CA2280028A1 - Electrostatic dissipative composition - Google Patents
Electrostatic dissipative composition Download PDFInfo
- Publication number
- CA2280028A1 CA2280028A1 CA002280028A CA2280028A CA2280028A1 CA 2280028 A1 CA2280028 A1 CA 2280028A1 CA 002280028 A CA002280028 A CA 002280028A CA 2280028 A CA2280028 A CA 2280028A CA 2280028 A1 CA2280028 A1 CA 2280028A1
- Authority
- CA
- Canada
- Prior art keywords
- thermoplastic
- group
- polyester
- thermoplastic composition
- prepared
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 133
- 229920000728 polyester Polymers 0.000 claims abstract description 47
- 229920001169 thermoplastic Polymers 0.000 claims abstract description 35
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 35
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 25
- 125000005442 diisocyanate group Chemical group 0.000 claims abstract description 21
- 239000004615 ingredient Substances 0.000 claims abstract description 20
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims abstract description 19
- 239000004970 Chain extender Substances 0.000 claims abstract description 17
- 239000004433 Thermoplastic polyurethane Substances 0.000 claims abstract description 15
- 229920002803 thermoplastic polyurethane Polymers 0.000 claims abstract description 15
- 229920001515 polyalkylene glycol Polymers 0.000 claims abstract description 7
- 229920000642 polymer Polymers 0.000 claims description 84
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 44
- -1 hydroxyethyl groups Chemical group 0.000 claims description 39
- 239000000463 material Substances 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 22
- 229920002635 polyurethane Polymers 0.000 claims description 19
- 239000004814 polyurethane Substances 0.000 claims description 19
- 230000003068 static effect Effects 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 229920001223 polyethylene glycol Polymers 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 230000008018 melting Effects 0.000 claims description 8
- 238000002844 melting Methods 0.000 claims description 8
- 239000002202 Polyethylene glycol Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 claims description 5
- 239000004606 Fillers/Extenders Substances 0.000 claims description 4
- 150000002148 esters Chemical group 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000000075 primary alcohol group Chemical group 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 4
- 229920000620 organic polymer Polymers 0.000 abstract description 4
- 229920001684 low density polyethylene Polymers 0.000 description 35
- 239000004702 low-density polyethylene Substances 0.000 description 35
- 239000000654 additive Substances 0.000 description 34
- 229920003023 plastic Polymers 0.000 description 30
- 239000004033 plastic Substances 0.000 description 30
- 230000000996 additive effect Effects 0.000 description 27
- 239000000126 substance Substances 0.000 description 24
- 239000012141 concentrate Substances 0.000 description 20
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 18
- 238000000034 method Methods 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 16
- 238000012360 testing method Methods 0.000 description 15
- 229920001577 copolymer Polymers 0.000 description 14
- 238000012545 processing Methods 0.000 description 14
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 11
- 239000002216 antistatic agent Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 238000002156 mixing Methods 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 8
- 229920001610 polycaprolactone Polymers 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 239000004743 Polypropylene Substances 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 239000005022 packaging material Substances 0.000 description 7
- 239000008188 pellet Substances 0.000 description 7
- 239000004632 polycaprolactone Substances 0.000 description 7
- 229920001155 polypropylene Polymers 0.000 description 7
- 229960000380 propiolactone Drugs 0.000 description 7
- HLWRUJAIJJEZDL-UHFFFAOYSA-M sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate Chemical compound [Na+].OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC([O-])=O HLWRUJAIJJEZDL-UHFFFAOYSA-M 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000004952 Polyamide Substances 0.000 description 6
- 239000004698 Polyethylene Substances 0.000 description 6
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical class O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 229920002647 polyamide Polymers 0.000 description 6
- 229920000573 polyethylene Polymers 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- ULKFLOVGORAZDI-UHFFFAOYSA-N 3,3-dimethyloxetan-2-one Chemical compound CC1(C)COC1=O ULKFLOVGORAZDI-UHFFFAOYSA-N 0.000 description 5
- 239000004604 Blowing Agent Substances 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 5
- 239000003963 antioxidant agent Substances 0.000 description 5
- 235000006708 antioxidants Nutrition 0.000 description 5
- 238000005102 attenuated total reflection Methods 0.000 description 5
- 230000001413 cellular effect Effects 0.000 description 5
- 239000000945 filler Substances 0.000 description 5
- 229920001903 high density polyethylene Polymers 0.000 description 5
- 239000004700 high-density polyethylene Substances 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 229920006113 non-polar polymer Polymers 0.000 description 5
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 238000002835 absorbance Methods 0.000 description 4
- 229920005601 base polymer Polymers 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 230000012447 hatching Effects 0.000 description 4
- 229920000570 polyether Polymers 0.000 description 4
- 229920000098 polyolefin Polymers 0.000 description 4
- 229920002223 polystyrene Polymers 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- 239000004594 Masterbatch (MB) Substances 0.000 description 3
- 229920002292 Nylon 6 Polymers 0.000 description 3
- 239000004721 Polyphenylene oxide Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 3
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 3
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000013329 compounding Methods 0.000 description 3
- 239000011231 conductive filler Substances 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 229920001451 polypropylene glycol Polymers 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000002787 reinforcement Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- RTTZISZSHSCFRH-UHFFFAOYSA-N 1,3-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=CC(CN=C=O)=C1 RTTZISZSHSCFRH-UHFFFAOYSA-N 0.000 description 2
- 239000005059 1,4-Cyclohexyldiisocyanate Substances 0.000 description 2
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- NYAWADGYOWCCLK-UHFFFAOYSA-N [Na].[Zr] Chemical compound [Na].[Zr] NYAWADGYOWCCLK-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 239000002666 chemical blowing agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- LDQMVMLZQFWREI-UHFFFAOYSA-N dimethyl(octyl)azanium;methanesulfonate Chemical class CS([O-])(=O)=O.CCCCCCCC[NH+](C)C LDQMVMLZQFWREI-UHFFFAOYSA-N 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 230000001617 migratory effect Effects 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000011116 polymethylpentene Substances 0.000 description 2
- 229920000306 polymethylpentene Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000007639 printing Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000005211 surface analysis Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- 229940035437 1,3-propanediol Drugs 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical group C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- 229940043375 1,5-pentanediol Drugs 0.000 description 1
- ROHFBIREHKPELA-UHFFFAOYSA-N 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enoic acid;methane Chemical group C.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O ROHFBIREHKPELA-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- OSPOJLWAJPWJTO-UHFFFAOYSA-N 3-[hexadecyl(dimethyl)azaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)CC(O)CS([O-])(=O)=O OSPOJLWAJPWJTO-UHFFFAOYSA-N 0.000 description 1
- JRQLZCFSWYQHPI-UHFFFAOYSA-N 4,5-dichloro-2-cyclohexyl-1,2-thiazol-3-one Chemical compound O=C1C(Cl)=C(Cl)SN1C1CCCCC1 JRQLZCFSWYQHPI-UHFFFAOYSA-N 0.000 description 1
- NBOCQTNZUPTTEI-UHFFFAOYSA-N 4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide Chemical compound C1=CC(S(=O)(=O)NN)=CC=C1OC1=CC=C(S(=O)(=O)NN)C=C1 NBOCQTNZUPTTEI-UHFFFAOYSA-N 0.000 description 1
- 241000931526 Acer campestre Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000004156 Azodicarbonamide Substances 0.000 description 1
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- DQEFEBPAPFSJLV-UHFFFAOYSA-N Cellulose propionate Chemical compound CCC(=O)OCC1OC(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C1OC1C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(COC(=O)CC)O1 DQEFEBPAPFSJLV-UHFFFAOYSA-N 0.000 description 1
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 229920003354 Modic® Polymers 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920002319 Poly(methyl acrylate) Polymers 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241001233279 Scalopus Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- XOZUGNYVDXMRKW-AATRIKPKSA-N azodicarbonamide Chemical compound NC(=O)\N=N\C(N)=O XOZUGNYVDXMRKW-AATRIKPKSA-N 0.000 description 1
- 235000019399 azodicarbonamide Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 229920006218 cellulose propionate Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920006242 ethylene acrylic acid copolymer Polymers 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000003000 extruded plastic Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000003574 free electron Substances 0.000 description 1
- 239000002828 fuel tank Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 150000002311 glutaric acids Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002596 lactones Chemical group 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 238000004377 microelectronic Methods 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 1
- 239000000615 nonconductor Substances 0.000 description 1
- 235000019645 odor Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000011056 performance test Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 150000003047 pimelic acids Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000120 polyethyl acrylate Polymers 0.000 description 1
- 229940093430 polyethylene glycol 1500 Drugs 0.000 description 1
- 229940057838 polyethylene glycol 4000 Drugs 0.000 description 1
- 229940057847 polyethylene glycol 600 Drugs 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920000131 polyvinylidene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 1
- 238000004537 pulping Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007151 ring opening polymerisation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000012748 slip agent Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 150000003442 suberic acids Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920005613 synthetic organic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 238000007039 two-step reaction Methods 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B1/00—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors
- H01B1/20—Conductive material dispersed in non-conductive organic material
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B1/00—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors
- H01B1/06—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors mainly consisting of other non-metallic substances
- H01B1/12—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors mainly consisting of other non-metallic substances organic substances
- H01B1/122—Ionic conductors
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L75/00—Compositions of polyureas or polyurethanes; Compositions of derivatives of such polymers
- C08L75/04—Polyurethanes
- C08L75/08—Polyurethanes from polyethers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Dispersion Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/795,873 | 1997-02-06 | ||
| US08/795,873 US5863466A (en) | 1997-02-06 | 1997-02-06 | Electrostatic dissipative composition |
| PCT/US1998/002209 WO1998035359A1 (en) | 1997-02-06 | 1998-02-02 | Electrostatic dissipative composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2280028A1 true CA2280028A1 (en) | 1998-08-13 |
Family
ID=25166670
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002280028A Abandoned CA2280028A1 (en) | 1997-02-06 | 1998-02-02 | Electrostatic dissipative composition |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US5863466A (https=) |
| EP (1) | EP0963589A4 (https=) |
| JP (1) | JP2001512503A (https=) |
| KR (1) | KR20000070850A (https=) |
| AU (1) | AU6650498A (https=) |
| CA (1) | CA2280028A1 (https=) |
| NO (1) | NO312038B1 (https=) |
| WO (1) | WO1998035359A1 (https=) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6534422B1 (en) * | 1999-06-10 | 2003-03-18 | National Semiconductor Corporation | Integrated ESD protection method and system |
| US6207361B1 (en) * | 1999-12-27 | 2001-03-27 | Eastman Kodak Company | Photographic film with base containing polymeric antistatic material |
| US6197486B1 (en) * | 1999-12-27 | 2001-03-06 | Eastman Kodak Company | Reflective print material with extruded antistatic layer |
| US6248262B1 (en) | 2000-02-03 | 2001-06-19 | General Electric Company | Carbon-reinforced thermoplastic resin composition and articles made from same |
| US6231788B1 (en) | 2000-02-03 | 2001-05-15 | General Electric Company | Carbon-reinforced PC-ABS composition and articles made from same |
| US6689835B2 (en) * | 2001-04-27 | 2004-02-10 | General Electric Company | Conductive plastic compositions and method of manufacture thereof |
| US6872501B2 (en) * | 2001-05-11 | 2005-03-29 | Eastman Kodak Company | Antistat of onium salt and polyether polymer |
| US6740410B2 (en) * | 2001-05-16 | 2004-05-25 | Noveon Ip Holdings Corp. | Electrostatic dissipating polymeric multi-layer article or laminate |
| US6528572B1 (en) | 2001-09-14 | 2003-03-04 | General Electric Company | Conductive polymer compositions and methods of manufacture thereof |
| US7238744B2 (en) * | 2002-04-12 | 2007-07-03 | Daramic, Inc. | Ultrahigh molecular weight polyethylene articles and method of manufacture |
| US7018567B2 (en) * | 2002-07-22 | 2006-03-28 | General Electric Company | Antistatic flame retardant resin composition and methods for manufacture thereof |
| US20070179255A1 (en) * | 2002-11-08 | 2007-08-02 | Noveon, Inc. | Heat Resistant High Moisture Vapor Transmission Thermoplastic Polyurethane |
| US7202322B2 (en) * | 2002-11-08 | 2007-04-10 | Noveon, Inc. | Heat resistant high moisture vapor transmission thermoplastic polyurethane |
| US6893592B2 (en) | 2003-02-26 | 2005-05-17 | Eastman Kodak Company | Process of making an image recording element with an extruded polyester-containing image-receiving layer |
| US20040211942A1 (en) * | 2003-04-28 | 2004-10-28 | Clark Darren Cameron | Electrically conductive compositions and method of manufacture thereof |
| US20040232389A1 (en) * | 2003-05-22 | 2004-11-25 | Elkovitch Mark D. | Electrically conductive compositions and method of manufacture thereof |
| US20040262581A1 (en) * | 2003-06-27 | 2004-12-30 | Rodrigues David E. | Electrically conductive compositions and method of manufacture thereof |
| WO2005015574A1 (en) * | 2003-08-08 | 2005-02-17 | General Electric Company | Electrically conductive compositions comprising carbon nanotubes and method of manufacture thereof |
| US7354988B2 (en) * | 2003-08-12 | 2008-04-08 | General Electric Company | Electrically conductive compositions and method of manufacture thereof |
| US7026432B2 (en) * | 2003-08-12 | 2006-04-11 | General Electric Company | Electrically conductive compositions and method of manufacture thereof |
| US7309727B2 (en) * | 2003-09-29 | 2007-12-18 | General Electric Company | Conductive thermoplastic compositions, methods of manufacture and articles derived from such compositions |
| US20050070658A1 (en) * | 2003-09-30 | 2005-03-31 | Soumyadeb Ghosh | Electrically conductive compositions, methods of manufacture thereof and articles derived from such compositions |
| US7325744B2 (en) * | 2004-01-09 | 2008-02-05 | Arthur James Porter | Memory card holder device |
| JP2006022282A (ja) * | 2004-07-09 | 2006-01-26 | Regulus Co Ltd | 導電性樹脂組成物および導電性樹脂成形物 |
| JP5153053B2 (ja) * | 2004-07-22 | 2013-02-27 | Sabicイノベーティブプラスチックスジャパン合同会社 | 難燃性帯電防止ポリエステル系樹脂組成物 |
| US7462656B2 (en) * | 2005-02-15 | 2008-12-09 | Sabic Innovative Plastics Ip B.V. | Electrically conductive compositions and method of manufacture thereof |
| DE102005028056A1 (de) * | 2005-06-16 | 2006-12-21 | Basf Ag | Thermoplastisches Polyurethan enthaltend Isocyanat |
| US20080163542A1 (en) * | 2007-01-08 | 2008-07-10 | Innospec, Inc. | Synergistic fuel composition for enhancing fuel cold flow properties |
| DE102007027842A1 (de) * | 2007-06-13 | 2008-12-18 | Tesa Ag | Compound und Wickelband aus TPU |
| US8876921B2 (en) | 2007-07-20 | 2014-11-04 | Innospec Limited | Hydrocarbon compositions |
| JP5277659B2 (ja) * | 2008-02-20 | 2013-08-28 | 東洋インキScホールディングス株式会社 | 熱可塑性樹脂組成物及びその成形品 |
| US20100005706A1 (en) | 2008-07-11 | 2010-01-14 | Innospec Fuel Specialties, LLC | Fuel composition with enhanced low temperature properties |
| US8163848B2 (en) * | 2009-05-01 | 2012-04-24 | E. I. Du Pont De Nemours And Company | Antistatic poly(hydroxyalkanoic acid) compositions |
| US8861167B2 (en) | 2011-05-12 | 2014-10-14 | Global Plasma Solutions, Llc | Bipolar ionization device |
| GB201111799D0 (en) | 2011-07-08 | 2011-08-24 | Innospec Ltd | Improvements in fuels |
| US9260602B2 (en) | 2012-10-11 | 2016-02-16 | Sabic Global Technologies B.V. | Antistatic flame retardant resin compositions and methods and uses thereof |
| CN109689783A (zh) | 2016-08-15 | 2019-04-26 | 沙特基础工业全球技术公司 | 用于连接的个人防护设备的多功能阻燃热塑性组合物 |
| MY200198A (en) | 2017-07-06 | 2023-12-13 | Innospec Oil Field Chemicals Llc | Compositions and methods and uses relating thereto |
| WO2021231948A1 (en) * | 2020-05-15 | 2021-11-18 | Hememics Biotechnologies, Inc. | Multiplex biosensor for rapid point-of-care diagnostics |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2129264A (en) * | 1935-03-29 | 1938-09-06 | Du Pont | Nitrogen-containing organic compounds |
| US2697116A (en) * | 1951-09-25 | 1954-12-14 | California Research Corp | Quaternary taurine type compounds as surface-active agents |
| US2871218A (en) * | 1955-12-01 | 1959-01-27 | Goodrich Co B F | Simulated vulcanizates of polyurethane elastomers |
| US3012992A (en) * | 1959-03-25 | 1961-12-12 | Mobay Chemical Corp | Polyurethane castings |
| DE1159957B (de) * | 1960-11-08 | 1963-12-27 | Bayer Ag | Verfahren zur Herstellung von quaternaeren Ammoniumverbindungen |
| US3280179A (en) * | 1961-03-16 | 1966-10-18 | Textilana Corp | Processes for producing acyclic surfactant sulfobetaines |
| US3214411A (en) * | 1961-05-10 | 1965-10-26 | Mobay Chemical Corp | Polyester urethanes made with diphenylmethane diisocyanate which are processable by thermoplastic techniques |
| US3644482A (en) * | 1961-10-30 | 1972-02-22 | Geigy Ag J R | (4-hydroxy-5-alkylphenyl) alkanoic acid esters of polyols |
| DE1520759A1 (de) * | 1962-03-30 | 1969-11-27 | Shell Int Research | Verfahren zur Herstellung von hochmolekularen Polyestern aus Lactonen |
| US3299171A (en) * | 1964-04-20 | 1967-01-17 | Du Pont | Fibers of modified polypivalolactone |
| SE339731B (https=) * | 1964-10-06 | 1971-10-18 | Procter & Gamble | |
| US3285855A (en) * | 1965-03-11 | 1966-11-15 | Geigy Chem Corp | Stabilization of organic material with esters containing an alkylhydroxy-phenyl group |
| US3539521A (en) * | 1965-05-03 | 1970-11-10 | Procter & Gamble | Detergent composition |
| US3619115A (en) * | 1967-09-08 | 1971-11-09 | Procter & Gamble | Cool water laundering process |
| GB1182376A (en) * | 1968-07-01 | 1970-02-25 | Shell Int Research | Process for the Polymerization or Copolymerization of Beta-Propiolactones |
| US4088612A (en) * | 1968-08-15 | 1978-05-09 | Lever Brothers Company | Detergent compositions |
| GB1419096A (en) * | 1972-06-20 | 1975-12-24 | Procter & Gamble Ltd | Zwitterionic surface-active agents |
| US3867324A (en) * | 1972-07-28 | 1975-02-18 | Union Carbide Corp | Environmentally degradable-biodegradable blend of an oxyalkanoyl polymer and an environmentally degradable ethylene polymer |
| US4005029A (en) * | 1973-08-01 | 1977-01-25 | The Procter & Gamble Company | Laundering adjunct |
| US4191818A (en) * | 1975-10-25 | 1980-03-04 | Basf Wyandotte Corporation | Process for preparing heat-resistant polyurethane elastomers having no secondary softening range |
| JPS57111311A (en) * | 1980-12-29 | 1982-07-10 | Nippon Polyurethan Kogyo Kk | Thermoplastic polyurethane resin |
| US4439552A (en) * | 1981-05-08 | 1984-03-27 | Gravi-Mechanics Co. | Method of preparing a urethane prepolymer and polymer |
| JPS6043666A (ja) * | 1983-08-19 | 1985-03-08 | Kimoto & Co Ltd | オ−バ−ヘツドプロジエクタ−用フイルム |
| US5015412A (en) * | 1985-05-09 | 1991-05-14 | Sherex Chemical Company, Inc. | Alkaline tolerant sulfobetaine amphoteric surfactants |
| US4797447A (en) * | 1985-08-16 | 1989-01-10 | Shell Oil Company | Impact resistant blends of thermoplastic polyesters and modified block copolymers |
| DE3613790A1 (de) * | 1986-04-24 | 1987-10-29 | Bayer Ag | Verfahren zur herstellung von thermoplastischen polyurethanen fuer die strahlenvernetzung und ihre verwendung |
| DD296974A5 (de) * | 1987-04-20 | 1991-12-19 | Chemiefaserwerk | Verschleissminderndes antistatikum |
| CA1326720C (en) * | 1987-12-31 | 1994-02-01 | Michael John Modic | Impact resistant blends of polar thermoplastic polymers and modified block copolymers |
| US5187214A (en) * | 1988-11-08 | 1993-02-16 | Ppg Industries, Inc. | Quaternary ammonium antistatic polymer compositions |
| US4900776A (en) * | 1988-12-01 | 1990-02-13 | Georgia-Pacific Resins, Inc. | Potassium catalyst system for preparing polyurethane based plywood-patch compositions |
| US5096939A (en) * | 1989-06-07 | 1992-03-17 | Techmer Pm | Degradable polymeric compositions |
| US5159053A (en) * | 1989-08-28 | 1992-10-27 | The B. F. Goodrich Company | Polyurethane for use in electrostatic dissipating applications |
| BR9105924A (pt) * | 1990-01-05 | 1992-11-10 | Goodrich Co B F | Composicao polimerica dissipadora de eletrostatica,artigo polimerico e processo para preparar a dita composicao |
| US5259989A (en) * | 1993-03-25 | 1993-11-09 | Xerox Corporation | Electrically conductive elastomer |
| US5478486A (en) * | 1993-11-18 | 1995-12-26 | Henkel Corporation | Composition and method for treating substrates to reduce electrostatic charge and resultant article |
-
1997
- 1997-02-06 US US08/795,873 patent/US5863466A/en not_active Expired - Fee Related
-
1998
- 1998-02-02 EP EP98908471A patent/EP0963589A4/en not_active Withdrawn
- 1998-02-02 CA CA002280028A patent/CA2280028A1/en not_active Abandoned
- 1998-02-02 AU AU66504/98A patent/AU6650498A/en not_active Abandoned
- 1998-02-02 JP JP53488398A patent/JP2001512503A/ja active Pending
- 1998-02-02 WO PCT/US1998/002209 patent/WO1998035359A1/en not_active Ceased
- 1998-02-02 KR KR1019997007115A patent/KR20000070850A/ko not_active Ceased
-
1999
- 1999-08-05 NO NO19993785A patent/NO312038B1/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| WO1998035359A1 (en) | 1998-08-13 |
| AU6650498A (en) | 1998-08-26 |
| US5863466A (en) | 1999-01-26 |
| EP0963589A1 (en) | 1999-12-15 |
| KR20000070850A (ko) | 2000-11-25 |
| NO312038B1 (no) | 2002-03-04 |
| JP2001512503A (ja) | 2001-08-21 |
| EP0963589A4 (en) | 2001-11-14 |
| NO993785L (no) | 1999-10-05 |
| NO993785D0 (no) | 1999-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5863466A (en) | Electrostatic dissipative composition | |
| WO1998035359A9 (en) | Electrostatic dissipative composition | |
| US5159053A (en) | Polyurethane for use in electrostatic dissipating applications | |
| AU607160B2 (en) | An agent for imparting antistatic characteristics to a thermoplastic polymer and thermoplastic polymer composition containing the agent | |
| CA2304674A1 (en) | Compositions of interpolymers of alpha-olefin monomers with one or more vinyl or vinylidene aromatic monomers | |
| CA1316281C (en) | Antistatic thermoplastic polyamide-polyether compositions and antistatic polymeric films made therefrom | |
| US6139948A (en) | Coated aliphatic polyester film | |
| AU605513B2 (en) | An agent for imparting antistatic characteristics to a thermoplastic polymer and a thermoplastic polymer composition containing the agent. | |
| US5001015A (en) | Antistatic polyolefin compositions and antistatic polyolefin films made therefrom, including oriented films | |
| US5025922A (en) | Agent for imparting antistatic characteristics to a thermoplastic polymer and a thermoplastic polymer composition containing the agent | |
| JP2573986B2 (ja) | 永久帯電防止樹脂組成物 | |
| US5024792A (en) | Antistatic thermoplastic/polyamide-polyether compositions and antistatic polymeric films made therefrom | |
| US5171641A (en) | Permanent antistatic acid copolymer/quaternary amine polymeric films | |
| US4898771A (en) | Agent for imparting antistatic characteristics to a thermoplastic polymer and a thermoplastic polymer composition containing the agent | |
| MXPA99007302A (es) | Composicion disipadora electrostatica | |
| CA2008537A1 (en) | Permanently antistatic polymeric rigid containers | |
| EP0333146A2 (en) | Antistatically conductive masking film for electrostatic spray painting | |
| AU614571B2 (en) | Permanent antistatic acid copolymer/quaternary amine mixtures and permanent antistatic polymeric films made therefrom | |
| US4999252A (en) | Permanent antistatic acid copolymer/quaternary amine mixtures films | |
| JP2588576B2 (ja) | 帯電防止樹脂組成物 | |
| JPH06508859A (ja) | 帯電防止熱可塑性組成物 | |
| JPS62197434A (ja) | ポリオレフイン用帯電防止剤 | |
| JPS62143956A (ja) | スチレン系樹脂用帯電防止剤 | |
| JPS631987B2 (https=) | ||
| MXPA01005930A (es) | Copoliesteres con propiedades antiestaticas y alta claridad |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |