CA2352045A1 - Substituted benzo[de]isoquinoline-1,3-diones - Google Patents
Substituted benzo[de]isoquinoline-1,3-diones Download PDFInfo
- Publication number
- CA2352045A1 CA2352045A1 CA002352045A CA2352045A CA2352045A1 CA 2352045 A1 CA2352045 A1 CA 2352045A1 CA 002352045 A CA002352045 A CA 002352045A CA 2352045 A CA2352045 A CA 2352045A CA 2352045 A1 CA2352045 A1 CA 2352045A1
- Authority
- CA
- Canada
- Prior art keywords
- chz
- conh
- nhz
- phenyl
- benzo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- XJHABGPPCLHLLV-UHFFFAOYSA-N benzo[de]isoquinoline-1,3-dione Chemical class C1=CC(C(=O)NC2=O)=C3C2=CC=CC3=C1 XJHABGPPCLHLLV-UHFFFAOYSA-N 0.000 title description 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 148
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 239000012453 solvate Substances 0.000 claims abstract description 17
- 239000005557 antagonist Substances 0.000 claims abstract description 8
- 102000003886 Glycoproteins Human genes 0.000 claims abstract description 6
- 108090000288 Glycoproteins Proteins 0.000 claims abstract description 6
- -1 pyrazol-4-yl Chemical group 0.000 claims description 309
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 152
- 238000006243 chemical reaction Methods 0.000 claims description 35
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 29
- 229910052717 sulfur Inorganic materials 0.000 claims description 29
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 25
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 14
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 208000007536 Thrombosis Diseases 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 10
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 9
- 229940080818 propionamide Drugs 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 9
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 8
- 239000003814 drug Substances 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 6
- 208000035475 disorder Diseases 0.000 claims description 6
- 235000010290 biphenyl Nutrition 0.000 claims description 5
- 125000004957 naphthylene group Chemical group 0.000 claims description 5
- VKHWCSUSDNUMGL-UHFFFAOYSA-N 6-(3-aminopropylamino)-2-(4-carbazol-9-ylphenyl)benzo[de]isoquinoline-1,3-dione Chemical compound C12=CC=CC=C2C2=CC=CC=C2N1C(C=C1)=CC=C1N(C1=O)C(=O)C2=CC=C(NCCCN)C3=C2C1=CC=C3 VKHWCSUSDNUMGL-UHFFFAOYSA-N 0.000 claims description 4
- ZEXVKHBNFJZYRP-UHFFFAOYSA-N 6-(3-aminopropylamino)-2-[4-(4-methoxyphenyl)phenyl]benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(OC)=CC=C1C1=CC=C(N2C(C=3C=CC(NCCCN)=C4C=CC=C(C=34)C2=O)=O)C=C1 ZEXVKHBNFJZYRP-UHFFFAOYSA-N 0.000 claims description 4
- 206010003210 Arteriosclerosis Diseases 0.000 claims description 4
- 238000006069 Suzuki reaction reaction Methods 0.000 claims description 4
- 208000011775 arteriosclerosis disease Diseases 0.000 claims description 4
- 239000004305 biphenyl Substances 0.000 claims description 4
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- 238000002560 therapeutic procedure Methods 0.000 claims description 4
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 claims description 3
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 3
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 3
- 208000004476 Acute Coronary Syndrome Diseases 0.000 claims description 3
- 206010002383 Angina Pectoris Diseases 0.000 claims description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 3
- 206010038563 Reocclusion Diseases 0.000 claims description 3
- 208000006011 Stroke Diseases 0.000 claims description 3
- 208000032109 Transient ischaemic attack Diseases 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 238000002399 angioplasty Methods 0.000 claims description 3
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 claims description 3
- 230000000181 anti-adherent effect Effects 0.000 claims description 3
- 150000001499 aryl bromides Chemical class 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 3
- 239000007943 implant Substances 0.000 claims description 3
- 238000002513 implantation Methods 0.000 claims description 3
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 208000010125 myocardial infarction Diseases 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 3
- 230000002093 peripheral effect Effects 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 238000011321 prophylaxis Methods 0.000 claims description 3
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 3
- 125000005493 quinolyl group Chemical group 0.000 claims description 3
- 208000037803 restenosis Diseases 0.000 claims description 3
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 3
- CHWFVJRKVULOKZ-UHFFFAOYSA-N 2-[[3-[[[2-[4-(4-methoxyphenyl)phenyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]amino]methyl]phenyl]methyl]guanidine Chemical compound C1=CC(OC)=CC=C1C1=CC=C(N2C(C=3C=CC(NCC=4C=C(CN=C(N)N)C=CC=4)=C4C=CC=C(C=34)C2=O)=O)C=C1 CHWFVJRKVULOKZ-UHFFFAOYSA-N 0.000 claims description 2
- JZLUZCGYTSGWFH-UHFFFAOYSA-N 3-[3-[6-[2-(diaminomethylideneamino)ethylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]-n-(4-phenylbutyl)propanamide Chemical compound O=C1C(C2=3)=CC=CC=3C(NCCN=C(N)N)=CC=C2C(=O)N1C(C=1)=CC=CC=1CCC(=O)NCCCCC1=CC=CC=C1 JZLUZCGYTSGWFH-UHFFFAOYSA-N 0.000 claims description 2
- IIJYGVDBNLSICR-UHFFFAOYSA-N 3-[3-[6-[[4-[(diaminomethylideneamino)methyl]phenyl]methylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]-n-[2-(4-sulfamoylphenyl)ethyl]propanamide Chemical compound C1=CC(CN=C(N)N)=CC=C1CNC1=CC=C2C3=C1C=CC=C3C(=O)N(C=1C=C(CCC(=O)NCCC=3C=CC(=CC=3)S(N)(=O)=O)C=CC=1)C2=O IIJYGVDBNLSICR-UHFFFAOYSA-N 0.000 claims description 2
- QNOKUJOULCMTPE-UHFFFAOYSA-N 6-(3-aminopropylamino)-2-(2,3-dimethoxyphenyl)benzo[de]isoquinoline-1,3-dione Chemical compound COC1=CC=CC(N2C(C=3C=CC(NCCCN)=C4C=CC=C(C=34)C2=O)=O)=C1OC QNOKUJOULCMTPE-UHFFFAOYSA-N 0.000 claims description 2
- VQXVNJFSQKAWNS-UHFFFAOYSA-N 6-(3-aminopropylamino)-2-(3,4,5-trimethoxyphenyl)benzo[de]isoquinoline-1,3-dione Chemical compound COC1=C(OC)C(OC)=CC(N2C(C=3C=CC(NCCCN)=C4C=CC=C(C=34)C2=O)=O)=C1 VQXVNJFSQKAWNS-UHFFFAOYSA-N 0.000 claims description 2
- LCJLRTACSNAUGF-UHFFFAOYSA-N 6-(3-aminopropylamino)-2-(7-hydroxynaphthalen-1-yl)benzo[de]isoquinoline-1,3-dione Chemical compound C1=C(O)C=C2C(N3C(=O)C4=CC=C(C=5C=CC=C(C4=5)C3=O)NCCCN)=CC=CC2=C1 LCJLRTACSNAUGF-UHFFFAOYSA-N 0.000 claims description 2
- RZUMCJLNXRHEMC-UHFFFAOYSA-N NCCCNC1=CC=C2C3=C1C(N(C(C3=CC=C2)=O)C2=C(C(=CC=C2C#N)OC)OC)=O Chemical compound NCCCNC1=CC=C2C3=C1C(N(C(C3=CC=C2)=O)C2=C(C(=CC=C2C#N)OC)OC)=O RZUMCJLNXRHEMC-UHFFFAOYSA-N 0.000 claims description 2
- LFSSPMJJZJBEHV-UHFFFAOYSA-N NCCCNC=1C=CC=2C(N(C(C3=CC=CC=1C=23)=O)C1=CC(=C(C=C1)C1=CC=C(C=C1)O)C)=O Chemical compound NCCCNC=1C=CC=2C(N(C(C3=CC=CC=1C=23)=O)C1=CC(=C(C=C1)C1=CC=C(C=C1)O)C)=O LFSSPMJJZJBEHV-UHFFFAOYSA-N 0.000 claims description 2
- 230000002152 alkylating effect Effects 0.000 claims description 2
- 125000005620 boronic acid group Chemical class 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims description 2
- 238000010168 coupling process Methods 0.000 claims description 2
- 238000005859 coupling reaction Methods 0.000 claims description 2
- 238000005661 deetherification reaction Methods 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- MTJKHMLLZIZOFC-UHFFFAOYSA-N n-[2-(3-chlorophenyl)ethyl]-3-[3-[6-[[4-[(diaminomethylideneamino)methyl]cyclohexyl]methylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]propanamide Chemical compound C1CC(CN=C(N)N)CCC1CNC1=CC=C2C3=C1C=CC=C3C(=O)N(C=1C=C(CCC(=O)NCCC=3C=C(Cl)C=CC=3)C=CC=1)C2=O MTJKHMLLZIZOFC-UHFFFAOYSA-N 0.000 claims description 2
- JXMVOTAZKZTZLL-UHFFFAOYSA-N n-[2-(4-chlorophenyl)ethyl]-3-[3-[6-[[4-[(diaminomethylideneamino)methyl]cyclohexyl]methylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]propanamide Chemical compound C1CC(CN=C(N)N)CCC1CNC1=CC=C2C3=C1C=CC=C3C(=O)N(C=1C=C(CCC(=O)NCCC=3C=CC(Cl)=CC=3)C=CC=1)C2=O JXMVOTAZKZTZLL-UHFFFAOYSA-N 0.000 claims description 2
- BLQQCHMXQDLWCV-UHFFFAOYSA-N n-[2-(4-chlorophenyl)ethyl]-3-[3-[6-[[4-[(diaminomethylideneamino)methyl]phenyl]methylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]phenyl]propanamide Chemical compound C1=CC(CN=C(N)N)=CC=C1CNC1=CC=C2C3=C1C=CC=C3C(=O)N(C=1C=C(CCC(=O)NCCC=3C=CC(Cl)=CC=3)C=CC=1)C2=O BLQQCHMXQDLWCV-UHFFFAOYSA-N 0.000 claims description 2
- 230000000269 nucleophilic effect Effects 0.000 claims description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 claims description 2
- 125000004043 oxo group Chemical group O=* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000004962 sulfoxyl group Chemical group 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims 3
- 229910006074 SO2NH2 Inorganic materials 0.000 claims 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims 2
- CBSLBDYWSHOIER-UHFFFAOYSA-N C(C1=CC=CC=C1)NC=1C=CC2C(N(C(C3=CC=CC=1C23)=O)C1=C(C=CC(=C1)Cl)Cl)=O Chemical compound C(C1=CC=CC=C1)NC=1C=CC2C(N(C(C3=CC=CC=1C23)=O)C1=C(C=CC(=C1)Cl)Cl)=O CBSLBDYWSHOIER-UHFFFAOYSA-N 0.000 claims 1
- ALDVNYGMHFYXSI-UHFFFAOYSA-N N(C(=N)N)C(CNC=1C=CC2C(N(C(C3=CC=CC=1C23)=O)C=1C=C(C=CC=1)CCC(=O)NCCC1=CC=C(C=C1)C)=O)C Chemical compound N(C(=N)N)C(CNC=1C=CC2C(N(C(C3=CC=CC=1C23)=O)C=1C=C(C=CC=1)CCC(=O)NCCC1=CC=C(C=C1)C)=O)C ALDVNYGMHFYXSI-UHFFFAOYSA-N 0.000 claims 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical group Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 claims 1
- 238000007336 electrophilic substitution reaction Methods 0.000 claims 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims 1
- 238000011282 treatment Methods 0.000 claims 1
- 238000004949 mass spectrometry Methods 0.000 description 74
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 54
- LKOZHLXUWUBRDK-UHFFFAOYSA-N 4-nitro-1,8-naphthalic anhydride Chemical compound O=C1OC(=O)C2=CC=CC3=C2C1=CC=C3[N+](=O)[O-] LKOZHLXUWUBRDK-UHFFFAOYSA-N 0.000 description 50
- 229910052739 hydrogen Inorganic materials 0.000 description 42
- 125000006239 protecting group Chemical group 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- QFNFDHNZVTWZED-UHFFFAOYSA-N tert-butyl n-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate Chemical compound CC(C)(C)OC(=O)NC(=NC(=O)OC(C)(C)C)N1C=CC=N1 QFNFDHNZVTWZED-UHFFFAOYSA-N 0.000 description 34
- UJEUBSWHCGDJQU-UHFFFAOYSA-N 4-chloro-1,8-naphthalic anhydride Chemical compound O=C1OC(=O)C2=CC=CC3=C2C1=CC=C3Cl UJEUBSWHCGDJQU-UHFFFAOYSA-N 0.000 description 24
- 150000004985 diamines Chemical class 0.000 description 24
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 10
- 125000003282 alkyl amino group Chemical group 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 239000012442 inert solvent Substances 0.000 description 9
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 9
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 125000006295 amino methylene group Chemical group [H]N(*)C([H])([H])* 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 7
- 125000006219 1-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 6
- 125000005916 2-methylpentyl group Chemical group 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- VLVCDUSVTXIWGW-UHFFFAOYSA-N 4-iodoaniline Chemical compound NC1=CC=C(I)C=C1 VLVCDUSVTXIWGW-UHFFFAOYSA-N 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000004663 dialkyl amino group Chemical group 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 125000000565 sulfonamide group Chemical group 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 230000002792 vascular Effects 0.000 description 5
- 229910052727 yttrium Inorganic materials 0.000 description 5
- JGYSBUTWKGTFRU-UHFFFAOYSA-N 2-(4-iodophenyl)-6-nitrobenzo[de]isoquinoline-1,3-dione Chemical compound O=C1C(C2=3)=CC=CC=3C([N+](=O)[O-])=CC=C2C(=O)N1C1=CC=C(I)C=C1 JGYSBUTWKGTFRU-UHFFFAOYSA-N 0.000 description 4
- FFCSRWGYGMRBGD-UHFFFAOYSA-N 3-iodoaniline Chemical compound NC1=CC=CC(I)=C1 FFCSRWGYGMRBGD-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- 102000019997 adhesion receptor Human genes 0.000 description 4
- 108010013985 adhesion receptor Proteins 0.000 description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 238000007327 hydrogenolysis reaction Methods 0.000 description 4
- 230000003993 interaction Effects 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 229910052702 rhenium Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000005917 3-methylpentyl group Chemical group 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000006310 cycloalkyl amino group Chemical group 0.000 description 3
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 3
- 238000003797 solvolysis reaction Methods 0.000 description 3
- 108010047303 von Willebrand Factor Proteins 0.000 description 3
- 102100036537 von Willebrand factor Human genes 0.000 description 3
- 229960001134 von willebrand factor Drugs 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- KZKRRZFCAYOXQE-UHFFFAOYSA-N 1$l^{2}-azinane Chemical group C1CC[N]CC1 KZKRRZFCAYOXQE-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical group COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 2
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- XAAREPCDTYICSO-UHFFFAOYSA-N 6-chloro-2-(2,5-dichlorophenyl)benzo[de]isoquinoline-1,3-dione Chemical compound Clc1ccc(Cl)c(c1)N1C(=O)c2cccc3c(Cl)ccc(C1=O)c23 XAAREPCDTYICSO-UHFFFAOYSA-N 0.000 description 2
- 101100439665 Arabidopsis thaliana SWI2 gene Proteins 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- AECZNOAGDQXKGQ-UHFFFAOYSA-N NCC=1C=C(CNC=2C=CC=3C(N(C(C4=CC=CC2C34)=O)C=3C=C(C=CC3)SCC(=O)NCC(C)C3=CC=CC=C3)=O)C=CC1 Chemical compound NCC=1C=C(CNC=2C=CC=3C(N(C(C4=CC=CC2C34)=O)C=3C=C(C=CC3)SCC(=O)NCC(C)C3=CC=CC=C3)=O)C=CC1 AECZNOAGDQXKGQ-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000006268 biphenyl-3-yl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C([H])C(*)=C([H])C([H])=C1[H] 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 150000001642 boronic acid derivatives Chemical class 0.000 description 2
- 125000004556 carbazol-9-yl group Chemical group C1=CC=CC=2C3=CC=CC=C3N(C12)* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UCQFSGCWHRTMGG-UHFFFAOYSA-N pyrazole-1-carboximidamide Chemical compound NC(=N)N1C=CC=N1 UCQFSGCWHRTMGG-UHFFFAOYSA-N 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 229940107685 reopro Drugs 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- LOZKZWIQDVEDCQ-UHFFFAOYSA-N 1-(6-amino-2,3-dihydroindol-1-yl)ethanone Chemical compound C1=C(N)C=C2N(C(=O)C)CCC2=C1 LOZKZWIQDVEDCQ-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004338 2,2,3-trimethylbutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- HXGPBZKGPPZSGX-UHFFFAOYSA-N 2,7-bis[fluoro(dipyridin-2-yl)methyl]-1,8-naphthyridine Chemical compound C=1C=CC=NC=1C(C=1N=C2N=C(C=CC2=CC=1)C(F)(C=1N=CC=CC=1)C=1N=CC=CC=1)(F)C1=CC=CC=N1 HXGPBZKGPPZSGX-UHFFFAOYSA-N 0.000 description 1
- VKPFNZUWWUFPMQ-UHFFFAOYSA-N 2-(2,5-dichlorophenyl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione Chemical compound Clc1ccc(Cl)c(c1)N1C(=O)c2cccc3c(ccc(C1=O)c23)N1CCOCC1 VKPFNZUWWUFPMQ-UHFFFAOYSA-N 0.000 description 1
- YAPPKOJBUGQGJB-UHFFFAOYSA-N 2-(3-aminophenyl)-N-(3-chloro-4-methoxyphenyl)propanamide Chemical compound NC=1C=C(C=CC1)C(C(=O)NC1=CC(=C(C=C1)OC)Cl)C YAPPKOJBUGQGJB-UHFFFAOYSA-N 0.000 description 1
- ULKFKEJEQFNAEI-UHFFFAOYSA-N 2-(3-aminophenyl)-n-[(4-chlorophenyl)methyl]acetamide Chemical compound NC1=CC=CC(CC(=O)NCC=2C=CC(Cl)=CC=2)=C1 ULKFKEJEQFNAEI-UHFFFAOYSA-N 0.000 description 1
- LBWKDTFSPUMSAT-UHFFFAOYSA-N 2-(3-aminophenyl)acetamide Chemical compound NC(=O)CC1=CC=CC(N)=C1 LBWKDTFSPUMSAT-UHFFFAOYSA-N 0.000 description 1
- GOIDICVWCGAASN-UHFFFAOYSA-N 2-(3-aminophenyl)sulfanyl-n-(2-phenylpropyl)acetamide Chemical compound C=1C=CC=CC=1C(C)CNC(=O)CSC1=CC=CC(N)=C1 GOIDICVWCGAASN-UHFFFAOYSA-N 0.000 description 1
- YYSLAKUNUYEINN-UHFFFAOYSA-N 2-(3-iodophenyl)-6-nitrobenzo[de]isoquinoline-1,3-dione Chemical compound O=C1C(C2=3)=CC=CC=3C([N+](=O)[O-])=CC=C2C(=O)N1C1=CC=CC(I)=C1 YYSLAKUNUYEINN-UHFFFAOYSA-N 0.000 description 1
- NMJMERFJUXSNIB-UHFFFAOYSA-N 2-(3-iodophenyl)benzo[de]isoquinoline-1,3-dione Chemical compound IC1=CC=CC(N2C(C=3C=CC=C4C=CC=C(C=34)C2=O)=O)=C1 NMJMERFJUXSNIB-UHFFFAOYSA-N 0.000 description 1
- PBFBGLBYZHLKHL-UHFFFAOYSA-N 2-(4-aminophenyl)acetamide Chemical compound NC(=O)CC1=CC=C(N)C=C1 PBFBGLBYZHLKHL-UHFFFAOYSA-N 0.000 description 1
- GYRKBGAALJLBNX-UHFFFAOYSA-N 2-(4-aminophenyl)sulfanylacetamide Chemical compound NC(=O)CSC1=CC=C(N)C=C1 GYRKBGAALJLBNX-UHFFFAOYSA-N 0.000 description 1
- SVQWRCLMURYZEK-UHFFFAOYSA-N 2-(5-chloropyridin-2-yl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione Chemical compound O=C1C(C2=3)=CC=C([N+]([O-])=O)C=3C([N+](=O)[O-])=CC=C2C(=O)N1C1=CC=C(Cl)C=N1 SVQWRCLMURYZEK-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000006304 2-iodophenyl group Chemical group [H]C1=C([H])C(I)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004336 3,3-dimethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 1
- GAZRNXIMWKZADY-UHFFFAOYSA-N 3,5-dimethylpyrazole-1-carboximidamide Chemical group CC=1C=C(C)N(C(N)=N)N=1 GAZRNXIMWKZADY-UHFFFAOYSA-N 0.000 description 1
- KUEJSAUGTQCRAX-UHFFFAOYSA-N 3-(3-aminophenyl)-1-(3,4-dihydro-2h-quinolin-1-yl)propan-1-one Chemical compound NC1=CC=CC(CCC(=O)N2C3=CC=CC=C3CCC2)=C1 KUEJSAUGTQCRAX-UHFFFAOYSA-N 0.000 description 1
- GMOQWPKGLOCVKP-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(1-phenylethyl)propanamide Chemical compound C=1C=CC=CC=1C(C)NC(=O)CCC1=CC=CC(N)=C1 GMOQWPKGLOCVKP-UHFFFAOYSA-N 0.000 description 1
- SMMIMWKVBWGZTR-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(2-phenylethyl)propanamide Chemical compound NC1=CC=CC(CCC(=O)NCCC=2C=CC=CC=2)=C1 SMMIMWKVBWGZTR-UHFFFAOYSA-N 0.000 description 1
- QDHPZYAPNKZUJG-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(2-phenylpropyl)propanamide Chemical compound C=1C=CC=CC=1C(C)CNC(=O)CCC1=CC=CC(N)=C1 QDHPZYAPNKZUJG-UHFFFAOYSA-N 0.000 description 1
- UNFLDCQOWRQDQZ-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(3-fluoro-4-methoxyphenyl)propanamide Chemical compound C1=C(F)C(OC)=CC=C1NC(=O)CCC1=CC=CC(N)=C1 UNFLDCQOWRQDQZ-UHFFFAOYSA-N 0.000 description 1
- PWKHNDMGHCIXCR-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(3-fluoro-4-methylphenyl)propanamide Chemical compound C1=C(F)C(C)=CC=C1NC(=O)CCC1=CC=CC(N)=C1 PWKHNDMGHCIXCR-UHFFFAOYSA-N 0.000 description 1
- CEMZPJVEEWBKAA-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(3-phenoxyphenyl)propanamide Chemical compound NC1=CC=CC(CCC(=O)NC=2C=C(OC=3C=CC=CC=3)C=CC=2)=C1 CEMZPJVEEWBKAA-UHFFFAOYSA-N 0.000 description 1
- KIICADDCTHDVRX-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(3-phenylmethoxyphenyl)propanamide Chemical compound NC1=CC=CC(CCC(=O)NC=2C=C(OCC=3C=CC=CC=3)C=CC=2)=C1 KIICADDCTHDVRX-UHFFFAOYSA-N 0.000 description 1
- ZVJAXGZCRGWLEK-UHFFFAOYSA-N 3-(3-aminophenyl)-n-(4-phenylbutyl)propanamide Chemical compound NC1=CC=CC(CCC(=O)NCCCCC=2C=CC=CC=2)=C1 ZVJAXGZCRGWLEK-UHFFFAOYSA-N 0.000 description 1
- RVQRLVBUGCFQCI-UHFFFAOYSA-N 3-(3-aminophenyl)-n-[(3-chloro-4-fluorophenyl)methyl]propanamide Chemical compound NC1=CC=CC(CCC(=O)NCC=2C=C(Cl)C(F)=CC=2)=C1 RVQRLVBUGCFQCI-UHFFFAOYSA-N 0.000 description 1
- VGTPNLJCBULJMG-UHFFFAOYSA-N 3-(3-aminophenyl)-n-benzylpropanamide Chemical compound NC1=CC=CC(CCC(=O)NCC=2C=CC=CC=2)=C1 VGTPNLJCBULJMG-UHFFFAOYSA-N 0.000 description 1
- SESMXIUQFRSIGI-UHFFFAOYSA-N 3-(3-aminophenyl)-n-naphthalen-2-ylpropanamide Chemical compound NC1=CC=CC(CCC(=O)NC=2C=C3C=CC=CC3=CC=2)=C1 SESMXIUQFRSIGI-UHFFFAOYSA-N 0.000 description 1
- QCYCUIGAICOZNN-UHFFFAOYSA-N 3-(3-aminophenyl)propanamide Chemical compound NC(=O)CCC1=CC=CC(N)=C1 QCYCUIGAICOZNN-UHFFFAOYSA-N 0.000 description 1
- SBHFVSXLYOBZKD-UHFFFAOYSA-N 3-(3-aminophenyl)propanoic acid Chemical compound NC1=CC=CC(CCC(O)=O)=C1 SBHFVSXLYOBZKD-UHFFFAOYSA-N 0.000 description 1
- OEFAIWKFALHMEY-UHFFFAOYSA-N 3-(aminomethyl)cyclohexan-1-amine Chemical compound NCC1CCCC(N)C1 OEFAIWKFALHMEY-UHFFFAOYSA-N 0.000 description 1
- PLRYMZZGYMLOME-UHFFFAOYSA-N 3-[3-[6-[3-(diaminomethylideneamino)propylamino]-1,3-dioxophenalen-2-yl]phenyl]-n-[2-(4-methylphenyl)ethyl]propanamide Chemical compound C1=CC(C)=CC=C1CCNC(=O)CCC1=CC=CC(C2C(C=3C=CC(NCCCN=C(N)N)=C4C=CC=C(C=34)C2=O)=O)=C1 PLRYMZZGYMLOME-UHFFFAOYSA-N 0.000 description 1
- GSCPDZHWVNUUFI-UHFFFAOYSA-N 3-aminobenzamide Chemical compound NC(=O)C1=CC=CC(N)=C1 GSCPDZHWVNUUFI-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000003974 3-carbamimidamidopropyl group Chemical group C(N)(=N)NCCC* 0.000 description 1
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- VFPLSXYJYAKZCT-UHFFFAOYSA-N 4-(2-phenylethenyl)aniline Chemical compound C1=CC(N)=CC=C1C=CC1=CC=CC=C1 VFPLSXYJYAKZCT-UHFFFAOYSA-N 0.000 description 1
- ZIYKAMLQVZCJRC-UHFFFAOYSA-N 4-(4-aminophenyl)butanamide Chemical compound NC(=O)CCCC1=CC=C(N)C=C1 ZIYKAMLQVZCJRC-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- JLNMBIKJQAKQBH-UHFFFAOYSA-N 4-cyclohexylaniline Chemical compound C1=CC(N)=CC=C1C1CCCCC1 JLNMBIKJQAKQBH-UHFFFAOYSA-N 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- VKJXAQYPOTYDLO-UHFFFAOYSA-N 4-methylphenethylamine Chemical compound CC1=CC=C(CCN)C=C1 VKJXAQYPOTYDLO-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JTIWXDLCUZTDFM-UHFFFAOYSA-N 4-pyrrolidin-1-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)N1CCCC1 JTIWXDLCUZTDFM-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical compound [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 1
- MAXBVGJEFDMHNV-UHFFFAOYSA-N 5-chloropyridin-2-amine Chemical compound NC1=CC=C(Cl)C=N1 MAXBVGJEFDMHNV-UHFFFAOYSA-N 0.000 description 1
- CXOLKKTWEMTKRL-UHFFFAOYSA-N 5-methoxypyrimidine-2-sulfonic acid Chemical compound COC1=CN=C(S(O)(=O)=O)N=C1 CXOLKKTWEMTKRL-UHFFFAOYSA-N 0.000 description 1
- CPNHVLGXXUPGIS-UHFFFAOYSA-N 5-piperidin-1-ylsulfonylnaphthalen-1-amine Chemical compound C1=CC=C2C(N)=CC=CC2=C1S(=O)(=O)N1CCCCC1 CPNHVLGXXUPGIS-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- JCBGSKLMUCBTJK-UHFFFAOYSA-N 5-trifluoromethyl-[1,3,4]thiadiazol-2-yl Chemical group FC(F)(F)C1=NN=[C]S1 JCBGSKLMUCBTJK-UHFFFAOYSA-N 0.000 description 1
- FQRCSJLFCQWWBV-UHFFFAOYSA-N 6,7-dinitro-benzo[de]isochromene-1,3-dione Chemical compound O=C1OC(=O)C2=CC=C([N+]([O-])=O)C3=C2C1=CC=C3[N+](=O)[O-] FQRCSJLFCQWWBV-UHFFFAOYSA-N 0.000 description 1
- KMUBFBXKQNKPTD-UHFFFAOYSA-N 6-(3-aminopropylamino)-2-(4-phenylphenyl)benzo[de]isoquinoline-1,3-dione Chemical compound NCCCNc1ccc2C(=O)N(C(=O)c3cccc1c23)c1ccc(cc1)-c1ccccc1 KMUBFBXKQNKPTD-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- DJUFCSADKLAPMS-UHFFFAOYSA-N ClC1=CC=C(CNC(CC2=CC(=CC=C2)N2C(C3=CC=CC=4C3=C(C2=O)C=CC4NCC4CCC(CC4)CNC(=N)N)=O)=O)C=C1 Chemical compound ClC1=CC=C(CNC(CC2=CC(=CC=C2)N2C(C3=CC=CC=4C3=C(C2=O)C=CC4NCC4CCC(CC4)CNC(=N)N)=O)=O)C=C1 DJUFCSADKLAPMS-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 101000783577 Dendroaspis angusticeps Thrombostatin Proteins 0.000 description 1
- 101000783578 Dendroaspis jamesoni kaimosae Dendroaspin Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 238000005642 Gabriel synthesis reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NENQYAVXAVSIBP-UHFFFAOYSA-N N(C(=N)N)CC1CCC(CC1)CNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C=2C=C(C=CC2)CCC(=O)NCCC2=CC=CC=C2)=O Chemical compound N(C(=N)N)CC1CCC(CC1)CNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C=2C=C(C=CC2)CCC(=O)NCCC2=CC=CC=C2)=O NENQYAVXAVSIBP-UHFFFAOYSA-N 0.000 description 1
- UGPCAPXTEITXJS-UHFFFAOYSA-N N(C(=N)N)CC=1C=C(CNC=2C=CC=3C(N(C(C4=CC=CC2C34)=O)C=3C=C(C=CC3)SCC(=O)NCC(C)C3=CC=CC=C3)=O)C=CC1 Chemical compound N(C(=N)N)CC=1C=C(CNC=2C=CC=3C(N(C(C4=CC=CC2C34)=O)C=3C=C(C=CC3)SCC(=O)NCC(C)C3=CC=CC=C3)=O)C=CC1 UGPCAPXTEITXJS-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- DNCIZVHCIFIRJO-UHFFFAOYSA-N NCC1CC(CCC1)CNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C2=CC(=CC=C2)CCC(=O)N2CCCC3=CC=CC=C23)=O Chemical compound NCC1CC(CCC1)CNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C2=CC(=CC=C2)CCC(=O)N2CCCC3=CC=CC=C23)=O DNCIZVHCIFIRJO-UHFFFAOYSA-N 0.000 description 1
- ZZBUZMOJOVOSKY-UHFFFAOYSA-N NCC1CCC(CC1)CNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C=2C=C(C=CC2)CCC(=O)NCCC2=CC=CC=C2)=O Chemical compound NCC1CCC(CC1)CNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C=2C=C(C=CC2)CCC(=O)NCCC2=CC=CC=C2)=O ZZBUZMOJOVOSKY-UHFFFAOYSA-N 0.000 description 1
- JHMVFGNHLDMHBG-UHFFFAOYSA-N NCC=1C=C(CNC=2C=CC=3C(N(C(C4=CC=CC2C34)=O)C=3C=C(C=CC3)CCC(=O)NCC(C)C3=CC=CC=C3)=O)C=CC1 Chemical compound NCC=1C=C(CNC=2C=CC=3C(N(C(C4=CC=CC2C34)=O)C=3C=C(C=CC3)CCC(=O)NCC(C)C3=CC=CC=C3)=O)C=CC1 JHMVFGNHLDMHBG-UHFFFAOYSA-N 0.000 description 1
- YTFMPOREGCKDBM-UHFFFAOYSA-N NCCCNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C2=CC=C(C=C2)S(=O)(=O)N2CCCC2)=O Chemical compound NCCCNC=1C=CC=2C(N(C(C3=CC=CC1C23)=O)C2=CC=C(C=C2)S(=O)(=O)N2CCCC2)=O YTFMPOREGCKDBM-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical class C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 102000015636 Oligopeptides Human genes 0.000 description 1
- 108010038807 Oligopeptides Proteins 0.000 description 1
- 108010081391 Ristocetin Proteins 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 102100028651 Tenascin-N Human genes 0.000 description 1
- 101710087911 Tenascin-N Proteins 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 206010053648 Vascular occlusion Diseases 0.000 description 1
- QLBRROYTTDFLDX-UHFFFAOYSA-N [3-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCCC(CN)C1 QLBRROYTTDFLDX-UHFFFAOYSA-N 0.000 description 1
- HZSJQDJAPNMERT-UHFFFAOYSA-N [N+](=O)([O-])C1=CC=C2C(C(C(C=3C=CC=C1C32)=O)C=3C=C(C=CC3)CCC(=O)NCCC3=CC=C(C=C3)C)=O Chemical compound [N+](=O)([O-])C1=CC=C2C(C(C(C=3C=CC=C1C32)=O)C=3C=C(C=CC3)CCC(=O)NCCC3=CC=C(C=C3)C)=O HZSJQDJAPNMERT-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 150000001503 aryl iodides Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 125000004532 benzofuran-3-yl group Chemical group O1C=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- 150000004074 biphenyls Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- LHHCSNFAOIFYRV-DOVBMPENSA-N boceprevir Chemical compound O=C([C@@H]1[C@@H]2[C@@H](C2(C)C)CN1C(=O)[C@@H](NC(=O)NC(C)(C)C)C(C)(C)C)NC(C(=O)C(N)=O)CC1CCC1 LHHCSNFAOIFYRV-DOVBMPENSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- FFGPTBGBLSHEPO-UHFFFAOYSA-N carbamazepine Chemical compound C1=CC2=CC=CC=C2N(C(=O)N)C2=CC=CC=C21 FFGPTBGBLSHEPO-UHFFFAOYSA-N 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- BGTFCAQCKWKTRL-YDEUACAXSA-N chembl1095986 Chemical compound C1[C@@H](N)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]([C@H]1C(N[C@H](C2=CC(O)=CC(O[C@@H]3[C@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)=C2C=2C(O)=CC=C(C=2)[C@@H](NC(=O)[C@@H]2NC(=O)[C@@H]3C=4C=C(C(=C(O)C=4)C)OC=4C(O)=CC=C(C=4)[C@@H](N)C(=O)N[C@@H](C(=O)N3)[C@H](O)C=3C=CC(O4)=CC=3)C(=O)N1)C(O)=O)=O)C(C=C1)=CC=C1OC1=C(O[C@@H]3[C@H]([C@H](O)[C@@H](O)[C@H](CO[C@@H]5[C@H]([C@@H](O)[C@H](O)[C@@H](C)O5)O)O3)O[C@@H]3[C@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O[C@@H]3[C@H]([C@H](O)[C@@H](CO)O3)O)C4=CC2=C1 BGTFCAQCKWKTRL-YDEUACAXSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000002319 fibrinogen receptor antagonist Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 235000013773 glyceryl triacetate Nutrition 0.000 description 1
- 239000001087 glyceryl triacetate Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- YXRWCJIUXJHFDY-UHFFFAOYSA-N n-(4-aminophenyl)-5-methoxypyrimidine-2-sulfonamide Chemical compound N1=CC(OC)=CN=C1S(=O)(=O)NC1=CC=C(N)C=C1 YXRWCJIUXJHFDY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HRRDCWDFRIJIQZ-UHFFFAOYSA-N naphthalene-1,8-dicarboxylic acid Chemical class C1=CC(C(O)=O)=C2C(C(=O)O)=CC=CC2=C1 HRRDCWDFRIJIQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- UQPUONNXJVWHRM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UQPUONNXJVWHRM-UHFFFAOYSA-N 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 description 1
- 125000004497 pyrazol-5-yl group Chemical group N1N=CC=C1* 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- 229950004257 ristocetin Drugs 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 125000004496 thiazol-5-yl group Chemical group S1C=NC=C1* 0.000 description 1
- 230000001732 thrombotic effect Effects 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229960002622 triacetin Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- 230000001228 trophic effect Effects 0.000 description 1
- 208000021331 vascular occlusion disease Diseases 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/04—Ortho- or peri-condensed ring systems
- C07D221/06—Ring systems of three rings
- C07D221/14—Aza-phenalenes, e.g. 1,8-naphthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P41/00—Drugs used in surgical methods, e.g. surgery adjuvants for preventing adhesion or for vitreum substitution
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US19941398A | 1998-11-25 | 1998-11-25 | |
US09/199,413 | 1998-11-25 | ||
US39878399A | 1999-09-20 | 1999-09-20 | |
US09/398,783 | 1999-09-20 | ||
PCT/EP1999/008561 WO2000032577A2 (en) | 1998-11-25 | 1999-11-09 | Substituted benzo[de]isoquinoline-1,3-diones |
Publications (1)
Publication Number | Publication Date |
---|---|
CA2352045A1 true CA2352045A1 (en) | 2000-06-08 |
Family
ID=26894745
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA002352045A Abandoned CA2352045A1 (en) | 1998-11-25 | 1999-11-09 | Substituted benzo[de]isoquinoline-1,3-diones |
Country Status (15)
Country | Link |
---|---|
EP (1) | EP1144381A2 (ko) |
JP (1) | JP2002537225A (ko) |
KR (1) | KR20010080569A (ko) |
CN (1) | CN1330638A (ko) |
AU (1) | AU760136B2 (ko) |
BR (1) | BR9915648A (ko) |
CA (1) | CA2352045A1 (ko) |
CZ (1) | CZ20011782A3 (ko) |
HU (1) | HUP0104520A3 (ko) |
ID (1) | ID28982A (ko) |
NO (1) | NO20012544L (ko) |
PL (1) | PL348204A1 (ko) |
SK (1) | SK7022001A3 (ko) |
TW (1) | TW473474B (ko) |
WO (1) | WO2000032577A2 (ko) |
Families Citing this family (15)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO1998007421A1 (fr) * | 1996-08-16 | 1998-02-26 | Ishihara Sangyo Kaisha, Ltd. | Composition medicinale |
EP1088821A1 (en) * | 1999-09-28 | 2001-04-04 | Applied Research Systems ARS Holding N.V. | Pharmaceutically active sulfonamide derivatives |
US7547716B2 (en) | 2001-06-08 | 2009-06-16 | Institute Of Medicinal Molecular Design, Inc. | Sulfonamide derivatives |
US6693198B2 (en) * | 2002-04-22 | 2004-02-17 | Xanthus Life Sciences, Inc. | Amonafide salts |
US8097725B2 (en) * | 2004-12-03 | 2012-01-17 | Roche Diagnostics Operations, Inc. | Luminescent indicator dye and optical sensor |
FR2915685A1 (fr) * | 2007-05-02 | 2008-11-07 | Thales Sa | Compose fluorescent a l'etat solide dans l'eau,procede de synthese et utilisation dans des capteurs |
WO2014149198A1 (en) * | 2013-03-15 | 2014-09-25 | Alumend, Llc | Compositions and methods of using the compositions for plaque softening |
CN107417616A (zh) * | 2013-05-01 | 2017-12-01 | 中央研究院 | 治疗β‑地中海贫血和镰状细胞病的方法和组合物 |
CN103450176B (zh) * | 2013-08-15 | 2016-07-06 | 大连理工大学 | 一类含2-(4-氨基苯基)苯并噻唑萘酰亚胺化合物及其应用 |
CN107087409B (zh) * | 2014-09-19 | 2020-07-31 | 吕衍达 | 苯并杂环化合物及其应用 |
CN106905237B (zh) * | 2017-02-08 | 2019-05-14 | 上海师范大学 | 一种pH和乏氧双响应定位肿瘤细胞的萘酰亚胺类比率荧光探针及其合成方法 |
CN110283123B (zh) * | 2019-07-08 | 2022-06-17 | 桂林医学院 | 4-对甲苯磺酰基哌嗪-3-硝基-1,8-萘酰亚胺衍生物及其合成方法和应用 |
CN110272388B (zh) * | 2019-07-08 | 2022-06-17 | 桂林医学院 | 4-二硫代甲酸哌嗪-3-硝基-1,8-萘酰亚胺衍生物及其合成方法和应用 |
CN110407865B (zh) * | 2019-08-02 | 2022-04-15 | 山东师范大学 | 基于苯磺酰胺结构的式(i)化合物及其制备方法与应用 |
CN111518075B (zh) * | 2020-04-17 | 2023-03-28 | 西南大学 | 萘酰亚胺哌嗪三唑类化合物及其制备方法和应用 |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2423546C2 (de) * | 1974-05-15 | 1983-01-27 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von 4-Amino-1,8- naphthalsäure-N-arylimid-Verbindungen |
ES459497A1 (es) * | 1977-06-04 | 1978-04-16 | Made Labor Sa | Un metodo para la preparacion industrial de naftalimidas y sus derivados. |
DE3635711A1 (de) * | 1986-10-21 | 1988-04-28 | Knoll Ag | 5-nitrobenzo(de)isochinolin-1,3-dione, ihre herstellung und verwendung |
KR20000052691A (ko) * | 1996-10-21 | 2000-08-25 | 스트라칸 그라함 | 뉴로트로핀 길항제 조성물 |
WO1998018764A1 (de) * | 1996-10-28 | 1998-05-07 | Merck Patent Gmbh | Dihydrobenzoanthracenone, -pyrimidinone oder dihydronaphthochinolinone |
-
1999
- 1999-11-09 AU AU26603/00A patent/AU760136B2/en not_active Ceased
- 1999-11-09 BR BR9915648-2A patent/BR9915648A/pt not_active IP Right Cessation
- 1999-11-09 KR KR1020017006547A patent/KR20010080569A/ko not_active Application Discontinuation
- 1999-11-09 CN CN99813687A patent/CN1330638A/zh active Pending
- 1999-11-09 CZ CZ20011782A patent/CZ20011782A3/cs unknown
- 1999-11-09 ID IDW00200101392A patent/ID28982A/id unknown
- 1999-11-09 WO PCT/EP1999/008561 patent/WO2000032577A2/en not_active Application Discontinuation
- 1999-11-09 JP JP2000585219A patent/JP2002537225A/ja active Pending
- 1999-11-09 CA CA002352045A patent/CA2352045A1/en not_active Abandoned
- 1999-11-09 EP EP99968783A patent/EP1144381A2/en not_active Withdrawn
- 1999-11-09 SK SK702-2001A patent/SK7022001A3/sk unknown
- 1999-11-09 PL PL99348204A patent/PL348204A1/xx unknown
- 1999-11-09 HU HU0104520A patent/HUP0104520A3/hu unknown
- 1999-11-24 TW TW088120540A patent/TW473474B/zh not_active IP Right Cessation
-
2001
- 2001-05-23 NO NO20012544A patent/NO20012544L/no not_active Application Discontinuation
Also Published As
Publication number | Publication date |
---|---|
KR20010080569A (ko) | 2001-08-22 |
NO20012544D0 (no) | 2001-05-23 |
ID28982A (id) | 2001-07-19 |
TW473474B (en) | 2002-01-21 |
PL348204A1 (en) | 2002-05-06 |
WO2000032577A2 (en) | 2000-06-08 |
HUP0104520A3 (en) | 2002-10-28 |
AU760136B2 (en) | 2003-05-08 |
HUP0104520A2 (hu) | 2002-04-29 |
AU2660300A (en) | 2000-06-19 |
JP2002537225A (ja) | 2002-11-05 |
CZ20011782A3 (cs) | 2001-09-12 |
CN1330638A (zh) | 2002-01-09 |
BR9915648A (pt) | 2001-08-14 |
SK7022001A3 (en) | 2002-09-10 |
NO20012544L (no) | 2001-05-23 |
WO2000032577A3 (en) | 2000-09-21 |
EP1144381A2 (en) | 2001-10-17 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
RU2265597C2 (ru) | Арил- и гетероарилзамещенные гетероциклические производные мочевины, способ ингибирования киназы raf и фармацевтическая композиция | |
AU2005254617B2 (en) | 3-aminoindazoles | |
ES2367126T3 (es) | Derivados de 5-([1,3,4]oxadiazol-2-il)-1h-indazol y 5-([1,3,4]tiadiazol-2-il)-1h-indazol como inhibidores para el tratamiento de diabetes. | |
US7285554B2 (en) | Pyrazole derivative | |
CA2352045A1 (en) | Substituted benzo[de]isoquinoline-1,3-diones | |
US20030232860A1 (en) | Medicine comprising dicyanopyridine derivative | |
BG64984B1 (bg) | Инхибиране на raf киназа при използване на заместени хетероциклени уреи | |
KR20040078122A (ko) | 2-아실아미노티아졸 유도체 또는 그 염 | |
CA2585535A1 (en) | Novel bradykinin b1 antagonists, method for producing the same and the use thereof as drugs | |
EP1064273A2 (en) | 1,3,4-thiadiazoles useful for the treatment of cmv infections | |
JP2000143635A (ja) | 血管新生阻害剤 | |
JP2013534229A (ja) | バニロイド受容体リガンドとしての置換された環状カルボキサミド誘導体および尿素誘導体 | |
WO2000023420A1 (fr) | Derives d'amine aromatique, procede de preparation de ces derives et agents les contenant | |
CA2351348A1 (en) | Substituted benzo[de]isoquinoline-1,3-diones | |
US20090215758A1 (en) | Use of 2,5-Disubstituted Thiazol-4-One Derivatives in Drugs | |
WO1998058646A1 (en) | Use of somatostatin agonists and antagonists for treating diseases related to the eye | |
US6159941A (en) | Use of somatostatin agonists and antagonists for treating diseases related to the eye | |
MXPA01005227A (en) | Substituted benzo[de]isoquinoline-1,3-diones | |
JP2001519826A (ja) | 金属プロテイナーゼ阻害剤 | |
MX2008016399A (es) | Inhibidores de canal de potasio kv1.5. | |
SK15522002A3 (sk) | Derivát esteru kyseliny karbaminovej ako inhibítor faktora Xa, spôsob jeho prípravy, jeho použitia a farmaceutický prostriedok, ktorý ho obsahuje | |
MXPA06004918A (en) | Thiozolidinones, production and use thereof as medicaments |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FZDE | Discontinued |