CH635066A5 - Verfahren zur herstellung cyclischer aminosaeuren. - Google Patents
Verfahren zur herstellung cyclischer aminosaeuren. Download PDFInfo
- Publication number
- CH635066A5 CH635066A5 CH343777A CH343777A CH635066A5 CH 635066 A5 CH635066 A5 CH 635066A5 CH 343777 A CH343777 A CH 343777A CH 343777 A CH343777 A CH 343777A CH 635066 A5 CH635066 A5 CH 635066A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- formula
- compounds
- amino acids
- imide
- Prior art date
Links
- 150000001413 amino acids Chemical class 0.000 title description 8
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 description 34
- -1 cyclic amino acids Chemical class 0.000 description 25
- 238000000034 method Methods 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 238000006644 Lossen rearrangement reaction Methods 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 150000003949 imides Chemical class 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 229940086542 triethylamine Drugs 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000005840 aryl radicals Chemical class 0.000 description 4
- 229940077388 benzenesulfonate Drugs 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- KMBMIFAMYKVGMQ-UHFFFAOYSA-N 2-[1-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]acetic acid Chemical compound ON=C(O)CC1(CC(O)=O)CCCCC1 KMBMIFAMYKVGMQ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000002015 acyclic group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 3
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 2
- CQAHQVNBEBOLQB-UHFFFAOYSA-N 2-[1-(aminomethyl)cycloheptyl]acetic acid;hydrochloride Chemical compound Cl.OC(=O)CC1(CN)CCCCCC1 CQAHQVNBEBOLQB-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 230000006179 O-acylation Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- SAYBRQDMVZLOPM-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylsulfanyl]acetic acid Chemical compound OC(=O)CSCC1=CC=C(Cl)C=C1 SAYBRQDMVZLOPM-UHFFFAOYSA-N 0.000 description 1
- MXNASYICBPHSLF-UHFFFAOYSA-N 2-[1-(aminomethyl)cycloheptyl]acetic acid Chemical compound OC(=O)CC1(CN)CCCCCC1 MXNASYICBPHSLF-UHFFFAOYSA-N 0.000 description 1
- BBZPPPNVZUVGSW-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclohexyl]acetic acid;benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1.OC(=O)CC1(CN)CCCCC1 BBZPPPNVZUVGSW-UHFFFAOYSA-N 0.000 description 1
- XBUDZAQEMFGLEU-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydron;chloride Chemical compound Cl.OC(=O)CC1(CN)CCCCC1 XBUDZAQEMFGLEU-UHFFFAOYSA-N 0.000 description 1
- ZREIWWCKNBMKBH-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclopentyl]acetic acid;benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1.OC(=O)CC1(CN)CCCC1 ZREIWWCKNBMKBH-UHFFFAOYSA-N 0.000 description 1
- XFLACBVNBXGJKW-UHFFFAOYSA-N 2-[1-(carboxymethyl)cycloheptyl]acetic acid Chemical compound OC(=O)CC1(CC(O)=O)CCCCCC1 XFLACBVNBXGJKW-UHFFFAOYSA-N 0.000 description 1
- USFHSOVRNQGFKG-UHFFFAOYSA-N 2-[1-[2-(benzenesulfonyloxyamino)-2-oxoethyl]cycloheptyl]acetic acid Chemical compound C=1C=CC=CC=1S(=O)(=O)ONC(=O)CC1(CC(=O)O)CCCCCC1 USFHSOVRNQGFKG-UHFFFAOYSA-N 0.000 description 1
- MOOLOLYTJOYTAN-UHFFFAOYSA-N 2-[1-[2-(hydroxyamino)-2-oxoethyl]cyclopentyl]acetic acid Chemical compound ON=C(O)CC1(CC(O)=O)CCCC1 MOOLOLYTJOYTAN-UHFFFAOYSA-N 0.000 description 1
- XNDSIASQMRYFSW-UHFFFAOYSA-N 3-oxaspiro[5.5]undecane-2,4-dione Chemical compound C1C(=O)OC(=O)CC11CCCCC1 XNDSIASQMRYFSW-UHFFFAOYSA-N 0.000 description 1
- CGSIJCLRVFEHNY-UHFFFAOYSA-N 3-oxaspiro[5.6]dodecane-2,4-dione Chemical compound C1C(=O)OC(=O)CC21CCCCCC2 CGSIJCLRVFEHNY-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- GFWLMILMVMCJDI-UHFFFAOYSA-N 8-oxaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)OC(=O)CC11CCCC1 GFWLMILMVMCJDI-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical compound OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101100412921 Drosophila melanogaster Rich gene Proteins 0.000 description 1
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- LJOODBDWMQKMFB-UHFFFAOYSA-N cyclohexyl-acetic acid Natural products OC(=O)CC1CCCCC1 LJOODBDWMQKMFB-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/20—Spiro-condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/54—Spiro-condensed
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyrrole Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762611690 DE2611690A1 (de) | 1976-03-19 | 1976-03-19 | Cyclische sulfonyloxyimide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH635066A5 true CH635066A5 (de) | 1983-03-15 |
Family
ID=5972938
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH343777A CH635066A5 (de) | 1976-03-19 | 1977-03-18 | Verfahren zur herstellung cyclischer aminosaeuren. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4152326A (enExample) |
| JP (1) | JPS52113977A (enExample) |
| AU (1) | AU513892B2 (enExample) |
| BE (1) | BE852591A (enExample) |
| CH (1) | CH635066A5 (enExample) |
| DE (1) | DE2611690A1 (enExample) |
| DK (2) | DK156826C (enExample) |
| ES (1) | ES457050A1 (enExample) |
| FR (1) | FR2344540A1 (enExample) |
| GB (1) | GB1575709A (enExample) |
| IE (1) | IE44641B1 (enExample) |
| LU (1) | LU76974A1 (enExample) |
| NL (1) | NL186634C (enExample) |
| SE (2) | SE442013B (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| YU162789A (en) * | 1988-09-01 | 1990-12-31 | Lonza Ag | 2-aza-4-(alcoxycarbonyl) spiro/4,5/decan-3-ones |
| AU633612B2 (en) * | 1989-08-25 | 1993-02-04 | Warner-Lambert Company | Improved process for cyclic amino acid anticonvulsant compounds |
| US5132451A (en) * | 1989-08-25 | 1992-07-21 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| DE3928182A1 (de) | 1989-08-25 | 1991-02-28 | Goedecke Ag | Verfahren zur herstellung von gabapentin |
| DE3928183A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Lactamfreie cyclische aminosaeuren |
| US5319135A (en) * | 1989-08-25 | 1994-06-07 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| US5149870A (en) * | 1989-11-16 | 1992-09-22 | Lonza Ltd. | Process for the production of 1-(aminomethyl)cyclohexane acetic acid |
| US5136091A (en) * | 1989-11-16 | 1992-08-04 | Lonza Ltd. | Process for the production of 1-(aminomethyl) cyclohexane acetic acid |
| FI905584A7 (fi) * | 1989-11-16 | 1991-05-17 | Lonza Ag | Menetelmä 1-(aminometyyli)sykloheksaanietikkahapon valmistamiseksi |
| EE9800309A (et) * | 1996-03-14 | 1999-02-15 | Warner-Lambert Company | Uued asendatud tsüklilised aminohapped kui farmatseutilised toimeained |
| US6294690B1 (en) | 1997-10-07 | 2001-09-25 | Warner-Lambert Company | Process for preparing a cyclic amino acid anticonvulsant compound |
| KR100589066B1 (ko) * | 1997-10-27 | 2006-06-13 | 워너-램버트 캄파니 엘엘씨 | 약제로서 유용한 시클릭 아미노산 및 그의 유도체 |
| GB2362646A (en) * | 2000-05-26 | 2001-11-28 | Warner Lambert Co | Cyclic amino acid derivatives useful as pharmaceutical agents |
| ATE255891T1 (de) | 2000-06-16 | 2003-12-15 | Teva Pharma | Stabiles gabapentin, das mehr als 20 ppm chlor enthält |
| YU95302A (sh) * | 2000-06-16 | 2006-05-25 | Teva Pharmaceutical Industries Ltd. | Stabilni gabapentin koji ima ph u kontrolisanom rasponu |
| US8048917B2 (en) | 2005-04-06 | 2011-11-01 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US7186855B2 (en) | 2001-06-11 | 2007-03-06 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US6818787B2 (en) * | 2001-06-11 | 2004-11-16 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| JP4231408B2 (ja) * | 2001-09-28 | 2009-02-25 | ダイセル化学工業株式会社 | N−置換環状イミド化合物で構成された触媒、及びこの触媒を用いた有機化合物の製造法 |
| US7612112B2 (en) * | 2001-10-25 | 2009-11-03 | Depomed, Inc. | Methods of treatment using a gastric retained gabapentin dosage |
| US20070184104A1 (en) * | 2001-10-25 | 2007-08-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| US20060159743A1 (en) * | 2001-10-25 | 2006-07-20 | Depomed, Inc. | Methods of treating non-nociceptive pain states with gastric retentive gabapentin |
| TWI312285B (en) | 2001-10-25 | 2009-07-21 | Depomed Inc | Methods of treatment using a gastric retained gabapentin dosage |
| ITMI20012750A1 (it) | 2001-12-21 | 2003-06-21 | Procos Spa | Processo per la produzione dell'acido 1-(amminometil)-cicloesil-acetico in forma pura |
| ITMI20022071A1 (it) * | 2002-10-01 | 2004-04-02 | Erregierre Spa | Processo di sintesi dell'acido 1-(aminometil)cicloesanacetico cloridato. |
| DE60230552D1 (de) | 2002-11-18 | 2009-02-05 | Nicholas Piramal India Ltd | Verbessertes verfahren zur herstellung von gabapentin |
| ITMI20030825A1 (it) * | 2003-04-18 | 2004-10-19 | Farchemia Srl | Procedimento per la preparazione di gabapentin esente da |
| US20050187295A1 (en) * | 2004-02-19 | 2005-08-25 | Surendra Kalyan | Processes for the preparation of gabapentin |
| US20090176882A1 (en) * | 2008-12-09 | 2009-07-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| US8431739B2 (en) | 2010-06-14 | 2013-04-30 | Divi's Laboratories, Ltd. | Process for the preparation of gabapentin |
| RU2678991C1 (ru) * | 2017-12-21 | 2019-02-05 | Закрытое акционерное общество "Институт новых углеродных материалов и технологий" (ЗАО "ИНУМиТ") | Латентный катализатор ускорения отверждения смесей фенолформальдегидных и эпоксидных смол и способ его изготовления |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3256277A (en) * | 1966-06-14 | Azaspiro alkanes | ||
| US3256276A (en) * | 1961-02-17 | 1966-06-14 | Geschickter Fund Med Res | Substituted spiroimides |
| US3238217A (en) * | 1961-09-07 | 1966-03-01 | Geschickter Fund Med Res | Azaspiranes |
| US3432499A (en) * | 1965-04-02 | 1969-03-11 | Geschickter Fund Med Res | Trifluoromethylazaspiranes and azaspirane diones |
| DE2460891C2 (de) * | 1974-12-21 | 1982-09-23 | Gödecke AG, 1000 Berlin | 1-Aminomethyl-1-cycloalkanessigsäuren und deren Ester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel |
-
1976
- 1976-03-19 DE DE19762611690 patent/DE2611690A1/de active Granted
-
1977
- 1977-03-07 US US05/775,336 patent/US4152326A/en not_active Expired - Lifetime
- 1977-03-09 IE IE520/77A patent/IE44641B1/en not_active IP Right Cessation
- 1977-03-16 GB GB11097/77A patent/GB1575709A/en not_active Expired
- 1977-03-17 FR FR7707961A patent/FR2344540A1/fr active Granted
- 1977-03-17 BE BE6045936A patent/BE852591A/xx not_active IP Right Cessation
- 1977-03-17 SE SE7703018A patent/SE442013B/xx not_active IP Right Cessation
- 1977-03-18 NL NLAANVRAGE7703014,A patent/NL186634C/xx not_active IP Right Cessation
- 1977-03-18 CH CH343777A patent/CH635066A5/de not_active IP Right Cessation
- 1977-03-18 AU AU23414/77A patent/AU513892B2/en not_active Expired
- 1977-03-18 LU LU76974A patent/LU76974A1/xx unknown
- 1977-03-18 JP JP2934577A patent/JPS52113977A/ja active Pending
- 1977-03-18 DK DK120077A patent/DK156826C/da not_active IP Right Cessation
- 1977-03-21 ES ES457050A patent/ES457050A1/es not_active Expired
-
1982
- 1982-09-24 SE SE8205469A patent/SE454273B/sv not_active IP Right Cessation
-
1988
- 1988-04-20 DK DK214688A patent/DK159680C/da active
Also Published As
| Publication number | Publication date |
|---|---|
| DK214688D0 (da) | 1988-04-20 |
| JPS52113977A (en) | 1977-09-24 |
| AU513892B2 (en) | 1981-01-15 |
| SE7703018L (sv) | 1977-09-20 |
| SE8205469D0 (sv) | 1982-09-24 |
| LU76974A1 (enExample) | 1977-07-22 |
| DK120077A (da) | 1977-09-20 |
| SE8205469L (sv) | 1982-09-24 |
| BE852591A (fr) | 1977-09-19 |
| DE2611690C2 (enExample) | 1992-01-16 |
| DK214688A (da) | 1988-04-20 |
| SE442013B (sv) | 1985-11-25 |
| DK156826B (da) | 1989-10-09 |
| DK156826C (da) | 1990-03-12 |
| ES457050A1 (es) | 1978-08-16 |
| AU2341477A (en) | 1978-09-21 |
| IE44641L (en) | 1977-09-19 |
| NL7703014A (nl) | 1977-09-21 |
| FR2344540B1 (enExample) | 1981-02-27 |
| SE454273B (sv) | 1988-04-18 |
| NL186634C (nl) | 1991-01-16 |
| DK159680C (da) | 1991-04-22 |
| DK159680B (da) | 1990-11-19 |
| FR2344540A1 (fr) | 1977-10-14 |
| GB1575709A (en) | 1980-09-24 |
| DE2611690A1 (de) | 1977-09-22 |
| US4152326A (en) | 1979-05-01 |
| IE44641B1 (en) | 1982-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH635066A5 (de) | Verfahren zur herstellung cyclischer aminosaeuren. | |
| EP0414275A2 (de) | Verfahren zur Herstellung von cyclischen Aminosäurederivaten sowie Zwischenprodukte | |
| DE69909165T2 (de) | Verfahren zur Herstellung von N-Glycyltyrosin | |
| DE2541342A1 (de) | Neue phenoxyalkylcarbonsaeuren und verfahren zur herstellung derselben | |
| DE2537681A1 (de) | Verfahren zur herstellung der isomeren 1,4-dibrom-epoxy-cyclohexene | |
| DE3642105A1 (de) | Substituierte aminomethyl-5,6,7,8-tetrahydronaphtyl-oxyessigsaeuren, neue zwischenprodukte, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimitteln | |
| EP0025140B1 (de) | Verfahren zur Herstellung bekannter und neuer 6-Amino-6-desoxy-2,3-0-isopropyliden-alpha-L-sorbofuranose-Derivate sowie neue Zwischenprodukte des Verfahrens | |
| EP0133493B1 (de) | Verfahren zur Herstellung von Kohlenhydraten | |
| CH619955A5 (enExample) | ||
| DE887816C (de) | Verfahren zur Herstellung von 1-Nitrophenyl-2-amino-propan-1, 3-diolderivaten | |
| DE2427420C2 (de) | Verfahren zum 11a-Dehalogenieren eines 11a-Halogen-6-methylentetracyclins | |
| EP0088252B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| CH644122A5 (de) | 14-oxo-15-halogen-e-homoeburnanderivate, verfahren zu deren herstellung und deren verwendung. | |
| DE2436897C2 (de) | Verfahren zur Herstellung von Trisaminopyridinen | |
| DE2214488C3 (de) | Verfahren zur Herstellung 1-substituierter 4-AminopyiTolin-3-one(2) | |
| US2891987A (en) | alpha-amino-beta-aminoxypropionic acid and derivatives thereof | |
| DE3323510A1 (de) | 2-ketosulfonamide und verfahren zu deren herstellung | |
| EP0087656B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| EP0087654B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| DE1121052B (de) | Verfahren zur Herstellung von 4, 5-substituierten 2-Amino-oxazolen | |
| DE2362687A1 (de) | Verfahren zur razematspaltung von d,l-penicillamin | |
| EP0087657B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| DE68904546T2 (de) | Aminoacetonitril-derivate. | |
| DE69819315T2 (de) | Verfahren zur herstellung von piperidincarbonsäureamiden | |
| DE930565C (de) | Verfahren zur Herstellung von 1-Phenyl-2-amino-1, 3-propandiolen oder von im Phenylrest substituierten 1-Phenyl-2-amino-1, 3-propandiolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |