CH666683A5 - Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen. - Google Patents
Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen. Download PDFInfo
- Publication number
- CH666683A5 CH666683A5 CH39/86A CH3986A CH666683A5 CH 666683 A5 CH666683 A5 CH 666683A5 CH 39/86 A CH39/86 A CH 39/86A CH 3986 A CH3986 A CH 3986A CH 666683 A5 CH666683 A5 CH 666683A5
- Authority
- CH
- Switzerland
- Prior art keywords
- mmol
- reaction
- mixture
- added
- solution
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 41
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 150000001875 compounds Chemical class 0.000 description 31
- 238000006243 chemical reaction Methods 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 24
- 239000000203 mixture Substances 0.000 description 23
- 238000000034 method Methods 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 125000001424 substituent group Chemical group 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 9
- 125000004093 cyano group Chemical group *C#N 0.000 description 8
- -1 methylenedioxy Chemical group 0.000 description 8
- BMMCNKYHQAKJBN-UHFFFAOYSA-N 4-phenyl-1h-pyrrole-3-carbonitrile Chemical class N#CC1=CNC=C1C1=CC=CC=C1 BMMCNKYHQAKJBN-UHFFFAOYSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 4
- CDUQMGQIHYISOP-RMKNXTFCSA-N (e)-2-cyano-3-phenylprop-2-enoic acid Chemical compound OC(=O)C(\C#N)=C\C1=CC=CC=C1 CDUQMGQIHYISOP-RMKNXTFCSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000005233 alkylalcohol group Chemical group 0.000 description 3
- OHUDHPKMAJDBPI-UHFFFAOYSA-N isocyanomethylsulfonylbenzene Chemical compound [C-]#[N+]CS(=O)(=O)C1=CC=CC=C1 OHUDHPKMAJDBPI-UHFFFAOYSA-N 0.000 description 3
- HSQGMTRYSIHDAC-UHFFFAOYSA-N leucyl-alanine Chemical compound CC(C)CC(N)C(=O)NC(C)C(O)=O HSQGMTRYSIHDAC-UHFFFAOYSA-N 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- SADKTSLRGYYBOS-UHFFFAOYSA-N 1-chloro-4-(isocyanomethylsulfonyl)benzene Chemical compound ClC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 SADKTSLRGYYBOS-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HZLGVCAVFBNSGW-UHFFFAOYSA-N C(#N)OC(C(=O)O)=C(C1=CC=CC=C1)Cl Chemical compound C(#N)OC(C(=O)O)=C(C1=CC=CC=C1)Cl HZLGVCAVFBNSGW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- IAYSDKUKIIYRRA-UHFFFAOYSA-N 1-(isocyanatomethylsulfonyl)-4-methylbenzene Chemical compound CC1=CC=C(S(=O)(=O)CN=C=O)C=C1 IAYSDKUKIIYRRA-UHFFFAOYSA-N 0.000 description 1
- DMACYVMZKYRYSL-UHFFFAOYSA-N 2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enoic acid Chemical compound COC1=CC=C(C=C(C#N)C(O)=O)C=C1OC DMACYVMZKYRYSL-UHFFFAOYSA-N 0.000 description 1
- YYLUJSBONROLKZ-UHFFFAOYSA-N 2-cyano-3-(4-cyanophenyl)prop-2-enoic acid Chemical compound OC(=O)C(C#N)=CC1=CC=C(C#N)C=C1 YYLUJSBONROLKZ-UHFFFAOYSA-N 0.000 description 1
- GEWCXMLSRUQIDQ-UHFFFAOYSA-N 4-(2-chlorophenyl)-1h-pyrrole-3-carbonitrile Chemical compound ClC1=CC=CC=C1C1=CNC=C1C#N GEWCXMLSRUQIDQ-UHFFFAOYSA-N 0.000 description 1
- CJDIWEZPIAEWNK-UHFFFAOYSA-N 4-(4-cyanophenyl)-1h-pyrrole-3-carbonitrile Chemical compound N#CC1=CNC=C1C1=CC=C(C#N)C=C1 CJDIWEZPIAEWNK-UHFFFAOYSA-N 0.000 description 1
- FBTKOLHLDDSBOQ-UHFFFAOYSA-N 5-(2-chlorophenyl)-1H-pyrrole-3-carbonitrile Chemical compound ClC1=C(C=CC=C1)C=1NC=C(C=1)C#N FBTKOLHLDDSBOQ-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000010960 commercial process Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FKLFBQCQQYDUAM-UHFFFAOYSA-N fenpiclonil Chemical compound ClC1=CC=CC(C=2C(=CNC=2)C#N)=C1Cl FKLFBQCQQYDUAM-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 150000003233 pyrroles Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863601285 DE3601285A1 (de) | 1986-01-17 | 1986-01-17 | Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH666683A5 true CH666683A5 (de) | 1988-08-15 |
Family
ID=6292064
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH39/86A CH666683A5 (de) | 1986-01-17 | 1986-01-09 | Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4680413A (OSRAM) |
| CH (1) | CH666683A5 (OSRAM) |
| DE (1) | DE3601285A1 (OSRAM) |
| FR (1) | FR2593175B1 (OSRAM) |
| GB (1) | GB2185013B (OSRAM) |
| NL (1) | NL194042C (OSRAM) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE51617T1 (de) * | 1984-09-12 | 1990-04-15 | Ciba Geigy Ag | Verfahren zur herstellung von 4-phenyl-pyrrolderivaten. |
| US4687861A (en) * | 1984-11-28 | 1987-08-18 | Ciba-Geigy Corporation | Microbicidal compositions |
| DE3718375A1 (de) * | 1987-06-02 | 1988-12-15 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| EP0310558A3 (de) * | 1987-10-02 | 1990-07-04 | Ciba-Geigy Ag | Mikrobizide Mittel |
| DE3800387A1 (de) * | 1988-01-09 | 1989-07-20 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| US5420301A (en) * | 1988-03-18 | 1995-05-30 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| US5194628A (en) * | 1988-03-18 | 1993-03-16 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| ATE104974T1 (de) * | 1988-03-18 | 1994-05-15 | Ciba Geigy Ag | Verfahren zur herstellung eines pyrrol-derivats. |
| US4958030A (en) * | 1988-12-12 | 1990-09-18 | Ciba-Geigy Corporation | Process for the preparation of 3-phenylpyrrole derivatives |
| DE3912156A1 (de) * | 1989-04-13 | 1990-10-25 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| US5166395A (en) * | 1989-04-13 | 1992-11-24 | Bayer Aktiengesellschaft | Fungicidal 3-cyano-4-phenyl-pyrroles |
| DE4128132A1 (de) * | 1991-08-24 | 1993-02-25 | Bayer Ag | 3-(2-chlor-3-trifluormethylphenyl)-4-cyanopyrrol, dessen herstellung und verwendung und neue zwischenprodukte |
| US5234943A (en) * | 1989-04-13 | 1993-08-10 | Bayer Aktiengesellschaft | Fungicidal 3-(2-chloro-3-trifluoromethylphenyl)-4-cyanopyrrole |
| US5118816A (en) * | 1990-12-26 | 1992-06-02 | American Cyanamid Company | 2-aryl-5-(trifluoromethyl)-2-pyrroline compounds useful in the manufacture of insecticidal, nematocidal and acaricidal arylpyrroles |
| DE4107398A1 (de) * | 1991-03-08 | 1992-11-05 | Bayer Ag | Verfahren zur herstellung von in 3-stellung substituierten 4-cyano-pyrrolverbindungen |
| DE19812058C1 (de) * | 1998-03-19 | 1999-10-07 | Wella Ag | Diaminobenzol-Derivate und diese Verbindungen enthaltende Haarfärbemittel |
| US20090214475A1 (en) * | 2005-04-01 | 2009-08-27 | Algaen Corporation | Extractability and Bioavailability of the Natural Antioxidant Astaxanthin From a Green Alga, Haematococcus Pluvialis |
| PE20070404A1 (es) * | 2005-07-29 | 2007-05-10 | Wyeth Corp | Compuestos derivados de cianopirrol-sulfonamida como moduladores del receptor de progesterona |
| PE20070341A1 (es) * | 2005-07-29 | 2007-04-13 | Wyeth Corp | Derivados de pirrol como moduladores del receptor de progesterona |
| PE20070182A1 (es) * | 2005-07-29 | 2007-03-06 | Wyeth Corp | Derivados cianopirrol-fenil amida como moduladores del receptor de progesterona |
| PH12019502776A1 (en) * | 2017-06-30 | 2020-10-26 | Univ California | Compositions and methods for modulating hair growth |
| US12559490B2 (en) | 2020-06-30 | 2026-02-24 | The Regents Of The University Of California | Compositions and methods for modulating hair growth |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5225108A (en) * | 1975-08-15 | 1977-02-24 | Jiyunkichi Yamaji | Paper screening machine for concaveeconvex stencil paper |
| JPS5235727U (OSRAM) * | 1975-09-02 | 1977-03-14 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1457752A (fr) * | 1965-03-22 | 1966-01-24 | Fujisawa Pharmaceutical Co | Dérivés de l'acide phényl-3-pyrrole carboxylique-2 et procédés pour leur préparation |
| JPS5511524A (en) * | 1978-07-10 | 1980-01-26 | Nippon Soda Co Ltd | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide |
-
1985
- 1985-12-30 US US06/814,893 patent/US4680413A/en not_active Expired - Lifetime
-
1986
- 1986-01-02 GB GB8600031A patent/GB2185013B/en not_active Expired
- 1986-01-09 CH CH39/86A patent/CH666683A5/de not_active IP Right Cessation
- 1986-01-17 FR FR8600659A patent/FR2593175B1/fr not_active Expired
- 1986-01-17 NL NL8600095A patent/NL194042C/nl not_active IP Right Cessation
- 1986-01-17 DE DE19863601285 patent/DE3601285A1/de active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5225108A (en) * | 1975-08-15 | 1977-02-24 | Jiyunkichi Yamaji | Paper screening machine for concaveeconvex stencil paper |
| JPS5235727U (OSRAM) * | 1975-09-02 | 1977-03-14 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3601285C2 (OSRAM) | 1988-07-21 |
| FR2593175A1 (fr) | 1987-07-24 |
| GB8600031D0 (en) | 1986-02-12 |
| GB2185013A (en) | 1987-07-08 |
| FR2593175B1 (fr) | 1988-05-13 |
| US4680413A (en) | 1987-07-14 |
| NL8600095A (nl) | 1987-08-17 |
| NL194042C (nl) | 2001-05-03 |
| DE3601285A1 (de) | 1987-07-23 |
| GB2185013B (en) | 1989-11-01 |
| NL194042B (nl) | 2001-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3601285C2 (OSRAM) | ||
| EP0277317A1 (de) | Nitro-Derivate von 2-Iminoimidazolidinen und 2-Iminotetrahydropyrimidinen | |
| DE1817879A1 (de) | 1-(n-aethoxycarbonyl-n'-thioureido)-2(n-methoxycarbonyl-n'-thioureido)benzol, seine herstellung und seine verwendung als fungicid | |
| DE2858737C2 (OSRAM) | ||
| DE69125629T2 (de) | Verfahren zur Herstellung von Methoxyminoacetamidverbindungen | |
| EP0001769A1 (de) | 1,4-Dihydropyridincarbonsäureester mit schwefelhaltigen Estergruppen, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| EP0255689B1 (de) | Verfahren zur Herstellung von 1-Hydroxy-2-pyridonen | |
| EP0456073A2 (de) | Mehrfunktionelle Verbindungen mit alpha-Diazo-beta-ketoester- und Sulfonsäureester-Einheiten und Verfahren zu ihrer Herstellung. | |
| EP0608725A2 (de) | Verfahren zur Herstellung von Aminomethylenverbindungen | |
| DE2306918A1 (de) | Benzaldehyd-sulfonylhydrazone, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von hasenartigen und nagetieren | |
| DE2356239A1 (de) | Benzophenon-derivate und verfahren zu ihrer herstellung | |
| EP0173190B1 (de) | Verfahren zur Herstellung von 5-Acylpyrimidinen | |
| DE3139457A1 (de) | Neue substituierte benzanilidether, verfahren zu ihrer herstellung, ihre verwendung als fungizide und zwischenprodukte hierfuer | |
| DE2537379A1 (de) | Substituierte 2-phenylimino-1,3- dithiolane, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitizide mittel | |
| DE2836945A1 (de) | Derivate des 1,2,4-triazols | |
| EP0378046B1 (de) | Verfahren zur Herstellung von 3-Phenylpyrrolderivaten | |
| DE2037508C3 (de) | 19.01.70 Schweiz 674-70 Pyrimidylphosphorsäureesteramide, Verfahren zu ihrer Herstellung und diese enthaltende Mittel | |
| DD209443A5 (de) | Verfahren zur herstellung von acylaminoderivaten von 1-(aryl- oder subst.-aryl)amino-1-thioalkancarboxysaeuren | |
| DE3600332A1 (de) | Verfahren zur herstellung von pyron-3-carboxamidverbindungen | |
| EP0158248A2 (de) | Verfahren zur Herstellung von Biphenylylsulfonylharnstoff- Derivaten, Zwischenprodukte für diese sowie Verfahren für die Herstellung der Zwischenprodukte | |
| DD216013A5 (de) | Verfahren zur herstellung neuer ethendiamin- und guanidin-derivate | |
| EP0276721A1 (de) | 2-Cyan-2-oximino-acetamide | |
| DE890189C (de) | Verfahren zur Herstellung von Barbitursaeureabkoemmlingen | |
| DE4333688C2 (de) | Verfahren zur Herstellung von 3-Aryl-2-(dialkoxymethyl)-propannitrilen und ihre Umsetzung zu 5-Arylmethyl-2,4-diamino-pyrimidinen, insbesondere zu Trimethoprim | |
| DE19520816A1 (de) | Herbizide Pyrrolinone |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |