CH628060A5 - Verfahren zur herstellung von silicium-stickstoff-verbindungen. - Google Patents
Verfahren zur herstellung von silicium-stickstoff-verbindungen. Download PDFInfo
- Publication number
- CH628060A5 CH628060A5 CH1063077A CH1063077A CH628060A5 CH 628060 A5 CH628060 A5 CH 628060A5 CH 1063077 A CH1063077 A CH 1063077A CH 1063077 A CH1063077 A CH 1063077A CH 628060 A5 CH628060 A5 CH 628060A5
- Authority
- CH
- Switzerland
- Prior art keywords
- carbon atoms
- catalysts
- hydrogen
- catalyst
- hydrocarbon radical
- Prior art date
Links
- UMVBXBACMIOFDO-UHFFFAOYSA-N [N].[Si] Chemical compound [N].[Si] UMVBXBACMIOFDO-UHFFFAOYSA-N 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title 1
- 239000003054 catalyst Substances 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 12
- -1 hydrocarbon radical Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 2
- 239000002245 particle Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- 230000008030 elimination Effects 0.000 claims 1
- 238000003379 elimination reaction Methods 0.000 claims 1
- 239000000376 reactant Substances 0.000 claims 1
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 20
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 11
- 238000009835 boiling Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- PQDJYEQOELDLCP-UHFFFAOYSA-N trimethylsilane Chemical compound C[SiH](C)C PQDJYEQOELDLCP-UHFFFAOYSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229910052759 nickel Inorganic materials 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 238000011049 filling Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- UBHZUDXTHNMNLD-UHFFFAOYSA-N dimethylsilane Chemical compound C[SiH2]C UBHZUDXTHNMNLD-UHFFFAOYSA-N 0.000 description 2
- VDCSGNNYCFPWFK-UHFFFAOYSA-N diphenylsilane Chemical compound C=1C=CC=CC=1[SiH2]C1=CC=CC=C1 VDCSGNNYCFPWFK-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- OGWVYCFORNDBRE-UHFFFAOYSA-N n,n-bis(trimethylsilyl)ethanamine Chemical compound CCN([Si](C)(C)C)[Si](C)(C)C OGWVYCFORNDBRE-UHFFFAOYSA-N 0.000 description 2
- 229910017464 nitrogen compound Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- FIADVASZMLCQIF-UHFFFAOYSA-N 2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane Chemical compound C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N[Si](C)(C)N1 FIADVASZMLCQIF-UHFFFAOYSA-N 0.000 description 1
- UIYBOILKWCOZRG-UHFFFAOYSA-N C1(=CC=CC=C1)[SiH2]C1=CC=CC=C1.NC1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)[SiH2]C1=CC=CC=C1.NC1=CC=CC=C1 UIYBOILKWCOZRG-UHFFFAOYSA-N 0.000 description 1
- INJAZKVXBHPVQG-UHFFFAOYSA-N C[SiH](C)C.N Chemical compound C[SiH](C)C.N INJAZKVXBHPVQG-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- UCXUKTLCVSGCNR-UHFFFAOYSA-N diethylsilane Chemical compound CC[SiH2]CC UCXUKTLCVSGCNR-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000003670 easy-to-clean Effects 0.000 description 1
- IQSBKDJPSOMMRZ-UHFFFAOYSA-N ethenyl(methyl)silane Chemical compound C[SiH2]C=C IQSBKDJPSOMMRZ-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000007210 heterogeneous catalysis Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- LAQFLZHBVPULPL-UHFFFAOYSA-N methyl(phenyl)silicon Chemical compound C[Si]C1=CC=CC=C1 LAQFLZHBVPULPL-UHFFFAOYSA-N 0.000 description 1
- ZSMNRKGGHXLZEC-UHFFFAOYSA-N n,n-bis(trimethylsilyl)methanamine Chemical compound C[Si](C)(C)N(C)[Si](C)(C)C ZSMNRKGGHXLZEC-UHFFFAOYSA-N 0.000 description 1
- IPJPAQIHUIKFLV-UHFFFAOYSA-N n-trimethylsilylaniline Chemical compound C[Si](C)(C)NC1=CC=CC=C1 IPJPAQIHUIKFLV-UHFFFAOYSA-N 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000001367 organochlorosilanes Chemical class 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/10—Compounds having one or more C—Si linkages containing nitrogen having a Si-N linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Silicon Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762639286 DE2639286A1 (de) | 1976-09-01 | 1976-09-01 | Verfahren zur herstellung von silicium-stickstoff-verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH628060A5 true CH628060A5 (de) | 1982-02-15 |
Family
ID=5986869
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1063077A CH628060A5 (de) | 1976-09-01 | 1977-08-31 | Verfahren zur herstellung von silicium-stickstoff-verbindungen. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4115427A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5331626A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1096392A (cg-RX-API-DMAC10.html) |
| CH (1) | CH628060A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2639286A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES462003A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2363572A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1584648A (cg-RX-API-DMAC10.html) |
| HU (1) | HU178509B (cg-RX-API-DMAC10.html) |
| IT (1) | IT1112060B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7709589A (cg-RX-API-DMAC10.html) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4612383A (en) * | 1985-04-26 | 1986-09-16 | S R I International | Method of producing polysilazanes |
| US4788309A (en) * | 1985-04-26 | 1988-11-29 | Sri International | Method of forming compounds having Si-N groups and resulting products |
| US4459421A (en) * | 1981-06-12 | 1984-07-10 | The United States Of America As Represented By The United States Department Of Energy | Method of preparing (CH3)3 SiNSO and byproducts thereof |
| US4471132A (en) * | 1983-05-31 | 1984-09-11 | General Electric Company | Method for making polyalkoxyaminosilanes |
| US4540803A (en) * | 1983-11-28 | 1985-09-10 | Dow Corning Corporation | Hydrosilazane polymers from [R3 Si]2 NH and HSiCl3 |
| US5008422A (en) * | 1985-04-26 | 1991-04-16 | Sri International | Polysilazanes and related compositions, processes and uses |
| US5055431A (en) * | 1985-04-26 | 1991-10-08 | Sri International | Polysilazanes and related compositions, processes and uses |
| US4778907A (en) * | 1985-12-20 | 1988-10-18 | The Dexter Corporation | Method for making organosilazanes |
| US4983552A (en) * | 1986-11-26 | 1991-01-08 | The Dexter Corporation | Method for making organosilazanes |
| US5120686A (en) * | 1985-12-20 | 1992-06-09 | The Dexter Corporation | Method of preparing a polysilazane |
| GB8914575D0 (en) * | 1989-06-24 | 1989-08-16 | Ici Plc | Catalysts |
| WO2018125477A1 (en) * | 2016-12-27 | 2018-07-05 | Dow Silicones Corporation | Catalysis of dehydrocoupling reactions between amines and silanes |
| CN109824714B (zh) * | 2019-03-05 | 2021-04-27 | 湖北江瀚新材料股份有限公司 | 一种环硅氮氨基硅烷的合成方法 |
| CN114409692B (zh) * | 2022-01-10 | 2023-10-10 | 北京莱瑞森医药科技有限公司 | 一种制备六甲基二硅烷胺的方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3140288A (en) * | 1962-02-02 | 1964-07-07 | Minnesota Mining & Mfg | Cyclodisilazane compounds |
| US3530092A (en) * | 1968-07-26 | 1970-09-22 | Union Carbide Corp | Process for preparing organosiliconnitrogen compounds |
| GB1381463A (en) * | 1972-08-24 | 1975-01-22 | Sagami Chem Res | Process for producing a substituted organosilane compound |
-
1976
- 1976-09-01 DE DE19762639286 patent/DE2639286A1/de active Granted
-
1977
- 1977-08-29 US US05/828,804 patent/US4115427A/en not_active Expired - Lifetime
- 1977-08-30 IT IT50822/77A patent/IT1112060B/it active
- 1977-08-31 NL NL7709589A patent/NL7709589A/xx not_active Application Discontinuation
- 1977-08-31 JP JP10470577A patent/JPS5331626A/ja active Pending
- 1977-08-31 CA CA285,849A patent/CA1096392A/en not_active Expired
- 1977-08-31 HU HU77DI297A patent/HU178509B/hu unknown
- 1977-08-31 GB GB36418/77A patent/GB1584648A/en not_active Expired
- 1977-08-31 CH CH1063077A patent/CH628060A5/de not_active IP Right Cessation
- 1977-08-31 FR FR7726500A patent/FR2363572A1/fr not_active Withdrawn
- 1977-08-31 ES ES462003A patent/ES462003A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1096392A (en) | 1981-02-24 |
| HU178509B (en) | 1982-05-28 |
| GB1584648A (en) | 1981-02-18 |
| NL7709589A (nl) | 1978-03-03 |
| JPS5331626A (en) | 1978-03-25 |
| FR2363572A1 (fr) | 1978-03-31 |
| DE2639286A1 (de) | 1978-03-02 |
| US4115427A (en) | 1978-09-19 |
| DE2639286C2 (cg-RX-API-DMAC10.html) | 1989-04-27 |
| IT1112060B (it) | 1986-01-13 |
| ES462003A1 (es) | 1978-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2366359C2 (de) | ω-Alkenylsilane, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH628060A5 (de) | Verfahren zur herstellung von silicium-stickstoff-verbindungen. | |
| DE960461C (de) | Verfahren zur Herstellung von Organohalogenmonosilanen aus Organohalogenpolysilanen | |
| DE19520737C2 (de) | Verfahren zur Herstellung von Alkylhydrogenchlorsilanen | |
| DE69602231T2 (de) | Verfahren zur Herstellung von aromatischen Carbamaten | |
| EP0351661A1 (de) | Ruthenium-Trägerkatalysator, seine Herstellung und sein Einsatz bei der Herstellung von gegebenenfalls substituiertem Cyclohexylamin und gegebenenfalls substituiertem Dicyclohexylamin | |
| DE1127898B (de) | Verfahren zur Herstellung von ª‰-Cyanaethylphenyldichlorsilan | |
| EP0601479A1 (de) | Verfahren zur Entfernung von wasserstoffhaltigen Silanen aus Methylchlorsilanen | |
| DE1960263A1 (de) | Verfahren zur Alkylierung aromatischer Amine | |
| EP0277642B1 (de) | Verfahren zur Herstellung von Oximosilanen | |
| DE102010028454A1 (de) | Festbett-Hydrosilylierungs-Katalysator-Komplex und Verfahren hierzu | |
| EP0600479A1 (de) | Verfahren zur Herstellung von Dimethylchlorsilan | |
| DE102009028653A1 (de) | Katalysator zur Hydrodechlorierung von Chlorsilanen zu Hydrogensilanen und Verfahren zur Darstellung von Hydrogensilanen mit diesem Katalysator | |
| EP1103556B1 (de) | Verfahren zur Herstellung von halogenierten 1,2-Disilaethanen | |
| DE812551C (de) | Verfahren zur Herstellung von Pyrrolidon-Derivaten | |
| US3707563A (en) | Process for preparing n-alkylated aliphatic diamines | |
| DE2348738A1 (de) | N-alkylierung aromatischer amine | |
| DE2453365A1 (de) | Verfahren zur herstellung von n-trimethylsilylacetamid | |
| DE1593756A1 (de) | Verfahren zur Herstellung von aromatischen Aminen | |
| EP0123123A2 (de) | Verfahren zur Herstellung von 2-Isopropenyloxazolinen | |
| DE60122104T2 (de) | Einstufige Hydrierung von Nitrobenzol zu p-Aminophenol | |
| DE2746751A1 (de) | Verfahren zur hydrierung von bis-(2-cyanaethoxy)-verbindungen | |
| EP0070424A1 (de) | Verfahren zur Herstellung von N,N'-disubstituierten 3-Aminopropanamiden | |
| DE10302792B4 (de) | Herstellungsverfahren für Alkyldichlorsilane | |
| DE2154482C3 (de) | Verfahren zur Herstellung von Indolderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |