CH671228A5 - - Google Patents
Download PDFInfo
- Publication number
- CH671228A5 CH671228A5 CH4494/86A CH449486A CH671228A5 CH 671228 A5 CH671228 A5 CH 671228A5 CH 4494/86 A CH4494/86 A CH 4494/86A CH 449486 A CH449486 A CH 449486A CH 671228 A5 CH671228 A5 CH 671228A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- het
- amino
- compound
- group
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 49
- -1 2-benzothiazolyl Chemical group 0.000 claims description 35
- 238000000034 method Methods 0.000 claims description 20
- 125000000623 heterocyclic group Chemical group 0.000 claims description 18
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- 125000006239 protecting group Chemical group 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- 229930186147 Cephalosporin Natural products 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 6
- 229940124587 cephalosporin Drugs 0.000 claims description 6
- 150000001780 cephalosporins Chemical class 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical class C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- 125000005518 carboxamido group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 claims 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 39
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 239000002253 acid Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 238000005917 acylation reaction Methods 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 150000007970 thio esters Chemical class 0.000 description 9
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 7
- 230000010933 acylation Effects 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- NDVMCQUOSYOQMZ-UHFFFAOYSA-N 2,2-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)C(C(N)=O)[Si](C)(C)C NDVMCQUOSYOQMZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 125000001544 thienyl group Chemical group 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 239000003242 anti bacterial agent Substances 0.000 description 4
- 229940088710 antibiotic agent Drugs 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical compound CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 3
- 230000001376 precipitating effect Effects 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- WLAMYJLJGUBTBG-UHFFFAOYSA-N 1,3-benzothiazol-2-ylsulfanyl 2-thiophen-2-ylacetate Chemical compound S1C(=NC2=C1C=CC=C2)SOC(CC=1SC=CC=1)=O WLAMYJLJGUBTBG-UHFFFAOYSA-N 0.000 description 2
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000004306 triazinyl group Chemical group 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- HKMCFPMRRRMURQ-SBXXRYSUSA-N (6R)-3-(methoxymethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)CC(=O)NC1[C@@H]2N(C(=C(CS2)COC)C(=O)O)C1=O HKMCFPMRRRMURQ-SBXXRYSUSA-N 0.000 description 1
- KCCXIEAFHKKZLW-JLOHTSLTSA-N (6r)-3-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(O)=O)NC(=O)CC1=CC=CS1 KCCXIEAFHKKZLW-JLOHTSLTSA-N 0.000 description 1
- NVIAYEIXYQCDAN-MHTLYPKNSA-N (6r,7s)-7-azaniumyl-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(C)=C(C([O-])=O)N2C(=O)[C@H]([NH3+])[C@@H]12 NVIAYEIXYQCDAN-MHTLYPKNSA-N 0.000 description 1
- BDSDFCVDQUGOFB-XNCJUZBTSA-N (6s,7s)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC)=C(C(O)=O)N2C(=O)[C@H](N)[C@H]12 BDSDFCVDQUGOFB-XNCJUZBTSA-N 0.000 description 1
- GRWAIJBHBCCLGS-UHFFFAOYSA-N 2-(tetrazol-1-yl)acetic acid Chemical compound OC(=O)CN1C=NN=N1 GRWAIJBHBCCLGS-UHFFFAOYSA-N 0.000 description 1
- SMJRBWINMFUUDS-UHFFFAOYSA-N 2-thienylacetic acid Chemical compound OC(=O)CC1=CC=CS1 SMJRBWINMFUUDS-UHFFFAOYSA-N 0.000 description 1
- 241000588813 Alcaligenes faecalis Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- KVTHLUJEUCIKJS-UHFFFAOYSA-N CC(=O)OC1=CC=CC=[N+]1SC2=NN=NN2C Chemical group CC(=O)OC1=CC=CC=[N+]1SC2=NN=NN2C KVTHLUJEUCIKJS-UHFFFAOYSA-N 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical group CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000588653 Neisseria Species 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 1
- 241000607768 Shigella Species 0.000 description 1
- 241000607762 Shigella flexneri Species 0.000 description 1
- 241000607760 Shigella sonnei Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 229940005347 alcaligenes faecalis Drugs 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001733 carboxylic acid esters Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000002720 diazolyl group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LKHYFCSSVZVVNF-UHFFFAOYSA-N ethyl hexanoate;sodium Chemical compound [Na].CCCCCC(=O)OCC LKHYFCSSVZVVNF-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 229940115939 shigella sonnei Drugs 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT0338185A AT383810B (de) | 1985-11-20 | 1985-11-20 | Verfahren zur herstellung von cephalosporinderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH671228A5 true CH671228A5 (enExample) | 1989-08-15 |
Family
ID=3549668
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH4494/86A CH671228A5 (enExample) | 1985-11-20 | 1986-11-11 |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS62135477A (enExample) |
| AT (1) | AT383810B (enExample) |
| BE (1) | BE905783A (enExample) |
| CH (1) | CH671228A5 (enExample) |
| DE (1) | DE3639410A1 (enExample) |
| ES (1) | ES2002912A6 (enExample) |
| FR (1) | FR2590257A1 (enExample) |
| GB (1) | GB2183232B (enExample) |
| IT (1) | IT1195841B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2042507T3 (es) * | 1986-02-07 | 1993-12-16 | Hoffmann La Roche | Procedimiento para la obtencion de carboxiamidas. |
| AT402928B (de) * | 1994-12-23 | 1997-09-25 | Biochemie Gmbh | Neues verfahren zur herstellung von cefotaxim |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0004570B1 (en) * | 1978-03-09 | 1982-04-14 | Asahi Kasei Kogyo Kabushiki Kaisha | Thiol esters, process for their preparation, pharmaceutical compositions containing them and a process for preparing cephalosporin compounds using the same |
| EP0047014B1 (en) * | 1980-09-02 | 1986-01-15 | Asahi Kasei Kogyo Kabushiki Kaisha | Novel thioesters and process for the preparation of the same |
| EP0060301B1 (en) * | 1980-09-19 | 1985-11-27 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for preparing cephalosporin compounds |
| US4327211A (en) * | 1980-11-26 | 1982-04-27 | Asahi Kasei Kogyo Kabushiki Kaisha | Method for preparation of cephalosporin compounds |
| DE3587866D1 (de) * | 1984-04-10 | 1994-07-28 | Biochemie Gmbh | Cephalosporinzwischenprodukte, Verfahren zu ihrer Herstellung und ihre Verwendung. |
-
1985
- 1985-11-20 AT AT0338185A patent/AT383810B/de not_active IP Right Cessation
-
1986
- 1986-11-11 CH CH4494/86A patent/CH671228A5/de not_active IP Right Cessation
- 1986-11-17 GB GB8627404A patent/GB2183232B/en not_active Expired
- 1986-11-18 DE DE19863639410 patent/DE3639410A1/de not_active Withdrawn
- 1986-11-18 FR FR8616024A patent/FR2590257A1/fr not_active Withdrawn
- 1986-11-18 IT IT67857/86A patent/IT1195841B/it active
- 1986-11-19 BE BE0/217434A patent/BE905783A/fr not_active IP Right Cessation
- 1986-11-19 JP JP61276380A patent/JPS62135477A/ja active Pending
- 1986-11-20 ES ES8603111A patent/ES2002912A6/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES2002912A6 (es) | 1988-10-01 |
| DE3639410A1 (de) | 1987-05-21 |
| GB8627404D0 (en) | 1986-12-17 |
| ATA338185A (de) | 1987-01-15 |
| GB2183232B (en) | 1989-11-15 |
| FR2590257A1 (fr) | 1987-05-22 |
| BE905783A (fr) | 1987-05-19 |
| IT1195841B (it) | 1988-10-27 |
| IT8667857A0 (it) | 1986-11-18 |
| AT383810B (de) | 1987-08-25 |
| GB2183232A (en) | 1987-06-03 |
| JPS62135477A (ja) | 1987-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2760123C2 (de) | 7-Aminothiazolyl-syn-oxyiminoacetamidocephalosporansäuren, ihre Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| DE2824559C2 (de) | 7α-Methoxy-7β-(4-substituierte-methylen-1,3-dithietan-2-yl)-carboxamido-3-Δ↑3↑-cephem-4-carbonsäuren, Verfahren zu deren Herstellung sowie ihre Verwendung | |
| DE2336345A1 (de) | Cephalosporinverbindungen, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| CH617202A5 (enExample) | ||
| DE2736471C2 (enExample) | ||
| DE2434340A1 (de) | 7-acylamido-3-cephem-4-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung in pharmazeutischen zubereitungen | |
| DE2824575A1 (de) | 1,3-dithietan-2-carbonsaeuren sowie verfahren zu ihrer herstellung | |
| DE69418218T2 (de) | Chinolonylcarboxamidocephalosporin-derivate und diese enthaltende arzneimittel | |
| DE2429229A1 (de) | 7-trifluormethylsulfinylacetamidocephalosporine, ihre salze, verfahren zu ihrer herstellung und arzneimittel | |
| DE2439455A1 (de) | 7-cyanmethylmercapto-, -sulfinylund sulfonylacetamidocephalosporine, ihre salze, verfahren zu ihrer herstellung und arzneimittel | |
| EP0185679B1 (de) | Cephalosporinzwischenprodukte, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2521063A1 (de) | Phenylacetamidocephalosporin- derivate | |
| CH671228A5 (enExample) | ||
| DE2715038A1 (de) | Neue antibakterielle verbindungen | |
| DE2534926A1 (de) | Sauerstoffanaloge von cephalosporinen | |
| DE2700271A1 (de) | Thienopyridinderivate | |
| DE2539411A1 (de) | Cephamycine, ihre salze, verfahren zu ihrer herstellung und arzneipraeparate | |
| CH666037A5 (de) | Verfahren zur herstellung von cephalosporin-syn-isomeren. | |
| DE2451492A1 (de) | 2-oxo-1-pyridinyl-penicillin- und -cephalosporin-derivate | |
| AT381702B (de) | Verfahren zur herstellung neuer thiazolderivate | |
| EP0312844B1 (de) | Cephalosporinzwischenprodukte, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| AT362507B (de) | Verfahren zur herstellung von neuen cephalos- porinverbindungen | |
| AT333421B (de) | Verfahren zur herstellung von 3-cephemderivaten | |
| EP0423837A2 (de) | Cephalosporinzwischenprodukte und ihre Verwendung | |
| EP0005785A1 (de) | Cephemderivate, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |