CH633117A5 - Photographisches farbentwicklergemisch. - Google Patents
Photographisches farbentwicklergemisch. Download PDFInfo
- Publication number
- CH633117A5 CH633117A5 CH28578A CH28578A CH633117A5 CH 633117 A5 CH633117 A5 CH 633117A5 CH 28578 A CH28578 A CH 28578A CH 28578 A CH28578 A CH 28578A CH 633117 A5 CH633117 A5 CH 633117A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- group
- color developer
- antioxidant
- compound
- Prior art date
Links
- -1 hydrocarbon radicals Chemical class 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 30
- 239000003963 antioxidant agent Substances 0.000 claims description 29
- 125000000623 heterocyclic group Chemical group 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 23
- 230000003078 antioxidant effect Effects 0.000 claims description 20
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 10
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims description 7
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000002837 carbocyclic group Chemical group 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- MSWZFWKMSRAUBD-QZABAPFNSA-N beta-D-glucosamine Chemical compound N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-QZABAPFNSA-N 0.000 claims description 3
- FTZLOGYLADSPDJ-UHFFFAOYSA-N 1,1-diphosphonoethylphosphonic acid Chemical compound OP(=O)(O)C(C)(P(O)(O)=O)P(O)(O)=O FTZLOGYLADSPDJ-UHFFFAOYSA-N 0.000 claims description 2
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 2
- 125000002723 alicyclic group Chemical group 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 2
- 229960003330 pentetic acid Drugs 0.000 claims description 2
- 159000000001 potassium salts Chemical class 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 claims description 2
- 230000000087 stabilizing effect Effects 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 claims description 2
- XHAZMZWXAOBLQG-UHFFFAOYSA-N (1-hydroxy-1-phosphonopropyl)phosphonic acid Chemical compound CCC(O)(P(O)(O)=O)P(O)(O)=O XHAZMZWXAOBLQG-UHFFFAOYSA-N 0.000 claims 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 claims 1
- 125000002587 enol group Chemical group 0.000 claims 1
- 125000005750 substituted cyclic group Chemical group 0.000 claims 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 17
- 239000003513 alkali Substances 0.000 description 9
- 238000011161 development Methods 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 229960001484 edetic acid Drugs 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- 230000035945 sensitivity Effects 0.000 description 6
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 5
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 125000002243 cyclohexanonyl group Chemical group *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002085 enols Chemical class 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical group O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 2
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- WAHQIHHSVDYTGC-GMTAPVOTSA-N (3s,4r,5r)-3,4,5,6-tetrahydroxy-1-piperidin-1-ylhexan-2-one Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)CN1CCCCC1 WAHQIHHSVDYTGC-GMTAPVOTSA-N 0.000 description 1
- XBTWVJKPQPQTDW-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(C)=C1 XBTWVJKPQPQTDW-UHFFFAOYSA-N 0.000 description 1
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 1
- FFAJEKUNEVVYCW-UHFFFAOYSA-N 4-n-ethyl-4-n-(2-methoxyethyl)-2-methylbenzene-1,4-diamine Chemical compound COCCN(CC)C1=CC=C(N)C(C)=C1 FFAJEKUNEVVYCW-UHFFFAOYSA-N 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- CSGQJHQYWJLPKY-UHFFFAOYSA-N CITRAZINIC ACID Chemical compound OC(=O)C=1C=C(O)NC(=O)C=1 CSGQJHQYWJLPKY-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical compound CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 1
- VWYAICBFTAKVGG-UHFFFAOYSA-N O.OS(O)(=O)=O.Nc1ccccc1 Chemical compound O.OS(O)(=O)=O.Nc1ccccc1 VWYAICBFTAKVGG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- NUBNBELEINUYLB-UHFFFAOYSA-L [Na+].[Na+].[O-]S([O-])=O.OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O Chemical compound [Na+].[Na+].[O-]S([O-])=O.OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O NUBNBELEINUYLB-UHFFFAOYSA-L 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229920013821 hydroxy alkyl cellulose Polymers 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- ZYOCCIGDDIEWMM-UHFFFAOYSA-N n-[2-(n-ethylanilino)ethyl]methanesulfonamide Chemical compound CS(=O)(=O)NCCN(CC)C1=CC=CC=C1 ZYOCCIGDDIEWMM-UHFFFAOYSA-N 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 239000002455 scale inhibitor Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/29—Development processes or agents therefor
- G03C5/305—Additives other than developers
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772700938 DE2700938A1 (de) | 1977-01-12 | 1977-01-12 | Photographische farbentwicklerzusammensetzung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH633117A5 true CH633117A5 (de) | 1982-11-15 |
Family
ID=5998481
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH28578A CH633117A5 (de) | 1977-01-12 | 1978-01-11 | Photographisches farbentwicklergemisch. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4142895A (enExample) |
| JP (1) | JPS5389425A (enExample) |
| BE (1) | BE862150A (enExample) |
| CA (1) | CA1135554A (enExample) |
| CH (1) | CH633117A5 (enExample) |
| DE (1) | DE2700938A1 (enExample) |
| FR (1) | FR2377652A1 (enExample) |
| GB (1) | GB1568341A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4264716A (en) * | 1979-09-10 | 1981-04-28 | Eastman Kodak Company | Photographic color developer compositions |
| JPH06105345B2 (ja) * | 1986-07-21 | 1994-12-21 | 富士写真フイルム株式会社 | カラ−写真現像液組成物及びハロゲン化銀カラ−写真感光材料の処理方法 |
| JPH0654377B2 (ja) * | 1986-07-31 | 1994-07-20 | 富士写真フイルム株式会社 | ハロゲン化銀カラ−写真感光材料の処理方法 |
| GB8628613D0 (en) * | 1986-11-29 | 1987-01-07 | Horsell Graphic Ind Ltd | Developing fluid for lithographic plates |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB190609537A (en) * | 1906-04-23 | 1907-02-07 | William Folberth | Improvements in Speed-changing and Reversing-gear for Motor Cars. |
| US2936308A (en) * | 1955-06-02 | 1960-05-10 | John E Hodge | Novel reductones and methods of making them |
| FR1228100A (fr) * | 1958-01-30 | 1960-08-26 | Kodak Pathe | Procédé de stabilisation des images photographiques en couleurs, images stabilisées par ledit procédé, et produits photographiques contenant de telles images |
| BE610270A (enExample) * | 1960-11-14 | |||
| BE616004A (enExample) * | 1961-04-10 | |||
| DE1472752C3 (de) * | 1965-05-03 | 1978-12-07 | Agfa-Gevaert Ag, 5090 Leverkusen | Entwicklerkonzentrat |
| US3582333A (en) * | 1968-04-08 | 1971-06-01 | Eastman Kodak Co | Method for reducing color fog in color emulsions coated on electron bombarded supports |
| US3619185A (en) * | 1968-04-29 | 1971-11-09 | Polaroid Corp | Photographic processing compositions and processes using same |
| US3664835A (en) * | 1969-10-02 | 1972-05-23 | Eastman Kodak Co | Photographic product,composition and process comprising an anhydro dihydro amino reductone developing agent |
| US3617282A (en) * | 1970-05-18 | 1971-11-02 | Eastman Kodak Co | Nucleating agents for photographic reversal processes |
| DE2227639A1 (de) * | 1972-06-07 | 1974-01-03 | Agfa Gevaert Ag | Photographische farbentwicklermischung |
| DE2246610C3 (de) * | 1972-09-22 | 1980-01-03 | Agfa-Gevaert Ag, 5090 Leverkusen | Photographischer Farbentwickler |
| US3846129A (en) * | 1972-09-25 | 1974-11-05 | Eastman Kodak Co | Dye diffusion transfer compositions,elements and processes |
| JPS5227638A (en) * | 1975-08-27 | 1977-03-02 | Fuji Photo Film Co Ltd | Method for stabilization of color developer |
| DE2622950C2 (de) * | 1976-05-21 | 1986-04-03 | Agfa-Gevaert Ag, 5090 Leverkusen | Wässrige, alkalische Farbentwicklerzusammensetzung |
-
1977
- 1977-01-12 DE DE19772700938 patent/DE2700938A1/de active Granted
- 1977-12-22 BE BE1008594A patent/BE862150A/xx unknown
-
1978
- 1978-01-05 US US05/867,048 patent/US4142895A/en not_active Expired - Lifetime
- 1978-01-10 CA CA000294636A patent/CA1135554A/en not_active Expired
- 1978-01-10 JP JP93378A patent/JPS5389425A/ja active Granted
- 1978-01-11 CH CH28578A patent/CH633117A5/de not_active IP Right Cessation
- 1978-01-12 FR FR7800832A patent/FR2377652A1/fr not_active Withdrawn
- 1978-01-12 GB GB1237/78A patent/GB1568341A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5389425A (en) | 1978-08-07 |
| JPS611740B2 (enExample) | 1986-01-20 |
| GB1568341A (en) | 1980-05-29 |
| CA1135554A (en) | 1982-11-16 |
| DE2700938C2 (enExample) | 1988-10-13 |
| US4142895A (en) | 1979-03-06 |
| FR2377652A1 (fr) | 1978-08-11 |
| BE862150A (nl) | 1978-06-22 |
| DE2700938A1 (de) | 1978-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2736886C3 (de) | Verfahren zum Entfernen des Silberbildes eines belichteten und farbentwickelten farbphotographischen Aufzeichnungsmaterials | |
| CH627561A5 (de) | Fotografische farbentwicklerzusammensetzung. | |
| DE2633208A1 (de) | Verfahren zur ausbildung von bildern durch eine stabilisierte farbintensivierbehandlung | |
| DE69329814T2 (de) | Photographische Verarbeitungszusammensetzung und photographisches Verarbeitungsverfahren | |
| CH646534A5 (de) | Unbelichtete, nicht entwickelte farbphotographische silberhalogenidemulsion und farbentwicklerbad. | |
| DE2707989C2 (de) | Farbentwickler und dessen Verwendung zum Entwickeln eines belichteten farbphotographischen Silberhalogenidmaterials | |
| DE69624308T2 (de) | Bernsteinsäurederivate als abbaubare Chelatbildner, ihre Verwendungen und Zusammensetzungen | |
| DE69605752T2 (de) | Bleich- oder Bleichfixier-Lösung enthaltend einen Metallkomplex einer Polyamino-monobeonstein säure | |
| CH633117A5 (de) | Photographisches farbentwicklergemisch. | |
| DE3516417A1 (de) | Behandlungs- bzw. entwicklungsverfahren fuer ein farbphotographisches material | |
| DE2453630A1 (de) | Photographische farbentwicklerloesung | |
| DE69426851T2 (de) | Fotografische Entwicklungs-Lösung, die ternäre Ferri-Komplexsalze enthält | |
| DE69227297T2 (de) | Verbesserte Bleichmittelzusammensetzungen und photographische Verarbeitungsverfahren | |
| DE2050699A1 (de) | Losung zur Behandlung von lichtempfind lichen photographischen Materialien | |
| EP0118071B1 (de) | Fotografische Entwicklerzusammensetzung | |
| DE1282454B (de) | Photographische Entwicklerloesung | |
| DE2205115A1 (de) | Zusammensetzung für die Behandlung eines lichtempfindlichen photographischen Silberhalogenidelements | |
| DE69501797T2 (de) | Wasserstoffperoxid-Bleichzusammensetzungen für die Verwendung mit photographischen Silberhalogenidelementen | |
| DE4226372A1 (de) | Bleichbad für fotografisches Material | |
| DE2052693A1 (de) | Entwicklung von fotografischen Materialien | |
| DE2657438C2 (de) | Verfahren zur Erzeugung eines farbigen Bildes in einem silberhalogenidhaltigen, farbphotographischen Aufzeichnungsmaterial | |
| DE19805728A1 (de) | Fotografisches Umkehrbad-Konzentrat und Verfahren zur Herstellung desselben | |
| DE2735262A1 (de) | Verfahren zur erzeugung eines photographischen bildes | |
| DE69029032T2 (de) | Alkalischer photographischer Schwarzweissentwickler | |
| DE2127942A1 (de) | Wäßriges Bad zum Neutralisieren von Aldehyd bei der photographischen Entwicklung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |