CH626073A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626073A5 CH626073A5 CH1527276A CH1527276A CH626073A5 CH 626073 A5 CH626073 A5 CH 626073A5 CH 1527276 A CH1527276 A CH 1527276A CH 1527276 A CH1527276 A CH 1527276A CH 626073 A5 CH626073 A5 CH 626073A5
- Authority
- CH
- Switzerland
- Prior art keywords
- dihydro
- oxo
- quinazoline
- carboxy
- phenyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 84
- -1 N-pyrrolidinyl Chemical group 0.000 claims description 58
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 claims description 39
- 125000004432 carbon atom Chemical group C* 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 25
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 20
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- VAACJQYGGWXTFM-UHFFFAOYSA-N 4-oxo-2-(2-propan-2-yloxyphenyl)-1h-quinazoline-6-carboxylic acid Chemical compound CC(C)OC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 VAACJQYGGWXTFM-UHFFFAOYSA-N 0.000 claims description 9
- 229910021529 ammonia Inorganic materials 0.000 claims description 9
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 8
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 8
- 159000000000 sodium salts Chemical class 0.000 claims description 8
- 125000004423 acyloxy group Chemical group 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- XBJGXLGXTOGYOG-UHFFFAOYSA-N 2-(2-butoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCCCOC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 XBJGXLGXTOGYOG-UHFFFAOYSA-N 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 claims description 5
- FPZWZCWUIYYYBU-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl acetate Chemical group CCOCCOCCOC(C)=O FPZWZCWUIYYYBU-UHFFFAOYSA-N 0.000 claims description 4
- JRTZVAGRLSVETB-UHFFFAOYSA-N 2-butyl-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CCCC)=NC2=C1 JRTZVAGRLSVETB-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 235000019270 ammonium chloride Nutrition 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 150000003840 hydrochlorides Chemical class 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- AHYZGEVNXOQPKS-UHFFFAOYSA-N 2-(2-butan-2-yloxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCC(C)OC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 AHYZGEVNXOQPKS-UHFFFAOYSA-N 0.000 claims description 2
- ZXRVKZHFUQXZJT-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 ZXRVKZHFUQXZJT-UHFFFAOYSA-N 0.000 claims description 2
- QHHFAUKDTXEAJA-UHFFFAOYSA-N 2-(2-hydroxypropyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CC(O)C)=NC2=C1 QHHFAUKDTXEAJA-UHFFFAOYSA-N 0.000 claims description 2
- IHRHRYHHABCOBI-UHFFFAOYSA-N 2-(2-methoxy-4-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC(C)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 IHRHRYHHABCOBI-UHFFFAOYSA-N 0.000 claims description 2
- RTOFVUHSDGCCPH-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=C(C)C=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 RTOFVUHSDGCCPH-UHFFFAOYSA-N 0.000 claims description 2
- YHEZGYVGOLJOOB-UHFFFAOYSA-N 2-(2-propan-2-yloxyphenyl)-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound CC(C)OC1=CC=CC=C1C1=NC2=CC=C(C=3NN=NN=3)C=C2C(=O)N1 YHEZGYVGOLJOOB-UHFFFAOYSA-N 0.000 claims description 2
- DUWXNJQNUJCKCK-UHFFFAOYSA-N 2-(4-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=CC(C)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 DUWXNJQNUJCKCK-UHFFFAOYSA-N 0.000 claims description 2
- YPVURATXQOTBCJ-UHFFFAOYSA-N 2-heptyl-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CCCCCCC)=NC2=C1 YPVURATXQOTBCJ-UHFFFAOYSA-N 0.000 claims description 2
- PJLIFUWSOQOWRB-UHFFFAOYSA-N 2-hexyl-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CCCCCC)=NC2=C1 PJLIFUWSOQOWRB-UHFFFAOYSA-N 0.000 claims description 2
- VMIAQGKCNVCJFA-UHFFFAOYSA-N 2-nonyl-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CCCCCCCCC)=NC2=C1 VMIAQGKCNVCJFA-UHFFFAOYSA-N 0.000 claims description 2
- HFIKTHFMZWBVEB-UHFFFAOYSA-N 4-oxo-2-(4-propan-2-ylphenyl)-1h-quinazoline-6-carboxylic acid Chemical compound C1=CC(C(C)C)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 HFIKTHFMZWBVEB-UHFFFAOYSA-N 0.000 claims description 2
- LVBBTCLWVCPTBQ-UHFFFAOYSA-N 4-oxo-2-pentyl-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CCCCC)=NC2=C1 LVBBTCLWVCPTBQ-UHFFFAOYSA-N 0.000 claims description 2
- BXEGIORFMUZFIB-UHFFFAOYSA-N 4-oxo-2-propan-2-yl-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(C(C)C)=NC2=C1 BXEGIORFMUZFIB-UHFFFAOYSA-N 0.000 claims description 2
- UXKQENGEJDZCLH-UHFFFAOYSA-N 4-oxo-2-propyl-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CCC)=NC2=C1 UXKQENGEJDZCLH-UHFFFAOYSA-N 0.000 claims description 2
- KICPYUPTIAQUNK-UHFFFAOYSA-N 4-oxo-2-undecyl-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CCCCCCCCCCC)=NC2=C1 KICPYUPTIAQUNK-UHFFFAOYSA-N 0.000 claims description 2
- 101100295738 Gallus gallus COR3 gene Proteins 0.000 claims description 2
- 230000032050 esterification Effects 0.000 claims description 2
- 238000005886 esterification reaction Methods 0.000 claims description 2
- LJJVZJSGXHJIPP-UHFFFAOYSA-N ethylpentyl Chemical group [CH2+]CCC[CH]C[CH2-] LJJVZJSGXHJIPP-UHFFFAOYSA-N 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- 229940071870 hydroiodic acid Drugs 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 claims description 2
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 claims 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 2
- ZRIITLLYNBGVTH-UHFFFAOYSA-N 2-(2,6-dimethoxyphenyl)-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound COC1=CC=CC(OC)=C1C1=NC2=CC=C(C=3NN=NN=3)C=C2C(=O)N1 ZRIITLLYNBGVTH-UHFFFAOYSA-N 0.000 claims 1
- BUOUSDQKMRSTBO-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound CCOC1=CC=CC=C1C1=NC2=CC=C(C=3NN=NN=3)C=C2C(=O)N1 BUOUSDQKMRSTBO-UHFFFAOYSA-N 0.000 claims 1
- OVIXDENCJVTYMJ-UHFFFAOYSA-N 2-(2-methoxy-4-methylphenyl)-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound COC1=CC(C)=CC=C1C1=NC(=O)C2=CC(C3=NNN=N3)=CC=C2N1 OVIXDENCJVTYMJ-UHFFFAOYSA-N 0.000 claims 1
- PZAPCOIYFGIQGW-UHFFFAOYSA-N 2-[4-(2-ethoxyethoxy)phenyl]-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=CC(OCCOCC)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 PZAPCOIYFGIQGW-UHFFFAOYSA-N 0.000 claims 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims 1
- CRYYRHCULCAQMZ-UHFFFAOYSA-N 4-oxo-2-(2-propoxyphenyl)-1h-quinazoline-6-carboxylic acid Chemical compound CCCOC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 CRYYRHCULCAQMZ-UHFFFAOYSA-N 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 230000008030 elimination Effects 0.000 claims 1
- 238000003379 elimination reaction Methods 0.000 claims 1
- 238000006266 etherification reaction Methods 0.000 claims 1
- 239000012458 free base Substances 0.000 claims 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 47
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 28
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 238000001816 cooling Methods 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 230000007935 neutral effect Effects 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000010790 dilution Methods 0.000 description 12
- 239000012895 dilution Substances 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 11
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 230000003266 anti-allergic effect Effects 0.000 description 8
- 230000020477 pH reduction Effects 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- DIVIKOUNIUHIRV-UHFFFAOYSA-N 2-(2-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 DIVIKOUNIUHIRV-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000007865 diluting Methods 0.000 description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 4
- DZCBKUAAGVVLOX-UHFFFAOYSA-N 1-morpholin-4-ylethanol Chemical compound CC(O)N1CCOCC1 DZCBKUAAGVVLOX-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- XGYFVDSEJARAEA-UHFFFAOYSA-N 2-(2,3-diethoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=CC=CC(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1OCC XGYFVDSEJARAEA-UHFFFAOYSA-N 0.000 description 2
- PEVAIZIFXLHRJX-UHFFFAOYSA-N 2-(2-ethoxy-3-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=C(OC)C=CC=C1C1=NC(=O)C2=CC(C(O)=O)=CC=C2N1 PEVAIZIFXLHRJX-UHFFFAOYSA-N 0.000 description 2
- DHGIEFBQANMQEL-UHFFFAOYSA-N 2-(2-ethoxy-5-ethylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=CC=C(CC)C=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 DHGIEFBQANMQEL-UHFFFAOYSA-N 0.000 description 2
- FKBAPDCFZRVMEI-UHFFFAOYSA-N 2-(2-ethoxy-5-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=CC=C(OC)C=C1C1=NC(=O)C2=CC(C(O)=O)=CC=C2N1 FKBAPDCFZRVMEI-UHFFFAOYSA-N 0.000 description 2
- SHFQZXXHZUEBSW-UHFFFAOYSA-N 2-(diethylamino)ethyl 2-(2-ethoxy-3-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylate Chemical compound CCOC1=C(OC)C=CC=C1C1=NC2=CC=C(C(=O)OCCN(CC)CC)C=C2C(=O)N1 SHFQZXXHZUEBSW-UHFFFAOYSA-N 0.000 description 2
- FVJDSSPVRCEOGJ-UHFFFAOYSA-N 2-[2-(2-ethoxyethoxy)phenyl]-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOCCOC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 FVJDSSPVRCEOGJ-UHFFFAOYSA-N 0.000 description 2
- XIGSLVIYSSSYNA-UHFFFAOYSA-N 2-amino-5-methoxycarbonylbenzoic acid Chemical compound COC(=O)C1=CC=C(N)C(C(O)=O)=C1 XIGSLVIYSSSYNA-UHFFFAOYSA-N 0.000 description 2
- BDBLLWHZWCBDAR-UHFFFAOYSA-N 4-aminobenzene-1,3-dicarboxylic acid Chemical compound NC1=CC=C(C(O)=O)C=C1C(O)=O BDBLLWHZWCBDAR-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 206010002198 Anaphylactic reaction Diseases 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 230000036783 anaphylactic response Effects 0.000 description 2
- 208000003455 anaphylaxis Diseases 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- QWENMFNFBJHLTE-UHFFFAOYSA-N dimethyl 4-aminobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=C(N)C(C(=O)OC)=C1 QWENMFNFBJHLTE-UHFFFAOYSA-N 0.000 description 2
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 2
- XBRDBODLCHKXHI-UHFFFAOYSA-N epolamine Chemical compound OCCN1CCCC1 XBRDBODLCHKXHI-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- MCQOVGJGDSIYRI-UHFFFAOYSA-N methyl 4-amino-3-carbamoylbenzoate Chemical compound COC(=O)C1=CC=C(N)C(C(N)=O)=C1 MCQOVGJGDSIYRI-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- LGACUMPRRMLUFZ-UHFFFAOYSA-N 1,4-dihydroquinazoline Chemical class C1=CC=C2CN=CNC2=C1 LGACUMPRRMLUFZ-UHFFFAOYSA-N 0.000 description 1
- KEVKXUZQHIMSCM-UHFFFAOYSA-N 1-pyrrolidin-1-ylethanol Chemical class CC(O)N1CCCC1 KEVKXUZQHIMSCM-UHFFFAOYSA-N 0.000 description 1
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical group COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 1
- OLBGRIGKTNLSCC-UHFFFAOYSA-N 2-(2,2-dimethylpropyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CC(C)(C)C)=NC2=C1 OLBGRIGKTNLSCC-UHFFFAOYSA-N 0.000 description 1
- KVAHIUQNAMUQKY-UHFFFAOYSA-N 2-(2,3-dimethoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=CC(C=2NC3=CC=C(C=C3C(=O)N=2)C(O)=O)=C1OC KVAHIUQNAMUQKY-UHFFFAOYSA-N 0.000 description 1
- GAWJGOVTLYVFOX-UHFFFAOYSA-N 2-(2,4-dimethoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC(OC)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 GAWJGOVTLYVFOX-UHFFFAOYSA-N 0.000 description 1
- HQTVHCVCHMATAT-UHFFFAOYSA-N 2-(2,5-diethoxyphenyl)-4-oxo-3H-quinazoline-6-carboxylic acid Chemical compound C(=O)(O)C=1C=C2C(NC(=NC2=CC1)C1=C(C=CC(=C1)OCC)OCC)=O HQTVHCVCHMATAT-UHFFFAOYSA-N 0.000 description 1
- MQELNKOVNOAFBP-UHFFFAOYSA-N 2-(2,5-dimethoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=C(OC)C(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1 MQELNKOVNOAFBP-UHFFFAOYSA-N 0.000 description 1
- MPTCDMDURDBCRG-UHFFFAOYSA-N 2-(2-butoxy-4-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCCCOC1=CC(C)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 MPTCDMDURDBCRG-UHFFFAOYSA-N 0.000 description 1
- IPBISMOAWWNTOB-UHFFFAOYSA-N 2-(2-butoxy-5-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCCCOC1=CC=C(C)C=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 IPBISMOAWWNTOB-UHFFFAOYSA-N 0.000 description 1
- QAPQUDHHMAHZNO-UHFFFAOYSA-N 2-(2-chlorophenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound N1C(=O)C2=CC(C(=O)O)=CC=C2N=C1C1=CC=CC=C1Cl QAPQUDHHMAHZNO-UHFFFAOYSA-N 0.000 description 1
- OEIAFUYILCEEAR-UHFFFAOYSA-N 2-(2-ethoxy-3-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=C(C)C=CC=C1C1=NC(=O)C2=CC(C(O)=O)=CC=C2N1 OEIAFUYILCEEAR-UHFFFAOYSA-N 0.000 description 1
- NFWHUBUSZSSERF-UHFFFAOYSA-N 2-(2-ethoxy-5-ethyl-3-methylphenyl)-4-oxo-3H-quinazoline-6-carboxylic acid Chemical compound C(=O)(O)C=1C=C2C(NC(=NC2=CC=1)C1=C(C(=CC(=C1)CC)C)OCC)=O NFWHUBUSZSSERF-UHFFFAOYSA-N 0.000 description 1
- NATQXYIQLWLYLX-UHFFFAOYSA-N 2-(2-ethoxy-5-methoxyphenyl)-6-(2H-tetrazol-5-yl)-3H-quinazolin-4-one Chemical compound N1N=NN=C1C=1C=C2C(NC(=NC2=CC=1)C1=C(C=CC(=C1)OC)OCC)=O NATQXYIQLWLYLX-UHFFFAOYSA-N 0.000 description 1
- OXZHIQRYNBGNDU-UHFFFAOYSA-N 2-(2-ethoxy-5-propoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCCOC1=CC=C(OCC)C(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1 OXZHIQRYNBGNDU-UHFFFAOYSA-N 0.000 description 1
- XFFDEIWRPLFUNI-UHFFFAOYSA-N 2-(2-ethoxy-5-propylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCCC1=CC=C(OCC)C(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1 XFFDEIWRPLFUNI-UHFFFAOYSA-N 0.000 description 1
- TXGHZYNJXCGBTE-UHFFFAOYSA-N 2-(2-fluorophenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound N1C(=O)C2=CC(C(=O)O)=CC=C2N=C1C1=CC=CC=C1F TXGHZYNJXCGBTE-UHFFFAOYSA-N 0.000 description 1
- JRHNVRUNYKAHJB-UHFFFAOYSA-N 2-(2-hexoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCCCCCOC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 JRHNVRUNYKAHJB-UHFFFAOYSA-N 0.000 description 1
- UDFXREXLEZEPQK-UHFFFAOYSA-N 2-(2-methoxy-3-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=C(C)C=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 UDFXREXLEZEPQK-UHFFFAOYSA-N 0.000 description 1
- PBSJRTSWRUGRRQ-UHFFFAOYSA-N 2-(2-methoxy-5-propoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCCOC1=CC=C(OC)C(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1 PBSJRTSWRUGRRQ-UHFFFAOYSA-N 0.000 description 1
- RRFDRFLPGPGHNK-UHFFFAOYSA-N 2-(2-methoxy-5-sulfamoylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=C(S(N)(=O)=O)C=C1C1=NC(=O)C2=CC(C(O)=O)=CC=C2N1 RRFDRFLPGPGHNK-UHFFFAOYSA-N 0.000 description 1
- PPHKTULEAJOYAV-UHFFFAOYSA-N 2-(2-methoxypropyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CC(C)OC)=NC2=C1 PPHKTULEAJOYAV-UHFFFAOYSA-N 0.000 description 1
- ONAPCUGRZZXDBX-UHFFFAOYSA-N 2-(2-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CC1=CC=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 ONAPCUGRZZXDBX-UHFFFAOYSA-N 0.000 description 1
- BBIDMPJPQGSHIH-UHFFFAOYSA-N 2-(2-methylpropyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)NC(CC(C)C)=NC2=C1 BBIDMPJPQGSHIH-UHFFFAOYSA-N 0.000 description 1
- ZTHNOWKBHIIZIW-UHFFFAOYSA-N 2-(2-methylpropyl)-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(CC(C)C)=NC2=CC=C1C1=NN=NN1 ZTHNOWKBHIIZIW-UHFFFAOYSA-N 0.000 description 1
- FPNTYXIGGFYKOP-UHFFFAOYSA-N 2-(3-chlorophenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound N1C(=O)C2=CC(C(=O)O)=CC=C2N=C1C1=CC=CC(Cl)=C1 FPNTYXIGGFYKOP-UHFFFAOYSA-N 0.000 description 1
- BHRUMQDDJVUYIY-UHFFFAOYSA-N 2-(3-ethoxy-2-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=CC=CC(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1OC BHRUMQDDJVUYIY-UHFFFAOYSA-N 0.000 description 1
- RHHNYKGGJKZIPF-UHFFFAOYSA-N 2-(3-ethoxypyridin-2-yl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=CC=CN=C1C1=NC(=O)C2=CC(C(O)=O)=CC=C2N1 RHHNYKGGJKZIPF-UHFFFAOYSA-N 0.000 description 1
- HREZROOJZNWWFG-UHFFFAOYSA-N 2-(3-fluorophenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound N1C(=O)C2=CC(C(=O)O)=CC=C2N=C1C1=CC=CC(F)=C1 HREZROOJZNWWFG-UHFFFAOYSA-N 0.000 description 1
- SOJCMYXJILZQHA-UHFFFAOYSA-N 2-(3-methoxy-2-propan-2-yloxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=CC(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1OC(C)C SOJCMYXJILZQHA-UHFFFAOYSA-N 0.000 description 1
- ICZJHHJACYYAKZ-UHFFFAOYSA-N 2-(3-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=CC(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1 ICZJHHJACYYAKZ-UHFFFAOYSA-N 0.000 description 1
- PQDAGFUMHYZINZ-UHFFFAOYSA-N 2-(3-methylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CC1=CC=CC(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1 PQDAGFUMHYZINZ-UHFFFAOYSA-N 0.000 description 1
- IFNZCAHJMCYSDH-UHFFFAOYSA-N 2-(4-fluorophenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound N1C(=O)C2=CC(C(=O)O)=CC=C2N=C1C1=CC=C(F)C=C1 IFNZCAHJMCYSDH-UHFFFAOYSA-N 0.000 description 1
- HUIYIYCOQLXWCJ-UHFFFAOYSA-N 2-(4-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=CC(OC)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 HUIYIYCOQLXWCJ-UHFFFAOYSA-N 0.000 description 1
- XGMPTUIQDAFQJS-UHFFFAOYSA-N 2-(4-methyl-2-propan-2-yloxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CC(C)OC1=CC(C)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 XGMPTUIQDAFQJS-UHFFFAOYSA-N 0.000 description 1
- BATBBZNEIKXFAA-UHFFFAOYSA-N 2-(4-tert-butylphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound C1=CC(C(C)(C)C)=CC=C1C1=NC(=O)C2=CC(C(O)=O)=CC=C2N1 BATBBZNEIKXFAA-UHFFFAOYSA-N 0.000 description 1
- UGEMUQJMLZESEZ-UHFFFAOYSA-N 2-(5-ethoxy-2-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CCOC1=CC=C(OC)C(C=2NC(=O)C3=CC(=CC=C3N=2)C(O)=O)=C1 UGEMUQJMLZESEZ-UHFFFAOYSA-N 0.000 description 1
- CXSWCVUYMQLAHC-UHFFFAOYSA-N 2-(5-fluoro-2-methoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound COC1=CC=C(F)C=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 CXSWCVUYMQLAHC-UHFFFAOYSA-N 0.000 description 1
- VYCVXHBRMPWQOO-UHFFFAOYSA-N 2-(5-methyl-2-propan-2-yloxyphenyl)-4-oxo-1h-quinazoline-6-carboxylic acid Chemical compound CC(C)OC1=CC=C(C)C=C1C1=NC2=CC=C(C(O)=O)C=C2C(=O)N1 VYCVXHBRMPWQOO-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- JSRJZAAIPDFZPS-UHFFFAOYSA-N 2-butyl-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C=1C=C2NC(CCCC)=NC(=O)C2=CC=1C1=NN=NN1 JSRJZAAIPDFZPS-UHFFFAOYSA-N 0.000 description 1
- QNWBKBUDIBNWER-UHFFFAOYSA-N 2-ethoxy-3-methoxybenzoyl chloride Chemical compound CCOC1=C(OC)C=CC=C1C(Cl)=O QNWBKBUDIBNWER-UHFFFAOYSA-N 0.000 description 1
- ZKYHQOLHXLHCHT-UHFFFAOYSA-N 2-ethoxy-3-methylbenzoyl chloride Chemical compound CCOC1=C(C)C=CC=C1C(Cl)=O ZKYHQOLHXLHCHT-UHFFFAOYSA-N 0.000 description 1
- NHHNHCVYWNRVBO-UHFFFAOYSA-N 2-ethoxy-5-ethyl-3-methylbenzoyl chloride Chemical compound C(C)OC1=C(C(=O)Cl)C=C(C=C1C)CC NHHNHCVYWNRVBO-UHFFFAOYSA-N 0.000 description 1
- GPHGYTSOMUWVPI-UHFFFAOYSA-N 2-heptyl-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(CCCCCCC)=NC2=CC=C1C1=NN=NN1 GPHGYTSOMUWVPI-UHFFFAOYSA-N 0.000 description 1
- FVOUMTNFGHLBLI-UHFFFAOYSA-N 2-hexyl-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(CCCCCC)=NC2=CC=C1C1=NN=NN1 FVOUMTNFGHLBLI-UHFFFAOYSA-N 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- NHBWXAABJXMQRV-UHFFFAOYSA-N 2-nonyl-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(CCCCCCCCC)=NC2=CC=C1C1=NN=NN1 NHBWXAABJXMQRV-UHFFFAOYSA-N 0.000 description 1
- KNYNFEZICWZKPD-UHFFFAOYSA-N 2-pentyl-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(CCCCC)=NC2=CC=C1C1=NN=NN1 KNYNFEZICWZKPD-UHFFFAOYSA-N 0.000 description 1
- VFSGKYDSWVLJQM-UHFFFAOYSA-N 2-propan-2-yl-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(C(C)C)=NC2=CC=C1C1=NN=NN1 VFSGKYDSWVLJQM-UHFFFAOYSA-N 0.000 description 1
- CIYMDTDRZWFTTL-UHFFFAOYSA-N 2-propan-2-yloxybenzoyl chloride Chemical compound CC(C)OC1=CC=CC=C1C(Cl)=O CIYMDTDRZWFTTL-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- REEFCSNIARXYBO-UHFFFAOYSA-N 2-propyl-6-(2h-tetrazol-5-yl)-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(CCC)=NC2=CC=C1C1=NN=NN1 REEFCSNIARXYBO-UHFFFAOYSA-N 0.000 description 1
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical class NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- UPMNBYAMLYNZQO-UHFFFAOYSA-N 4-(hexanoylamino)benzene-1,3-dicarboxylic acid Chemical compound CCCCCC(=O)NC1=CC=C(C(O)=O)C=C1C(O)=O UPMNBYAMLYNZQO-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- DRMDSDYOOWHMQW-UHFFFAOYSA-N 4-oxo-2-(2-propan-2-yloxyphenyl)-1h-quinazoline-6-carbonyl chloride Chemical compound CC(C)OC1=CC=CC=C1C1=NC2=CC=C(C(Cl)=O)C=C2C(=O)N1 DRMDSDYOOWHMQW-UHFFFAOYSA-N 0.000 description 1
- PCPTVFYFYKQHJI-UHFFFAOYSA-N 6-(2h-tetrazol-5-yl)-2-undecyl-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC(CCCCCCCCCCC)=NC2=CC=C1C1=NN=NN1 PCPTVFYFYKQHJI-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RZZPDXZPRHQOCG-OJAKKHQRSA-O CDP-choline(1+) Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC[N+](C)(C)C)O[C@H]1N1C(=O)N=C(N)C=C1 RZZPDXZPRHQOCG-OJAKKHQRSA-O 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical class CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- ZQUASSVEPRAJBX-UHFFFAOYSA-N ethyl 2-(2-butoxyphenyl)-4-oxo-1h-quinazoline-6-carboxylate Chemical compound CCCCOC1=CC=CC=C1C1=NC2=CC=C(C(=O)OCC)C=C2C(=O)N1 ZQUASSVEPRAJBX-UHFFFAOYSA-N 0.000 description 1
- MASXVERUYSGERV-UHFFFAOYSA-N ethyl 2-[2-(2-ethoxyethoxy)phenyl]-4-oxo-1h-quinazoline-6-carboxylate Chemical compound CCOCCOC1=CC=CC=C1C1=NC2=CC=C(C(=O)OCC)C=C2C(=O)N1 MASXVERUYSGERV-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 150000002221 fluorine Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229920000591 gum Polymers 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- DJUJUCBZYKEEQK-UHFFFAOYSA-N methyl 2,4-dioxo-1h-3,1-benzoxazine-6-carboxylate Chemical compound N1C(=O)OC(=O)C2=CC(C(=O)OC)=CC=C21 DJUJUCBZYKEEQK-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical compound C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229950008882 polysorbate Drugs 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 238000009495 sugar coating Methods 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/91—Oxygen atoms with aryl or aralkyl radicals attached in position 2 or 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/90—Oxygen atoms with acyclic radicals attached in position 2 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/93—Sulfur atoms
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pulmonology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Immunology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT29998/75A IT1050750B (it) | 1975-12-05 | 1975-12-05 | Derivati della 3.4 di idro chinazolina |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626073A5 true CH626073A5 (cg-RX-API-DMAC10.html) | 1981-10-30 |
Family
ID=11228830
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1527276A CH626073A5 (cg-RX-API-DMAC10.html) | 1975-12-05 | 1976-12-03 | |
| CH885580A CH626075A5 (cg-RX-API-DMAC10.html) | 1975-12-05 | 1980-11-28 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH885580A CH626075A5 (cg-RX-API-DMAC10.html) | 1975-12-05 | 1980-11-28 |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4251531A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5271485A (cg-RX-API-DMAC10.html) |
| AT (1) | AT355029B (cg-RX-API-DMAC10.html) |
| AU (1) | AU505660B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE848696A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1084051A (cg-RX-API-DMAC10.html) |
| CH (2) | CH626073A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS194786B2 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2654215A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK147855C (cg-RX-API-DMAC10.html) |
| FI (1) | FI64359C (cg-RX-API-DMAC10.html) |
| FR (1) | FR2333511A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1523081A (cg-RX-API-DMAC10.html) |
| HU (1) | HU177817B (cg-RX-API-DMAC10.html) |
| IL (1) | IL50849A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1050750B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7613450A (cg-RX-API-DMAC10.html) |
| NO (1) | NO146095C (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ182778A (cg-RX-API-DMAC10.html) |
| SE (1) | SE7613588L (cg-RX-API-DMAC10.html) |
| SU (1) | SU786894A3 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA766745B (cg-RX-API-DMAC10.html) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4419357A (en) | 1982-01-18 | 1983-12-06 | The Dow Chemical Company | 3-(1H-Tetrazol-5-yl)-4(3H)-quinazolinones |
| IL69274A (en) * | 1982-08-05 | 1986-08-31 | Erba Farmitalia | (substituted amino)derivatives of 3-benzylidene-pyrrolo(2,1-b)quinazolin-9-ones and 6-benzylidene-pyrido(2,1-b)quinazolin-11-ones,their preparation and pharmaceutical compositions containing them |
| US4666913A (en) * | 1985-11-22 | 1987-05-19 | William H. Rorer, Inc. | Hydroxy and aminothiazolyl-benzodiazinone compounds, cardiotonic compositions including the same, and their uses |
| GB8827988D0 (en) * | 1988-11-30 | 1989-01-05 | Smith Kline French Lab | Chemical compounds |
| US5430148A (en) * | 1992-03-31 | 1995-07-04 | Agouron Pharmaceuticals, Inc. | Antiproliferative quinazolines |
| US6632961B1 (en) * | 1998-05-22 | 2003-10-14 | Abbott Laboratories | Antiangiogenic drug to treat cancer, arthritis and retinopathy |
| JP4554816B2 (ja) * | 1998-05-22 | 2010-09-29 | アボット・ラボラトリーズ | ガン、関節炎および網膜症を処置するための抗血管形成薬 |
| CO5170498A1 (es) * | 1999-05-28 | 2002-06-27 | Abbott Lab | Biaril sulfonamidas son utiles como inhibidores de proliferacion celular |
| CA2444704C (en) * | 2001-04-23 | 2012-07-10 | University Of Virginia Patent Foundation | Synthesis and evaluation of phthalimide mimics as anti-angiogenic agents |
| NZ543636A (en) * | 2003-06-06 | 2009-07-31 | Arexis Ab | Use of fused heterocyclic compounds as SCCE inhibitors for the treatment of skin conditions or cancer |
| CN100518740C (zh) * | 2003-06-06 | 2009-07-29 | 阿里克斯股份公司 | 杂环化合物作为scce抑制剂的制药用途 |
| AU2007282678B2 (en) * | 2006-08-08 | 2012-09-27 | Aska Pharmaceutical Co., Ltd. | Quinazoline derivative |
| CN101641339B (zh) | 2007-02-01 | 2013-07-17 | 雷斯韦洛吉克斯公司 | 用于预防和治疗心血管疾病的化合物 |
| AU2010224523B2 (en) | 2009-03-18 | 2014-05-08 | Resverlogix Corp. | Novel anti-inflammatory agents |
| MX374414B (es) | 2009-04-22 | 2025-03-06 | Resverlogix Corp | Nuevos agentes anti-inflamatorios. |
| CN107530356A (zh) | 2015-03-13 | 2018-01-02 | 雷斯韦洛吉克斯公司 | 用于治疗补体相关疾病之组合物及治疗方法 |
| GB201510254D0 (en) * | 2015-06-12 | 2015-07-29 | Syngenta Participations Ag | Improvements in or relating to organic compounds |
| JP7427252B2 (ja) * | 2018-06-27 | 2024-02-05 | 株式会社リボルナバイオサイエンス | 脊髄性筋萎縮症の予防または治療剤 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3696102A (en) * | 1970-03-09 | 1972-10-03 | Pfizer & Co C | Process for the synthesis of substituted quinazolin-4-ones |
| GB1301319A (cg-RX-API-DMAC10.html) | 1970-07-13 | 1972-12-29 |
-
1975
- 1975-12-05 IT IT29998/75A patent/IT1050750B/it active
-
1976
- 1976-11-02 US US05/738,221 patent/US4251531A/en not_active Expired - Lifetime
- 1976-11-04 IL IL50849A patent/IL50849A/xx unknown
- 1976-11-10 ZA ZA766745A patent/ZA766745B/xx unknown
- 1976-11-10 AU AU19472/76A patent/AU505660B2/en not_active Expired
- 1976-11-24 BE BE172653A patent/BE848696A/xx not_active IP Right Cessation
- 1976-11-25 FI FI763391A patent/FI64359C/fi not_active IP Right Cessation
- 1976-11-30 DE DE19762654215 patent/DE2654215A1/de not_active Withdrawn
- 1976-12-01 GB GB50164/76A patent/GB1523081A/en not_active Expired
- 1976-12-01 NZ NZ182778A patent/NZ182778A/xx unknown
- 1976-12-02 NL NL7613450A patent/NL7613450A/xx not_active Application Discontinuation
- 1976-12-02 FR FR7636343A patent/FR2333511A1/fr active Granted
- 1976-12-02 AT AT894376A patent/AT355029B/de not_active IP Right Cessation
- 1976-12-03 HU HU76EA167A patent/HU177817B/hu unknown
- 1976-12-03 SU SU762426155A patent/SU786894A3/ru active
- 1976-12-03 CA CA267,090A patent/CA1084051A/en not_active Expired
- 1976-12-03 SE SE7613588A patent/SE7613588L/xx not_active Application Discontinuation
- 1976-12-03 DK DK546776A patent/DK147855C/da not_active IP Right Cessation
- 1976-12-03 NO NO764135A patent/NO146095C/no unknown
- 1976-12-03 CS CS767886A patent/CS194786B2/cs unknown
- 1976-12-03 CH CH1527276A patent/CH626073A5/de not_active IP Right Cessation
- 1976-12-06 JP JP51146444A patent/JPS5271485A/ja active Granted
-
1980
- 1980-11-28 CH CH885580A patent/CH626075A5/de not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH626073A5 (cg-RX-API-DMAC10.html) | ||
| FI77455C (fi) | Foerfarande foer framstaellning av antihypertensiva 2,4-diaminokinazolinfoereningar. | |
| DE69530989T2 (de) | Neue pyrimidinderivate und verfahren zu ihrer herstellung | |
| US4159330A (en) | 2-Disubstituted phenyl-3,4-dihydro-4-oxo-quinazoline derivatives and process for their preparation | |
| DE2157424A1 (de) | N,n'-disubstituierte cyclische diamine und verfahren zu deren herstellung | |
| DE2557342A1 (de) | Basisch substituierte indolderivate und verfahren zu ihrer herstellung | |
| CH623581A5 (cg-RX-API-DMAC10.html) | ||
| EP0011142B1 (de) | Pyrido (2,1-b) chinazolinon-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
| CH638799A5 (de) | 2h-benzofuran-3-on-derivate sowie ein verfahren zu deren herstellung und solche verbindungen enthaltende pharmazeutische praeparate. | |
| EP0023343A2 (de) | Substituierte 3-Amino-sydnonimine, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
| DE3633977A1 (de) | Tetrahydrochinolinderivate, ein verfahren zu ihrer herstellung, ihre verwendung und sie enthaltende pharmazeutische zubereitungen | |
| DE3715779A1 (de) | Flavon-3-carbonsaeure-verbindungen sowie verfahren, zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3442860A1 (de) | 5-alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3- on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| AT371461B (de) | Verfahren zur herstellung neuer benzopyranderivate und deren salze | |
| CH647777A5 (de) | Substituierte pyrido-(1,2-a)-pyrimidine. | |
| EP0072960B1 (de) | 1,5-Diphenylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH616934A5 (en) | Process for the preparation of chromone derivatives | |
| DE2832358C2 (cg-RX-API-DMAC10.html) | ||
| CH638516A5 (en) | Process for preparing substituted aminoquinazoline derivatives | |
| DE2755716A1 (de) | 2-disubstituierte phenyl-3,4- dihydro-4-oxo-chinazolin-derivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE1950990A1 (de) | Verfahren zur Herstellung von neuen triazacyclischen Verbindungen | |
| CH634315A5 (de) | Verfahren zur herstellung von substituierten 2-vinylchromonen. | |
| US3974161A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
| US3956343A (en) | Novel 5-vinyl-3-isoxazolyl substituted pyridines | |
| WO1996002540A1 (de) | Heterocyclyl-1-phenyl substituierte chinoloncarbonsäuren als antivirale mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |