CH648334A5 - Zubereitung enthaltend einen polymerisationsinitiator. - Google Patents
Zubereitung enthaltend einen polymerisationsinitiator. Download PDFInfo
- Publication number
- CH648334A5 CH648334A5 CH4605/81A CH460581A CH648334A5 CH 648334 A5 CH648334 A5 CH 648334A5 CH 4605/81 A CH4605/81 A CH 4605/81A CH 460581 A CH460581 A CH 460581A CH 648334 A5 CH648334 A5 CH 648334A5
- Authority
- CH
- Switzerland
- Prior art keywords
- preparation according
- value
- initiator
- curing
- epoxy resin
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 29
- 239000003505 polymerization initiator Substances 0.000 title claims description 8
- 239000003822 epoxy resin Substances 0.000 claims description 25
- 229920000647 polyepoxide Polymers 0.000 claims description 25
- 239000003999 initiator Substances 0.000 claims description 19
- -1 peroxide compound Chemical class 0.000 claims description 19
- 238000006116 polymerization reaction Methods 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 12
- 239000004593 Epoxy Substances 0.000 claims description 11
- 238000001723 curing Methods 0.000 claims description 11
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 9
- 229920005989 resin Polymers 0.000 claims description 9
- 239000011347 resin Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 150000002978 peroxides Chemical class 0.000 claims description 8
- 239000000945 filler Substances 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical group [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000007848 Bronsted acid Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 239000002685 polymerization catalyst Substances 0.000 claims description 4
- 230000005855 radiation Effects 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 238000009472 formulation Methods 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052752 metalloid Inorganic materials 0.000 claims description 2
- 150000002738 metalloids Chemical class 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims description 2
- 238000003860 storage Methods 0.000 claims description 2
- 239000012954 diazonium Substances 0.000 claims 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims 1
- 238000003848 UV Light-Curing Methods 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 239000003377 acid catalyst Substances 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 238000009835 boiling Methods 0.000 claims 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims 1
- 239000011248 coating agent Substances 0.000 claims 1
- 238000004132 cross linking Methods 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 238000000354 decomposition reaction Methods 0.000 claims 1
- 150000001989 diazonium salts Chemical class 0.000 claims 1
- JDVIRCVIXCMTPU-UHFFFAOYSA-N ethanamine;trifluoroborane Chemical compound CCN.FB(F)F JDVIRCVIXCMTPU-UHFFFAOYSA-N 0.000 claims 1
- 238000001704 evaporation Methods 0.000 claims 1
- 230000008020 evaporation Effects 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 239000012761 high-performance material Substances 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 150000002894 organic compounds Chemical class 0.000 claims 1
- 230000000737 periodic effect Effects 0.000 claims 1
- 238000006303 photolysis reaction Methods 0.000 claims 1
- 230000015843 photosynthesis, light reaction Effects 0.000 claims 1
- 229910052711 selenium Inorganic materials 0.000 claims 1
- 239000011669 selenium Substances 0.000 claims 1
- 239000003381 stabilizer Substances 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- 229910052714 tellurium Inorganic materials 0.000 claims 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 238000001994 activation Methods 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 4
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 3
- YXALYBMHAYZKAP-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]heptan-4-ylmethyl 7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1C(=O)OCC1CC2OC2CC1 YXALYBMHAYZKAP-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- KUBDPQJOLOUJRM-UHFFFAOYSA-N 2-(chloromethyl)oxirane;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound ClCC1CO1.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 KUBDPQJOLOUJRM-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 229940106691 bisphenol a Drugs 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 229910000679 solder Inorganic materials 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 2
- ZWAJLVLEBYIOTI-OLQVQODUSA-N (1s,6r)-7-oxabicyclo[4.1.0]heptane Chemical compound C1CCC[C@@H]2O[C@@H]21 ZWAJLVLEBYIOTI-OLQVQODUSA-N 0.000 description 1
- VNGLSHRKASEXOM-UHFFFAOYSA-N 2,4-dioxabicyclo[3.2.2]nona-1(7),5,8-trien-3-one Chemical compound O1C(=O)OC2=CC=C1C=C2 VNGLSHRKASEXOM-UHFFFAOYSA-N 0.000 description 1
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 1
- OECTYKWYRCHAKR-UHFFFAOYSA-N 4-vinylcyclohexene dioxide Chemical compound C1OC1C1CC2OC2CC1 OECTYKWYRCHAKR-UHFFFAOYSA-N 0.000 description 1
- LCFVJGUPQDGYKZ-UHFFFAOYSA-N Bisphenol A diglycidyl ether Chemical compound C=1C=C(OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC1CO1 LCFVJGUPQDGYKZ-UHFFFAOYSA-N 0.000 description 1
- 241000566113 Branta sandvicensis Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- 101100396546 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) tif-6 gene Proteins 0.000 description 1
- 229920000459 Nitrile rubber Polymers 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 description 1
- UPIWXMRIPODGLE-UHFFFAOYSA-N butyl benzenecarboperoxoate Chemical compound CCCCOOC(=O)C1=CC=CC=C1 UPIWXMRIPODGLE-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000002079 cooperative effect Effects 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- OZLBDYMWFAHSOQ-UHFFFAOYSA-N diphenyliodanium Chemical compound C=1C=CC=CC=1[I+]C1=CC=CC=C1 OZLBDYMWFAHSOQ-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000007725 thermal activation Methods 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 229920006163 vinyl copolymer Polymers 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/68—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/14—Polycondensates modified by chemical after-treatment
- C08G59/1433—Polycondensates modified by chemical after-treatment with organic low-molecular-weight compounds
- C08G59/1438—Polycondensates modified by chemical after-treatment with organic low-molecular-weight compounds containing oxygen
- C08G59/145—Compounds containing one epoxy group
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Emergency Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Epoxy Resins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/176,723 US4374751A (en) | 1980-08-08 | 1980-08-08 | Polymerization initiator compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH648334A5 true CH648334A5 (de) | 1985-03-15 |
Family
ID=22645574
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH4605/81A CH648334A5 (de) | 1980-08-08 | 1981-07-14 | Zubereitung enthaltend einen polymerisationsinitiator. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4374751A (enExample) |
| JP (1) | JPS5757712A (enExample) |
| CH (1) | CH648334A5 (enExample) |
| DE (1) | DE3127977A1 (enExample) |
| FR (1) | FR2488262B1 (enExample) |
| GB (1) | GB2081271B (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4393185A (en) * | 1981-06-02 | 1983-07-12 | Ciba-Geigy Corporation | Thermally polymerizable mixtures and processes for the thermally-initiated polymerization of cationically polymerizable compounds |
| US4482679A (en) * | 1982-09-18 | 1984-11-13 | Ciba-Geigy Corporation | Heat-curable epoxy compositions containing diaryliodosyl salts |
| GB8307220D0 (en) * | 1983-03-16 | 1983-04-20 | Ciba Geigy Ag | Production of images |
| GB8332073D0 (en) * | 1983-12-01 | 1984-01-11 | Ciba Geigy Ag | Polymerisable compositions |
| US4882245A (en) * | 1985-10-28 | 1989-11-21 | International Business Machines Corporation | Photoresist composition and printed circuit boards and packages made therewith |
| CA1330464C (en) * | 1987-12-08 | 1994-06-28 | Mitsui Petrochemical Industries, Ltd. | Active energy ray-curable composition and optical recording medium having cured product of the composition |
| US5015675A (en) * | 1989-07-31 | 1991-05-14 | General Electric Company | Encapsulation method, microelectronic devices made therefrom, and heat curable compositions based on epoxy resins, diaryliodonium hexafluroantimonate salts and free radical generators |
| JPH04234422A (ja) * | 1990-10-31 | 1992-08-24 | Internatl Business Mach Corp <Ibm> | 二重硬化エポキシバックシール処方物 |
| US5807937A (en) * | 1995-11-15 | 1998-09-15 | Carnegie Mellon University | Processes based on atom (or group) transfer radical polymerization and novel (co) polymers having useful structures and properties |
| JP3765896B2 (ja) | 1996-12-13 | 2006-04-12 | Jsr株式会社 | 光学的立体造形用光硬化性樹脂組成物 |
| US7125938B2 (en) * | 1997-03-11 | 2006-10-24 | Carnegie Mellon University | Atom or group transfer radical polymerization |
| AU3919500A (en) | 1999-03-23 | 2000-10-09 | Carnegie Wave Energy Limited | Catalytic processes for the controlled polymerization of free radically (co)polymerizable monomers and functional polymeric systems prepared thereby |
| DE19927949A1 (de) | 1999-06-18 | 2000-12-21 | Delo Industrieklebstoffe Gmbh | Kationisch härtende Masse, ihre Verwendung sowie Verfahren zur Herstellung gehärteter Polymermassen |
| US7049373B2 (en) * | 1999-08-06 | 2006-05-23 | Carnegie Mellon University | Process for preparation of graft polymers |
| US6790919B2 (en) | 2000-10-06 | 2004-09-14 | Carnegie Mellon University | Catalyst system for controlled polymerization |
| US7332550B2 (en) * | 2000-10-06 | 2008-02-19 | Carnegie Mellon University | Stabilization of transition metal complexes for catalysis in diverse environments |
| DE10108129A1 (de) * | 2001-02-21 | 2002-09-05 | Schenectady Europ Gmbh | Wäßrige Epoxidharzemulsionen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE60236642D1 (de) * | 2001-04-06 | 2010-07-22 | Univ Carnegie Mellon | Verfahren zur herstellung von nanostrukturierten materialien |
| US7064166B2 (en) * | 2001-10-12 | 2006-06-20 | Carnegie Mellon University | Process for monomer sequence control in polymerizations |
| WO2003031481A2 (en) | 2001-10-12 | 2003-04-17 | Carnegie Mellon University | Simultaneous reverse and normal initiation of atrp |
| US20030216528A1 (en) * | 2002-03-13 | 2003-11-20 | Krzysztof Matyjaszewski | Novel (co)polymers and a novel polymerization process based on atom (or group) transfer radical polymerization |
| AU2003276847A1 (en) * | 2002-08-09 | 2004-02-25 | Carnegie Mellon University | Polymers, supersoft elastomers and methods for preparing the same |
| US7893174B2 (en) * | 2004-03-05 | 2011-02-22 | Carnegie Mellon University | Atom transfer radical polymerization process |
| US7795355B2 (en) * | 2004-03-05 | 2010-09-14 | Carnegie Mellon University | Preparation of functional polymers |
| US8273823B2 (en) | 2005-08-23 | 2012-09-25 | Carnegie Mellon University | Atom transfer radical polymerization in microemulsion and true emulsion polymerization processes |
| DE602006017416D1 (de) * | 2005-08-26 | 2010-11-18 | Univ Carnegie Mellon | Polymerisationsverfahren mit katalysatorreaktivierung |
| WO2008057163A2 (en) * | 2006-10-09 | 2008-05-15 | Carnegie Mellon University | Preparation of functional gel particles with a dual crosslink network |
| KR20090091200A (ko) * | 2006-12-21 | 2009-08-26 | 다우 코닝 코포레이션 | 이중 경화 중합체 및 이의 제조 방법 및 용도 |
| KR20090093999A (ko) * | 2006-12-21 | 2009-09-02 | 다우 코닝 코포레이션 | 이중 경화 중합체, 이의 제조방법 및 용도 |
| WO2008148000A1 (en) * | 2007-05-23 | 2008-12-04 | Carnegie Mellon University | Atom transfer dispersion polymerization |
| WO2009023353A1 (en) * | 2007-05-23 | 2009-02-19 | Carnegie Mellon University | Hybrid particle composite structures with reduced scattering |
| JP2009135353A (ja) * | 2007-12-03 | 2009-06-18 | Panasonic Corp | 半導体装置及びその製造に使用する樹脂接着材 |
| GB2481561B (en) | 2009-03-27 | 2013-12-11 | Univ Carnegie Mellon | Preparation of functional star macromolecules |
| WO2012091965A1 (en) | 2010-12-17 | 2012-07-05 | Carnegie Mellon University | Electrochemically mediated atom transfer radical polymerization |
| US20140275420A1 (en) | 2011-08-22 | 2014-09-18 | Carnegie Mellon University | Atom transfer radical polymerization under biologically compatible conditions |
| WO2013126745A2 (en) | 2012-02-23 | 2013-08-29 | Carnegie Mellon University | Ligands designed to provide highly active catalyst complexes |
| US9982070B2 (en) | 2015-01-12 | 2018-05-29 | Carnegie Mellon University | Aqueous ATRP in the presence of an activator regenerator |
| US11174325B2 (en) | 2017-01-12 | 2021-11-16 | Carnegie Mellon University | Surfactant assisted formation of a catalyst complex for emulsion atom transfer radical polymerization processes |
| EP4141036A1 (en) * | 2021-08-27 | 2023-03-01 | General Electric Company | Binders comprising a monomer and an initiator for use in additive manufacturing |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US370296A (en) * | 1887-09-20 | w weinig | ||
| US2807648A (en) * | 1955-09-16 | 1957-09-24 | Stauffer Chemical Co | Process for making sulfonium compounds |
| NL224266A (enExample) * | 1957-01-22 | |||
| US3235620A (en) * | 1961-05-15 | 1966-02-15 | Union Carbide Corp | Compositions comprising diglycidyl diether of dihydric phenols and vinylcyclohexene dioxide |
| ES305034A1 (es) * | 1963-10-18 | 1965-04-01 | Ciba Geigy | Procedimiento para endurecer compuestos poliepoxidos cicloalifaticos |
| US3369055A (en) * | 1965-12-06 | 1968-02-13 | Monsanto Res Corp | Nitrogenous copolymers |
| US3403199A (en) * | 1966-03-08 | 1968-09-24 | Ramos Thomas | Diglycidyl ether of polyhydric alcohols with diamines or hydroquinones and bis(2, 3-epoxycyclopentyl)ether |
| US3398211A (en) * | 1966-03-08 | 1968-08-20 | Ramos Thomas | Diglycidyl ethers of polyhydric alcohols with diamines or hydroquinones and 1, 4-cyclohexadiene dioxide |
| US3708296A (en) * | 1968-08-20 | 1973-01-02 | American Can Co | Photopolymerization of epoxy monomers |
| US3567797A (en) * | 1968-12-09 | 1971-03-02 | Shell Oil Co | Curable compositions comprising (a) a bis(1,2 - epoxyalkyl) cycloaliphatic compound,(b) a polyether polyepoxide and (c) a curing agent |
| US3563850A (en) * | 1969-06-11 | 1971-02-16 | Gen Electric | Electrical insulation containing epoxy resin,bis(2,3-epoxy-cyclopentyl) ether and resorcinol formaldehyde resin |
| US3677995A (en) * | 1970-07-07 | 1972-07-18 | Gen Electric | Epoxy resin cement |
| US4138255A (en) * | 1977-06-27 | 1979-02-06 | General Electric Company | Photo-curing method for epoxy resin using group VIa onium salt |
| US4230814A (en) * | 1979-02-12 | 1980-10-28 | General Electric Company | Heat curable compositions |
| US4351708A (en) * | 1980-02-29 | 1982-09-28 | Ciba-Geigy Corporation | Photochemically or thermally polymerizable mixtures |
-
1980
- 1980-08-08 US US06/176,723 patent/US4374751A/en not_active Expired - Lifetime
-
1981
- 1981-06-29 GB GB8119957A patent/GB2081271B/en not_active Expired
- 1981-07-14 CH CH4605/81A patent/CH648334A5/de not_active IP Right Cessation
- 1981-07-15 DE DE19813127977 patent/DE3127977A1/de active Granted
- 1981-08-05 FR FR8115151A patent/FR2488262B1/fr not_active Expired
- 1981-08-07 JP JP56123156A patent/JPS5757712A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5757712A (en) | 1982-04-07 |
| JPS6336331B2 (enExample) | 1988-07-20 |
| GB2081271A (en) | 1982-02-17 |
| FR2488262A1 (fr) | 1982-02-12 |
| GB2081271B (en) | 1984-12-05 |
| FR2488262B1 (fr) | 1986-03-21 |
| DE3127977A1 (de) | 1982-05-27 |
| US4374751A (en) | 1983-02-22 |
| DE3127977C2 (enExample) | 1989-04-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3127977C2 (enExample) | ||
| DE2602574C2 (de) | Photopolymerisierbare Zusammensetzungen | |
| DE2618897C2 (de) | Durch sichtbares Licht härtbare Zusammensetzung und deren Verwendung | |
| DE69433493T2 (de) | Stabilisierte kationisch härtbare Zusammensetzungen | |
| DE2518639C3 (de) | Härtbare Zusammensetzungen | |
| DE2559833C2 (de) | Aromatische Oniumsalze und deren Verwendung | |
| DE1543884A1 (de) | Verfahren zur Herstellung von Hydroxyaethern durch Reaktion von Epoxyverbindungen mit Phenolen in Gegenwart eines Katalysators | |
| DE2315500A1 (de) | Polymerisierbares epoxydgemisch | |
| EP0200674A1 (de) | (Acylthiopropyl)-Polyphenole | |
| DE2012012C3 (de) | Verfahren zur kationischen Polymerisation von polymerisierbaren Monomeren mit Hilfe von Bis-(perfluoralkylsulfonyl)-Verbindungen | |
| DE3114677A1 (de) | Waermehaertbare epoxyharzmischung | |
| EP0518908B1 (de) | Verfahren zur polymerisation von epoxidverbindungen | |
| DE2541709A1 (de) | Photopolymerisierbare zusammensetzungen und verfahren zur herstellung derselben | |
| DE2251169C2 (de) | Härtbare Epoxyharz-Zusammensetzung | |
| DE3139520A1 (de) | "thermisch haertbare epoxidharzmischungen" | |
| DE3325481C2 (de) | Metallatomhaltige Epoxidharze | |
| DE68902849T2 (de) | Polyfluorid-sulfonium-verbindungen und deren verwendung als polymerisierungsinitiator. | |
| DE1099162B (de) | Verfahren zur Herstellung von Kunststoffen auf Grundlage von Polyepoxyden | |
| DE2818243A1 (de) | Haertbare zusammensetzungen sowie dafuer verwendbare dicarbonylchelatsalze | |
| DE2350692C2 (de) | Verfahren zur Herstellung von in Kohlenwasserstofflösungsmitteln löslichen Kohlenwasserstoffharzen | |
| EP0160622A2 (de) | Zusammensetzungen enthaltend vorverlängerte Epoxidharzester | |
| DE2853885C2 (de) | Härtbare Zusammensetzung und Verfahren zum Schäumen derselben | |
| DE3342357C2 (de) | Furan-Reimprägnierharze | |
| DE2854011C2 (de) | Hitzehärtbare Masse und Verfahren zu deren Herstellung | |
| DE2313628C2 (de) | Stabilisierte, polymerisierbare Zubereitung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |