 0.000 description 1
- 102000038380 alpha-secretases Human genes 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000006933 amyloid-beta aggregation Effects 0.000 description 1
- 230000003941 amyloidogenesis Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- KBZOIRJILGZLEJ-LGYYRGKSSA-N argipressin Chemical compound C([C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@@H](C(N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N1)=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(N)=O)C1=CC=CC=C1 KBZOIRJILGZLEJ-LGYYRGKSSA-N 0.000 description 1
- 229940039856 aricept Drugs 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 229960005261 aspartic acid Drugs 0.000 description 1
- 238000003149 assay kit Methods 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- LUFPJJNWMYZRQE-UHFFFAOYSA-N benzylsulfanylmethylbenzene Chemical compound C=1C=CC=CC=1CSCC1=CC=CC=C1 LUFPJJNWMYZRQE-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 108091007737 beta-secretases Proteins 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000010170 biological method Methods 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 238000001574 biopsy Methods 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000012503 blood component Substances 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- BPKIGYQJPYCAOW-FFJTTWKXSA-I calcium;potassium;disodium;(2s)-2-hydroxypropanoate;dichloride;dihydroxide;hydrate Chemical compound O.[OH-].[OH-].[Na+].[Na+].[Cl-].[Cl-].[K+].[Ca+2].C[C@H](O)C([O-])=O BPKIGYQJPYCAOW-FFJTTWKXSA-I 0.000 description 1
- BMLSTPRTEKLIPM-UHFFFAOYSA-I calcium;potassium;disodium;hydrogen carbonate;dichloride;dihydroxide;hydrate Chemical compound O.[OH-].[OH-].[Na+].[Na+].[Cl-].[Cl-].[K+].[Ca+2].OC([O-])=O BMLSTPRTEKLIPM-UHFFFAOYSA-I 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000006244 carboxylic acid protecting group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 239000000544 cholinesterase inhibitor Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 229960001681 croscarmellose sodium Drugs 0.000 description 1
- 229960000913 crospovidone Drugs 0.000 description 1
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 1
- 238000007821 culture assay Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- SASYSVUEVMOWPL-NXVVXOECSA-N decyl oleate Chemical compound CCCCCCCCCCOC(=O)CCCCCCC\C=C/CCCCCCCC SASYSVUEVMOWPL-NXVVXOECSA-N 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000005786 degenerative changes Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 231100000223 dermal penetration Toxicity 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 239000011903 deuterated solvents Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 210000002257 embryonic structure Anatomy 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000008387 emulsifying waxe Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- IUCAJXJJKXMLJK-UHFFFAOYSA-N ethyl 4-[(3,4,5-trimethoxybenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NC(=O)C1=CC(OC)=C(OC)C(OC)=C1 IUCAJXJJKXMLJK-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 235000013861 fat-free Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000001605 fetal effect Effects 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229930003944 flavone Natural products 0.000 description 1
- 235000011949 flavones Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 108020001507 fusion proteins Proteins 0.000 description 1
- 102000037865 fusion proteins Human genes 0.000 description 1
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 1
- 102000038383 gamma-secretases Human genes 0.000 description 1
- 108091007739 gamma-secretases Proteins 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000009650 gentamicin protection assay Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 150000002338 glycosides Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- UBHWBODXJBSFLH-UHFFFAOYSA-N hexadecan-1-ol;octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO.CCCCCCCCCCCCCCCCCCO UBHWBODXJBSFLH-UHFFFAOYSA-N 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 210000001320 hippocampus Anatomy 0.000 description 1
- 102000056542 human ADAM10 Human genes 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000008309 hydrophilic cream Substances 0.000 description 1
- 150000005165 hydroxybenzoic acids Chemical class 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000030214 innervation Effects 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 229910001411 inorganic cation Inorganic materials 0.000 description 1
- 230000027097 intermediate-density lipoprotein particle remodeling Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 239000007925 intracardiac injection Substances 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 238000007914 intraventricular administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- DXVOSTCYXXRQEW-UHFFFAOYSA-N iodocyclobutane Chemical compound IC1CCC1 DXVOSTCYXXRQEW-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229940078545 isocetyl stearate Drugs 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- XUGNVMKQXJXZCD-UHFFFAOYSA-N isopropyl palmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC(C)C XUGNVMKQXJXZCD-UHFFFAOYSA-N 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 229940099563 lactobionic acid Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940033355 lauric acid Drugs 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 108020001756 ligand binding domains Proteins 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 150000002634 lipophilic molecules Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- RDAKCPVJSPEDON-UHFFFAOYSA-M lithium;formate;hydrate Chemical compound [Li+].O.[O-]C=O RDAKCPVJSPEDON-UHFFFAOYSA-M 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 241001515942 marmosets Species 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- BUGYDGFZZOZRHP-UHFFFAOYSA-N memantine Chemical compound C1C(C2)CC3(C)CC1(C)CC2(N)C3 BUGYDGFZZOZRHP-UHFFFAOYSA-N 0.000 description 1
- 229960004640 memantine Drugs 0.000 description 1
- 210000002418 meninge Anatomy 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- KJCVCRCYCOWPFY-UHFFFAOYSA-N methyl 2-fluoro-4-nitrobenzoate Chemical compound COC(=O)C1=CC=C([N+]([O-])=O)C=C1F KJCVCRCYCOWPFY-UHFFFAOYSA-N 0.000 description 1
- QAFJIJWLEBLXHH-UHFFFAOYSA-N methyl 2-fluorobenzoate Chemical compound COC(=O)C1=CC=CC=C1F QAFJIJWLEBLXHH-UHFFFAOYSA-N 0.000 description 1
- WVWZECQNFWFVFW-UHFFFAOYSA-N methyl 2-methylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C WVWZECQNFWFVFW-UHFFFAOYSA-N 0.000 description 1
- FVXIUUVHUPWRCD-UHFFFAOYSA-N methyl 4-[[3-chloro-4-cyclobutyloxy-5-(trifluoromethyl)benzoyl]amino]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1NC(=O)C(C=C1C(F)(F)F)=CC(Cl)=C1OC1CCC1 FVXIUUVHUPWRCD-UHFFFAOYSA-N 0.000 description 1
- CRRVUTVYBGLSDA-UHFFFAOYSA-N methyl 4-[[3-chloro-4-hydroxy-5-(trifluoromethyl)benzoyl]amino]-2-methylbenzoate Chemical compound C1=C(C)C(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=C(O)C(C(F)(F)F)=C1 CRRVUTVYBGLSDA-UHFFFAOYSA-N 0.000 description 1
- DTGRYJFWBNMEOM-UHFFFAOYSA-N methyl 4-[[4-ethoxy-3,5-di(propan-2-yloxy)benzoyl]amino]-2-fluorobenzoate Chemical compound C1=C(OC(C)C)C(OCC)=C(OC(C)C)C=C1C(=O)NC1=CC=C(C(=O)OC)C(F)=C1 DTGRYJFWBNMEOM-UHFFFAOYSA-N 0.000 description 1
- IYEKSDFYHAQYAM-UHFFFAOYSA-N methyl 4-amino-2-(trifluoromethyl)benzoate Chemical compound COC(=O)C1=CC=C(N)C=C1C(F)(F)F IYEKSDFYHAQYAM-UHFFFAOYSA-N 0.000 description 1
- DOMJYWCXCVFKCA-UHFFFAOYSA-N methyl 4-amino-3-fluorobenzoate Chemical compound COC(=O)C1=CC=C(N)C(F)=C1 DOMJYWCXCVFKCA-UHFFFAOYSA-N 0.000 description 1
- LJYSUEZSIXOJFK-UHFFFAOYSA-N methyl 5-aminopyridine-2-carboxylate Chemical compound COC(=O)C1=CC=C(N)C=N1 LJYSUEZSIXOJFK-UHFFFAOYSA-N 0.000 description 1
- UVTBEJGKSJOOIF-UHFFFAOYSA-N methyl 6-aminopyridazine-3-carboxylate Chemical compound COC(=O)C1=CC=C(N)N=N1 UVTBEJGKSJOOIF-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methyl-cyclopentane Natural products CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 238000010172 mouse model Methods 0.000 description 1
- 229940043348 myristyl alcohol Drugs 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- MRHQBBSKCLIMRH-UHFFFAOYSA-N n-(acetamidomethoxymethyl)acetamide Chemical compound CC(=O)NCOCNC(C)=O MRHQBBSKCLIMRH-UHFFFAOYSA-N 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 210000001178 neural stem cell Anatomy 0.000 description 1
- 230000000626 neurodegenerative effect Effects 0.000 description 1
- 230000002981 neuropathic effect Effects 0.000 description 1
- 230000000324 neuroprotective effect Effects 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 229940127264 non-peptide agonist Drugs 0.000 description 1
- 230000036963 noncompetitive effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 108020004017 nuclear receptors Proteins 0.000 description 1
- 102000027507 nuclear receptors type II Human genes 0.000 description 1
- 108091008686 nuclear receptors type II Proteins 0.000 description 1
- LUHFJLLCZSYACL-UHFFFAOYSA-N o-(2,2,2-trichloroethyl)hydroxylamine Chemical compound NOCC(Cl)(Cl)Cl LUHFJLLCZSYACL-UHFFFAOYSA-N 0.000 description 1
- GWCBVFMHGHMALR-UHFFFAOYSA-N o-(2-trimethylsilylethyl)hydroxylamine Chemical compound C[Si](C)(C)CCON GWCBVFMHGHMALR-UHFFFAOYSA-N 0.000 description 1
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 1
- KKVUFSINQFSJNK-UHFFFAOYSA-N o-tert-butylhydroxylamine Chemical compound CC(C)(C)ON KKVUFSINQFSJNK-UHFFFAOYSA-N 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 235000014593 oils and fats Nutrition 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000004031 partial agonist Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229920000729 poly(L-lysine) polymer Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- WSHYKIAQCMIPTB-UHFFFAOYSA-M potassium;2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate Chemical compound [K+].[O-]C=1C2=CC=CC=C2OC(=O)C=1C(CC(=O)C)C1=CC=CC=C1 WSHYKIAQCMIPTB-UHFFFAOYSA-M 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 210000004129 prosencephalon Anatomy 0.000 description 1
- 229940076788 pyruvate Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 108091006073 receptor regulators Proteins 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000033987 renal water absorption Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000003118 sandwich ELISA Methods 0.000 description 1
- 238000004626 scanning electron microscopy Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000001568 sexual effect Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000008354 sodium chloride injection Substances 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000007619 statistical method Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229960004274 stearic acid Drugs 0.000 description 1
- 150000003432 sterols Chemical class 0.000 description 1
- 235000003702 sterols Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 239000012609 strong anion exchange resin Substances 0.000 description 1
- 239000012607 strong cation exchange resin Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000001502 supplementing effect Effects 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000012353 t test Methods 0.000 description 1
- 235000018553 tannin Nutrition 0.000 description 1
- 229920001864 tannin Polymers 0.000 description 1
- 239000001648 tannin Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- FGTJJHCZWOVVNH-UHFFFAOYSA-N tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C FGTJJHCZWOVVNH-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- 238000011285 therapeutic regimen Methods 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 229940098465 tincture Drugs 0.000 description 1
- 239000006208 topical dosage form Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 239000006216 vaginal suppository Substances 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- JQSHBVHOMNKWFT-DTORHVGOSA-N varenicline Chemical compound C12=CC3=NC=CN=C3C=C2[C@H]2C[C@@H]1CNC2 JQSHBVHOMNKWFT-DTORHVGOSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000025033 vasoconstriction Effects 0.000 description 1
- 229960003726 vasopressin Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- VHBFFQKBGNRLFZ-UHFFFAOYSA-N vitamin p Natural products O1C2=CC=CC=C2C(=O)C=C1C1=CC=CC=C1 VHBFFQKBGNRLFZ-UHFFFAOYSA-N 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/70—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/84—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/67—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/75—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/56—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/04—Systems containing only non-condensed rings with a four-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Hospice & Palliative Care (AREA)
- Psychiatry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0915196.0A GB0915196D0 (en) | 2009-09-01 | 2009-09-01 | Therapeutic compounds and their use |
| GB0915196.0 | 2009-09-01 | ||
| PCT/GB2010/001650 WO2011027106A1 (en) | 2009-09-01 | 2010-09-01 | Therapeutic aryl-am i do-aryl compounds and their use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CN102639487A true CN102639487A (zh) | 2012-08-15 |
Family
ID=41202973
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CN2010800493386A Pending CN102639487A (zh) | 2009-09-01 | 2010-09-01 | 治疗性芳基-酰氨基-芳基化合物以及它们的应用 |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US20120149737A1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP2473479A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP5778675B2 (cg-RX-API-DMAC7.html) |
| CN (1) | CN102639487A (cg-RX-API-DMAC7.html) |
| AU (1) | AU2010291056B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR112012004173A2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2771097C (cg-RX-API-DMAC7.html) |
| GB (1) | GB0915196D0 (cg-RX-API-DMAC7.html) |
| IL (1) | IL218137A (cg-RX-API-DMAC7.html) |
| MX (1) | MX2012002481A (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ598331A (cg-RX-API-DMAC7.html) |
| RU (1) | RU2012108173A (cg-RX-API-DMAC7.html) |
| SG (1) | SG178480A1 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2011027106A1 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA201201287B (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN109071530A (zh) * | 2016-06-06 | 2018-12-21 | 上海艾力斯医药科技有限公司 | 稠合嘧啶哌啶环衍生物及其制备方法和应用 |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB0915196D0 (en) | 2009-09-01 | 2009-10-07 | King S College London | Therapeutic compounds and their use |
| WO2012125749A2 (en) * | 2011-03-14 | 2012-09-20 | Io Therapeutics, Inc. | INFLAMMATION AND AUTOIMMUNE DISORDER TREATMENT USING RARα SELECTIVE AGONISTS |
| CN102727475B (zh) * | 2012-06-14 | 2014-05-07 | 合肥博太医药生物技术发展有限公司 | 视黄酸及其衍生物在制备防治老年痴呆药物中的应用 |
| JP6596090B2 (ja) * | 2014-12-17 | 2019-10-23 | キングス カレッジ ロンドン | レチノイン酸受容体ベータ(RARβ)アゴニストとしてのビシクロヘテロアリール−ヘテロアリール−安息香酸化合物 |
| EP3267969A1 (en) * | 2015-03-09 | 2018-01-17 | King's College London | Combination therapy with rar alpha agonists for enhancing th1 response |
| WO2017066428A1 (en) | 2015-10-13 | 2017-04-20 | H. Lee Moffitt Cancer Center & Research Institute, Inc. | Brd4-kinase inhibitors as cancer therapeutics |
| WO2017174999A1 (en) * | 2016-04-07 | 2017-10-12 | High Force Research Limited | Synthetic retinoids for use in rar mediated conditions |
| GB201900687D0 (en) | 2019-01-17 | 2019-03-06 | King S College London | Immunotherapeutic methods and compositions |
| AU2019400930A1 (en) | 2018-12-19 | 2021-07-01 | King's College London | Immunotherapeutic methods and compositions |
| CA3128032A1 (en) | 2019-01-29 | 2020-08-06 | The Johns Hopkins University | Small molecule neutral sphingomyelinase 2 (nsmase2) inhibitors |
| WO2020263960A1 (en) * | 2019-06-28 | 2020-12-30 | Carl Wagner | Compositions comprising a retinoid x receptor (rxr) agonist, a retinoic acid receptor (rar) agonist, or a dual rxr/rar agonist |
| JP2026500298A (ja) | 2022-12-15 | 2026-01-06 | シンジェンタ クロップ プロテクション アクチェンゲゼルシャフト | 殺有害生物剤として有用である新規な二環式カルボキサミド化合物 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0515684A1 (en) * | 1990-02-14 | 1992-12-02 | Chugai Seiyaku Kabushiki Kaisha | Inhibitor of denatured ldl formation |
| CN1207727A (zh) * | 1995-11-22 | 1999-02-10 | 视觉药品公司 | 具有类视色素样生物活性的取代芳基或杂芳基酰胺类化合物 |
| KR100921173B1 (ko) * | 2007-11-14 | 2009-10-13 | (주)아모레퍼시픽 | 피부 내에서 히알루론산 생합성을 촉진시키는3,4,5-트리메톡시벤즈 아미드 유도체 화합물, 그 제조방법및 이를 함유하는 화장료 조성물 |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2260118C2 (de) | 1972-12-08 | 1982-06-03 | Bayer Ag, 5090 Leverkusen | Penicilline sowie ihre Verwendung als Arzneimittel |
| DE3580134D1 (de) | 1984-07-07 | 1990-11-22 | Shudo Koichi Prof Dr Chem | Benzoesaeurederivate. |
| JPS61233678A (ja) | 1985-04-09 | 1986-10-17 | Maruko Seiyaku Kk | ベンジルピペラジン誘導体 |
| JPS62215581A (ja) | 1986-03-18 | 1987-09-22 | Koichi Shiyudo | フラボンカルボン酸誘導体 |
| US4808631A (en) | 1986-11-07 | 1989-02-28 | Hoffmann-La Roche Inc. | Aromatic acid derivatives |
| US4992468A (en) | 1989-07-26 | 1991-02-12 | Allergan, Inc. | Phenylethenyl compounds having retinoid-like activity |
| FR2663850B1 (fr) | 1990-07-02 | 1994-01-14 | Gird Galderma | Composition pharmaceutique ou cosmetique contenant en association un retinouide et un sterol. |
| EP0619116A3 (en) | 1993-04-05 | 1994-11-23 | Hoechst Japan | Use of synthetic retinoids for osteopathy. |
| US5648385A (en) | 1994-01-03 | 1997-07-15 | Bristol-Myers Squibb Co. | Retinoid-like compounds |
| US5849735A (en) | 1995-01-17 | 1998-12-15 | American Cyanamid Company | Tricyclic benzazepine vasopressin antagonists |
| US5559248A (en) | 1995-04-05 | 1996-09-24 | Bristol-Myers Squibb Co. | Retinoid-like heterocycles |
| ES2180751T3 (es) | 1995-04-10 | 2003-02-16 | Taiho Pharmaceutical Co Ltd | Inhibidor de metastasis de cancer. |
| JP3964478B2 (ja) | 1995-06-30 | 2007-08-22 | エーザイ・アール・アンド・ディー・マネジメント株式会社 | ヘテロ環含有カルボン酸誘導体及びそれを含有する医薬 |
| FR2739777B1 (fr) | 1995-10-11 | 1997-11-14 | Cird Galderma | Ligand antagoniste rar-gamma ou agoniste rar-alpha en tant qu'inhibiteur d'apoptose |
| HUP0102470A3 (en) | 1998-07-01 | 2002-05-28 | Takeda Chemical Industries Ltd | 1,3-azole derivatives as retinoid-associated receptor regulators and their use |
| US6245884B1 (en) | 1998-10-16 | 2001-06-12 | Vivian Y. H. Hook | Secretases related to alzheimer's dementia |
| PL198852B1 (pl) | 1998-10-22 | 2008-07-31 | Neurosearch As | Podstawione pochodne fenylu, kompozycja farmaceutyczna je zawierająca oraz ich zastosowanie |
| TW400614B (en) | 1998-11-06 | 2000-08-01 | United Microelectronics Corp | The manufacture method of Shallow Trench Isolation(STI) |
| US6897304B2 (en) | 2000-09-22 | 2005-05-24 | Zenyaku Kogyo Kabushiki Kaisha | Cephem compounds and ESBL-detecting reagents containing the same |
| CA2432825A1 (en) | 2000-12-15 | 2002-06-20 | Emory University | Nonpeptide agonists and antagonists of vasopressin receptors |
| GB0103998D0 (en) | 2001-02-19 | 2001-04-04 | King S College London | Method |
| US7105566B2 (en) * | 2002-10-22 | 2006-09-12 | Allergan, Inc. | Methods of treatment during vascular procedures |
| US8367822B2 (en) | 2003-09-22 | 2013-02-05 | Enzo Therapeutics, Inc. | Compositions and methods for bone formation and remodeling |
| EP2415755A4 (en) | 2009-03-31 | 2012-09-19 | Renascience Co Ltd | INHIBITOR AGENT OF PLASMINOGEN ACTIVATOR INHIBITOR 1 |
| GB0915196D0 (en) | 2009-09-01 | 2009-10-07 | King S College London | Therapeutic compounds and their use |
| WO2012058378A1 (en) | 2010-10-29 | 2012-05-03 | Romark Laboratories L.C. | Pharmaceutical compositions and methods of use of salicylanilides for treatment of hepatitis viruses |
-
2009
- 2009-09-01 GB GBGB0915196.0A patent/GB0915196D0/en not_active Ceased
-
2010
- 2010-09-01 AU AU2010291056A patent/AU2010291056B2/en not_active Ceased
- 2010-09-01 CA CA2771097A patent/CA2771097C/en not_active Expired - Fee Related
- 2010-09-01 EP EP10752907A patent/EP2473479A1/en not_active Withdrawn
- 2010-09-01 JP JP2012526118A patent/JP5778675B2/ja not_active Expired - Fee Related
- 2010-09-01 NZ NZ598331A patent/NZ598331A/xx not_active IP Right Cessation
- 2010-09-01 RU RU2012108173/04A patent/RU2012108173A/ru not_active Application Discontinuation
- 2010-09-01 MX MX2012002481A patent/MX2012002481A/es not_active Application Discontinuation
- 2010-09-01 WO PCT/GB2010/001650 patent/WO2011027106A1/en not_active Ceased
- 2010-09-01 US US13/391,207 patent/US20120149737A1/en not_active Abandoned
- 2010-09-01 CN CN2010800493386A patent/CN102639487A/zh active Pending
- 2010-09-01 SG SG2012011193A patent/SG178480A1/en unknown
- 2010-09-01 BR BR112012004173A patent/BR112012004173A2/pt not_active IP Right Cessation
-
2012
- 2012-02-16 IL IL218137A patent/IL218137A/en active IP Right Grant
- 2012-02-21 ZA ZA2012/01287A patent/ZA201201287B/en unknown
-
2015
- 2015-10-09 US US14/879,340 patent/US9447028B2/en not_active Expired - Fee Related
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0515684A1 (en) * | 1990-02-14 | 1992-12-02 | Chugai Seiyaku Kabushiki Kaisha | Inhibitor of denatured ldl formation |
| CN1207727A (zh) * | 1995-11-22 | 1999-02-10 | 视觉药品公司 | 具有类视色素样生物活性的取代芳基或杂芳基酰胺类化合物 |
| KR100921173B1 (ko) * | 2007-11-14 | 2009-10-13 | (주)아모레퍼시픽 | 피부 내에서 히알루론산 생합성을 촉진시키는3,4,5-트리메톡시벤즈 아미드 유도체 화합물, 그 제조방법및 이를 함유하는 화장료 조성물 |
Non-Patent Citations (2)
| Title |
|---|
| GARY M. COPPOLA ET AL.: "Perhydroquinolylbenzamides as Novel Inhibitors of 11β-Hydroxysteroid Dehydrogenase Type 1", 《JOURNAL OF MEDICINAL CHEMISTRY》 * |
| HOWARD TUCKER ET AL.: "Novel Inhibitors of Prolyl 4-Hydroxylase. 2. 5-Amide Substituted Pyridine-2-carboxylic Acids", 《JOURNAL OF MEDICINAL CHEMISTRY》 * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN109071530A (zh) * | 2016-06-06 | 2018-12-21 | 上海艾力斯医药科技有限公司 | 稠合嘧啶哌啶环衍生物及其制备方法和应用 |
| CN109071530B (zh) * | 2016-06-06 | 2021-08-17 | 上海艾力斯医药科技股份有限公司 | 稠合嘧啶哌啶环衍生物及其制备方法和应用 |
Also Published As
| Publication number | Publication date |
|---|---|
| AU2010291056A1 (en) | 2012-03-15 |
| IL218137A (en) | 2016-06-30 |
| US20120149737A1 (en) | 2012-06-14 |
| GB0915196D0 (en) | 2009-10-07 |
| ZA201201287B (en) | 2013-05-29 |
| CA2771097C (en) | 2019-01-15 |
| CA2771097A1 (en) | 2011-03-10 |
| EP2473479A1 (en) | 2012-07-11 |
| RU2012108173A (ru) | 2013-10-10 |
| SG178480A1 (en) | 2012-04-27 |
| WO2011027106A1 (en) | 2011-03-10 |
| MX2012002481A (es) | 2012-03-26 |
| JP2013503819A (ja) | 2013-02-04 |
| JP5778675B2 (ja) | 2015-09-16 |
| US9447028B2 (en) | 2016-09-20 |
| AU2010291056B2 (en) | 2016-01-28 |
| IL218137A0 (en) | 2012-06-28 |
| NZ598331A (en) | 2013-10-25 |
| BR112012004173A2 (pt) | 2017-05-30 |
| US20160039747A1 (en) | 2016-02-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN102639487A (zh) | 治疗性芳基-酰氨基-芳基化合物以及它们的应用 | |
| KR101302627B1 (ko) | 11-베타-하이드록시스테로이드 데하이드로게나제 타입 1 효소의 억제제 | |
| CN1867551B (zh) | 作为前列腺素e2拮抗剂的苯基或吡啶基酰胺化合物 | |
| US10214477B2 (en) | (Hetero)aryl cyclopropylamine compounds as LSD1 inhibitors | |
| RU2681211C2 (ru) | (гетеро)арилциклопропиламины в качестве ингибиторов lsd1 | |
| RU2280025C9 (ru) | Новые производные аминодикарбоновых кислот, обладающие фармацевтическими свойствами | |
| JP3953096B2 (ja) | サイクリックampホスホジエステラーゼおよびtnf阻害剤としての置換芳香族化合物 | |
| RU2493149C2 (ru) | Замещенные метилфенилкетоны, пригодные для использования в качестве ингибиторов pde4 | |
| JP2004525117A (ja) | 置換アミノジカルボン酸誘導体 | |
| IL184328A (en) | Substituted adamantyl-containing acetamides as inhibitors of the 11-beta-hydroxysteroid dehydrogenase type 1 and pharmaceutical compositions comprising the same | |
| TW201039814A (en) | Diacylethylenediamine compounds | |
| JP2021514963A (ja) | ニューロトロフィンに関連する疾患を治療するためのトリアジン誘導体 | |
| ES2907746T3 (es) | Compuestos de amida y uso de los mismos | |
| CA2566053A1 (en) | Phenyl carboxamide compounds useful as beta-secretase inhibitors for the treatment of alzheimer's disease | |
| WO1999027965A1 (en) | Antihyperlipemic agents | |
| US9290444B2 (en) | Inhibitors of the 11-beta-hydroxysteroid dehydrogenase type 1 enzyme | |
| US8993632B2 (en) | Inhibitors of the 11-beta-hydroxysteroid dehydrogenase type 1 enzyme | |
| CN118414327A (zh) | 作为选择性phd1抑制剂的吡啶酰胺化合物、组合物和使用方法 | |
| KR20040028769A (ko) | 카텝신 억제제로서의 화합물 및 조성물 | |
| NZ622656B2 (en) | (hetero)aryl cyclopropylamine compounds as lsd1 inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C06 | Publication | ||
| PB01 | Publication | ||
| C10 | Entry into substantive examination | ||
| SE01 | Entry into force of request for substantive examination | ||
| C02 | Deemed withdrawal of patent application after publication (patent law 2001) | ||
| WD01 | Invention patent application deemed withdrawn after publication |
Application publication date: 20120815 |