CA2250740C - 2-substituted 7-haloindenes and methods for synthesizing - Google Patents
2-substituted 7-haloindenes and methods for synthesizing Download PDFInfo
- Publication number
- CA2250740C CA2250740C CA002250740A CA2250740A CA2250740C CA 2250740 C CA2250740 C CA 2250740C CA 002250740 A CA002250740 A CA 002250740A CA 2250740 A CA2250740 A CA 2250740A CA 2250740 C CA2250740 C CA 2250740C
- Authority
- CA
- Canada
- Prior art keywords
- compound
- formula
- reacting
- produce
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000000034 method Methods 0.000 title claims abstract description 47
- 230000002194 synthesizing effect Effects 0.000 title claims abstract description 8
- 125000003118 aryl group Chemical group 0.000 claims abstract description 11
- 150000001875 compounds Chemical class 0.000 claims description 150
- 239000011541 reaction mixture Substances 0.000 claims description 35
- -1 9-fluorenyl group Chemical group 0.000 claims description 34
- 238000006243 chemical reaction Methods 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- 229910052783 alkali metal Inorganic materials 0.000 claims description 21
- 150000002367 halogens Chemical group 0.000 claims description 21
- 229910052736 halogen Inorganic materials 0.000 claims description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- 150000001340 alkali metals Chemical class 0.000 claims description 16
- 239000000460 chlorine Substances 0.000 claims description 14
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims description 11
- 150000008046 alkali metal hydrides Chemical class 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- KCWZBTAORNNKFH-UHFFFAOYSA-N 7-chloro-2-methyl-1h-indene Chemical compound C1=CC(Cl)=C2CC(C)=CC2=C1 KCWZBTAORNNKFH-UHFFFAOYSA-N 0.000 claims description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 8
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- VQSMDEGMFQYKRS-UHFFFAOYSA-N 1-(2-methyl-3h-inden-4-yl)naphthalene Chemical compound C1=CC=C2C(C=3C=CC=C4C=C(CC4=3)C)=CC=CC2=C1 VQSMDEGMFQYKRS-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 6
- 239000012279 sodium borohydride Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 229910001623 magnesium bromide Inorganic materials 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 5
- BASMANVIUSSIIM-UHFFFAOYSA-N 1-chloro-2-(chloromethyl)benzene Chemical compound ClCC1=CC=CC=C1Cl BASMANVIUSSIIM-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 229910052740 iodine Chemical group 0.000 claims description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 239000011737 fluorine Chemical group 0.000 claims description 3
- 229910052731 fluorine Chemical group 0.000 claims description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000011630 iodine Chemical group 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 claims description 3
- 229910007932 ZrCl4 Inorganic materials 0.000 claims description 2
- PBGGNZZGJIKBMJ-UHFFFAOYSA-N di(propan-2-yl)azanide Chemical compound CC(C)[N-]C(C)C PBGGNZZGJIKBMJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims 4
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims 2
- 229910006124 SOCl2 Inorganic materials 0.000 claims 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims 2
- 229910000104 sodium hydride Inorganic materials 0.000 claims 2
- 239000012312 sodium hydride Substances 0.000 claims 2
- 239000012968 metallocene catalyst Substances 0.000 abstract description 5
- 125000003454 indenyl group Chemical class C1(C=CC2=CC=CC=C12)* 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000000543 intermediate Substances 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000004821 distillation Methods 0.000 description 9
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 8
- 150000005690 diesters Chemical class 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- QBWFKUHFFIDVTA-UHFFFAOYSA-N 7-chloro-2-ethyl-1h-indene Chemical compound C1=CC(Cl)=C2CC(CC)=CC2=C1 QBWFKUHFFIDVTA-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 239000002480 mineral oil Substances 0.000 description 5
- 235000010446 mineral oil Nutrition 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 239000002685 polymerization catalyst Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000007832 Na2SO4 Substances 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 3
- 238000000526 short-path distillation Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000013022 venting Methods 0.000 description 3
- JQCCMEDYANGBOG-UHFFFAOYSA-N 2-methyl-7-phenyl-1h-indene Chemical compound C=12CC(C)=CC2=CC=CC=1C1=CC=CC=C1 JQCCMEDYANGBOG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- CAYKGPJSXROKPC-UHFFFAOYSA-N 1-(2-methyl-1h-inden-4-yl)naphthalene Chemical compound C1=CC=C2C(C3=CC=CC4=C3C=C(C4)C)=CC=CC2=C1 CAYKGPJSXROKPC-UHFFFAOYSA-N 0.000 description 1
- SEXZHJJUKFXNDY-UHFFFAOYSA-N 1-(bromomethyl)-2-phenylbenzene Chemical group BrCC1=CC=CC=C1C1=CC=CC=C1 SEXZHJJUKFXNDY-UHFFFAOYSA-N 0.000 description 1
- NETUDYPBFNJKOB-UHFFFAOYSA-N 2-[(2-chlorophenyl)methyl]butanoic acid Chemical compound CCC(C(O)=O)CC1=CC=CC=C1Cl NETUDYPBFNJKOB-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WJTHSRTZOOWAEG-UHFFFAOYSA-N 2-ethyl-7-phenyl-1h-indene Chemical compound C=12CC(CC)=CC2=CC=CC=1C1=CC=CC=C1 WJTHSRTZOOWAEG-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- WCDLCPLAAKUJNY-UHFFFAOYSA-N 4-[4-[3-(1h-pyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-6-yl]phenyl]morpholine Chemical compound C1COCCN1C1=CC=C(C2=CN3N=CC(=C3N=C2)C2=CNN=C2)C=C1 WCDLCPLAAKUJNY-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 102220347004 c.89G>A Human genes 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- IDASTKMEQGPVRR-UHFFFAOYSA-N cyclopenta-1,3-diene;zirconium(2+) Chemical compound [Zr+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 IDASTKMEQGPVRR-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 229940058172 ethylbenzene Drugs 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002469 indenes Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CPOFMOWDMVWCLF-UHFFFAOYSA-N methyl(oxo)alumane Chemical compound C[Al]=O CPOFMOWDMVWCLF-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- MFBOGIVSZKQAPD-UHFFFAOYSA-M sodium butyrate Chemical compound [Na+].CCCC([O-])=O MFBOGIVSZKQAPD-UHFFFAOYSA-M 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F17/00—Metallocenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C1/00—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon
- C07C1/32—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon starting from compounds containing hetero-atoms other than or in addition to oxygen or halogen
- C07C1/325—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon starting from compounds containing hetero-atoms other than or in addition to oxygen or halogen the hetero-atom being a metal atom
- C07C1/326—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon starting from compounds containing hetero-atoms other than or in addition to oxygen or halogen the hetero-atom being a metal atom the hetero-atom being a magnesium atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/35—Preparation of halogenated hydrocarbons by reactions not affecting the number of carbon or of halogen atoms in the reaction
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C25/00—Compounds containing at least one halogen atom bound to a six-membered aromatic ring
- C07C25/18—Polycyclic aromatic halogenated hydrocarbons
- C07C25/22—Polycyclic aromatic halogenated hydrocarbons with condensed rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/08—One of the condensed rings being a six-membered aromatic ring the other ring being five-membered, e.g. indane
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/795,019 US5789634A (en) | 1997-02-05 | 1997-02-05 | Coupling reactions of 2-substituted, 7-haloindenes with aryl substituents to produce metallocene catalyst intermediates |
| US08/795,019 | 1997-02-05 | ||
| PCT/US1998/002345 WO1998033752A1 (en) | 1997-02-05 | 1998-02-05 | 2-substituted 7-haloindenes and methods for synthesizing |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2250740A1 CA2250740A1 (en) | 1998-08-06 |
| CA2250740C true CA2250740C (en) | 2008-08-05 |
Family
ID=25164410
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002250740A Expired - Fee Related CA2250740C (en) | 1997-02-05 | 1998-02-05 | 2-substituted 7-haloindenes and methods for synthesizing |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5789634A (enExample) |
| EP (1) | EP0920406B1 (enExample) |
| JP (1) | JP4372230B2 (enExample) |
| AU (1) | AU6148898A (enExample) |
| CA (1) | CA2250740C (enExample) |
| DE (1) | DE69825960T2 (enExample) |
| WO (1) | WO1998033752A1 (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6075171A (en) * | 1997-02-05 | 2000-06-13 | Boulder Scientific Company | 2-substituted 7-haloindenes and methods for synthesizing |
| US6465700B1 (en) * | 1997-02-05 | 2002-10-15 | Boulder Scientific Company | Coupling reactions of 2-substituted, 7-haloindenes with aryl substituents to produce metallocene catalyst ligands |
| US6586625B1 (en) * | 2000-05-08 | 2003-07-01 | Boulder Scientific Company | Synthesis of 2-halobenzyl alkanoic acid |
| US6380120B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6380123B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6376408B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6380124B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US7122498B2 (en) * | 2000-06-30 | 2006-10-17 | Exxonmobil Chemical Patents Inc. | Metallocenes and catalyst compositions derived therefrom |
| US6376409B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6380121B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6376627B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6380330B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6380122B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6870016B1 (en) | 2000-06-30 | 2005-03-22 | Exxonmobil Chemical Patents Inc. | Polymerization process and polymer composition |
| US6380334B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6376411B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6399723B1 (en) | 2000-06-30 | 2002-06-04 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6376410B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6380331B1 (en) | 2000-06-30 | 2002-04-30 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6376413B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6376407B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| US6414095B1 (en) | 2000-06-30 | 2002-07-02 | Exxon Mobil Chemical Patents Inc. | Metallocene compositions |
| US6376412B1 (en) | 2000-06-30 | 2002-04-23 | Exxonmobil Chemical Patents Inc. | Metallocene compositions |
| WO2003002583A2 (en) | 2001-06-29 | 2003-01-09 | Exxonmobil Chemical Patents Inc. | Metallocenes and catalyst compositions derived therefrom |
| DE10152989A1 (de) * | 2001-10-26 | 2003-05-08 | Bayer Ag | Komplexe N-heterocyslischer Carbene und ihre Verwendung |
| DE10214938A1 (de) * | 2002-04-04 | 2003-10-16 | Merck Patent Gmbh | Fluorierte Indene und 1,7-Dihydroindacene mit negativem delta epsilon |
| WO2003084904A1 (en) * | 2002-04-10 | 2003-10-16 | Basell Polyolefine Gmbh | Preparation of substituted indenes |
| US7205427B2 (en) * | 2002-06-04 | 2007-04-17 | Boulder Scientific Company | Cross-coupling synthesis of alkyl (dialkylphenyl) indenes |
| AU2003280396A1 (en) * | 2002-10-22 | 2004-05-13 | Basell Polyolefine Gmbh | Preparation of substituted indenes |
| DE10249325A1 (de) * | 2002-10-22 | 2004-05-06 | Basell Polyolefine Gmbh | Verfahren zur Herstellung von substituierten Indenen |
| US7105467B2 (en) * | 2003-07-08 | 2006-09-12 | Pharmacore, Inc. | Nickel catalyzed cross-coupling reactions between organomagnesium compounds and anisole derivatives |
| DE10358082A1 (de) * | 2003-12-10 | 2005-07-14 | Basell Polyolefine Gmbh | Organübergangsmetallverbindung, Bscyclopentadienyligandsystem, Katalysatorsystem und Hertellung von Polyolefinen |
| US7910783B2 (en) | 2005-12-14 | 2011-03-22 | Exxonmobil Chemical Patents Inc. | Preparation of substituted bridged indenyl and related ligands |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2953609A (en) * | 1958-04-29 | 1960-09-20 | American Oil Co | Preparation of substituted tetrahydro-indenoindene |
| US5059572A (en) * | 1989-10-31 | 1991-10-22 | Shell Oil Company | Catalyst and process for coupling organometallic reagents with aryl or vinylic halides |
| TW294669B (enExample) * | 1992-06-27 | 1997-01-01 | Hoechst Ag | |
| DE4303634B4 (de) * | 1993-02-09 | 2006-06-14 | Merck Patent Gmbh | Indan-Derivate |
-
1997
- 1997-02-05 US US08/795,019 patent/US5789634A/en not_active Expired - Lifetime
-
1998
- 1998-02-05 AU AU61488/98A patent/AU6148898A/en not_active Abandoned
- 1998-02-05 JP JP53325598A patent/JP4372230B2/ja not_active Expired - Fee Related
- 1998-02-05 WO PCT/US1998/002345 patent/WO1998033752A1/en not_active Ceased
- 1998-02-05 CA CA002250740A patent/CA2250740C/en not_active Expired - Fee Related
- 1998-02-05 EP EP98906206A patent/EP0920406B1/en not_active Expired - Lifetime
- 1998-02-05 DE DE69825960T patent/DE69825960T2/de not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0920406A4 (enExample) | 1999-06-09 |
| JP2000508680A (ja) | 2000-07-11 |
| AU6148898A (en) | 1998-08-25 |
| CA2250740A1 (en) | 1998-08-06 |
| WO1998033752A1 (en) | 1998-08-06 |
| EP0920406B1 (en) | 2004-09-01 |
| DE69825960T2 (de) | 2005-09-08 |
| JP4372230B2 (ja) | 2009-11-25 |
| DE69825960D1 (de) | 2004-10-07 |
| EP0920406A1 (en) | 1999-06-09 |
| US5789634A (en) | 1998-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2250740C (en) | 2-substituted 7-haloindenes and methods for synthesizing | |
| KR100283824B1 (ko) | 아릴-치환된 인데닐 유도체를 리간드로서 함유하는 메탈로센, 이를 사용한 올레핀 중합체의 제조방법 및 촉매로서의 이의 용도 | |
| KR100254304B1 (ko) | 올레핀중합체의제조방법 | |
| JP3434288B2 (ja) | 置換されたインデン類の製造方法 | |
| KR100624632B1 (ko) | 메탈로센 및 그의 제조 방법 | |
| AU764843B2 (en) | Coupling reactions of 2-substituted, 7-haloindenes with aryl substituents to produce metallocene catalyst ligands | |
| JPH05148166A (ja) | 新規なフルオレニル化合物及びその製造法 | |
| JPH0859722A (ja) | 非晶質のプロピレンのポリマーの製造方法 | |
| US6043403A (en) | Process for the preparation of cyclopentadienyl compounds and compounds obtained therefrom | |
| JP3815814B2 (ja) | 橋状メタロセン化合物の製造法 | |
| US6075171A (en) | 2-substituted 7-haloindenes and methods for synthesizing | |
| EP0920403B1 (en) | Process for preparing cyclopentadienyl compounds | |
| US6100416A (en) | Asymmetric ethylene-bridged metallocenes useful as catalysts in the polymerization of olefins and process for preparing said metallocenes | |
| JP2006503911A (ja) | rac−ジオルガノシリルビス(2−メチルベンゾ[e]インデニル)ジルコニウム化合物のラセモ選択的合成法 | |
| JP2005529865A (ja) | インデン置換体の製造方法 | |
| JPH1025258A (ja) | シクロペンタジエン系化合物のアルキル化方法 | |
| JP2007525489A (ja) | メタロセン化合物 | |
| WO2001062690A1 (en) | Process for preparing bisindenylalkanes | |
| TW201125872A (en) | New metallocene compounds, catalysts comprising them, process for producing an olefin polymer by use of the catalysts, and olefin homo- and copolymers | |
| MXPA98010099A (en) | Metallocenes and catalysts for polymerization of olefins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |
Effective date: 20170206 |